NO971134L - Derivater av 2-amino-1,2,3,4-tetrahydronaftalen som er aktive på det kardiovaskulære system - Google Patents
Derivater av 2-amino-1,2,3,4-tetrahydronaftalen som er aktive på det kardiovaskulære systemInfo
- Publication number
- NO971134L NO971134L NO971134A NO971134A NO971134L NO 971134 L NO971134 L NO 971134L NO 971134 A NO971134 A NO 971134A NO 971134 A NO971134 A NO 971134A NO 971134 L NO971134 L NO 971134L
- Authority
- NO
- Norway
- Prior art keywords
- tetrahydro
- mmol
- propyl
- solution
- naphthylamine
- Prior art date
Links
- LCGFVWKNXLRFIF-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-2-amine Chemical class C1=CC=C2CC(N)CCC2=C1 LCGFVWKNXLRFIF-UHFFFAOYSA-N 0.000 title description 4
- 210000000748 cardiovascular system Anatomy 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 120
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- 200000000007 Arterial disease Diseases 0.000 claims abstract description 4
- 206010019280 Heart failures Diseases 0.000 claims abstract description 4
- 208000001647 Renal Insufficiency Diseases 0.000 claims abstract description 4
- 208000026106 cerebrovascular disease Diseases 0.000 claims abstract description 4
- 201000006370 kidney failure Diseases 0.000 claims abstract description 4
- 230000002093 peripheral effect Effects 0.000 claims abstract description 4
- 208000037849 arterial hypertension Diseases 0.000 claims abstract description 3
- 206010007559 Cardiac failure congestive Diseases 0.000 claims abstract 2
- -1 methoxy, methyl Chemical group 0.000 claims description 86
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 71
- 229910052757 nitrogen Inorganic materials 0.000 claims description 65
- 239000000203 mixture Substances 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 38
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 230000009467 reduction Effects 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 150000001721 carbon Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 229910052727 yttrium Inorganic materials 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 239000000651 prodrug Substances 0.000 claims description 5
- 229940002612 prodrug Drugs 0.000 claims description 5
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 4
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 4
- 101100097467 Arabidopsis thaliana SYD gene Proteins 0.000 claims description 3
- 206010058842 Cerebrovascular insufficiency Diseases 0.000 claims description 3
- 101100495925 Schizosaccharomyces pombe (strain 972 / ATCC 24843) chr3 gene Proteins 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 2
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 claims description 2
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 2
- 229910003204 NH2 Inorganic materials 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- 230000000302 ischemic effect Effects 0.000 abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 289
- 239000000543 intermediate Substances 0.000 description 270
- 239000000243 solution Substances 0.000 description 254
- 238000005160 1H NMR spectroscopy Methods 0.000 description 192
- 239000002904 solvent Substances 0.000 description 184
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 127
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 120
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 119
- 239000000460 chlorine Substances 0.000 description 115
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 110
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 108
- 239000007787 solid Substances 0.000 description 108
- 239000011541 reaction mixture Substances 0.000 description 103
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 98
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 96
- 238000002360 preparation method Methods 0.000 description 93
- 238000003756 stirring Methods 0.000 description 91
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 73
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- 238000010992 reflux Methods 0.000 description 64
- 239000012074 organic phase Substances 0.000 description 63
- 239000011734 sodium Substances 0.000 description 62
- 238000004587 chromatography analysis Methods 0.000 description 55
- 239000003480 eluent Substances 0.000 description 55
