PL53679B1 - - Google Patents
Download PDFInfo
- Publication number
- PL53679B1 PL53679B1 PL108527A PL10852765A PL53679B1 PL 53679 B1 PL53679 B1 PL 53679B1 PL 108527 A PL108527 A PL 108527A PL 10852765 A PL10852765 A PL 10852765A PL 53679 B1 PL53679 B1 PL 53679B1
- Authority
- PL
- Poland
- Prior art keywords
- product
- mixture
- acid
- esterification
- glutaric
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N n-butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 10
- 239000000047 product Substances 0.000 claims description 8
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 238000005886 esterification reaction Methods 0.000 claims description 5
- WNLRTRBMVRJNCN-UHFFFAOYSA-N Adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N Cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 3
- JFCQEDHGNNZCLN-UHFFFAOYSA-N Glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 239000000077 insect repellent Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000006227 byproduct Substances 0.000 claims description 2
- 150000002311 glutaric acids Chemical class 0.000 claims 1
- 235000011044 succinic acid Nutrition 0.000 claims 1
- 150000003444 succinic acids Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 description 3
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- YUXIBTJKHLUKBD-UHFFFAOYSA-N Dibutyl succinate Chemical compound CCCCOC(=O)CCC(=O)OCCCC YUXIBTJKHLUKBD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000001384 succinic acid Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- BQNDPALRJDCXOY-UHFFFAOYSA-N 2,3-dibutylbutanedioic acid Chemical compound CCCCC(C(O)=O)C(C(O)=O)CCCC BQNDPALRJDCXOY-UHFFFAOYSA-N 0.000 description 1
- BLXVTZPGEOGTGG-UHFFFAOYSA-N 2-[2-(4-nonylphenoxy)ethoxy]ethanol Chemical compound CCCCCCCCCC1=CC=C(OCCOCCO)C=C1 BLXVTZPGEOGTGG-UHFFFAOYSA-N 0.000 description 1
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- SWYVHBPXKKDGLL-UHFFFAOYSA-N N,N,3-trimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC(C)=C1 SWYVHBPXKKDGLL-UHFFFAOYSA-N 0.000 description 1
- 210000003491 Skin Anatomy 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- KTUQUZJOVNIKNZ-UHFFFAOYSA-N butan-1-ol;hydrate Chemical compound O.CCCCO KTUQUZJOVNIKNZ-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 230000001264 neutralization Effects 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000001846 repelling Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000001187 sodium carbonate Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL53679B1 true PL53679B1 (da) | 1967-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2326077C2 (de) | Ungesättigte Cyclopropancarbonsäuren und deren Derivate, deren Herstellung und diese enthaltende Insektizide | |
| DE1618939B2 (de) | Cyclopropancarbonsaeureester und ihre verwendung als insektizide | |
| US2413803A (en) | 2-ethyl-2-butyl propanediol-1,3 | |
| DE2327660C3 (de) | Cyclopropancarbonsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2034128C2 (de) | Cyclopentenolonester, Cyclopentenone und die Verwendung der Cyclopentenolonester als Insektizide | |
| DE2129124C3 (da) | ||
| US3839561A (en) | Insecticidal compositions stabilized by certain diisophorone derivatives | |
| DE2108975C3 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| PL53679B1 (da) | ||
| DE863566C (de) | Insektenabwehrmittel | |
| US2302159A (en) | Insect repellent | |
| DE2013924A1 (de) | Verfahren zur Razemisierung optisch aktiver trans-Cyclopropancarbonsäuren und ihrer Derivate | |
| DE1926433A1 (de) | Cyclopropancarbonsaeureester,Verfahren zu ihrer Herstellung und ihre Verwendung als Insecticide oder in insecticiden Mitteln | |
| DE956040C (de) | Verfahren zur Herstellung von fuer die Polykondensation gut geeigneten Terephthalsaeureglykolestern | |
| AU2002327899B2 (en) | Insect repellent | |
| US2808359A (en) | Insect repellent compositions of hydroxy-alkyl esters of polybasic organic acids and methods of using same | |
| DE1926433C (de) | Cyclopropancarbonsaureester und ihre Verwendung als Insecticide | |
| DE961406C (de) | Schaedlingsbekaempfungsmittel | |
| DE1928540C (de) | Cyclopropancarbonsäureester und ihre Verwendung als Insektizide | |
| DE1620287C3 (de) | Chrysanthemummonocarbonsäureester, Verfahren zu ihrer Herstellung und deren Verwendung als Insektizide | |
| DE1114177B (de) | Verfahren zur Herstellung von Milchsaeure | |
| DE1923916C3 (de) | p-Brombenzoylpropionsäureester und Mittel zur Abwehr von Insekten | |
| DE2335347C3 (de) | Substituierte Essigsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Pestizide | |
| AT254849B (de) | Verfahren zur Hestellung neuer Cyclopropancarbonsäureester | |
| AT233314B (de) | Mittel zur Bekämpfung von Insekten und Spinnentieren |