NZ566914A - 2-amino-7, 8-dihydro-6H-pyrido[4,3-d] pyrimidin-5-ones - Google Patents
2-amino-7, 8-dihydro-6H-pyrido[4,3-d] pyrimidin-5-onesInfo
- Publication number
- NZ566914A NZ566914A NZ566914A NZ56691406A NZ566914A NZ 566914 A NZ566914 A NZ 566914A NZ 566914 A NZ566914 A NZ 566914A NZ 56691406 A NZ56691406 A NZ 56691406A NZ 566914 A NZ566914 A NZ 566914A
- Authority
- NZ
- New Zealand
- Prior art keywords
- phenyl
- methoxy
- methyl
- substituted
- pyridin
- Prior art date
Links
- CZOQBGHFZWUWPV-UHFFFAOYSA-N 2-amino-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical class O=C1NCCC2=NC(N)=NC=C21 CZOQBGHFZWUWPV-UHFFFAOYSA-N 0.000 title description 18
- -1 2-amino-7-[2-(pyridin-2-yl)-phenyl]-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one compound Chemical class 0.000 claims abstract description 897
- 150000001875 compounds Chemical class 0.000 claims abstract description 216
- 150000003839 salts Chemical class 0.000 claims abstract description 91
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 55
- 238000000034 method Methods 0.000 claims abstract description 47
- 201000011510 cancer Diseases 0.000 claims abstract description 41
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims abstract description 17
- 239000002253 acid Substances 0.000 claims abstract description 17
- 201000011243 gastrointestinal stromal tumor Diseases 0.000 claims abstract description 12
- 206010051066 Gastrointestinal stromal tumour Diseases 0.000 claims abstract description 11
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 claims abstract description 9
- 206010025323 Lymphomas Diseases 0.000 claims abstract description 9
- 208000031261 Acute myeloid leukaemia Diseases 0.000 claims abstract description 8
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims abstract description 8
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims abstract description 8
- 206010006187 Breast cancer Diseases 0.000 claims abstract description 7
- 208000026310 Breast neoplasm Diseases 0.000 claims abstract description 7
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 claims abstract description 7
- 208000032839 leukemia Diseases 0.000 claims abstract description 7
- 201000001441 melanoma Diseases 0.000 claims abstract description 7
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 claims abstract description 6
- 206010048832 Colon adenoma Diseases 0.000 claims abstract description 6
- 208000028018 Lymphocytic leukaemia Diseases 0.000 claims abstract description 6
- 208000034578 Multiple myelomas Diseases 0.000 claims abstract description 6
- 206010035226 Plasma cell myeloma Diseases 0.000 claims abstract description 6
- 210000000621 bronchi Anatomy 0.000 claims abstract description 6
- 210000003228 intrahepatic bile duct Anatomy 0.000 claims abstract description 6
- 208000003747 lymphoid leukemia Diseases 0.000 claims abstract description 6
- 208000025113 myeloid leukemia Diseases 0.000 claims abstract description 6
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 claims abstract description 5
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims abstract description 5
- 239000012458 free base Substances 0.000 claims abstract description 5
- 208000005017 glioblastoma Diseases 0.000 claims abstract description 5
- 206010009944 Colon cancer Diseases 0.000 claims abstract description 4
- 206010061968 Gastric neoplasm Diseases 0.000 claims abstract description 4
- 206010033128 Ovarian cancer Diseases 0.000 claims abstract description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 claims abstract description 4
- 206010060862 Prostate cancer Diseases 0.000 claims abstract description 4
- 208000024313 Testicular Neoplasms Diseases 0.000 claims abstract description 4
- 208000024770 Thyroid neoplasm Diseases 0.000 claims abstract description 4
- 208000029742 colonic neoplasm Diseases 0.000 claims abstract description 4
- 208000020816 lung neoplasm Diseases 0.000 claims abstract description 4
- 208000025189 neoplasm of testis Diseases 0.000 claims abstract description 4
- 201000003120 testicular cancer Diseases 0.000 claims abstract description 4
- 201000002510 thyroid cancer Diseases 0.000 claims abstract description 4
- 229910052705 radium Inorganic materials 0.000 claims abstract description 3
- 229910052701 rubidium Inorganic materials 0.000 claims abstract description 3
- 208000008839 Kidney Neoplasms Diseases 0.000 claims abstract 6
- 206010038389 Renal cancer Diseases 0.000 claims abstract 6
- 208000014829 head and neck neoplasm Diseases 0.000 claims abstract 6
- 201000010982 kidney cancer Diseases 0.000 claims abstract 6
- 208000003174 Brain Neoplasms Diseases 0.000 claims abstract 3
- 206010006417 Bronchial carcinoma Diseases 0.000 claims abstract 3
- 208000000461 Esophageal Neoplasms Diseases 0.000 claims abstract 3
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims abstract 3
- 206010061336 Pelvic neoplasm Diseases 0.000 claims abstract 3
- 208000009565 Pharyngeal Neoplasms Diseases 0.000 claims abstract 3
- 208000015634 Rectal Neoplasms Diseases 0.000 claims abstract 3
- 208000005718 Stomach Neoplasms Diseases 0.000 claims abstract 3
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims abstract 3
- 201000005200 bronchus cancer Diseases 0.000 claims abstract 3
- 201000010881 cervical cancer Diseases 0.000 claims abstract 3
- 201000004101 esophageal cancer Diseases 0.000 claims abstract 3
- 201000005619 esophageal carcinoma Diseases 0.000 claims abstract 3
- 206010017758 gastric cancer Diseases 0.000 claims abstract 3
- 201000005264 laryngeal carcinoma Diseases 0.000 claims abstract 3
- 206010023841 laryngeal neoplasm Diseases 0.000 claims abstract 3
- 201000004962 larynx cancer Diseases 0.000 claims abstract 3
- 201000007270 liver cancer Diseases 0.000 claims abstract 3
- 208000014018 liver neoplasm Diseases 0.000 claims abstract 3
- 208000026037 malignant tumor of neck Diseases 0.000 claims abstract 3
- 201000005443 oral cavity cancer Diseases 0.000 claims abstract 3
- 201000008006 pharynx cancer Diseases 0.000 claims abstract 3
- 201000002314 small intestine cancer Diseases 0.000 claims abstract 3
- 201000011549 stomach cancer Diseases 0.000 claims abstract 3
- 201000005112 urinary bladder cancer Diseases 0.000 claims abstract 3
- 125000000217 alkyl group Chemical group 0.000 claims description 116
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 99
- 229910052739 hydrogen Inorganic materials 0.000 claims description 94
- 239000001257 hydrogen Substances 0.000 claims description 93
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 93
- 125000003118 aryl group Chemical group 0.000 claims description 73
- 125000001072 heteroaryl group Chemical group 0.000 claims description 64
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 61
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 48
- 125000000623 heterocyclic group Chemical group 0.000 claims description 47
- 125000005843 halogen group Chemical group 0.000 claims description 44
- 102100034051 Heat shock protein HSP 90-alpha Human genes 0.000 claims description 42
- 101710113864 Heat shock protein 90 Proteins 0.000 claims description 41
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 40
- 125000003545 alkoxy group Chemical group 0.000 claims description 35
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 34
- 229910052799 carbon Inorganic materials 0.000 claims description 29
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 28
- 238000011282 treatment Methods 0.000 claims description 28
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 24
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 19
- 125000004076 pyridyl group Chemical group 0.000 claims description 19
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 19
- 201000010099 disease Diseases 0.000 claims description 18
- 230000000694 effects Effects 0.000 claims description 18
- 125000000335 thiazolyl group Chemical group 0.000 claims description 18
- 239000003795 chemical substances by application Substances 0.000 claims description 17
- 125000001041 indolyl group Chemical group 0.000 claims description 17
- 125000001544 thienyl group Chemical group 0.000 claims description 17
- 125000001153 fluoro group Chemical group F* 0.000 claims description 16
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 13
- 239000003814 drug Substances 0.000 claims description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 12
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 12
- 230000003612 virological effect Effects 0.000 claims description 12
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 11
- 125000002541 furyl group Chemical group 0.000 claims description 11
- 125000002971 oxazolyl group Chemical group 0.000 claims description 11
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 11
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 10
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 10
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims description 10
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 10
- 125000001425 triazolyl group Chemical group 0.000 claims description 10
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 9
- 239000005517 L01XE01 - Imatinib Substances 0.000 claims description 9
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 claims description 9
- 125000002883 imidazolyl group Chemical group 0.000 claims description 9
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 claims description 9
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 9
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 8
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims description 8
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 8
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 8
- 150000001356 alkyl thiols Chemical class 0.000 claims description 8
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 8
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 150000003573 thiols Chemical class 0.000 claims description 8
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 claims description 7
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 7
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 7
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 6
- 101001016865 Homo sapiens Heat shock protein HSP 90-alpha Proteins 0.000 claims description 6
- 241000700588 Human alphaherpesvirus 1 Species 0.000 claims description 6
- 108091000080 Phosphotransferase Proteins 0.000 claims description 6