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 238000001704 evaporation Methods 0.000 description 54
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 48
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 46
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 46
- 230000008020 evaporation Effects 0.000 description 46
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 239000012071 phase Substances 0.000 description 40
- 239000003921 oil Substances 0.000 description 35
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 34
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 31
- 238000001816 cooling Methods 0.000 description 30
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 30
- 235000019253 formic acid Nutrition 0.000 description 29
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 24
- 239000012043 crude product Substances 0.000 description 23
- 239000000725 suspension Substances 0.000 description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 22
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 21
- 101150041968 CDC13 gene Proteins 0.000 description 20
- 230000000694 effects Effects 0.000 description 18
- 230000002378 acidificating effect Effects 0.000 description 17
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 15
- 239000008346 aqueous phase Substances 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 14
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 13
- 102000005962 receptors Human genes 0.000 description 13
- 108020003175 receptors Proteins 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 229960003638 dopamine Drugs 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 229910021529 ammonia Inorganic materials 0.000 description 11
- 230000003291 dopaminomimetic effect Effects 0.000 description 11
- 239000013067 intermediate product Substances 0.000 description 11
- 238000006722 reduction reaction Methods 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- 238000000926 separation method Methods 0.000 description 10
- RYBJORHCUPVNMB-UHFFFAOYSA-N dopexamine Chemical group C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=CC=C1 RYBJORHCUPVNMB-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000000556 agonist Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 229960001857 dopexamine Drugs 0.000 description 8
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 230000003276 anti-hypertensive effect Effects 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 238000000451 chemical ionisation Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 102000016979 Other receptors Human genes 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 239000007983 Tris buffer Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000010511 deprotection reaction Methods 0.000 description 4
- 238000004090 dissolution Methods 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- VEPTXBCIDSFGBF-UHFFFAOYSA-M tetrabutylazanium;fluoride;trihydrate Chemical compound O.O.O.[F-].CCCC[N+](CCCC)(CCCC)CCCC VEPTXBCIDSFGBF-UHFFFAOYSA-M 0.000 description 4
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 4
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 3
- DCANQDLBQJKACQ-UTONKHPSSA-N (2r)-6-methoxy-7-nitro-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.COC1=C([N+]([O-])=O)C=C2C[C@H](NCCC)CCC2=C1 DCANQDLBQJKACQ-UTONKHPSSA-N 0.000 description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 3
- WDJGPVYIVAPBFF-YDALLXLXSA-N (2s)-5,6-dimethoxy-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrobromide Chemical compound Br.C1=CC(OC)=C(OC)C2=C1C[C@@H](NCCC)CC2 WDJGPVYIVAPBFF-YDALLXLXSA-N 0.000 description 3
- NIRFXPKKDAWIGU-UHFFFAOYSA-N 2-(5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide Chemical compound C1C(C(C)C(N)=O)CC(C)C2=C(OC)C(OC)=CC=C21 NIRFXPKKDAWIGU-UHFFFAOYSA-N 0.000 description 3
- WDHMMMSUEYUBAY-UHFFFAOYSA-N 2-amino-4-(2,3-dimethoxyphenyl)pentanoic acid Chemical compound COC1=CC=CC(C(C)CC(N)C(O)=O)=C1OC WDHMMMSUEYUBAY-UHFFFAOYSA-N 0.000 description 3
- WLNQOVMTVKVJRY-UHFFFAOYSA-N 3-[4-(carbamothioylamino)phenyl]propanoic acid Chemical compound NC(=S)NC1=CC=C(CCC(O)=O)C=C1 WLNQOVMTVKVJRY-UHFFFAOYSA-N 0.000 description 3
