PH30227A - 7-Isoindolinyl-quinolone-carboxylic acid derivatives - Google Patents
7-Isoindolinyl-quinolone-carboxylic acid derivativesInfo
- Publication number
- PH30227A PH30227A PH44526A PH44526A PH30227A PH 30227 A PH30227 A PH 30227A PH 44526 A PH44526 A PH 44526A PH 44526 A PH44526 A PH 44526A PH 30227 A PH30227 A PH 30227A
- Authority
- PH
- Philippines
- Prior art keywords
- isoindolinyl
- quinolone
- carboxylic acid
- acid derivatives
- derivatives
- Prior art date
Links
- VQBYVYIEFZDFEF-UHFFFAOYSA-N 7-(2,3-dihydro-1h-isoindol-1-yl)-2-oxo-1h-quinoline-3-carboxylic acid Chemical class N1CC2=CC=CC=C2C1C1=CC=C2C=C(C(=O)O)C(=O)NC2=C1 VQBYVYIEFZDFEF-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4120646A DE4120646A1 (de) | 1991-06-22 | 1991-06-22 | 7-isoindolinyl-chinolon- und naphthyridoncarbonsaeure-derivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH30227A true PH30227A (en) | 1997-02-05 |
Family
ID=6434522
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH44526A PH30227A (en) | 1991-06-22 | 1992-06-17 | 7-Isoindolinyl-quinolone-carboxylic acid derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5464796A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0520240A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPH05239051A (cg-RX-API-DMAC7.html) |
| KR (1) | KR930000503A (cg-RX-API-DMAC7.html) |
| CN (1) | CN1068115A (cg-RX-API-DMAC7.html) |
| AU (1) | AU648669B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2071677A1 (cg-RX-API-DMAC7.html) |
| CZ (1) | CZ190192A3 (cg-RX-API-DMAC7.html) |
| DE (1) | DE4120646A1 (cg-RX-API-DMAC7.html) |
| FI (1) | FI922873A7 (cg-RX-API-DMAC7.html) |
| HU (1) | HUT62288A (cg-RX-API-DMAC7.html) |
| IE (1) | IE922003A1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL102261A (cg-RX-API-DMAC7.html) |
| MX (1) | MX9202982A (cg-RX-API-DMAC7.html) |
| NO (1) | NO922226L (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ243214A (cg-RX-API-DMAC7.html) |
| PH (1) | PH30227A (cg-RX-API-DMAC7.html) |
| RU (1) | RU2056411C1 (cg-RX-API-DMAC7.html) |
| SK (1) | SK190192A3 (cg-RX-API-DMAC7.html) |
| TW (1) | TW202442B (cg-RX-API-DMAC7.html) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4230804A1 (de) * | 1992-09-15 | 1994-03-17 | Bayer Ag | 7-Isoindolinyl-chinolon- und -naphthyridon-Derivate |
| US5527910A (en) * | 1992-12-30 | 1996-06-18 | Cheil Foods & Chemicals, Inc. | Pyridone carboxylic acid compounds and their uses for treating infectious diseases caused by bacteria |
| DE4301246A1 (de) * | 1993-01-19 | 1994-07-21 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäurederivate |
| US5532239A (en) * | 1993-08-02 | 1996-07-02 | Assistance Publique - Hopitaux De Paris | Therapeutic application of fluoroquinolone derivatives |
| DE4329600A1 (de) * | 1993-09-02 | 1995-03-09 | Bayer Ag | Pyrido [1,2,3-d,e] [1,3,4] benzoxadiazinderivate |
| DE4418510A1 (de) * | 1994-05-27 | 1995-11-30 | Bayer Ag | 1,9-überbrückte Thiazolol[3,4-a]chinolinderivate |