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 6
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 102000020233 phosphotransferase Human genes 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 5
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 claims description 5
- 229910052727 yttrium Inorganic materials 0.000 claims description 5
- 229960002411 imatinib Drugs 0.000 claims description 4
- 230000001225 therapeutic effect Effects 0.000 claims description 4
- NIULRPKPBLEFJZ-SNVBAGLBSA-N (7r)-2-amino-7-(2-bromo-4-fluorophenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1Br NIULRPKPBLEFJZ-SNVBAGLBSA-N 0.000 claims description 3
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 3
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 claims description 3
- 230000001093 anti-cancer Effects 0.000 claims description 3
- 229960002949 fluorouracil Drugs 0.000 claims description 3
- 229960004768 irinotecan Drugs 0.000 claims description 3
- 229960004641 rituximab Drugs 0.000 claims description 3
- BMKDZUISNHGIBY-ZETCQYMHSA-N (+)-dexrazoxane Chemical compound C([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 BMKDZUISNHGIBY-ZETCQYMHSA-N 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 claims description 2
- 108091006112 ATPases Proteins 0.000 claims description 2
- 102000057290 Adenosine Triphosphatases Human genes 0.000 claims description 2
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 claims description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 2
- 102000004190 Enzymes Human genes 0.000 claims description 2
- 108090000790 Enzymes Proteins 0.000 claims description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 claims description 2
- 239000002147 L01XE04 - Sunitinib Substances 0.000 claims description 2
- 239000005511 L01XE05 - Sorafenib Substances 0.000 claims description 2
- 229940123237 Taxane Drugs 0.000 claims description 2
- 229940122803 Vinca alkaloid Drugs 0.000 claims description 2
- 229940045799 anthracyclines and related substance Drugs 0.000 claims description 2
- 229960004562 carboplatin Drugs 0.000 claims description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 2
- 229960004316 cisplatin Drugs 0.000 claims description 2
- 229960004397 cyclophosphamide Drugs 0.000 claims description 2
- 229960000605 dexrazoxane Drugs 0.000 claims description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 claims description 2
- 229960001433 erlotinib Drugs 0.000 claims description 2
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 claims description 2
- 235000008191 folinic acid Nutrition 0.000 claims description 2
- 239000011672 folinic acid Substances 0.000 claims description 2
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 2
- 229960005277 gemcitabine Drugs 0.000 claims description 2
- 229960001691 leucovorin Drugs 0.000 claims description 2
- 229960003787 sorafenib Drugs 0.000 claims description 2
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 claims description 2
- 229960001796 sunitinib Drugs 0.000 claims description 2
- 229950006410 tezacitabine Drugs 0.000 claims description 2
- GFFXZLZWLOBBLO-ASKVSEFXSA-N tezacitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 GFFXZLZWLOBBLO-ASKVSEFXSA-N 0.000 claims description 2
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 claims description 2
- 229960000303 topotecan Drugs 0.000 claims description 2
- 229960000575 trastuzumab Drugs 0.000 claims description 2
- YCOYDOIWSSHVCK-UHFFFAOYSA-N vatalanib Chemical compound C1=CC(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1CC1=CC=NC=C1 YCOYDOIWSSHVCK-UHFFFAOYSA-N 0.000 claims description 2
- 229950000578 vatalanib Drugs 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 11
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 claims 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 claims 1
- BNOYRDUPHFYYTI-GFCCVEGCSA-N (7r)-2-amino-7-[4-fluoro-2-(2-methoxy-1,3-thiazol-4-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 BNOYRDUPHFYYTI-GFCCVEGCSA-N 0.000 claims 1
- WSMQUUGTQYPVPD-OAHLLOKOSA-N (7r)-2-amino-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 WSMQUUGTQYPVPD-OAHLLOKOSA-N 0.000 claims 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims 1
- 239000012830 cancer therapeutic Substances 0.000 claims 1
- 150000002357 guanidines Chemical class 0.000 abstract description 3
- 229960003810 piperidione Drugs 0.000 abstract 1
- BDTRIDKONHOQQN-UHFFFAOYSA-N 4h-pyrimidin-5-one Chemical class O=C1CN=CN=C1 BDTRIDKONHOQQN-UHFFFAOYSA-N 0.000 description 53
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 41
- CSBPQHGADOHBPJ-UHFFFAOYSA-N 6h-pyrido[4,3-d]pyrimidin-5-one Chemical class C1=NC=C2C(=O)NC=CC2=N1 CSBPQHGADOHBPJ-UHFFFAOYSA-N 0.000 description 38
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 33
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 26
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 25
- 229940002612 prodrug Drugs 0.000 description 22
- 239000000651 prodrug Substances 0.000 description 22
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 20
- 125000003710 aryl alkyl group Chemical group 0.000 description 20
- 230000001413 cellular effect Effects 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000003481 heat shock protein 90 inhibitor Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 229910001868 water Inorganic materials 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 125000001424 substituent group Chemical group 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 210000004027 cell Anatomy 0.000 description 17
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- 235000019439 ethyl acetate Nutrition 0.000 description 16
- 108090000623 proteins and genes Proteins 0.000 description 16
- 102000004169 proteins and genes Human genes 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 230000002062 proliferating effect Effects 0.000 description 15
- 125000003282 alkyl amino group Chemical group 0.000 description 14
- 125000001207 fluorophenyl group Chemical group 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 206010012812 Diffuse cutaneous mastocytosis Diseases 0.000 description 13
- 125000001188 haloalkyl group Chemical group 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- 125000004438 haloalkoxy group Chemical group 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 11
- 239000012267 brine Substances 0.000 description 11
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 125000000304 alkynyl group Chemical group 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- 230000005764 inhibitory process Effects 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 125000005842 heteroatom Chemical group 0.000 description 9
- 230000001404 mediated effect Effects 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000002246 antineoplastic agent Substances 0.000 description 8
- 230000006907 apoptotic process Effects 0.000 description 8
- 208000015114 central nervous system disease Diseases 0.000 description 8
- 230000002526 effect on cardiovascular system Effects 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 229940043355 kinase inhibitor Drugs 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000006467 substitution reaction Methods 0.000 description 8
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 7
- 238000005481 NMR spectroscopy Methods 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 7
- 230000001363 autoimmune Effects 0.000 description 7
- 208000035362 autoimmune disorder of the nervous system Diseases 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 7
- 239000003112 inhibitor Substances 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- AYUNIORJHRXIBJ-TXHRRWQRSA-N tanespimycin Chemical compound N1C(=O)\C(C)=C\C=C/[C@H](OC)[C@@H](OC(N)=O)\C(C)=C\[C@H](C)[C@@H](O)[C@@H](OC)C[C@H](C)CC2=C(NCC=C)C(=O)C=C1C2=O AYUNIORJHRXIBJ-TXHRRWQRSA-N 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- JRZJKWGQFNTSRN-UHFFFAOYSA-N Geldanamycin Natural products C1C(C)CC(OC)C(O)C(C)C=C(C)C(OC(N)=O)C(OC)CCC=C(C)C(=O)NC2=CC(=O)C(OC)=C1C2=O JRZJKWGQFNTSRN-UHFFFAOYSA-N 0.000 description 6
- 108010006519 Molecular Chaperones Proteins 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- QTQAWLPCGQOSGP-GBTDJJJQSA-N geldanamycin Chemical compound N1C(=O)\C(C)=C/C=C\[C@@H](OC)[C@H](OC(N)=O)\C(C)=C/[C@@H](C)[C@@H](O)[C@H](OC)C[C@@H](C)CC2=C(OC)C(=O)C=C1C2=O QTQAWLPCGQOSGP-GBTDJJJQSA-N 0.000 description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 6
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 6
- 239000002502 liposome Substances 0.000 description 6
- 238000004007 reversed phase HPLC Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 102000005431 Molecular Chaperones Human genes 0.000 description 5
- 208000015606 cardiovascular system disease Diseases 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 230000006870 function Effects 0.000 description 5
- 229940080856 gleevec Drugs 0.000 description 5
- 229940088597 hormone Drugs 0.000 description 5
- 239000005556 hormone Substances 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 150000003951 lactams Chemical class 0.000 description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 102000027450 oncoproteins Human genes 0.000 description 5
- 108091008819 oncoproteins Proteins 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 238000000159 protein binding assay Methods 0.000 description 5
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 5
- 230000011664 signaling Effects 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 4
- 208000023345 Autoimmune Diseases of the Nervous System Diseases 0.000 description 4
- 108010002616 Interleukin-5 Proteins 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- 102400000336 Thyrotropin-releasing hormone Human genes 0.000 description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 230000004663 cell proliferation Effects 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 238000010511 deprotection reaction Methods 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 210000000244 kidney pelvis Anatomy 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 230000037361 pathway Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 210000000664 rectum Anatomy 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 210000002784 stomach Anatomy 0.000 description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 229940124597 therapeutic agent Drugs 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- FSPQCTGGIANIJZ-UHFFFAOYSA-N 2-[[(3,4-dimethoxyphenyl)-oxomethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)NC1=C(C(N)=O)C(CCCC2)=C2S1 FSPQCTGGIANIJZ-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 208000023275 Autoimmune disease Diseases 0.000 description 3