- AVGUSYIHPBIIAW-UHFFFAOYSA-N 4-(2,3-dimethoxyphenyl)-2-hydroxyiminopentanoic acid Chemical compound ON=C(C(=O)O)CC(C)C1=C(C(=CC=C1)OC)OC AVGUSYIHPBIIAW-UHFFFAOYSA-N 0.000 description 3
- ULKRKZAAPVKIMK-UHFFFAOYSA-N 4-(2,3-dimethoxyphenyl)-2-oxopentanoic acid Chemical compound COC1=CC=CC(C(C)CC(=O)C(O)=O)=C1OC ULKRKZAAPVKIMK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 101150049660 DRD2 gene Proteins 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- XYZBKFKOGXFQEQ-JTQLQIEISA-N [(6s)-2-methoxy-6-(propanoylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] trifluoromethanesulfonate Chemical compound C1=CC(OC)=C(OS(=O)(=O)C(F)(F)F)C2=C1C[C@@H](NC(=O)CC)CC2 XYZBKFKOGXFQEQ-JTQLQIEISA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 210000001367 artery Anatomy 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940126208 compound 22 Drugs 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- YZLMIPLSFVLMRQ-UHFFFAOYSA-N n-(5,6-dimethoxy-4-methyl-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)-2,2,2-trifluoroacetamide Chemical compound O=C1C(NC(=O)C(F)(F)F)CC(C)C2=C(OC)C(OC)=CC=C21 YZLMIPLSFVLMRQ-UHFFFAOYSA-N 0.000 description 3
- TUWFWCZIHYANAG-LLVKDONJSA-N n-[(2r)-6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl]propanamide Chemical compound COC1=C([N+]([O-])=O)C=C2C[C@H](NC(=O)CC)CCC2=C1 TUWFWCZIHYANAG-LLVKDONJSA-N 0.000 description 3
- ATTGCEWFWYZVHW-JTQLQIEISA-N n-[(2s)-5-hydroxy-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propanamide Chemical compound C1=CC(OC)=C(O)C2=C1C[C@@H](NC(=O)CC)CC2 ATTGCEWFWYZVHW-JTQLQIEISA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000013558 reference substance Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 3
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 2
- VDBBSFYASBSEKF-BTQNPOSSSA-N (2r)-6,7-dimethoxy-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.COC1=C(OC)C=C2C[C@H](NCCC)CCC2=C1 VDBBSFYASBSEKF-BTQNPOSSSA-N 0.000 description 2
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 2
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 2
- FRKJDYFPVFMCAK-PPHPATTJSA-N (6s)-6-(propylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol;hydrobromide Chemical compound Br.OC1=CC=C2C[C@@H](NCCC)CCC2=C1O FRKJDYFPVFMCAK-PPHPATTJSA-N 0.000 description 2
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 2
- RBNDDYRENQQDTP-UHFFFAOYSA-N 2,2,2-trifluoro-n-[2-(2-oxo-3h-1,3-benzothiazol-5-yl)ethyl]acetamide Chemical compound FC(F)(F)C(=O)NCCC1=CC=C2SC(=O)NC2=C1 RBNDDYRENQQDTP-UHFFFAOYSA-N 0.000 description 2
- HGGWOSYNRVOQJH-UHFFFAOYSA-N 2-(4-methylsulfonylphenyl)acetic acid Chemical compound CS(=O)(=O)C1=CC=C(CC(O)=O)C=C1 HGGWOSYNRVOQJH-UHFFFAOYSA-N 0.000 description 2
- KTYOFFRCZYUNRD-UHFFFAOYSA-N 2-[3,4-bis(phenylmethoxy)phenyl]ethanethiol Chemical compound C=1C=CC=CC=1COC1=CC(CCS)=CC=C1OCC1=CC=CC=C1 KTYOFFRCZYUNRD-UHFFFAOYSA-N 0.000 description 2
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 2
- PMKXQVFLMAHCTC-UHFFFAOYSA-N 3-(2-amino-1,3-benzothiazol-6-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C=C2SC(N)=NC2=C1 PMKXQVFLMAHCTC-UHFFFAOYSA-N 0.000 description 2
- NUBWWTKDRCILDM-UHFFFAOYSA-N 3-(2-chloro-1,3-benzothiazol-6-yl)propanoic acid Chemical compound OC(=O)CCC1=CC=C2N=C(Cl)SC2=C1 NUBWWTKDRCILDM-UHFFFAOYSA-N 0.000 description 2
- LHHKQWQTBCTDQM-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)propanoic acid Chemical compound COC1=CC=C(CCC(O)=O)C=C1OC LHHKQWQTBCTDQM-UHFFFAOYSA-N 0.000 description 2
- MGBKJKDRMRAZKC-UHFFFAOYSA-N 3-aminobenzene-1,2-diol Chemical group NC1=CC=CC(O)=C1O MGBKJKDRMRAZKC-UHFFFAOYSA-N 0.000 description 2
- RDEJLXKSVRUSAG-UHFFFAOYSA-N 4-(2-bromoethyl)-1,2-bis(phenylmethoxy)benzene Chemical compound C=1C=CC=CC=1COC1=CC(CCBr)=CC=C1OCC1=CC=CC=C1 RDEJLXKSVRUSAG-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- KGMRFWSUKWJTTP-UHFFFAOYSA-N 4-[1-[2-[3,4-bis(phenylmethoxy)phenyl]-7-bromoheptoxy]-7-bromoheptan-2-yl]-1,2-bis(phenylmethoxy)benzene Chemical compound C=1C=C(OCC=2C=CC=CC=2)C(OCC=2C=CC=CC=2)=CC=1C(CCCCCBr)COCC(CCCCCBr)C(C=C1OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 KGMRFWSUKWJTTP-UHFFFAOYSA-N 0.000 description 2
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 description 2
- ULDMWKDYEXHYFI-UHFFFAOYSA-N 5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-amine Chemical compound C1C(N)CC(C)C2=C(OC)C(OC)=CC=C21 ULDMWKDYEXHYFI-UHFFFAOYSA-N 0.000 description 2
