PL110263B1 - Phytohormonal agent and a herbicide - Google Patents
Phytohormonal agent and a herbicide Download PDFInfo
- Publication number
- PL110263B1 PL110263B1 PL1976192321A PL19232176A PL110263B1 PL 110263 B1 PL110263 B1 PL 110263B1 PL 1976192321 A PL1976192321 A PL 1976192321A PL 19232176 A PL19232176 A PL 19232176A PL 110263 B1 PL110263 B1 PL 110263B1
- Authority
- PL
- Poland
- Prior art keywords
- carbon atoms
- alkyl group
- group
- formula
- model
- Prior art date
Links
- 239000003795 chemical substances by application Substances 0.000 title claims description 13
- 230000002363 herbicidal effect Effects 0.000 title claims description 13
- 239000004009 herbicide Substances 0.000 title claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 103
- 125000000217 alkyl group Chemical group 0.000 claims description 79
- 239000013543 active substance Substances 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000004414 alkyl thio group Chemical group 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- -1 trifluoromethoxy, trifluoro-methylthio, carboxyl Chemical group 0.000 claims description 14
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 9
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 9
- 125000005842 heteroatom Chemical group 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 239000011593 sulfur Substances 0.000 claims description 9
- 125000004429 atom Chemical group 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 7
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 5
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical class C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 33
- 241000196324 Embryophyta Species 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 7
- 241000227653 Lycopersicon Species 0.000 description 6
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 235000013399 edible fruits Nutrition 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000005507 spraying Methods 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 235000021533 Beta vulgaris Nutrition 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 240000004322 Lens culinaris Species 0.000 description 2
- 235000010666 Lens esculenta Nutrition 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical class O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000004062 sedimentation Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000013008 thixotropic agent Substances 0.000 description 2
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000021508 Coleus Nutrition 0.000 description 1
- 244000061182 Coleus blumei Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 229910019785 NBF4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000220259 Raphanus Species 0.000 description 1
- 235000019057 Raphanus caudatus Nutrition 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000011380 Raphanus sativus Nutrition 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000007767 bonding agent Substances 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- IYWCBYFJFZCCGV-UHFFFAOYSA-N formamide;hydrate Chemical compound O.NC=O IYWCBYFJFZCCGV-UHFFFAOYSA-N 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000005078 fruit development Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 239000003617 indole-3-acetic acid Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000003375 plant hormone Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- ARENMZZMCSLORU-UHFFFAOYSA-N propan-2-yl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OC(C)C)=CC=CC2=C1 ARENMZZMCSLORU-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- PBIMIGNDTBRRPI-UHFFFAOYSA-N trifluoro borate Chemical compound FOB(OF)OF PBIMIGNDTBRRPI-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/12—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines
- C07C259/18—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines having carbon atoms of hydroxamidine groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7527884A FR2323683A1 (fr) | 1975-09-11 | 1975-09-11 | Nouveaux derives d'amidoximes, leur preparation et les compositions qui les contiennent |