- 102000001301 EGF receptor Human genes 0.000 description 3
- 108060006698 EGF receptor Proteins 0.000 description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 3
- 108010004889 Heat-Shock Proteins Proteins 0.000 description 3
- 102000002812 Heat-Shock Proteins Human genes 0.000 description 3
- 241000711549 Hepacivirus C Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- 208000012902 Nervous system disease Diseases 0.000 description 3
- 108091008611 Protein Kinase B Proteins 0.000 description 3
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 description 3
- 101710151245 Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 238000006069 Suzuki reaction reaction Methods 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 229940046836 anti-estrogen Drugs 0.000 description 3
- 230000001833 anti-estrogenic effect Effects 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 210000003679 cervix uteri Anatomy 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 210000001072 colon Anatomy 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 210000003238 esophagus Anatomy 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 239000000328 estrogen antagonist Substances 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 125000004475 heteroaralkyl group Chemical group 0.000 description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 210000000867 larynx Anatomy 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 210000004698 lymphocyte Anatomy 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 210000000214 mouth Anatomy 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229940127084 other anti-cancer agent Drugs 0.000 description 3
- 210000001672 ovary Anatomy 0.000 description 3
- 125000004043 oxo group Chemical group O=* 0.000 description 3
- 210000000496 pancreas Anatomy 0.000 description 3
- 210000003800 pharynx Anatomy 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 210000002307 prostate Anatomy 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 210000000813 small intestine Anatomy 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 125000005017 substituted alkenyl group Chemical group 0.000 description 3
- 125000004426 substituted alkynyl group Chemical group 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 210000001685 thyroid gland Anatomy 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000003652 trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 3
- 210000003932 urinary bladder Anatomy 0.000 description 3
- VBWJSOZNRRIJKW-CYBMUJFWSA-N (7r)-2-amino-4-ethyl-7-[2-(2-methoxy-1,3-thiazol-4-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=CC=C1C1=CSC(OC)=N1 VBWJSOZNRRIJKW-CYBMUJFWSA-N 0.000 description 2
- ZSOOONHJQCGYGH-CQSZACIVSA-N (7r)-2-amino-4-ethyl-7-[2-(6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=CC=C1C1=CN=CC(OC)=N1 ZSOOONHJQCGYGH-CQSZACIVSA-N 0.000 description 2
- PUZHLUJYTGUFDZ-MRXNPFEDSA-N (7r)-2-amino-4-ethyl-7-[2-(6-methoxypyridin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=CC=C1C1=CC=CC(OC)=N1 PUZHLUJYTGUFDZ-MRXNPFEDSA-N 0.000 description 2
- XQNIXHZQURVQNY-CYBMUJFWSA-N (7r)-2-amino-4-ethyl-7-[4-fluoro-2-(2-methoxy-1,3-thiazol-4-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=C(F)C=C1C1=CSC(OC)=N1 XQNIXHZQURVQNY-CYBMUJFWSA-N 0.000 description 2
- QHJOJAPTTNUTLH-MRXNPFEDSA-N (7r)-2-amino-4-ethyl-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=C(F)C=C1C1=CC=CC(OC)=N1 QHJOJAPTTNUTLH-MRXNPFEDSA-N 0.000 description 2
- ZRFMJIRKTWKFFF-LLVKDONJSA-N (7r)-2-amino-7-(2-bromo-4-fluorophenyl)-4-ethyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=C(F)C=C1Br ZRFMJIRKTWKFFF-LLVKDONJSA-N 0.000 description 2
- CNWJBTHUHMAMCT-CQSZACIVSA-N (7r)-2-amino-7-(2-cyclopentyloxy-4-fluorophenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1OC1CCCC1 CNWJBTHUHMAMCT-CQSZACIVSA-N 0.000 description 2
- JETRSAYBEYEUMV-OAHLLOKOSA-N (7r)-2-amino-7-(4-fluoro-2-pyridin-3-ylphenyl)-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2NC(=O)C3=CN=C(N=C3C2)N)=CC=C(F)C=C1C1=CC=CN=C1 JETRSAYBEYEUMV-OAHLLOKOSA-N 0.000 description 2
- MVWLENRNKYYEID-MRXNPFEDSA-N (7r)-2-amino-7-[2-(2,3-dimethoxyphenyl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1OC MVWLENRNKYYEID-MRXNPFEDSA-N 0.000 description 2
- XDHFEFLWTMOYPX-MRXNPFEDSA-N (7r)-2-amino-7-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 XDHFEFLWTMOYPX-MRXNPFEDSA-N 0.000 description 2
- ZHLGDCNNFNWSIN-CQSZACIVSA-N (7r)-2-amino-7-[2-(4-ethoxypyrimidin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CC=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 ZHLGDCNNFNWSIN-CQSZACIVSA-N 0.000 description 2
- OCTZNELAVPCHKI-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5,6-dimethoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(OC)C(OC)=NC=C1C1=CC=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 OCTZNELAVPCHKI-CYBMUJFWSA-N 0.000 description 2
- JDERYWBTAWGGPK-OAHLLOKOSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyridin-2-yl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(N)C(OC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 JDERYWBTAWGGPK-OAHLLOKOSA-N 0.000 description 2
- JRWDAMDIXNLHPV-CQSZACIVSA-N (7r)-2-amino-7-[2-(6-ethoxypyrazin-2-yl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CN=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 JRWDAMDIXNLHPV-CQSZACIVSA-N 0.000 description 2
- BGOLLOXAKPBNOR-CQSZACIVSA-N (7r)-2-amino-7-[2-(6-ethoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CN=CC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 BGOLLOXAKPBNOR-CQSZACIVSA-N 0.000 description 2
- LQRMWIFHAFUBHY-CYBMUJFWSA-N (7r)-2-amino-7-[2-(6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 LQRMWIFHAFUBHY-CYBMUJFWSA-N 0.000 description 2
- YYVZNVJHYCNNAS-OAHLLOKOSA-N (7r)-2-amino-7-[2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 YYVZNVJHYCNNAS-OAHLLOKOSA-N 0.000 description 2
- XTFUULJHEFTUJD-OAHLLOKOSA-N (7r)-2-amino-7-[2-(6-methoxypyridin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 XTFUULJHEFTUJD-OAHLLOKOSA-N 0.000 description 2
- NEBIQJIIOIAQDK-CQSZACIVSA-N (7r)-2-amino-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1C1=CC=CN=C1F NEBIQJIIOIAQDK-CQSZACIVSA-N 0.000 description 2
- WJIVZYGWMWGPEU-QGZVFWFLSA-N (7r)-2-amino-7-[4-fluoro-2-(3-methylphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 WJIVZYGWMWGPEU-QGZVFWFLSA-N 0.000 description 2
- URIQODZTLUYWGV-MRXNPFEDSA-N (7r)-2-amino-7-[4-fluoro-2-(4-fluoro-2-methoxyphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC(F)=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 URIQODZTLUYWGV-MRXNPFEDSA-N 0.000 description 2
- MJWHLLCUDBSQTP-QGZVFWFLSA-N (7r)-2-amino-7-[4-fluoro-2-(4-fluoro-2-methylphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CC1=CC(F)=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 MJWHLLCUDBSQTP-QGZVFWFLSA-N 0.000 description 2
- DAUZFWLDXPXYFO-QGZVFWFLSA-N (7r)-2-amino-7-[4-fluoro-2-(4-methylphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=CC(C)=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 DAUZFWLDXPXYFO-QGZVFWFLSA-N 0.000 description 2
- NYVDVTHQVSBUIY-MRXNPFEDSA-N (7r)-2-amino-7-[4-fluoro-2-(4-pyrrolidin-1-ylpyrimidin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1C(N=1)=NC=CC=1N1CCCC1 NYVDVTHQVSBUIY-MRXNPFEDSA-N 0.000 description 2
- HGAWINPTRRJJMQ-CYBMUJFWSA-N (7r)-2-amino-7-[4-fluoro-2-(6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 HGAWINPTRRJJMQ-CYBMUJFWSA-N 0.000 description 2
- GZHQNPWPYAHOLX-SECBINFHSA-N (7r)-2-amino-7-[5-(6-methoxypyrazin-2-yl)-1,3-thiazol-4-yl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C2=C(N=CS2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 GZHQNPWPYAHOLX-SECBINFHSA-N 0.000 description 2
- UXILBYKFHRNDKO-QFIPXVFZSA-N (7s)-2-amino-6-benzyl-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound N1([C@@H](CC=2N=C(N)N=C(C=2C1=O)C)C=1C(=CC(F)=CC=1)C=1C(=NC=CC=1)F)CC1=CC=CC=C1 UXILBYKFHRNDKO-QFIPXVFZSA-N 0.000 description 2
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 2
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- PSRJRRKMWYGYOW-LLVKDONJSA-N 2-[(7r)-2-amino-4-methyl-5-oxo-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-7-yl]-5-fluorobenzonitrile Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1C#N PSRJRRKMWYGYOW-LLVKDONJSA-N 0.000 description 2
- RQEOWHDYQJQZCH-UHFFFAOYSA-N 2-amino-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=CN=C1 RQEOWHDYQJQZCH-UHFFFAOYSA-N 0.000 description 2
- SBYNSECSXUAJLJ-UHFFFAOYSA-N 2-amino-7-[2-(2-chloropyridin-3-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=CN=C1Cl SBYNSECSXUAJLJ-UHFFFAOYSA-N 0.000 description 2
- UAWTYVQSIYQXFE-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(3-fluorophenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=CC(F)=C1 UAWTYVQSIYQXFE-UHFFFAOYSA-N 0.000 description 2
- RIDDHTUWCLPYQB-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-4,6-dimethyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)C2N(C(=O)C3=C(C)N=C(N)N=C3C2)C)=N1 RIDDHTUWCLPYQB-UHFFFAOYSA-N 0.000 description 2
- DYBPIKUOTANKHX-UHFFFAOYSA-N 2-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound O=C1NCCC2=NC(C)=NC=C21 DYBPIKUOTANKHX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 101710163595 Chaperone protein DnaK Proteins 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- 108010037462 Cyclooxygenase 2 Proteins 0.000 description 2
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 2
- 108091008794 FGF receptors Proteins 0.000 description 2
- 102000044168 Fibroblast Growth Factor Receptor Human genes 0.000 description 2
- 101710178376 Heat shock 70 kDa protein Proteins 0.000 description 2
- 101710152018 Heat shock cognate 70 kDa protein Proteins 0.000 description 2
- 241000700721 Hepatitis B virus Species 0.000 description 2
- MCAHMSDENAOJFZ-UHFFFAOYSA-N Herbimycin A Natural products N1C(=O)C(C)=CC=CC(OC)C(OC(N)=O)C(C)=CC(C)C(OC)C(OC)CC(C)C(OC)C2=CC(=O)C=C1C2=O MCAHMSDENAOJFZ-UHFFFAOYSA-N 0.000 description 2
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- 108091008606 PDGF receptors Proteins 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 2
- 102100033479 RAF proto-oncogene serine/threonine-protein kinase Human genes 0.000 description 2