- RPKCCKCENHLOBN-UHFFFAOYSA-N 5,6-dimethoxy-4-methyl-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.C1=CC(OC)=C(OC)C2=C1CC(NCCC)CC2C RPKCCKCENHLOBN-UHFFFAOYSA-N 0.000 description 2
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 description 2
- KOQCISGPATVUJH-UHFFFAOYSA-N 6-(1,3-dioxoisoindol-2-yl)hexanoyl chloride Chemical compound C1=CC=C2C(=O)N(CCCCCC(=O)Cl)C(=O)C2=C1 KOQCISGPATVUJH-UHFFFAOYSA-N 0.000 description 2
- SFVTTZOWPDBYJW-QFIPXVFZSA-N 6-[[2-(3-chloro-4-hydroxyphenyl)acetyl]amino]-n-[(2s)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-n-propylhexanamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(OC)C=C2)OC)CC1)C(=O)CCCCCNC(=O)CC1=CC=C(O)C(Cl)=C1 SFVTTZOWPDBYJW-QFIPXVFZSA-N 0.000 description 2
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- DXZKGJFZEOJNJU-UHFFFAOYSA-O CN(C)C(O)=[S+]C(C=CC(CCNC(C(F)(F)F)=O)=C1)=C1N.Cl Chemical compound CN(C)C(O)=[S+]C(C=CC(CCNC(C(F)(F)F)=O)=C1)=C1N.Cl DXZKGJFZEOJNJU-UHFFFAOYSA-O 0.000 description 2
- TZNSPSNZUSMWHG-UHFFFAOYSA-N CN(C)C([O-])=[S+]C1=CC=C(CCNC(C(F)(F)F)=O)C=C1[N+]([O-])=O Chemical compound CN(C)C([O-])=[S+]C1=CC=C(CCNC(C(F)(F)F)=O)C=C1[N+]([O-])=O TZNSPSNZUSMWHG-UHFFFAOYSA-N 0.000 description 2
- 229940127007 Compound 39 Drugs 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 240000007711 Peperomia pellucida Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 2
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229960002684 aminocaproic acid Drugs 0.000 description 2
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 229940098773 bovine serum albumin Drugs 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000003943 catecholamines Chemical class 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125961 compound 24 Drugs 0.000 description 2
- 229940125807 compound 37 Drugs 0.000 description 2
- 229940127573 compound 38 Drugs 0.000 description 2
- 229940127271 compound 49 Drugs 0.000 description 2
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 2
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 2
- 229960001253 domperidone Drugs 0.000 description 2
- 229940052760 dopamine agonists Drugs 0.000 description 2
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- WUAXWQRULBZETB-UHFFFAOYSA-N homoveratric acid Chemical compound COC1=CC=C(CC(O)=O)C=C1OC WUAXWQRULBZETB-UHFFFAOYSA-N 0.000 description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical group O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- 210000004731 jugular vein Anatomy 0.000 description 2
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- CSHCHVCBJYMVNG-QFIPXVFZSA-N n-[(2s)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-6-[[2-(4-hydroxy-3-nitrophenyl)acetyl]amino]-n-propylhexanamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(OC)C=C2)OC)CC1)C(=O)CCCCCNC(=O)CC1=CC=C(O)C([N+]([O-])=O)=C1 CSHCHVCBJYMVNG-QFIPXVFZSA-N 0.000 description 2
- PGCQWGQUQLVJKO-UHFFFAOYSA-N n-[2-[4-(carbamothioylamino)phenyl]ethyl]-2,2,2-trifluoroacetamide Chemical compound NC(=S)NC1=CC=C(CCNC(=O)C(F)(F)F)C=C1 PGCQWGQUQLVJKO-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N o-dihydroxy-benzene Natural products OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 210000002563 splenic artery Anatomy 0.000 description 2
- 230000000707 stereoselective effect Effects 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- DZGWFCGJZKJUFP-UHFFFAOYSA-N tyramine Chemical compound NCCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-N 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- TYHHDWAHJRRYCU-UHFFFAOYSA-N (2-nitrophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=CC=C1[N+]([O-])=O TYHHDWAHJRRYCU-UHFFFAOYSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- OVSNYLXMTWOUKT-SNVBAGLBSA-N (2r)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine Chemical compound C1C[C@@H](N)CC2=C1C=C(OC)C(OC)=C2 OVSNYLXMTWOUKT-SNVBAGLBSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- LUSCVVWWECDAKZ-JIDHJSLPSA-N (2s)-5,6-bis(phenylmethoxy)-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.C([C@@H](C1)NCCC)CC(C=2OCC=3C=CC=CC=3)=C1C=CC=2OCC1=CC=CC=C1 LUSCVVWWECDAKZ-JIDHJSLPSA-N 0.000 description 1