| DE4427530A1 (de) * | 1994-08-04 | 1996-02-08 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| DE4435479A1 (de) * | 1994-10-04 | 1996-04-11 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| DE19500792A1 (de) * | 1995-01-13 | 1996-07-18 | Bayer Ag | Chinolon- und Naphthyridoncarbonsäure-Derivate |
| JPH08213881A (ja) * | 1995-02-02 | 1996-08-20 | Fujitsu Ltd | 周波数制御回路 |
| DE19506535A1 (de) * | 1995-02-09 | 1996-08-14 | Bayer Ag | 1,6-Naphthyridoncarbonsäurederivate |
| DE19512484A1 (de) * | 1995-04-04 | 1996-10-17 | Bayer Ag | Kohlenhydratmodifizierte Cytostatika |
| MY138335A (en) * | 1997-09-15 | 2009-05-29 | Procter & Gamble | Antimicrobial quinolones, their compositions and uses |
| PA8466701A1 (es) | 1998-01-21 | 2000-09-29 | Pfizer Prod Inc | Comprimido de mesilato de trovafloxacino |
| SE9801474D0 (sv) * | 1998-04-27 | 1998-04-27 | Active Biotech Ab | Quinoline Derivatives |
| SE9802549D0 (sv) * | 1998-07-15 | 1998-07-15 | Active Biotech Ab | Quinoline derivatives |
| SE9802550D0 (sv) * | 1998-07-15 | 1998-07-15 | Active Biotech Ab | Quinoline derivatives |
| DE69925859T2 (de) * | 1998-11-24 | 2006-05-11 | Daiichi Pharmaceutical Co., Ltd. | Cycloalkylsubstituierte aminomethylpyrrolidin-derivate |
| DE19854357A1 (de) * | 1998-11-25 | 2000-05-31 | Bayer Ag | Semi-Hydrochlorid von 8-Cyan-1-cyclopropyl-7-(1S,6S-2,8-diazabicyclo/4.3.0/ -nonan-8-yl)-6-fluor-1,4-dihydro-4-oxo-3-chinolincarbonsäure |
| US7176313B2 (en) * | 2000-02-09 | 2007-02-13 | Daiichi Pharmaceutical Co., Ltd. | Anti acid-fast bacterial agent containing pyridonecarboxylic acids as active ingredient |
| EP1277471B1 (en) * | 2000-04-24 | 2008-05-28 | Daiichi Sankyo Company, Limited | Stable liquid preparation comprising sitafloxacin |
| US7220824B1 (en) | 2000-08-28 | 2007-05-22 | Bayer Aktiengesellschaft | Integrin-mediated drug targeting |
| EP1219634A1 (en) * | 2000-12-27 | 2002-07-03 | Bayer Aktiengesellschaft | Cytostatic-glycoconjugates having specifically cleavable peptidic linking units |
| IL157303A0 (en) * | 2001-02-21 | 2004-02-19 | Zentaris Gmbh | Quinoline, isoquinoline and phthalazine derivatives as antagonists of the gonadotropin-releasing hormone |
| EP1238678A1 (en) * | 2001-03-08 | 2002-09-11 | Bayer Aktiengesellschaft | Enzyme-activated cytostatic conjugates with integrin ligands |
| RU2275361C3 (ru) * | 2002-11-20 | 2021-10-01 | Джапан Тобакко Инк. | Соединение 4-оксохинолина и его применение в качестве ингибитора вич интегразы |
| SI1937642T1 (sl) * | 2005-10-19 | 2015-01-30 | Teva Pharmaceutical Industries Ltd. | Kristali natrijevega lakvinimoda in postopek za njihovo pripravo |
| US20070196398A1 (en) * | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone fatty acid salt compositions |
| US20070197548A1 (en) | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone compositions |
| US7973022B2 (en) | 2006-02-17 | 2011-07-05 | Idexx Laboratories, Inc. | Fluoroquinolone carboxylic acid salt compositions |
| WO2007110834A2 (en) * | 2006-03-28 | 2007-10-04 | The Procter & Gamble Company | Malate salts, and polymorphs of (3s,5s)-7-[3-amino-5-methyl-piperidinyl]-1-cyclopropyl-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid |
| EP1999125A2 (en) * | 2006-03-28 | 2008-12-10 | The Procter and Gamble Company | A coupling process for preparing quinolone intermediates |
| RU2399616C1 (ru) * | 2006-06-23 | 2010-09-20 | Джапан Тобакко Инк. | Производное 6-(гетероциклзамещенный бензил)-4-оксохинолина и его применение в качестве ингибитора интегразы вич |
| KR100690084B1 (ko) * | 2006-11-01 | 2007-03-09 | 주식회사 세홍이엔씨 | 출입문과 연동하는 주택 내 배전반 |
| USD612227S1 (en) | 2009-02-06 | 2010-03-23 | Rockler Companies, Inc. | Workpiece finishing support |
| WO2013111158A2 (en) * | 2012-01-03 | 2013-08-01 | Msn Laboratories Limited | Process for the preparation of dpp-iv inhibitor |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| NZ208470A (en) * | 1983-07-18 | 1988-06-30 | Abbott Lab | 6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid derivatives and antibacterial compositions containing such |
| EP0154780B1 (en) * | 1984-01-26 | 1990-04-11 | Abbott Laboratories | Quinoline antibacterial compounds |
| NZ210847A (en) * | 1984-01-26 | 1988-02-29 | Abbott Lab | Naphthyridine and pyridopyrimidine derivatives and pharmaceutical compositions |
| DE3420743A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-dihalogen-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| GB8612137D0 (en) * | 1986-05-19 | 1986-06-25 | Fujisawa Pharmaceutical Co | Quinolone compounds |
| JPH0262875A (ja) * | 1988-05-23 | 1990-03-02 | Wakunaga Pharmaceut Co Ltd | 新規イソインドリン誘導体 |
| JP2844079B2 (ja) * | 1988-05-23 | 1999-01-06 | 塩野義製薬株式会社 | ピリドンカルボン酸系抗菌剤 |
| DE3906365A1 (de) * | 1988-07-15 | 1990-01-18 | Bayer Ag | 7-(1-pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsaeure-derivate, verfahren sowie substituierte (oxa)diazabicyclooctane und -nonane als zwischenprodukte zu ihrer herstellung, und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| DE3910663A1 (de) * | 1989-04-03 | 1990-10-04 | Bayer Ag | 5-alkylchinoloncarbonsaeuren |
| WO1990012799A1 (en) * | 1989-04-26 | 1990-11-01 | The Upjohn Company | Antibacterial pyrido(1,2,3-de)-1,4-benzoxazinone agents |
| CA2030217A1 (en) * | 1989-11-21 | 1991-05-22 | Jun Imose | Pyridone-carboxylic acid derivatives useful as veterinary medicines |
-
1991
- 1991-06-22 DE DE4120646A patent/DE4120646A1/de not_active Withdrawn
-
1992
- 1992-05-22 TW TW081103997A patent/TW202442B/zh active
- 1992-06-03 AU AU17391/92A patent/AU648669B2/en not_active Ceased
- 1992-06-05 NO NO92922226A patent/NO922226L/no unknown
- 1992-06-10 EP EP92109742A patent/EP0520240A1/de not_active Withdrawn
- 1992-06-11 US US07/896,955 patent/US5464796A/en not_active Expired - Fee Related
- 1992-06-17 PH PH44526A patent/PH30227A/en unknown
- 1992-06-18 MX MX9202982A patent/MX9202982A/es unknown
- 1992-06-18 FI FI922873A patent/FI922873A7/fi unknown
- 1992-06-19 CA CA002071677A patent/CA2071677A1/en not_active Abandoned
- 1992-06-19 CZ CS921901A patent/CZ190192A3/cs unknown
- 1992-06-19 RU SU925052282A patent/RU2056411C1/ru active
- 1992-06-19 JP JP4184679A patent/JPH05239051A/ja active Pending
- 1992-06-19 SK SK1901-92A patent/SK190192A3/sk unknown