- 101710141955 RAF proto-oncogene serine/threonine-protein kinase Proteins 0.000 description 2
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 108091008605 VEGF receptors Proteins 0.000 description 2
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 2
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 2
- REAYFGLASQTHKB-UHFFFAOYSA-N [2-[3-(1H-pyrazol-4-yl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound N1N=CC(=C1)C=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 REAYFGLASQTHKB-UHFFFAOYSA-N 0.000 description 2
- SAHIZENKTPRYSN-UHFFFAOYSA-N [2-[3-(phenoxymethyl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound O(C1=CC=CC=C1)CC=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 SAHIZENKTPRYSN-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 102000001307 androgen receptors Human genes 0.000 description 2
- 108010080146 androgen receptors Proteins 0.000 description 2
- 230000033115 angiogenesis Effects 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000000692 anti-sense effect Effects 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 229940041181 antineoplastic drug Drugs 0.000 description 2
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 230000005907 cancer growth Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000022131 cell cycle Effects 0.000 description 2
- 230000025084 cell cycle arrest Effects 0.000 description 2
- 230000024245 cell differentiation Effects 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229940114081 cinnamate Drugs 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000010779 crude oil Substances 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000002081 enamines Chemical group 0.000 description 2
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- 230000002489 hematologic effect Effects 0.000 description 2
- MCAHMSDENAOJFZ-BVXDHVRPSA-N herbimycin Chemical compound N1C(=O)\C(C)=C\C=C/[C@H](OC)[C@@H](OC(N)=O)\C(C)=C\[C@H](C)[C@@H](OC)[C@@H](OC)C[C@H](C)[C@@H](OC)C2=CC(=O)C=C1C2=O MCAHMSDENAOJFZ-BVXDHVRPSA-N 0.000 description 2
- 229940022353 herceptin Drugs 0.000 description 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000009545 invasion Effects 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- VYGYNVZNSSTDLJ-HKCOAVLJSA-N monorden Natural products CC1CC2OC2C=C/C=C/C(=O)CC3C(C(=CC(=C3Cl)O)O)C(=O)O1 VYGYNVZNSSTDLJ-HKCOAVLJSA-N 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- NGGXACLSAZXJGM-UHFFFAOYSA-N n-(diaminomethylidene)acetamide Chemical group CC(=O)N=C(N)N NGGXACLSAZXJGM-UHFFFAOYSA-N 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- 230000002085 persistent effect Effects 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- CNMOHEDUVVUVPP-UHFFFAOYSA-N piperidine-2,3-dione Chemical compound O=C1CCCNC1=O CNMOHEDUVVUVPP-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- AECPBJMOGBFQDN-YMYQVXQQSA-N radicicol Chemical compound C1CCCC(=O)C[C@H]2[C@H](Cl)C(=O)CC(=O)[C@H]2C(=O)O[C@H](C)C[C@H]2O[C@@H]21 AECPBJMOGBFQDN-YMYQVXQQSA-N 0.000 description 2
- 229930192524 radicicol Natural products 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 125000004149 thio group Chemical group *S* 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 2
- 229940124676 vascular endothelial growth factor receptor Drugs 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- JTDGKQNNPKXKII-ZETCQYMHSA-N (1s)-1-(4-methoxyphenyl)ethanamine Chemical compound COC1=CC=C([C@H](C)N)C=C1 JTDGKQNNPKXKII-ZETCQYMHSA-N 0.000 description 1
- HBUBKKRHXORPQB-FJFJXFQQSA-N (2R,3S,4S,5R)-2-(6-amino-2-fluoro-9-purinyl)-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O HBUBKKRHXORPQB-FJFJXFQQSA-N 0.000 description 1
- XMAYWYJOQHXEEK-OZXSUGGESA-N (2R,4S)-ketoconazole Chemical compound C1CN(C(=O)C)CCN1C(C=C1)=CC=C1OC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C(=CC(Cl)=CC=2)Cl)OC1 XMAYWYJOQHXEEK-OZXSUGGESA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- PYGDPDNOWJKHBZ-CQSZACIVSA-N (7r)-2-amino-4-ethyl-7-[4-fluoro-2-(6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=C(F)C=C1C1=CN=CC(OC)=N1 PYGDPDNOWJKHBZ-CQSZACIVSA-N 0.000 description 1
- QQSUEIPSSCVBEE-XMMPIXPASA-N (7r)-2-amino-6-[(2,4-dimethoxyphenyl)methyl]-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC(OC)=CC=C1CN1C(=O)C2=C(C)N=C(N)N=C2C[C@@H]1C1=CC=C(F)C=C1C1=CC=CC(OC)=N1 QQSUEIPSSCVBEE-XMMPIXPASA-N 0.000 description 1
- GWALNSZSTYWHNG-HSZRJFAPSA-N (7r)-2-amino-6-[(3-chlorophenyl)methyl]-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2N(C(=O)C3=C(C)N=C(N)N=C3C2)CC=2C=C(Cl)C=CC=2)=N1 GWALNSZSTYWHNG-HSZRJFAPSA-N 0.000 description 1
- CEBRGPKLGCRFCK-HSZRJFAPSA-N (7r)-2-amino-6-benzyl-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound N1([C@H](CC=2N=C(N)N=C(C=2C1=O)C)C=1C(=CC(F)=CC=1)C=1C=NC=CC=1)CC1=CC=CC=C1 CEBRGPKLGCRFCK-HSZRJFAPSA-N 0.000 description 1
- RSUJRXWSZNFQPW-HSZRJFAPSA-N (7r)-2-amino-6-benzyl-7-[4-fluoro-2-(2-fluoro-3-methoxyphenyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2N(C(=O)C3=C(C)N=C(N)N=C3C2)CC=2C=CC=CC=2)=C1F RSUJRXWSZNFQPW-HSZRJFAPSA-N 0.000 description 1
- PBZRETIFPPUBFJ-RUZDIDTESA-N (7r)-2-amino-6-benzyl-7-[4-fluoro-2-(2-fluoro-4-methylphenyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound FC1=CC(C)=CC=C1C1=CC(F)=CC=C1[C@@H]1N(CC=2C=CC=CC=2)C(=O)C2=C(C)N=C(N)N=C2C1 PBZRETIFPPUBFJ-RUZDIDTESA-N 0.000 description 1
- UXILBYKFHRNDKO-JOCHJYFZSA-N (7r)-2-amino-6-benzyl-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound N1([C@H](CC=2N=C(N)N=C(C=2C1=O)C)C=1C(=CC(F)=CC=1)C=1C(=NC=CC=1)F)CC1=CC=CC=C1 UXILBYKFHRNDKO-JOCHJYFZSA-N 0.000 description 1
- BQIQUAYMOYRJEN-RUZDIDTESA-N (7r)-2-amino-6-benzyl-7-[4-fluoro-2-(3-methoxyphenyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2N(C(=O)C3=C(C)N=C(N)N=C3C2)CC=2C=CC=CC=2)=C1 BQIQUAYMOYRJEN-RUZDIDTESA-N 0.000 description 1
- HLYLTDJJMPFLRT-GOSISDBHSA-N (7r)-2-amino-6-ethyl-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC)=CC=C(F)C=C1C1=CC=CN=C1 HLYLTDJJMPFLRT-GOSISDBHSA-N 0.000 description 1
- KZAQMGDXUBXJLG-GOSISDBHSA-N (7r)-2-amino-6-ethyl-7-[4-fluoro-2-(2-methoxypyridin-3-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC)=CC=C(F)C=C1C1=CC=CN=C1OC KZAQMGDXUBXJLG-GOSISDBHSA-N 0.000 description 1
- BURHVDLVRAHROA-HXUWFJFHSA-N (7r)-2-amino-6-ethyl-7-[4-fluoro-2-(3-methoxyphenyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC)=CC=C(F)C=C1C1=CC=CC(OC)=C1 BURHVDLVRAHROA-HXUWFJFHSA-N 0.000 description 1
- MCKQRSHNEMPBTR-QGZVFWFLSA-N (7r)-2-amino-6-ethyl-7-[4-fluoro-2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC)=CC=C(F)C=C1C1=CN=CC(OC)=N1 MCKQRSHNEMPBTR-QGZVFWFLSA-N 0.000 description 1
- SGVCFUUGGVHILT-GFCCVEGCSA-N (7r)-2-amino-7-(2-bromo-4,5-diethoxyphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(OCC)C(OCC)=CC(Br)=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 SGVCFUUGGVHILT-GFCCVEGCSA-N 0.000 description 1
- SYUFGEHGMYNYOL-SNVBAGLBSA-N (7r)-2-amino-7-(2-bromo-4,5-dimethoxyphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(OC)C(OC)=CC(Br)=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 SYUFGEHGMYNYOL-SNVBAGLBSA-N 0.000 description 1
- PYUHPHXSCLEIDM-GFCCVEGCSA-N (7r)-2-amino-7-(2-bromo-4-ethoxyphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound BrC1=CC(OCC)=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 PYUHPHXSCLEIDM-GFCCVEGCSA-N 0.000 description 1
- WSLZLQSQWCUMLJ-OAHLLOKOSA-N (7r)-2-amino-7-(2-bromo-4-fluorophenyl)-4-methyl-6-(2-methylpropyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC(C)C)=CC=C(F)C=C1Br WSLZLQSQWCUMLJ-OAHLLOKOSA-N 0.000 description 1
- AGPPCVBZLSKPFP-LLVKDONJSA-N (7r)-2-amino-7-(2-bromo-4-methoxyphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound BrC1=CC(OC)=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 AGPPCVBZLSKPFP-LLVKDONJSA-N 0.000 description 1
- JHRBZBFFNJGBDX-SNVBAGLBSA-N (7r)-2-amino-7-(2-bromophenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=CC=C1Br JHRBZBFFNJGBDX-SNVBAGLBSA-N 0.000 description 1
- IHBWMFSUJZBNHS-CQSZACIVSA-N (7r)-2-amino-7-(2-cyclopentyloxyphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=CC=C1OC1CCCC1 IHBWMFSUJZBNHS-CQSZACIVSA-N 0.000 description 1
- GTSUIIPROYHHQL-SNVBAGLBSA-N (7r)-2-amino-7-(4-fluorophenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)=CC=C(F)C=C1 GTSUIIPROYHHQL-SNVBAGLBSA-N 0.000 description 1
- XCIDJUGADVTBOY-ZCFIWIBFSA-N (7r)-2-amino-7-(5-bromo-1,3-thiazol-4-yl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)C)N=CSC=1Br XCIDJUGADVTBOY-ZCFIWIBFSA-N 0.000 description 1
- PRKHPZITPQNLQM-SECBINFHSA-N (7r)-2-amino-7-(5-bromo-2-methoxypyridin-4-yl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=NC(OC)=CC([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1Br PRKHPZITPQNLQM-SECBINFHSA-N 0.000 description 1
- OWKFMMGDGVSSCH-CQSZACIVSA-N (7r)-2-amino-7-[2-(2,4-dimethoxypyrimidin-5-yl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=NC(OC)=NC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 OWKFMMGDGVSSCH-CQSZACIVSA-N 0.000 description 1
- QIVRZIJNOSPKAE-CYBMUJFWSA-N (7r)-2-amino-7-[2-(2-ethoxy-1,3-thiazol-4-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OCC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 QIVRZIJNOSPKAE-CYBMUJFWSA-N 0.000 description 1
- KLQLELHYCUTHSY-CQSZACIVSA-N (7r)-2-amino-7-[2-(2-ethoxy-1,3-thiazol-4-yl)-4-methoxyphenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OCC)=NC(C=2C(=CC=C(OC)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 KLQLELHYCUTHSY-CQSZACIVSA-N 0.000 description 1
- XREFELMPQYYTQL-CYBMUJFWSA-N (7r)-2-amino-7-[2-(2-ethoxy-1,3-thiazol-4-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OCC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 XREFELMPQYYTQL-CYBMUJFWSA-N 0.000 description 1
- JHPAFJTVQHGETR-GFCCVEGCSA-N (7r)-2-amino-7-[2-(2-methoxy-1,3-thiazol-4-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 JHPAFJTVQHGETR-GFCCVEGCSA-N 0.000 description 1
- BGTRYMGNQMHSTP-CQSZACIVSA-N (7r)-2-amino-7-[2-(4-ethoxy-5-fluoropyrimidin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(F)C(OCC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 BGTRYMGNQMHSTP-CQSZACIVSA-N 0.000 description 1
- UWFWRCHZCOUSLE-CQSZACIVSA-N (7r)-2-amino-7-[2-(4-methoxy-5-methylpyrimidin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(C)C(OC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 UWFWRCHZCOUSLE-CQSZACIVSA-N 0.000 description 1
- ABDXUMYYQCZDEM-OAHLLOKOSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)-4-ethoxyphenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OCC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CN=C(N)C(OCC)=N1 ABDXUMYYQCZDEM-OAHLLOKOSA-N 0.000 description 1