- BCQXWRLVVXKXAF-YDALLXLXSA-N (2s)-5,6-dimethoxy-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.C1=CC(OC)=C(OC)C2=C1C[C@@H](NCCC)CC2 BCQXWRLVVXKXAF-YDALLXLXSA-N 0.000 description 1
- ICJPCRXVYMMSJY-LBPRGKRZSA-N (2s)-5-methoxy-n-propyl-1,2,3,4-tetrahydronaphthalen-2-amine Chemical compound C1=CC=C(OC)C2=C1C[C@@H](NCCC)CC2 ICJPCRXVYMMSJY-LBPRGKRZSA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- IYTUKSIOQKTZEG-UHFFFAOYSA-N (3-chloro-4-hydroxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(O)C(Cl)=C1 IYTUKSIOQKTZEG-UHFFFAOYSA-N 0.000 description 1
- OELQQMWFPQWRGF-UHFFFAOYSA-N (3-chloro-5-methoxyphenyl)methanol Chemical compound COC1=CC(Cl)=CC(CO)=C1 OELQQMWFPQWRGF-UHFFFAOYSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- QBHBHOSRLDPIHG-UHFFFAOYSA-N (4-hydroxy-3-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(O)C([N+]([O-])=O)=C1 QBHBHOSRLDPIHG-UHFFFAOYSA-N 0.000 description 1
- YBADLXQNJCMBKR-UHFFFAOYSA-N (4-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-N 0.000 description 1
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 1
- UBMDLGUKBSCSFD-VWLOTQADSA-N (6S)-1-(methylamino)-6-[6-[2-(4-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)NC)CC1)CCCCCCNCCC1=CC=C(S(C)(=O)=O)C=C1 UBMDLGUKBSCSFD-VWLOTQADSA-N 0.000 description 1
- BOPDXZJYLPXPCW-RUZDIDTESA-N (6r)-6-[6-[2-(4-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-2,3-diol Chemical compound CCCN([C@H]1CC2=CC(O)=C(O)C=C2CC1)CCCCCCNCCC1=CC=C(S(C)(=O)=O)C=C1 BOPDXZJYLPXPCW-RUZDIDTESA-N 0.000 description 1
- XTEHTSBSZDUKQQ-VWLOTQADSA-N (6s)-1-(hydroxymethyl)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)CO)CC1)CCCCCCNCCC1=CC=CC=C1 XTEHTSBSZDUKQQ-VWLOTQADSA-N 0.000 description 1
- AGRMDXYGMDKUBP-VWLOTQADSA-N (6s)-1-(methylamino)-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-ol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)NC)CC1)CCCCCCNCCC1=CC=CC=C1 AGRMDXYGMDKUBP-VWLOTQADSA-N 0.000 description 1
- DGMRTTZFKNHHSC-NQCNTLBGSA-N (6s)-6-[6-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCNCC1OC2=CC=CC=C2OC1 DGMRTTZFKNHHSC-NQCNTLBGSA-N 0.000 description 1
- UFMQRYSPNYVWSB-QHCPKHFHSA-N (6s)-6-[6-(2,3-dihydroindol-1-yl)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCN1C2=CC=CC=C2CC1 UFMQRYSPNYVWSB-QHCPKHFHSA-N 0.000 description 1
- QYIVTBXTWNCFBV-QHCPKHFHSA-N (6s)-6-[6-[2-(1,3-benzodioxol-5-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCNCCC1=CC=C(OCO2)C2=C1 QYIVTBXTWNCFBV-QHCPKHFHSA-N 0.000 description 1
- UVHKPCMVGDCIQZ-QFIPXVFZSA-N (6s)-6-[6-[2-(2-amino-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCNCCC1=CC=C(N=C(N)S2)C2=C1 UVHKPCMVGDCIQZ-QFIPXVFZSA-N 0.000 description 1
- ROHLUXWYUOSJDG-IFUPQEAVSA-N (6s)-6-[6-[2-(2-methoxyphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol;dihydrochloride Chemical compound Cl.Cl.CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCOC1=CC=CC=C1OC ROHLUXWYUOSJDG-IFUPQEAVSA-N 0.000 description 1
- JRGFZJAWPWUSSO-QFIPXVFZSA-N (6s)-6-[6-[2-(2-nitrophenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=CC=C(O)C(O)=C2CC1)CCCCCCNCCOC1=CC=CC=C1[N+]([O-])=O JRGFZJAWPWUSSO-QFIPXVFZSA-N 0.000 description 1
- JUNRKHBAKYFSAL-QFIPXVFZSA-N (6s)-6-[6-[2-(3,4-dihydroxyphenyl)ethoxy]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCOCCC1=CC=C(O)C(O)=C1 JUNRKHBAKYFSAL-QFIPXVFZSA-N 0.000 description 1
- RTJHEUODQOLZED-QFIPXVFZSA-N (6s)-6-[6-[2-(3,4-dihydroxyphenyl)ethylsulfanyl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCSCCC1=CC=C(O)C(O)=C1 RTJHEUODQOLZED-QFIPXVFZSA-N 0.000 description 1
- OTJCSUXGMCYFLE-QHCPKHFHSA-N (6s)-6-[6-[2-(3,5-dihydroxy-4-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC(O)=C(C)C(O)=C1 OTJCSUXGMCYFLE-QHCPKHFHSA-N 0.000 description 1
- APVJEXIWHSIKRR-QFIPXVFZSA-N (6s)-6-[6-[2-(3-amino-4-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(O)C(N)=C1 APVJEXIWHSIKRR-QFIPXVFZSA-N 0.000 description 1
- OTAINTNHTZHDNV-QFIPXVFZSA-N (6s)-6-[6-[2-(3-chloro-4-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(O)C(Cl)=C1 OTAINTNHTZHDNV-QFIPXVFZSA-N 0.000 description 1
- RQVCZRJSEXJPJA-AKRCKQFNSA-N (6s)-6-[6-[2-(3-chloro-4-hydroxyphenyl)ethylamino]hexyl-propylamino]-8-methyl-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)C(C)C1)CCCCCCNCCC1=CC=C(O)C(Cl)=C1 RQVCZRJSEXJPJA-AKRCKQFNSA-N 0.000 description 1