| FR7621717A FR2357537A2 (fr) | 1976-07-08 | 1976-07-08 | Nouveaux derives d'amidoximes, leur preparation et les compositions phytohormonales et herbicides qui les contiennent |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL110263B1 true PL110263B1 (en) | 1980-07-31 |
Family
ID=26219059
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976192321A PL110263B1 (en) | 1975-09-11 | 1976-09-10 | Phytohormonal agent and a herbicide |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4116974A (enExample) |
| JP (1) | JPS5236640A (enExample) |
| AR (1) | AR216448A1 (enExample) |
| AT (1) | AT355059B (enExample) |
| BE (1) | BE846081A (enExample) |
| BR (1) | BR7605959A (enExample) |
| CA (1) | CA1080234A (enExample) |
| CH (1) | CH603043A5 (enExample) |
| DD (1) | DD128918A5 (enExample) |
| DE (1) | DE2640484A1 (enExample) |
| DK (1) | DK410676A (enExample) |
| ES (1) | ES451407A1 (enExample) |
| GB (1) | GB1501529A (enExample) |
| HU (1) | HU176860B (enExample) |
| IE (1) | IE43624B1 (enExample) |
| IL (1) | IL50463A (enExample) |
| IT (1) | IT1070587B (enExample) |
| LU (1) | LU75766A1 (enExample) |
| NL (1) | NL7610066A (enExample) |
| PL (1) | PL110263B1 (enExample) |
| PT (1) | PT65573B (enExample) |
| RO (1) | RO70581A (enExample) |
| SE (1) | SE7610050L (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2428036A1 (fr) * | 1978-06-08 | 1980-01-04 | Rolland Sa A | Nouveaux intermediaires de synthese pour la preparation de 0-(amino alkyl) oximes diaromatiques |
| US4423233A (en) * | 1981-04-23 | 1983-12-27 | Pfizer Inc. | Hypoglycemic 5-substituted oxazolidine-2,4-diones |
| JPS58181466U (ja) * | 1982-05-28 | 1983-12-03 | 株式会社マキタ電機製作所 | ボルト締付具 |
| JPS5912572U (ja) * | 1982-07-14 | 1984-01-26 | 株式会社マキタ電機製作所 | ボルト締付具 |
| US4432786A (en) * | 1982-05-10 | 1984-02-21 | Chevron Research Company | Thienylmethoxyiminoalkyl cyclohexanedione herbicides |
| JPS60131367U (ja) * | 1984-02-10 | 1985-09-03 | 日立工機株式会社 | ボルト締付工具 |
| US5006160A (en) * | 1988-07-06 | 1991-04-09 | Sds Biotech Kabushiki Kaisha | Imino[(3-halogenophenyl)amino]acetic acid derivatives and herbicides containing same |
| JPH0748372Y2 (ja) * | 1991-02-27 | 1995-11-08 | 前田金属工業株式会社 | ボルト締付機 |
| DE19806827A1 (de) * | 1998-02-18 | 1999-08-19 | Trw Automotive Electron & Comp | Verbindung zwischen einem Träger und einem Plattenelement |
| HUP0005002A2 (en) * | 2000-12-22 | 2002-08-28 | Sinnex Mueszaki Fejlesztoe Es | Acetic acid derivatives, compositions containing the same their use for increasing the abiotic stress tolerance of cultivated plants, for inhibiting the aging of seeds and for increasing the seed-vigore during stress conditions |
| RS52711B (sr) | 2005-05-10 | 2013-08-30 | Incyte Corporation | Modulatori indolamin 2,3-dioksigenaze i postupci upotrebe istih |
| EP1971583B1 (en) | 2005-12-20 | 2015-03-25 | Incyte Corporation | N-hydroxyamidinoheterocycles as modulators of indoleamine 2,3-dioxygenase |
| CL2007002650A1 (es) * | 2006-09-19 | 2008-02-08 | Incyte Corp | Compuestos derivados de heterociclo n-hidroxiamino; composicion farmaceutica, util para tratar cancer, infecciones virales y desordenes neurodegenerativos entre otras. |
| WO2008036642A2 (en) * | 2006-09-19 | 2008-03-27 | Incyte Corporation | N-hydroxyamidinoheterocycles as modulators of indoleamine 2,3-dioxygenase |
| PL2315756T3 (pl) | 2008-07-08 | 2015-02-27 | Incyte Holdings Corp | 1,2,5-oksadiazole jako inhibitory 2,3-dioksygenazy indoloaminy |
| DE102009004204A1 (de) * | 2009-01-09 | 2010-07-15 | Christian-Albrechts-Universität Zu Kiel | Verfahren zur verbesserten Bioaktivierung von Arzneistoffen |
| KR102617531B1 (ko) | 2013-11-08 | 2023-12-27 | 인사이트 홀딩스 코포레이션 | 인돌아민 2,3-디옥시게나제 억제제의 합성 방법 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272833A (en) * | 1963-10-09 | 1966-09-13 | Abbott Lab | Certain substituted 5-nitro-2-furylamidoximes |
| NL6905499A (enExample) * | 1969-04-10 | 1970-10-13 |
-
1976
- 1976-09-08 IE IE2008/76A patent/IE43624B1/en unknown
- 1976-09-08 GB GB37229/76A patent/GB1501529A/en not_active Expired
- 1976-09-08 DD DD7600194681A patent/DD128918A5/xx unknown
- 1976-09-08 CA CA260,741A patent/CA1080234A/en not_active Expired