- KTNKZWOMALPZFU-CQSZACIVSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)-4-fluorophenyl]-4-ethyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(CC)N=C(N)N=C3C2)=C1 KTNKZWOMALPZFU-CQSZACIVSA-N 0.000 description 1
- CBHLHQSZYFOTRD-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 CBHLHQSZYFOTRD-CYBMUJFWSA-N 0.000 description 1
- VBTGUWFNLIKXPW-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 VBTGUWFNLIKXPW-CYBMUJFWSA-N 0.000 description 1
- ZKSUZLKXPDCNJT-CQSZACIVSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)-4-methoxyphenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=C(OC)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 ZKSUZLKXPDCNJT-CQSZACIVSA-N 0.000 description 1
- JRUMJUOFDGKDDW-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 JRUMJUOFDGKDDW-CYBMUJFWSA-N 0.000 description 1
- IYDOFVVWQDVBJL-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-amino-6-ethoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OCC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 IYDOFVVWQDVBJL-CYBMUJFWSA-N 0.000 description 1
- DZVNPRWMBZCFPD-CQSZACIVSA-N (7r)-2-amino-7-[2-(5-amino-6-ethylpyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(CC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 DZVNPRWMBZCFPD-CQSZACIVSA-N 0.000 description 1
- KWVBOJGVFKJJON-CQSZACIVSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyrazin-2-yl)-4-ethoxyphenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OCC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CN=C(N)C(OC)=N1 KWVBOJGVFKJJON-CQSZACIVSA-N 0.000 description 1
- YLEHSXNUGPZEFG-GFCCVEGCSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyrazin-2-yl)-4-fluorophenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 YLEHSXNUGPZEFG-GFCCVEGCSA-N 0.000 description 1
- ZOJAOSAXIHOMRQ-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyrazin-2-yl)phenyl]-4-ethyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2)CC)=CC=CC=C1C1=CN=C(N)C(OC)=N1 ZOJAOSAXIHOMRQ-CYBMUJFWSA-N 0.000 description 1
- XIXQWXAXKHFMOV-GFCCVEGCSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=C1 XIXQWXAXKHFMOV-GFCCVEGCSA-N 0.000 description 1
- MEGJRXVVTLBCOM-OAHLLOKOSA-N (7r)-2-amino-7-[2-(5-amino-6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(N)C(OC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 MEGJRXVVTLBCOM-OAHLLOKOSA-N 0.000 description 1
- CTCIDUPLFJLLEX-CYBMUJFWSA-N (7r)-2-amino-7-[2-(5-fluoro-4-methoxypyrimidin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(F)C(OC)=NC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 CTCIDUPLFJLLEX-CYBMUJFWSA-N 0.000 description 1
- GEVQNWGODDAVJD-OAHLLOKOSA-N (7r)-2-amino-7-[2-(6-ethoxypyrazin-2-yl)-4-fluorophenyl]-4-ethyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CN=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(CC)N=C(N)N=C3C2)=N1 GEVQNWGODDAVJD-OAHLLOKOSA-N 0.000 description 1
- AMCUQIOCNNSZOX-CQSZACIVSA-N (7r)-2-amino-7-[2-(6-ethoxypyrazin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CN=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 AMCUQIOCNNSZOX-CQSZACIVSA-N 0.000 description 1
- YZMLUOHUAMGPGS-MRXNPFEDSA-N (7r)-2-amino-7-[2-(6-ethoxypyridin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CCOC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 YZMLUOHUAMGPGS-MRXNPFEDSA-N 0.000 description 1
- KVFSDPAXFWZEOO-CYBMUJFWSA-N (7r)-2-amino-7-[2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C=2C(=CC=CC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 KVFSDPAXFWZEOO-CYBMUJFWSA-N 0.000 description 1
- DQKUYPMPRLSRJL-CQSZACIVSA-N (7r)-2-amino-7-[2-[5-(dimethylamino)-6-methoxypyrazin-2-yl]-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N(C)C)C(OC)=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 DQKUYPMPRLSRJL-CQSZACIVSA-N 0.000 description 1
- VAGCKOKNGOHQSF-CYBMUJFWSA-N (7r)-2-amino-7-[2-[6-methoxy-5-(methylamino)pyrazin-2-yl]phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(OC)C(NC)=NC=C1C1=CC=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 VAGCKOKNGOHQSF-CYBMUJFWSA-N 0.000 description 1
- WEUSISCDNLTZOA-CQSZACIVSA-N (7r)-2-amino-7-[2-methoxy-5-(6-methoxypyridin-2-yl)pyridin-4-yl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC(OC)=NC=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 WEUSISCDNLTZOA-CQSZACIVSA-N 0.000 description 1
- BNRHCGPVINGNTO-OAHLLOKOSA-N (7r)-2-amino-7-[4-ethoxy-2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OCC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CN=CC(OC)=N1 BNRHCGPVINGNTO-OAHLLOKOSA-N 0.000 description 1
- SDVZGIHLCGTWNP-QGZVFWFLSA-N (7r)-2-amino-7-[4-ethoxy-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OCC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CC=CC(OC)=N1 SDVZGIHLCGTWNP-QGZVFWFLSA-N 0.000 description 1
- DIXCCWDGZDGMDI-LJQANCHMSA-N (7r)-2-amino-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4-methyl-6-(2-methylpropyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CC(C)C)=CC=C(F)C=C1C1=CC=CN=C1F DIXCCWDGZDGMDI-LJQANCHMSA-N 0.000 description 1
- ARFDWRCGNZTJPI-HXUWFJFHSA-N (7r)-2-amino-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4-methyl-6-(3-methylbutyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2N(C(C3=C(C)N=C(N)N=C3C2)=O)CCC(C)C)=CC=C(F)C=C1C1=CC=CN=C1F ARFDWRCGNZTJPI-HXUWFJFHSA-N 0.000 description 1
- ZDVWPCBCFQRVOL-GFCCVEGCSA-N (7r)-2-amino-7-[4-fluoro-2-(2-methoxy-1,3-thiazol-5-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OC)=NC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 ZDVWPCBCFQRVOL-GFCCVEGCSA-N 0.000 description 1
- KALCIQWJZRPDNY-MRXNPFEDSA-N (7r)-2-amino-7-[4-fluoro-2-(2-methoxyphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 KALCIQWJZRPDNY-MRXNPFEDSA-N 0.000 description 1
- KDONHFIXUCEHJH-QGZVFWFLSA-N (7r)-2-amino-7-[4-fluoro-2-(2-methylphenyl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CC1=CC=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=CN=C(N)N=C2C1 KDONHFIXUCEHJH-QGZVFWFLSA-N 0.000 description 1
- RBWYWCZCZNEVKM-OAQYLSRUSA-N (7r)-2-amino-7-[4-fluoro-2-(4-methoxypyridin-3-yl)phenyl]-4-methyl-6-(3-methylbutyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=NC=C1C1=CC(F)=CC=C1[C@@H]1N(CCC(C)C)C(=O)C2=C(C)N=C(N)N=C2C1 RBWYWCZCZNEVKM-OAQYLSRUSA-N 0.000 description 1
- BKSRJXJPZGILQE-CYBMUJFWSA-N (7r)-2-amino-7-[4-fluoro-2-(4-methoxypyrimidin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=NC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 BKSRJXJPZGILQE-CYBMUJFWSA-N 0.000 description 1
- FJMVDJBVWSKJEB-LLVKDONJSA-N (7r)-2-amino-7-[4-fluoro-2-(5-methoxy-1,3,4-oxadiazol-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound O1C(OC)=NN=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 FJMVDJBVWSKJEB-LLVKDONJSA-N 0.000 description 1
- DKQUDOVNDMRXNZ-CYBMUJFWSA-N (7r)-2-amino-7-[4-fluoro-2-(5-methoxythiophen-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OC)=CC=C1C1=CC(F)=CC=C1[C@@H]1NC(=O)C2=C(C)N=C(N)N=C2C1 DKQUDOVNDMRXNZ-CYBMUJFWSA-N 0.000 description 1
- STAZCFCLXXNIAA-OAHLLOKOSA-N (7r)-2-amino-7-[4-fluoro-2-(6-methoxypyridin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)[C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 STAZCFCLXXNIAA-OAHLLOKOSA-N 0.000 description 1
- PCZWGGJYDYCWEC-CYBMUJFWSA-N (7r)-2-amino-7-[4-methoxy-2-(2-methoxy-1,3-thiazol-4-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound S1C(OC)=NC(C=2C(=CC=C(OC)C=2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 PCZWGGJYDYCWEC-CYBMUJFWSA-N 0.000 description 1
- ZPGUUZGAYYKKFF-CQSZACIVSA-N (7r)-2-amino-7-[4-methoxy-2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CN=CC(OC)=N1 ZPGUUZGAYYKKFF-CQSZACIVSA-N 0.000 description 1
- BMXFLWCPBQXDMF-MRXNPFEDSA-N (7r)-2-amino-7-[4-methoxy-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C=1C(OC)=CC=C([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)C=1C1=CC=CC(OC)=N1 BMXFLWCPBQXDMF-MRXNPFEDSA-N 0.000 description 1
- JXDONXDHVYVNCH-LLVKDONJSA-N (7r)-2-amino-7-[5-(6-methoxypyridin-2-yl)-1,3-thiazol-4-yl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C2=C(N=CS2)[C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 JXDONXDHVYVNCH-LLVKDONJSA-N 0.000 description 1
- OQKKRQPCMJBLIX-CQSZACIVSA-N (7r)-2-amino-7-[5-methoxy-2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=CC(OC)=CC=C1C1=CN=CC(OC)=N1 OQKKRQPCMJBLIX-CQSZACIVSA-N 0.000 description 1
- AWEGVLDBVCNAEF-CQSZACIVSA-N (7r)-2-amino-7-[5-methoxy-2-(6-methoxypyrazin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=CC(OC)=CC=C1C1=CN=CC(OC)=N1 AWEGVLDBVCNAEF-CQSZACIVSA-N 0.000 description 1
- ZILAGEBEZFRQBB-MRXNPFEDSA-N (7r)-2-amino-7-[5-methoxy-2-(6-methoxypyridin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=CC(OC)=CC=C1C1=CC=CC(OC)=N1 ZILAGEBEZFRQBB-MRXNPFEDSA-N 0.000 description 1
- AUQYWVAXPGOCIO-MRXNPFEDSA-N (7r)-2-amino-7-[5-methoxy-2-(6-methoxypyridin-2-yl)phenyl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1([C@@H]2NC(=O)C3=CN=C(N)N=C3C2)=CC(OC)=CC=C1C1=CC=CC(OC)=N1 AUQYWVAXPGOCIO-MRXNPFEDSA-N 0.000 description 1
- GZHQNPWPYAHOLX-VIFPVBQESA-N (7s)-2-amino-7-[5-(6-methoxypyrazin-2-yl)-1,3-thiazol-4-yl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C2=C(N=CS2)[C@H]2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 GZHQNPWPYAHOLX-VIFPVBQESA-N 0.000 description 1
- PQJPOCLJLUWHRQ-VIFPVBQESA-N (7s)-2-amino-7-[5-(6-methoxypyrazin-2-yl)-1,3-thiazol-4-yl]-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C2=C(N=CS2)[C@H]2NC(=O)C3=CN=C(N)N=C3C2)=N1 PQJPOCLJLUWHRQ-VIFPVBQESA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- FBZVZUSVGKOWHG-UHFFFAOYSA-N 1,1-dimethoxy-n,n-dimethylethanamine Chemical compound COC(C)(OC)N(C)C FBZVZUSVGKOWHG-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- VUQPJRPDRDVQMN-UHFFFAOYSA-N 1-chlorooctadecane Chemical class CCCCCCCCCCCCCCCCCCCl VUQPJRPDRDVQMN-UHFFFAOYSA-N 0.000 description 1
- INMMVHOKQLWAQU-UHFFFAOYSA-N 1-phenyl-2-(trifluoromethoxy)benzene Chemical group FC(F)(F)OC1=CC=CC=C1C1=CC=CC=C1 INMMVHOKQLWAQU-UHFFFAOYSA-N 0.000 description 1
- ABEXEQSGABRUHS-UHFFFAOYSA-N 16-methylheptadecyl 16-methylheptadecanoate Chemical compound CC(C)CCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C ABEXEQSGABRUHS-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- PVDXPAQPUDMIHE-UHFFFAOYSA-N 2-amino-6h-quinazolin-5-one Chemical class O=C1CC=CC2=NC(N)=NC=C21 PVDXPAQPUDMIHE-UHFFFAOYSA-N 0.000 description 1