- XNMBPNMPXUWVCR-QHCPKHFHSA-N (6s)-6-[6-[2-(3-chloro-5-hydroxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC(O)=CC(Cl)=C1 XNMBPNMPXUWVCR-QHCPKHFHSA-N 0.000 description 1
- NAWOBHUTOUITCL-QHCPKHFHSA-N (6s)-6-[6-[2-(3-hydroxy-4-methoxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(OC)C(O)=C1 NAWOBHUTOUITCL-QHCPKHFHSA-N 0.000 description 1
- ARLGJOWHEVPIJA-DEOSSOPVSA-N (6s)-6-[6-[2-(3-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=CC(S(C)(=O)=O)=C1 ARLGJOWHEVPIJA-DEOSSOPVSA-N 0.000 description 1
- AGYHZNUGBOSGEU-DEOSSOPVSA-N (6s)-6-[6-[2-(4-aminophenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(N)C=C1 AGYHZNUGBOSGEU-DEOSSOPVSA-N 0.000 description 1
- MBEDWGPEQMHYKZ-QHCPKHFHSA-N (6s)-6-[6-[2-(4-hydroxy-3-methoxyphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(O)C(OC)=C1 MBEDWGPEQMHYKZ-QHCPKHFHSA-N 0.000 description 1
- HHLGOVICOMTSPS-DEOSSOPVSA-N (6s)-6-[6-[2-(4-hydroxy-3-methylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(O)C(C)=C1 HHLGOVICOMTSPS-DEOSSOPVSA-N 0.000 description 1
- SDOGRNZEHQPZQN-QFIPXVFZSA-N (6s)-6-[6-[2-(4-hydroxy-3-nitrophenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=CC=C(O)C(O)=C2CC1)CCCCCCNCCC1=CC=C(O)C([N+]([O-])=O)=C1 SDOGRNZEHQPZQN-QFIPXVFZSA-N 0.000 description 1
- RHGFLPXMKLVXRS-QFIPXVFZSA-N (6s)-6-[6-[2-(4-hydroxyphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCOC1=CC=C(O)C=C1 RHGFLPXMKLVXRS-QFIPXVFZSA-N 0.000 description 1
- KVYKYDZGZQBTPO-QFIPXVFZSA-N (6s)-6-[6-[2-(4-hydroxyphenyl)sulfanylethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCSC1=CC=C(O)C=C1 KVYKYDZGZQBTPO-QFIPXVFZSA-N 0.000 description 1
- VLEOUDKYKRKFGB-QHCPKHFHSA-N (6s)-6-[6-[2-(4-methylsulfonylphenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCOC1=CC=C(S(C)(=O)=O)C=C1 VLEOUDKYKRKFGB-QHCPKHFHSA-N 0.000 description 1
- ZKYPXICBPWTSEA-DEOSSOPVSA-N (6s)-6-[6-[2-(4-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(S(C)(=O)=O)C=C1 ZKYPXICBPWTSEA-DEOSSOPVSA-N 0.000 description 1
- LRGGWROUYPMITH-QHCPKHFHSA-N (6s)-6-[6-[2-(4-nitrophenoxy)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=CC=C(O)C(O)=C2CC1)CCCCCCNCCOC1=CC=C([N+]([O-])=O)C=C1 LRGGWROUYPMITH-QHCPKHFHSA-N 0.000 description 1
- CFMFANSMZROYST-VWLOTQADSA-N (6s)-6-[6-[2-[4-(hydroxymethyl)phenyl]ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(CO)C=C1 CFMFANSMZROYST-VWLOTQADSA-N 0.000 description 1
- ZYPOICNPHCLPKS-DEOSSOPVSA-N (6s)-6-[6-[3-(2-hydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCCC1=CC=CC=C1O ZYPOICNPHCLPKS-DEOSSOPVSA-N 0.000 description 1
- NDPKHIJEEOWRDV-QHCPKHFHSA-N (6s)-6-[6-[3-(3,4-dihydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCCC1=CC=C(O)C(O)=C1 NDPKHIJEEOWRDV-QHCPKHFHSA-N 0.000 description 1
- XPNGJBGWYQRFDP-DEOSSOPVSA-N (6s)-6-[6-[3-(4-hydroxyphenyl)propylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCCC1=CC=C(O)C=C1 XPNGJBGWYQRFDP-DEOSSOPVSA-N 0.000 description 1
- ODPDZLWTSCVLCT-VWLOTQADSA-N (6s)-6-[6-[4-(2-methoxyphenyl)piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCN(CC1)CCN1C1=CC=CC=C1OC ODPDZLWTSCVLCT-VWLOTQADSA-N 0.000 description 1
- GWWWFYUMGZWNGS-SANMLTNESA-N (6s)-6-[6-[4-[(4-hydroxyphenyl)methyl]piperazin-1-yl]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCN(CC1)CCN1CC1=CC=C(O)C=C1 GWWWFYUMGZWNGS-SANMLTNESA-N 0.000 description 1
- IQMVBTURUFQGQF-TUXUZCGSSA-N (6s)-8-methyl-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)C(C)C1)CCCCCCNCCC1=CC=CC=C1 IQMVBTURUFQGQF-TUXUZCGSSA-N 0.000 description 1
- 125000004760 (C1-C4) alkylsulfonylamino group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- JRZGPXSSNPTNMA-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-1-amine Chemical class C1=CC=C2C(N)CCCC2=C1 JRZGPXSSNPTNMA-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- KZEVSDGEBAJOTK-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[5-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CC=1OC(=NN=1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O KZEVSDGEBAJOTK-UHFFFAOYSA-N 0.000 description 1
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 1
- QSHIZISXBATBMJ-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)-5-methoxybenzene Chemical compound COC1=CC(Cl)=CC(CCl)=C1 QSHIZISXBATBMJ-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- FKORNNKNNHEZAR-UHFFFAOYSA-N 2,2,2-trifluoro-n-[2-(4-hydroxyphenyl)ethyl]acetamide Chemical compound OC1=CC=C(CCNC(=O)C(F)(F)F)C=C1 FKORNNKNNHEZAR-UHFFFAOYSA-N 0.000 description 1