- 1992-06-19 IL IL10226192A patent/IL102261A/en not_active IP Right Cessation
- 1992-06-19 NZ NZ243214A patent/NZ243214A/en unknown
- 1992-06-20 KR KR1019920010775A patent/KR930000503A/ko not_active Withdrawn
- 1992-06-22 CN CN92104849A patent/CN1068115A/zh active Pending
- 1992-06-22 HU HU9202085A patent/HUT62288A/hu unknown
- 1992-07-01 IE IE200392A patent/IE922003A1/en not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CN1068115A (zh) | 1993-01-20 |
| RU2056411C1 (ru) | 1996-03-20 |
| SK190192A3 (en) | 1995-08-09 |
| JPH05239051A (ja) | 1993-09-17 |
| IE922003A1 (en) | 1992-12-30 |
| IL102261A0 (en) | 1993-01-14 |
| EP0520240A1 (de) | 1992-12-30 |
| MX9202982A (es) | 1992-12-01 |
| FI922873A0 (fi) | 1992-06-18 |
| AU648669B2 (en) | 1994-04-28 |
| HU9202085D0 (en) | 1992-09-28 |
| CZ190192A3 (en) | 1993-01-13 |
| NZ243214A (en) | 1995-07-26 |
| DE4120646A1 (de) | 1992-12-24 |
| NO922226D0 (no) | 1992-06-05 |
| NO922226L (no) | 1992-12-23 |
| TW202442B (cg-RX-API-DMAC7.html) | 1993-03-21 |
| US5464796A (en) | 1995-11-07 |
| AU1739192A (en) | 1992-12-24 |
| FI922873A7 (fi) | 1992-12-23 |
| IL102261A (en) | 1996-10-16 |
| HUT62288A (en) | 1993-04-28 |
| KR930000503A (ko) | 1993-01-15 |
| CA2071677A1 (en) | 1992-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA924743B (en) | 7-azaisoindolinyl-quinolone-and-naphthyrindonecarboxylic acid derivatives | |
| PH30227A (en) | 7-Isoindolinyl-quinolone-carboxylic acid derivatives | |
| AP9200447A0 (en) | Acetic acid derivatives | |
| ZA94332B (en) | Quinolone- and naphtyridonecarboxylic acid derivatives | |
| IL103538A0 (en) | Quinoxaline-carboxylic and-phosphonic acid derivatives | |
| HU9203123D0 (en) | Substituted imidazolyl-propenic acid derivatives | |
| ZA93190B (en) | Benzofuranyl- and thiophenylmethylthio-alkanecarboxylic acid derivatives | |
| AU646762B2 (en) | Cyclic-substituted imidazolyl-propenoic acid derivatives | |
| HU9203124D0 (en) | Imidazolyl-propenic acid derivatives | |
| HU9403116D0 (en) | Epoxy-succinic acid derivatives | |
| ZA911398B (en) | Carboxylic acid derivatives | |
| ZA929330B (en) | Thiazolyl-substituted quinolylmethoxyphenylacetic acid derivatives. | |
| ZA913132B (en) | Carboxylic acid derivatives | |
| HU9302728D0 (en) | Pyridazinone-acetic acid derivatives | |
| ZA941668B (en) | Acyloxyhexanoic acid derivatives | |
| ZA931367B (en) | Sulphonylbenzyl-substituted imidazolylpropenoic acid derivatives | |
| AP9200396A0 (en) | Propenoic acid derivatives | |
| ZA93125B (en) | Quinolone- and naphthyridone-carboxylic acid derivatives | |
| ZA928275B (en) | Quinoxaline-carboxylic and -phosphonic acid derivatives. | |
| IL110170A0 (en) | 2-Oximino-2-thienyl-acetic acid derivatives | |
| ZA941923B (en) | Phenoxyphenylacetic acid derivatives | |
| ZA922831B (en) | Novel thienyl-nonatetraenoic acid derivatives | |
| HU9400588D0 (en) | 3-hydroxyanthranilic acid derivatives | |
| ZA924515B (en) | 7-isoindolinyl-quinolone-and naphthyridonecarboxylic acid derivatives | |
| ZA922022B (en) | N-acyl-alpha-amino acid derivatives |