- FXAVANFIFOFYHS-UHFFFAOYSA-N 2-amino-7-(4-fluoro-2-isoquinolin-4-ylphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=CC=C2C(C3=CC(F)=CC=C3C3CC=4N=C(N)N=C(C=4C(=O)N3)C)=CN=CC2=C1 FXAVANFIFOFYHS-UHFFFAOYSA-N 0.000 description 1
- AQTHBOYUWXXYOS-UHFFFAOYSA-N 2-amino-7-(4-fluoro-2-pyridin-4-ylphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=NC=C1 AQTHBOYUWXXYOS-UHFFFAOYSA-N 0.000 description 1
- DVMJXLNSOIVORZ-UHFFFAOYSA-N 2-amino-7-(4-fluoro-2-pyrimidin-5-ylphenyl)-4-methyl-6-(2-methyl-2-morpholin-4-ylpropyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound O=C1C=2C(C)=NC(N)=NC=2CC(C=2C(=CC(F)=CC=2)C=2C=NC=NC=2)N1CC(C)(C)N1CCOCC1 DVMJXLNSOIVORZ-UHFFFAOYSA-N 0.000 description 1
- PRGHXJMHSDQVHH-UHFFFAOYSA-N 2-amino-7-(4-fluoro-2-pyrimidin-5-ylphenyl)-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CN=CN=C1 PRGHXJMHSDQVHH-UHFFFAOYSA-N 0.000 description 1
- NTKVRCIELNMDPF-UHFFFAOYSA-N 2-amino-7-[2-(2,3-difluorophenyl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=CC(F)=C1F NTKVRCIELNMDPF-UHFFFAOYSA-N 0.000 description 1
- OHOBYWNLUGGBQO-UHFFFAOYSA-N 2-amino-7-[2-(2,4-dimethoxypyrimidin-5-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=NC(OC)=NC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 OHOBYWNLUGGBQO-UHFFFAOYSA-N 0.000 description 1
- MFRURRAHDNVPHP-UHFFFAOYSA-N 2-amino-7-[2-(5,6-dimethoxypyrazin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(OC)C(OC)=NC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 MFRURRAHDNVPHP-UHFFFAOYSA-N 0.000 description 1
- UBZCNOJGKIKFTO-UHFFFAOYSA-N 2-amino-7-[2-(5-amino-6-methoxypyrazin-2-yl)-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1=C(N)C(OC)=NC(C=2C(=CC=C(F)C=2)C2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 UBZCNOJGKIKFTO-UHFFFAOYSA-N 0.000 description 1
- KVFSDPAXFWZEOO-UHFFFAOYSA-N 2-amino-7-[2-(6-methoxypyrazin-2-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C=2C(=CC=CC=2)C2NC(=O)C3=C(C)N=C(N)N=C3C2)=N1 KVFSDPAXFWZEOO-UHFFFAOYSA-N 0.000 description 1
- WPAKYFRRJKSQHA-UHFFFAOYSA-N 2-amino-7-[2-[3-(dimethylamino)phenyl]-4-fluorophenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound CN(C)C1=CC=CC(C=2C(=CC=C(F)C=2)C2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 WPAKYFRRJKSQHA-UHFFFAOYSA-N 0.000 description 1
- JFEZWANDJWKPAJ-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(1h-pyrazol-4-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C=1C=NNC=1 JFEZWANDJWKPAJ-UHFFFAOYSA-N 0.000 description 1
- NWKNBEFKUXQRIO-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(2-fluoro-3-methoxyphenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)C2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1F NWKNBEFKUXQRIO-UHFFFAOYSA-N 0.000 description 1
- LUNWZWXZXHKXOA-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(2-fluoro-4-methylphenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound FC1=CC(C)=CC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 LUNWZWXZXHKXOA-UHFFFAOYSA-N 0.000 description 1
- PVZCGRBRAASWEV-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(2-fluoropyridin-3-yl)phenyl]-4,6-dimethyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound C1C2=NC(N)=NC(C)=C2C(=O)N(C)C1C1=CC=C(F)C=C1C1=CC=CN=C1F PVZCGRBRAASWEV-UHFFFAOYSA-N 0.000 description 1
- RHHRRWJSNDAWBM-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(2-methoxyphenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 RHHRRWJSNDAWBM-UHFFFAOYSA-N 0.000 description 1
- WMSAAXRBCSCNCY-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(2-methoxypyridin-3-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=NC=CC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 WMSAAXRBCSCNCY-UHFFFAOYSA-N 0.000 description 1
- ZTMFJEZCHKFSND-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound C1=C(F)C(OC)=CC=C1C1=CC(F)=CC=C1C1NC(=O)C2=C(C)N=C(N)N=C2C1 ZTMFJEZCHKFSND-UHFFFAOYSA-N 0.000 description 1
- PHNNBFXVXJNABN-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(3-methoxyphenyl)phenyl]-4-methyl-6-(2-methyl-2-morpholin-4-ylpropyl)-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)C2N(C(=O)C3=C(C)N=C(N)N=C3C2)CC(C)(C)N2CCOCC2)=C1 PHNNBFXVXJNABN-UHFFFAOYSA-N 0.000 description 1
- YJAZXDXAFAHDLS-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(3-methoxyphenyl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CC=CC(C=2C(=CC=C(F)C=2)C2NC(=O)C3=C(C)N=C(N)N=C3C2)=C1 YJAZXDXAFAHDLS-UHFFFAOYSA-N 0.000 description 1
- KIGITIURLJJEQT-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(6-fluoropyridin-3-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=C(F)N=C1 KIGITIURLJJEQT-UHFFFAOYSA-N 0.000 description 1
- GVIKWYBDIQVJLH-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(6-methoxypyrazin-2-yl)phenyl]-4,6-dimethyl-7,8-dihydropyrido[4,3-d]pyrimidin-5-one Chemical compound COC1=CN=CC(C=2C(=CC=C(F)C=2)C2N(C(=O)C3=C(C)N=C(N)N=C3C2)C)=N1 GVIKWYBDIQVJLH-UHFFFAOYSA-N 0.000 description 1
- IDKVDSGENDULKC-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-(furan-3-yl)phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C=1C=COC=1 IDKVDSGENDULKC-UHFFFAOYSA-N 0.000 description 1
- IZLYWWWDFCDFCR-UHFFFAOYSA-N 2-amino-7-[4-fluoro-2-[2-(trifluoromethyl)phenyl]phenyl]-4-methyl-7,8-dihydro-6h-pyrido[4,3-d]pyrimidin-5-one Chemical compound N1C(=O)C=2C(C)=NC(N)=NC=2CC1C1=CC=C(F)C=C1C1=CC=CC=C1C(F)(F)F IZLYWWWDFCDFCR-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- MNQVIZWWCRPZOK-UHFFFAOYSA-N 2-bromo-1,3-thiazole-4-carbaldehyde Chemical compound BrC1=NC(C=O)=CS1 MNQVIZWWCRPZOK-UHFFFAOYSA-N 0.000 description 1
- OPZDXMCOWFPQPE-UHFFFAOYSA-N 2-bromo-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C(Br)=C1 OPZDXMCOWFPQPE-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- IEEHKTFVUIVORU-UHFFFAOYSA-N 2-methylpropanedioyl dichloride Chemical compound ClC(=O)C(C)C(Cl)=O IEEHKTFVUIVORU-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical class BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- MZSAMHOCTRNOIZ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylaniline Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(NC2=CC=CC=C2)C=CC=1 MZSAMHOCTRNOIZ-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- KLYMGKOWQHWBRE-UHFFFAOYSA-N 5,6-dihydropyrido[4,3-d]pyrimidine Chemical compound C1=NC=C2CNC=CC2=N1 KLYMGKOWQHWBRE-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- 102100038222 60 kDa heat shock protein, mitochondrial Human genes 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical group CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 102000036365 BRCA1 Human genes 0.000 description 1
- 108700020463 BRCA1 Proteins 0.000 description 1
- 102100021663 Baculoviral IAP repeat-containing protein 5 Human genes 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- 206010007572 Cardiac hypertrophy Diseases 0.000 description 1
- 208000006029 Cardiomegaly Diseases 0.000 description 1
- 102000053642 Catalytic RNA Human genes 0.000 description 1
- 108090000994 Catalytic RNA Proteins 0.000 description 1
- 229940123587 Cell cycle inhibitor Drugs 0.000 description 1
- 108010058432 Chaperonin 60 Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 238000003512 Claisen condensation reaction Methods 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 description 1
- 108010025468 Cyclin-Dependent Kinase 6 Proteins 0.000 description 1
- 102100036252 Cyclin-dependent kinase 4 Human genes 0.000 description 1
- 102100026804 Cyclin-dependent kinase 6 Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000006228 Dieckmann condensation reaction Methods 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 206010059866 Drug resistance Diseases 0.000 description 1
- 102000000564 Elongation Factor 2 Kinase Human genes 0.000 description 1
- 108010016831 Elongation Factor 2 Kinase Proteins 0.000 description 1
- 102400001368 Epidermal growth factor Human genes 0.000 description 1
- 101800003838 Epidermal growth factor Proteins 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 102000007665 Extracellular Signal-Regulated MAP Kinases Human genes 0.000 description 1
- 108010007457 Extracellular Signal-Regulated MAP Kinases Proteins 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000034951 Genetic Translocation Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 102100026973 Heat shock protein 75 kDa, mitochondrial Human genes 0.000 description 1
- 101710130649 Heat shock protein 75 kDa, mitochondrial Proteins 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- 101000851376 Homo sapiens Tumor necrosis factor receptor superfamily member 8 Proteins 0.000 description 1
- 101150065069 Hsp90b1 gene Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010021143 Hypoxia Diseases 0.000 description 1
- 102000016878 Hypoxia-Inducible Factor 1 Human genes 0.000 description 1
- 108010028501 Hypoxia-Inducible Factor 1 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102100039688 Insulin-like growth factor 1 receptor Human genes 0.000 description 1
- 101710184277 Insulin-like growth factor 1 receptor Proteins 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- 108010002350 Interleukin-2 Proteins 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 241000764238 Isis Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 108091054455 MAP kinase family Proteins 0.000 description 1
- 102000043136 MAP kinase family Human genes 0.000 description 1
- 229940124647 MEK inhibitor Drugs 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZRVUJXDFFKFLMG-UHFFFAOYSA-N Meloxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=NC=C(C)S1 ZRVUJXDFFKFLMG-UHFFFAOYSA-N 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 241001529936 Murinae Species 0.000 description 1
- 101100335081 Mus musculus Flt3 gene Proteins 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- 150000001204 N-oxides Chemical group 0.000 description 1
- KTDZCOWXCWUPEO-UHFFFAOYSA-N NS-398 Chemical compound CS(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1OC1CCCCC1 KTDZCOWXCWUPEO-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 230000006179 O-acylation Effects 0.000 description 1
- PDWMCQIPVQIJCG-UHFFFAOYSA-N OBO.COC1=CN=CC(B(O)O)=N1 Chemical compound OBO.COC1=CN=CC(B(O)O)=N1 PDWMCQIPVQIJCG-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 108010058765 Oncogene Protein pp60(v-src) Proteins 0.000 description 1
- 238000003684 Perkin reaction Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 1
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 1
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 description 1