- TXKHTPYMJBUBHQ-UHFFFAOYSA-N 2,2,2-trifluoro-n-[2-(4-nitrophenyl)ethyl]acetamide Chemical compound [O-][N+](=O)C1=CC=C(CCNC(=O)C(F)(F)F)C=C1 TXKHTPYMJBUBHQ-UHFFFAOYSA-N 0.000 description 1
- HMBHAQMOBKLWRX-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxine-3-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)COC2=C1 HMBHAQMOBKLWRX-UHFFFAOYSA-N 0.000 description 1
- ODVLMCWNGKLROU-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-yl)acetic acid Chemical compound OC(=O)CC1=CC=C2OCOC2=C1 ODVLMCWNGKLROU-UHFFFAOYSA-N 0.000 description 1
- FQMZXMVHHKXGTM-UHFFFAOYSA-N 2-(1-adamantyl)-n-[2-[2-(2-hydroxyethylamino)ethylamino]quinolin-5-yl]acetamide Chemical compound C1C(C2)CC(C3)CC2CC13CC(=O)NC1=CC=CC2=NC(NCCNCCO)=CC=C21 FQMZXMVHHKXGTM-UHFFFAOYSA-N 0.000 description 1
- WTYVBLZNKUNKLW-UHFFFAOYSA-N 2-(2-methoxy-1,3-benzothiazol-6-yl)ethanamine Chemical compound C1=C(CCN)C=C2SC(OC)=NC2=C1 WTYVBLZNKUNKLW-UHFFFAOYSA-N 0.000 description 1
- IHONYPFTXGQWAX-UHFFFAOYSA-N 2-(2-methoxyphenoxy)acetic acid Chemical compound COC1=CC=CC=C1OCC(O)=O IHONYPFTXGQWAX-UHFFFAOYSA-N 0.000 description 1
- VIOQMVMSWAKXRD-NRFANRHFSA-N 2-(3,4-dihydroxyphenyl)-n-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexyl]acetamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNC(=O)CC1=CC=C(O)C(O)=C1 VIOQMVMSWAKXRD-NRFANRHFSA-N 0.000 description 1
- UXWYCBMHROMUBO-UHFFFAOYSA-N 2-(3,5-dimethoxy-4-methylphenyl)acetic acid Chemical compound COC1=CC(CC(O)=O)=CC(OC)=C1C UXWYCBMHROMUBO-UHFFFAOYSA-N 0.000 description 1
- NREQDYYHKLEOPH-UHFFFAOYSA-N 2-(3-chloro-5-methoxyphenyl)acetonitrile Chemical compound COC1=CC(Cl)=CC(CC#N)=C1 NREQDYYHKLEOPH-UHFFFAOYSA-N 0.000 description 1
- WBQZILBLAGIXEG-UHFFFAOYSA-N 2-(3-chloro-5-methoxyphenyl)ethanamine Chemical compound COC1=CC(Cl)=CC(CCN)=C1 WBQZILBLAGIXEG-UHFFFAOYSA-N 0.000 description 1
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 1
- GYBWDAKGSPTODN-UHFFFAOYSA-N 2-(4-methoxy-3-methylphenyl)acetic acid Chemical compound COC1=CC=C(CC(O)=O)C=C1C GYBWDAKGSPTODN-UHFFFAOYSA-N 0.000 description 1
- WXWWJUKMWNYILA-UHFFFAOYSA-N 2-(4-methoxy-3-phenylmethoxyphenyl)acetic acid Chemical compound COC1=CC=C(CC(O)=O)C=C1OCC1=CC=CC=C1 WXWWJUKMWNYILA-UHFFFAOYSA-N 0.000 description 1
- WPRFIGTZKOUYRL-UHFFFAOYSA-N 2-(4-methoxyphenyl)sulfanylacetic acid Chemical compound COC1=CC=C(SCC(O)=O)C=C1 WPRFIGTZKOUYRL-UHFFFAOYSA-N 0.000 description 1
- ZDUFIHMADJNVIQ-UHFFFAOYSA-N 2-(4-methylsulfonylphenoxy)acetic acid Chemical compound CS(=O)(=O)C1=CC=C(OCC(O)=O)C=C1 ZDUFIHMADJNVIQ-UHFFFAOYSA-N 0.000 description 1
- JVMHULJEYUQYSH-UHFFFAOYSA-N 2-(4-nitrophenyl)ethylazanium;chloride Chemical compound Cl.NCCC1=CC=C([N+]([O-])=O)C=C1 JVMHULJEYUQYSH-UHFFFAOYSA-N 0.000 description 1
- VXMSXBVTUNOSLL-UHFFFAOYSA-N 2-(4-phenylmethoxyphenoxy)acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1OCC1=CC=CC=C1 VXMSXBVTUNOSLL-UHFFFAOYSA-N 0.000 description 1
- GBDWTNPRRZVEFD-UHFFFAOYSA-N 2-[3,4-bis(phenylmethoxy)phenyl]ethanol Chemical compound C=1C=CC=CC=1COC1=CC(CCO)=CC=C1OCC1=CC=CC=C1 GBDWTNPRRZVEFD-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- PYRKKGOKRMZEIT-UHFFFAOYSA-N 2-[6-(2-cyclopropylethoxy)-9-(2-hydroxy-2-methylpropyl)-1h-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile Chemical compound C1=C2C3=CC(CC(C)(O)C)=CC=C3C=3NC(C=4C(=CC(F)=CC=4C#N)C#N)=NC=3C2=CC=C1OCCC1CC1 PYRKKGOKRMZEIT-UHFFFAOYSA-N 0.000 description 1
- ONITXICYEJIHEW-QHCPKHFHSA-N 2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexyl]-3,4-dihydro-1h-isoquinoline-6,7-diol Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCN1CC2=CC(O)=C(O)C=C2CC1 ONITXICYEJIHEW-QHCPKHFHSA-N 0.000 description 1
- FMKGJQHNYMWDFJ-CVEARBPZSA-N 2-[[4-(2,2-difluoropropoxy)pyrimidin-5-yl]methylamino]-4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]pyrimidine-5-carbonitrile Chemical compound FC(COC1=NC=NC=C1CNC1=NC=C(C(=N1)N[C@H]1CC([C@H](CC1)O)(C)C)C#N)(C)F FMKGJQHNYMWDFJ-CVEARBPZSA-N 0.000 description 1