- 1976-09-08 DE DE19762640484 patent/DE2640484A1/de not_active Withdrawn
- 1976-09-10 PL PL1976192321A patent/PL110263B1/pl unknown
- 1976-09-10 BR BR7605959A patent/BR7605959A/pt unknown
- 1976-09-10 AR AR264650A patent/AR216448A1/es active
- 1976-09-10 US US05/722,215 patent/US4116974A/en not_active Expired - Lifetime
- 1976-09-10 BE BE170532A patent/BE846081A/xx unknown
- 1976-09-10 DK DK410676A patent/DK410676A/da not_active Application Discontinuation
- 1976-09-10 JP JP51109352A patent/JPS5236640A/ja active Pending
- 1976-09-10 SE SE7610050A patent/SE7610050L/xx not_active Application Discontinuation
- 1976-09-10 NL NL7610066A patent/NL7610066A/xx not_active Application Discontinuation
- 1976-09-10 HU HU76PI539A patent/HU176860B/hu unknown
- 1976-09-10 ES ES451407A patent/ES451407A1/es not_active Expired
- 1976-09-10 LU LU75766A patent/LU75766A1/xx unknown
- 1976-09-10 AT AT670076A patent/AT355059B/de not_active IP Right Cessation
- 1976-09-10 RO RO7687499A patent/RO70581A/ro unknown
- 1976-09-10 PT PT65573A patent/PT65573B/pt unknown
- 1976-09-10 IL IL50463A patent/IL50463A/xx unknown
- 1976-09-10 IT IT27129/76A patent/IT1070587B/it active
- 1976-09-10 CH CH1156076A patent/CH603043A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL50463A0 (en) | 1976-11-30 |
| ATA670076A (de) | 1979-07-15 |
| DE2640484A1 (de) | 1977-04-07 |
| RO70581A (ro) | 1982-05-10 |
| CH603043A5 (enExample) | 1978-08-15 |
| IE43624L (en) | 1977-03-11 |
| AT355059B (de) | 1980-02-11 |
| IE43624B1 (en) | 1981-04-22 |
| BR7605959A (pt) | 1977-08-16 |
| DD128918A5 (de) | 1977-12-21 |
| BE846081A (fr) | 1977-03-10 |
| PT65573B (fr) | 1978-07-04 |
| HU176860B (en) | 1981-05-28 |
| CA1080234A (en) | 1980-06-24 |
| ES451407A1 (es) | 1977-12-16 |
| LU75766A1 (enExample) | 1978-05-12 |
| AR216448A1 (es) | 1979-12-28 |
| PT65573A (fr) | 1976-10-01 |
| IL50463A (en) | 1979-10-31 |
| SE7610050L (sv) | 1977-03-12 |
| NL7610066A (nl) | 1977-03-15 |
| GB1501529A (en) | 1978-02-15 |
| US4116974A (en) | 1978-09-26 |
| IT1070587B (it) | 1985-03-29 |
| JPS5236640A (en) | 1977-03-22 |
| DK410676A (da) | 1977-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL110263B1 (en) | Phytohormonal agent and a herbicide | |
| KR900003393B1 (ko) | 2-시아노벤즈 이미다졸 유도체의 제조방법 | |
| DK174658B1 (da) | Cyclopropylmalonanilatderivat til retardering af plantevækst, plantevækstretarderende præparat og anvendelse deraf | |
| EA000947B1 (ru) | Синергетические гербицидные композиции на основе метолахлора | |
| EA001549B1 (ru) | Гербицидная композиция и способ борьбы с сорняками | |
| PL110213B1 (en) | Pesticide | |
| HU184615B (en) | Compositions with antidote activity and process for preparing oxime derivatives applied as active substances thereof | |
| CA2374150A1 (en) | Strobilurin-based fungicide composition causing reduced chemical damage | |
| US4454147A (en) | Nematicidal 2-chloro-5-aryl-1,3,4-thiadiazoles | |
| KR820001281B1 (ko) | 펜옥시알킬옥사졸린의 제조방법 | |
| US4188203A (en) | Herbicidal and phytohormonal amidoximes | |
| US4531966A (en) | Herbicide compositions | |
| JPS61103873A (ja) | 新規な2‐シアノベンズイミダゾール誘導体 | |
| PL126684B1 (en) | A herbicide and plant growth inhibitor and a method for producing new derivatives of 2-nitro-5-phenoxyphenyloxazole,-oxazine,-imidazole,-pyrimidine or-thiazole | |
| BR9914709B1 (pt) | compostos 3-(fenil substituìdo)-5-(ciclopropil substituìdo)-1,2,4-triazol, seu processo de preparação, composição e processo não terapêutico para controlar insetos ou ácaros. | |
| US4154598A (en) | Herbicidal 1,2,4-oxadiazin-5-one compositions | |
| KR790001384B1 (ko) | 1, 2, 4-옥사디아진-5-온 유도체의 제조법 | |
| NO124777B (enExample) | ||
| US4324579A (en) | Herbicidal and phytohormonal amidoximes | |
| SE447377B (sv) | Nya bicyklo/2.2.1/heptanderivat och kompositioner innehallande dem och avsedda for reglering av vexters tillvext | |
| KR810001153B1 (ko) | 사이클로프로판 카복실산 아닐리드류의 제조방법 | |
| JPH0822804B2 (ja) | 裁培植物の成長をワークロルキノリン―8―カルボン酸を用いて促進する方法 | |
| KR840000863B1 (ko) | 혜테로사이클릭 페닐 에테르의 제조방법 | |
| US4216006A (en) | Herbicidal and phytohormonal amidoximes | |
| KR810001506B1 (ko) | 3-우레이도-(티오)-크로몬 유도체의 제조방법 |