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 208000000102 Squamous Cell Carcinoma of Head and Neck Diseases 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 108010002687 Survivin Proteins 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 101710204707 Transforming growth factor-beta receptor-associated protein 1 Proteins 0.000 description 1
- 102100036857 Tumor necrosis factor receptor superfamily member 8 Human genes 0.000 description 1
- 108090000848 Ubiquitin Proteins 0.000 description 1
- 102000044159 Ubiquitin Human genes 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N acetaldehyde dimethyl acetal Natural products COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- 230000003044 adaptive effect Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 238000012387 aerosolization Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005277 alkyl imino group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 229940124650 anti-cancer therapies Drugs 0.000 description 1
- 230000000340 anti-metabolite Effects 0.000 description 1
- 230000001446 anti-myeloma Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 1
- 238000011319 anticancer therapy Methods 0.000 description 1
- 229940100197 antimetabolite Drugs 0.000 description 1
- 239000002256 antimetabolite Substances 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000005126 aryl alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 1
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical compound [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 102000004441 bcr-abl Fusion Proteins Human genes 0.000 description 1
- 108010056708 bcr-abl Fusion Proteins Proteins 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000012148 binding buffer Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 229940088954 camptosar Drugs 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 239000003560 cancer drug Substances 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- OKTJSMMVPCPJKN-YPZZEJLDSA-N carbon-10 atom Chemical compound [10C] OKTJSMMVPCPJKN-YPZZEJLDSA-N 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- YAYRGNWWLMLWJE-UHFFFAOYSA-L carboplatin Chemical compound O=C1O[Pt](N)(N)OC(=O)C11CCC1 YAYRGNWWLMLWJE-UHFFFAOYSA-L 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 230000005961 cardioprotection Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 230000004637 cellular stress Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229940106189 ceramide Drugs 0.000 description 1
- 150000001783 ceramides Chemical class 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 238000012866 crystallographic experiment Methods 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 150000001923 cyclic compounds Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- SNRCKKQHDUIRIY-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloromethane;dichloropalladium;iron(2+) Chemical compound [Fe+2].ClCCl.Cl[Pd]Cl.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.C1=C[CH-]C(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 SNRCKKQHDUIRIY-UHFFFAOYSA-L 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000011393 cytotoxic chemotherapy Methods 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- GAFRWLVTHPVQGK-UHFFFAOYSA-N dipentyl sulfate Chemical class CCCCCOS(=O)(=O)OCCCCC GAFRWLVTHPVQGK-UHFFFAOYSA-N 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 230000002222 downregulating effect Effects 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 229940116977 epidermal growth factor Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 102000015694 estrogen receptors Human genes 0.000 description 1
- 108010038795 estrogen receptors Proteins 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- DBEPLOCGEIEOCV-WSBQPABSSA-N finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 1
- 229960004039 finasteride Drugs 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 238000002875 fluorescence polarization Methods 0.000 description 1
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 1
- 229960002074 flutamide Drugs 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 1
- 229960002584 gefitinib Drugs 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960003297 gemtuzumab ozogamicin Drugs 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004992 haloalkylamino group Chemical group 0.000 description 1
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 1
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 1
- 210000004124 hock Anatomy 0.000 description 1
- 238000011905 homologation Methods 0.000 description 1
- 208000018819 hormone-resistant breast carcinoma Diseases 0.000 description 1
- 150000007857 hydrazones Chemical group 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- PQPVPZTVJLXQAS-UHFFFAOYSA-N hydroxy-methyl-phenylsilicon Chemical compound C[Si](O)C1=CC=CC=C1 PQPVPZTVJLXQAS-UHFFFAOYSA-N 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 238000005417 image-selected in vivo spectroscopy Methods 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 150000003949 imides Chemical group 0.000 description 1
- 150000002466 imines Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 239000000367 immunologic factor Substances 0.000 description 1
- 238000009169 immunotherapy Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000012739 integrated shape imaging system Methods 0.000 description 1
- 229940047124 interferons Drugs 0.000 description 1
- 229940047122 interleukins Drugs 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 208000037906 ischaemic injury Diseases 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 229960004125 ketoconazole Drugs 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229960001929 meloxicam Drugs 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- BMGQWWVMWDBQGC-IIFHNQTCSA-N midostaurin Chemical compound CN([C@H]1[C@H]([C@]2(C)O[C@@H](N3C4=CC=CC=C4C4=C5C(=O)NCC5=C5C6=CC=CC=C6N2C5=C43)C1)OC)C(=O)C1=CC=CC=C1 BMGQWWVMWDBQGC-IIFHNQTCSA-N 0.000 description 1
- 229950010895 midostaurin Drugs 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000002829 mitogen activated protein kinase inhibitor Substances 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000004112 neuroprotection Effects 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000004650 oncogenic pathway Effects 0.000 description 1
- 230000006712 oncogenic signaling pathway Effects 0.000 description 1
- 230000006548 oncogenic transformation Effects 0.000 description 1
- 230000000771 oncological effect Effects 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 150000002923 oximes Chemical group 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- FWZRWHZDXBDTFK-ZHACJKMWSA-N panobinostat Chemical compound CC1=NC2=CC=C[CH]C2=C1CCNCC1=CC=C(\C=C\C(=O)NO)C=C1 FWZRWHZDXBDTFK-ZHACJKMWSA-N 0.000 description 1
- 229960005184 panobinostat Drugs 0.000 description 1
- 210000004197 pelvis Anatomy 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 150000008105 phosphatidylcholines Chemical class 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 230000003234 polygenic effect Effects 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 238000010837 poor prognosis Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- 230000004845 protein aggregation Effects 0.000 description 1
- 230000012846 protein folding Effects 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000004941 pyridazin-5-yl group Chemical group N1=NC=CC(=C1)* 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 102000009929 raf Kinases Human genes 0.000 description 1
- 108010077182 raf Kinases Proteins 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 1
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 230000003362 replicative effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 229930002330 retinoic acid Natural products 0.000 description 1
- 108091092562 ribozyme Proteins 0.000 description 1
- ATEBXHFBFRCZMA-VXTBVIBXSA-N rifabutin Chemical compound O([C@](C1=O)(C)O/C=C/[C@@H]([C@H]([C@@H](OC(C)=O)[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)\C=C\C=C(C)/C(=O)NC(=C2N3)C(=O)C=4C(O)=C5C)C)OC)C5=C1C=4C2=NC13CCN(CC(C)C)CC1 ATEBXHFBFRCZMA-VXTBVIBXSA-N 0.000 description 1
- 229960000885 rifabutin Drugs 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 108091006024 signal transducing proteins Proteins 0.000 description 1
- 102000034285 signal transducing proteins Human genes 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 150000003457 sulfones Chemical group 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000002198 surface plasmon resonance spectroscopy Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229950007866 tanespimycin Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XORCKRYJJZITCJ-QGZVFWFLSA-N tert-butyl n-[3-[(7r)-2-amino-7-(2-bromo-4-fluorophenyl)-4-methyl-5-oxo-7,8-dihydropyrido[4,3-d]pyrimidin-6-yl]propyl]carbamate Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2CCCNC(=O)OC(C)(C)C)C)=CC=C(F)C=C1Br XORCKRYJJZITCJ-QGZVFWFLSA-N 0.000 description 1
- PEBJOMJDRGXVDW-JOCHJYFZSA-N tert-butyl n-[3-[(7r)-2-amino-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-oxo-7,8-dihydropyrido[4,3-d]pyrimidin-6-yl]propyl]carbamate Chemical compound C1([C@H]2CC=3N=C(N)N=C(C=3C(=O)N2CCCNC(=O)OC(C)(C)C)C)=CC=C(F)C=C1C1=CC=CN=C1 PEBJOMJDRGXVDW-JOCHJYFZSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 230000026683 transduction Effects 0.000 description 1
- 238000010361 transduction Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003827 upregulation Effects 0.000 description 1
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 239000011534 wash buffer Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/86—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US72279605P | 2005-09-30 | 2005-09-30 | |
| US83688606P | 2006-08-09 | 2006-08-09 | |
| PCT/US2006/038181 WO2007041362A1 (en) | 2005-09-30 | 2006-09-28 | 2-amino-7,8-dihydro-6h-pyrido[4,3-d] pyrimidin-5-ones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ566914A true NZ566914A (en) | 2011-09-30 |
Family
ID=37661234
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ566914A NZ566914A (en) | 2005-09-30 | 2006-09-28 | 2-amino-7, 8-dihydro-6H-pyrido[4,3-d] pyrimidin-5-ones |
Country Status (31)
| Country | Link |
|---|---|
| US (2) | US7671059B2 (https=) |
| EP (1) | EP1928875B1 (https=) |
| JP (2) | JP5036002B2 (https=) |
| KR (1) | KR101311757B1 (https=) |
| AR (1) | AR058072A1 (https=) |
| AT (1) | ATE514694T1 (https=) |
| AU (1) | AU2006297124B2 (https=) |
| BR (1) | BRPI0616701A2 (https=) |
| CA (1) | CA2624253C (https=) |
| CR (1) | CR9846A (https=) |
| CY (1) | CY1112028T1 (https=) |
| DK (1) | DK1928875T3 (https=) |
| EA (1) | EA016152B1 (https=) |
| EC (1) | ECSP088324A (https=) |
| GE (1) | GEP20115231B (https=) |
| HR (1) | HRP20110655T1 (https=) |
| IL (1) | IL190446A0 (https=) |
| JO (1) | JO2783B1 (https=) |
| MA (1) | MA29885B1 (https=) |
| ME (1) | ME01952B (https=) |
| MY (1) | MY143604A (https=) |
| NO (1) | NO342258B1 (https=) |
| NZ (1) | NZ566914A (https=) |
| PE (1) | PE20070621A1 (https=) |
| PL (1) | PL1928875T3 (https=) |
| PT (1) | PT1928875E (https=) |
| RS (1) | RS51795B (https=) |
| SM (1) | SMAP200800029A (https=) |
| TN (1) | TNSN08143A1 (https=) |
| TW (1) | TWI373471B (https=) |
| WO (1) | WO2007041362A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2629599C1 (ru) * | 2016-09-28 | 2017-08-30 | Государственное бюджетное учреждение здравоохранения Московской области "Московский областной научно-исследовательский клинический институт им. М.Ф. Владимирского" (ГБУЗ МО МОНИКИ им. М.Ф. Владимирского) | Способ химиолучевого лечения опухолей прямой кишки и анального канала |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CL2007002994A1 (es) * | 2006-10-19 | 2008-02-08 | Wyeth Corp | Compuestos derivados heterociclicos que contienen sulfamoilo, inhibidores de hsp90; composicion farmaceutica; y uso para el tratamiento del cancer, tal como cancer de mama, de colon y prostata, entre otros. |
| CN101225083A (zh) * | 2007-01-16 | 2008-07-23 | 北京摩力克科技有限公司 | 四氢喹唑啉酮类化合物及其用于制备治疗和预防病毒性疾病的药物的用途 |
| GB2449293A (en) | 2007-05-17 | 2008-11-19 | Evotec | Compounds having Hsp90 inhibitory activity |
| SG187502A1 (en) | 2008-02-01 | 2013-02-28 | Takeda Pharmaceutical | Oxim derivatives as hsp90 inhibitors |
| EP2334379A2 (en) | 2008-09-26 | 2011-06-22 | INSERM (Institut National de la Santé et de la Recherche Médicale) | Host cell kinases as targets for antiviral therapies against hcv infection |
| EP2370103B1 (en) * | 2008-11-28 | 2016-03-23 | Novartis AG | Pharmaceutical combinations comprising an isoxazole derived hsp90-inhibitor and the her2 inhibitor trastuzumab |
| BRPI0924107A2 (pt) | 2008-11-28 | 2019-09-24 | Novartis Ag | inibidores de hsp90 para tratamento terapêutico |
| MA32934B1 (fr) * | 2008-11-28 | 2012-01-02 | Novartis Ag | Combinaisons inhibitrices hsp90 |
| AR075180A1 (es) * | 2009-01-29 | 2011-03-16 | Novartis Ag | Formulaciones orales solidas de una pirido-pirimidinona |
| AR077405A1 (es) | 2009-07-10 | 2011-08-24 | Sanofi Aventis | Derivados del indol inhibidores de hsp90, composiciones que los contienen y utilizacion de los mismos para el tratamiento del cancer |
| FR2949467B1 (fr) | 2009-09-03 | 2011-11-25 | Sanofi Aventis | Nouveaux derives de 5,6,7,8-tetrahydroindolizine inhibiteurs d'hsp90, compositions les contenant et utilisation |
| MX2012004846A (es) * | 2009-10-29 | 2012-10-05 | Genosco | Inhibidores de cinasa. |
| WO2012104823A2 (en) | 2011-02-04 | 2012-08-09 | Novartis Ag | Pyridopyrimidinone compounds in the treatment of neurodegenerative diseases |
| RU2624493C2 (ru) | 2011-10-14 | 2017-07-04 | Новартис Аг | 2-КАРБОКСАМИД ЦИКЛОАМИНО ПРОИЗВОДНЫЕ МОЧЕВИНЫ В КОМБИНАЦИИ С ИНГИБИТОРАМИ Hsp90 ДЛЯ ЛЕЧЕНИЯ ПРОЛИФЕРАТИВНЫХ ЗАБОЛЕВАНИЙ |
| ITTO20111013A1 (it) | 2011-11-03 | 2013-05-04 | Dac Srl | Composti farmaceutici |
| CN103664938A (zh) * | 2012-09-12 | 2014-03-26 | 山东亨利医药科技有限责任公司 | 含有嘧啶并环的syk抑制剂 |
| EP2916841A1 (en) | 2012-11-07 | 2015-09-16 | Novartis AG | Combination therapy |
| US9677907B2 (en) * | 2013-03-14 | 2017-06-13 | Itron Inc | Intelligent receptacle |
| GB201306610D0 (en) * | 2013-04-11 | 2013-05-29 | Almac Discovery Ltd | Pharmaceutical compounds |
| RU2657783C2 (ru) | 2013-09-30 | 2018-06-15 | Тайхо Фармасьютикал Ко., Лтд. | Комбинированная терапия с использованием азабициклосоединения для ракового заболевания |
| EP3189051A1 (en) * | 2014-09-02 | 2017-07-12 | Pierre Fabre Médicament | Isoquinolinone derivatives useful in the treatment of cancer |
| KR20160035411A (ko) * | 2014-09-23 | 2016-03-31 | 주식회사 오스코텍 | LRRK2 (Leucine Rich Repeat Kinase 2) 키나제 억제제로서의 피리도피리미딘 유도체 화합물 |
| KR101653560B1 (ko) * | 2016-02-02 | 2016-09-12 | 한국화학연구원 | 신규한 화합물 또는 이의 약학적으로 허용가능한 염, 및 이를 유효성분으로 함유하는 인플루엔자 바이러스 감염으로 인한 질환의 예방 또는 치료용 약학적 조성물 |
| KR20250007021A (ko) | 2017-06-09 | 2025-01-13 | 추가이 세이야쿠 가부시키가이샤 | N-치환 아미노산을 포함하는 펩타이드의 합성 방법 |
| CN115916752B (zh) * | 2020-06-26 | 2025-05-06 | 日本农药株式会社 | 芳基四氢吡啶衍生物或其盐类、和含有该化合物的杀虫剂及其使用方法 |
| EP4310084A4 (en) * | 2021-03-08 | 2025-06-25 | Jinan University | Pyridopyrimidine-based compound and use thereof |
| WO2026027375A1 (de) | 2024-07-29 | 2026-02-05 | Bayer Aktiengesellschaft | Hydroxy-dihydropyridinon carboxamide als schädlingsbekämpfungsmittel |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6165873A (ja) * | 1984-09-07 | 1986-04-04 | Mitsui Petrochem Ind Ltd | 2−ピペラジノピリミジン誘導体 |
| US4734418A (en) * | 1984-12-14 | 1988-03-29 | Mitsui Petrochemical Industries, Ltd. | Quinazoline compounds and antihypertensives |
| IL85347A0 (en) * | 1987-02-11 | 1988-07-31 | May & Baker Ltd | Cyclic diones |
| DE60206363T2 (de) * | 2001-02-12 | 2006-07-06 | F. Hoffmann-La Roche Ag | 6-substituierte pyridopyrimidine |
| DE102004018198A1 (de) * | 2004-04-15 | 2005-11-03 | Merck Patent Gmbh | Sulfonamide |
| WO2006045010A2 (en) | 2004-10-20 | 2006-04-27 | Resverlogix Corp. | Stilbenes and chalcones for the prevention and treatment of cardiovascular diseases |
| WO2006074293A2 (en) * | 2005-01-07 | 2006-07-13 | President And Fellows Of Harvard College | Bicyclic dihydropyrimidines as eg5 inhibitors |
| BRPI0609309A2 (pt) * | 2005-04-14 | 2010-03-09 | Novartis Vaccines & Diagnostic | 2-amino-quinazolin-5-onas como inibidores hsp90 com utilidade no tratamento de doenças proliferativas |
-
2006
- 2006-09-26 JO JO2006335A patent/JO2783B1/en active
- 2006-09-28 PL PL06825272T patent/PL1928875T3/pl unknown
- 2006-09-28 EP EP06825272A patent/EP1928875B1/en active Active
- 2006-09-28 CA CA2624253A patent/CA2624253C/en not_active Expired - Fee Related
- 2006-09-28 DK DK06825272.5T patent/DK1928875T3/da active
- 2006-09-28 ME MEP-2011-334A patent/ME01952B/me unknown
- 2006-09-28 AU AU2006297124A patent/AU2006297124B2/en not_active Ceased
- 2006-09-28 PT PT06825272T patent/PT1928875E/pt unknown
- 2006-09-28 RS RS20110334A patent/RS51795B/sr unknown
- 2006-09-28 SM SM200800029T patent/SMAP200800029A/it unknown
- 2006-09-28 KR KR1020087010134A patent/KR101311757B1/ko not_active Expired - Fee Related
- 2006-09-28 BR BRPI0616701-2A patent/BRPI0616701A2/pt not_active IP Right Cessation
- 2006-09-28 GE GEAP200610671A patent/GEP20115231B/en unknown
- 2006-09-28 AT AT06825272T patent/ATE514694T1/de active
- 2006-09-28 NZ NZ566914A patent/NZ566914A/en not_active IP Right Cessation
- 2006-09-28 WO PCT/US2006/038181 patent/WO2007041362A1/en not_active Ceased
- 2006-09-28 EA EA200800992A patent/EA016152B1/ru not_active IP Right Cessation
- 2006-09-28 JP JP2008533697A patent/JP5036002B2/ja not_active Expired - Fee Related
- 2006-09-28 MY MYPI20080862A patent/MY143604A/en unknown
- 2006-09-28 US US11/541,462 patent/US7671059B2/en active Active
- 2006-09-28 HR HR20110655T patent/HRP20110655T1/hr unknown
- 2006-09-28 PE PE2006001177A patent/PE20070621A1/es not_active Application Discontinuation
- 2006-09-28 AR ARP060104292A patent/AR058072A1/es unknown
- 2006-09-29 TW TW095136162A patent/TWI373471B/zh not_active IP Right Cessation
-
2008
- 2008-03-26 IL IL190446A patent/IL190446A0/en not_active IP Right Cessation
- 2008-03-28 EC EC2008008324A patent/ECSP088324A/es unknown
- 2008-03-28 TN TNP2008000143A patent/TNSN08143A1/en unknown
- 2008-03-28 CR CR9846A patent/CR9846A/es unknown
- 2008-04-24 MA MA30873A patent/MA29885B1/fr unknown
- 2008-04-30 NO NO20082069A patent/NO342258B1/no not_active IP Right Cessation
-
2009
- 2009-07-31 US US12/462,302 patent/US20100004237A1/en not_active Abandoned
-
2011
- 2011-08-09 CY CY20111100758T patent/CY1112028T1/el unknown
-
2012
- 2012-05-25 JP JP2012119613A patent/JP2012158611A/ja not_active Withdrawn
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2629599C1 (ru) * | 2016-09-28 | 2017-08-30 | Государственное бюджетное учреждение здравоохранения Московской области "Московский областной научно-исследовательский клинический институт им. М.Ф. Владимирского" (ГБУЗ МО МОНИКИ им. М.Ф. Владимирского) | Способ химиолучевого лечения опухолей прямой кишки и анального канала |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ566914A (en) | 2-amino-7, 8-dihydro-6H-pyrido[4,3-d] pyrimidin-5-ones | |
| CN116332948A (zh) | 一种含氮四环化合物及其制备方法和药用用途 | |
| CN110418789B (zh) | 作为治疗剂的N-环烷基/杂环烷基-4-(咪唑并[1,2-a]吡啶)嘧啶-2-胺的衍生物 | |
| US20040132730A1 (en) | Inhibitors of TGFbeta | |
| CA3005658A1 (en) | Modulators of ror-gamma | |
| JP2022545930A (ja) | Fgfr阻害剤とするピラゾール類誘導体及びその調製方法 | |
| RS60629B1 (sr) | Jedinjenja indol karboksamida korisna kao inhibitori kinaze | |
| JP2008536867A (ja) | 増殖疾患を処置する際に有用なhsp90インヒビターとしての2−アミノ−キナゾリン−5−オン | |
| KR20190016976A (ko) | Pi3k 베타 저해제로서의 아자벤즈이미다졸 유도체 | |
| JP2012529513A (ja) | トリアジン誘導体類及びそれらの治療応用 | |
| JP2007507466A (ja) | 誘導性noシンターゼ阻害剤としてのイミダゾピリジン誘導体 | |
| CN101287734B (zh) | 2-氨基-7,8-二氢-6H-吡啶并[4,3-d]嘧啶-5-酮 | |
| ES2369707T3 (es) | 2-amino-7,8-dihidro-6h-pirido(4,3-d)pirimidin-5-onas, procedimiento para su preparación y composiciones farmacéuticas que contienen las mismas. | |
| HK1118823B (en) | 2-amino-7,8-dihydro-6h-pyrido(4,3-d)pyrimidin-5-ones, process for their preparation and pharmaceutical compositions containing the same | |
| HK1123801A (zh) | 2-氨基-7,8-二氢-6h-吡啶并[4,3-d]嘧啶-5-酮 | |
| HK40083035A (en) | Parp7 inhibitor and use thereof | |
| HK1122275A (en) | 2-amino-quinazolin-5-ones as hsp90 inhibitors useful in treating proliferation diseases | |
| HK1096549B (en) | Imidazopyridine-derivatives as inducible no-synthase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PSEA | Patent sealed | ||
| RENW | Renewal (renewal fees accepted) | ||
| RENW | Renewal (renewal fees accepted) |
Free format text: PATENT RENEWED FOR 3 YEARS UNTIL 28 SEP 2016 BY CPA GLOBAL Effective date: 20130815 |
|
| ERR | Error or correction |
Free format text: THE OWNER HAS BEEN CORRECTED TO 890887, NOVARTIS AG, LICHTSTRASSE 35, CH-4056 BASEL, CH Effective date: 20140409 |
|
| RENW | Renewal (renewal fees accepted) |
Free format text: PATENT RENEWED FOR 3 YEARS UNTIL 28 SEP 2019 BY CPA GLOBAL Effective date: 20140910 |
|
| LAPS | Patent lapsed |