- LFOIDLOIBZFWDO-UHFFFAOYSA-N 2-methoxy-6-[6-methoxy-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-2-yl]imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 LFOIDLOIBZFWDO-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- UAVWWXVXXQGHGA-UHFFFAOYSA-N 3,7-ditert-butylnaphthalene-1,5-disulfonic acid Chemical compound C1=C(C(C)(C)C)C=C(S(O)(=O)=O)C2=CC(C(C)(C)C)=CC(S(O)(=O)=O)=C21 UAVWWXVXXQGHGA-UHFFFAOYSA-N 0.000 description 1
- PZOROCQPLLADIJ-UHFFFAOYSA-N 3-(2-methoxy-1,3-benzothiazol-6-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C=C2SC(OC)=NC2=C1 PZOROCQPLLADIJ-UHFFFAOYSA-N 0.000 description 1
- XSZSNLOPIWWFHS-UHFFFAOYSA-N 3-(2-methoxyphenyl)propanoic acid Chemical compound COC1=CC=CC=C1CCC(O)=O XSZSNLOPIWWFHS-UHFFFAOYSA-N 0.000 description 1
- GNPISAHACGIXLZ-UHFFFAOYSA-N 3-(4-methylphenoxy)propanoic acid Chemical compound CC1=CC=C(OCCC(O)=O)C=C1 GNPISAHACGIXLZ-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZROCNTZTEKIWKT-UHFFFAOYSA-N 4-(2,3-dimethoxyphenyl)-2-oxobut-3-enoic acid Chemical compound COC1=CC=CC(C=CC(=O)C(O)=O)=C1OC ZROCNTZTEKIWKT-UHFFFAOYSA-N 0.000 description 1
- RYBFWJVHZIKGQJ-UHFFFAOYSA-N 4-(2-aminoethyl)benzenesulfonic acid Chemical compound NCCC1=CC=C(S(O)(=O)=O)C=C1 RYBFWJVHZIKGQJ-UHFFFAOYSA-N 0.000 description 1
- SKANRQQUKOQOGZ-DEOSSOPVSA-N 4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]benzamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(C(N)=O)C=C1 SKANRQQUKOQOGZ-DEOSSOPVSA-N 0.000 description 1
- MOXRCUWOVMWLBF-QHCPKHFHSA-N 4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]benzenesulfonamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(S(N)(=O)=O)C=C1 MOXRCUWOVMWLBF-QHCPKHFHSA-N 0.000 description 1
- RUZFRHQKBGRPGH-QHCPKHFHSA-N 4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]benzenesulfonic acid Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(S(O)(=O)=O)C=C1 RUZFRHQKBGRPGH-QHCPKHFHSA-N 0.000 description 1
- NVRBRWMGMLWTHC-DEOSSOPVSA-N 4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]benzoic acid Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(C(O)=O)C=C1 NVRBRWMGMLWTHC-DEOSSOPVSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- AVDLFIONKHGQAP-UHFFFAOYSA-N 4-nitrophenoxyacetic acid Chemical compound OC(=O)COC1=CC=C([N+]([O-])=O)C=C1 AVDLFIONKHGQAP-UHFFFAOYSA-N 0.000 description 1
- XLJNTQIAXFSPFM-UHFFFAOYSA-N 5-(2-aminoethyl)-3h-1,3-benzothiazol-2-one;hydrochloride Chemical compound Cl.NCCC1=CC=C2SC(=O)NC2=C1 XLJNTQIAXFSPFM-UHFFFAOYSA-N 0.000 description 1
- ZUAWVCMOVDQZJB-QFIPXVFZSA-N 5-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-3h-1,3-benzothiazol-2-one Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCNCCC1=CC=C(SC(=O)N2)C2=C1 ZUAWVCMOVDQZJB-QFIPXVFZSA-N 0.000 description 1
- PKBAKBYJJLFUSA-HNNXBMFYSA-N 5-[[(2s)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-5-oxopentanoic acid Chemical compound C1=CC(OC)=C(OC)C2=C1C[C@@H](N(CCC)C(=O)CCCC(O)=O)CC2 PKBAKBYJJLFUSA-HNNXBMFYSA-N 0.000 description 1
- SHOWAGCIRTUYNA-UHFFFAOYSA-N 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydron;chloride Chemical compound [Cl-].C1C[NH2+]CC2=C1C=C(OC)C(OC)=C2 SHOWAGCIRTUYNA-UHFFFAOYSA-N 0.000 description 1
- SWUDIEPQCRLCOC-UHFFFAOYSA-N 6-(2,3-dihydroindol-1-yl)-6-oxohexanoic acid Chemical compound C1=CC=C2N(C(=O)CCCCC(=O)O)CCC2=C1 SWUDIEPQCRLCOC-UHFFFAOYSA-N 0.000 description 1
- YUCBZQRTEZJBBQ-UHFFFAOYSA-N 6-(2-aminoethyl)-1,3-benzothiazol-2-amine;dihydrochloride Chemical compound Cl.Cl.NCCC1=CC=C2N=C(N)SC2=C1 YUCBZQRTEZJBBQ-UHFFFAOYSA-N 0.000 description 1
- NICLXQJYHWXLQP-UHFFFAOYSA-N 6-(2-aminoethyl)-3h-1,3-benzothiazol-2-one;hydrobromide Chemical compound Br.NCCC1=CC=C2NC(=O)SC2=C1 NICLXQJYHWXLQP-UHFFFAOYSA-N 0.000 description 1
- BTDJPHNTWHKTNT-UHFFFAOYSA-N 6-[(2-phenylacetyl)amino]hexanoic acid Chemical compound OC(=O)CCCCCNC(=O)CC1=CC=CC=C1 BTDJPHNTWHKTNT-UHFFFAOYSA-N 0.000 description 1
- ADYMINPYXBHPDC-UHFFFAOYSA-N 6-[(2-phenylacetyl)amino]hexanoyl chloride Chemical compound ClC(=O)CCCCCNC(=O)CC1=CC=CC=C1 ADYMINPYXBHPDC-UHFFFAOYSA-N 0.000 description 1
- GSBUYWYZVISZRM-AKRCKQFNSA-N 6-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexan-2-ylamino]ethyl]-3-methyl-1,3-benzothiazol-2-one Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCC(C)NCCC1=CC=C(N(C)C(=O)S2)C2=C1 GSBUYWYZVISZRM-AKRCKQFNSA-N 0.000 description 1
- JDWACPVTJUDWLO-QFIPXVFZSA-N 6-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-3h-1,3-benzothiazol-2-one Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCNCCC1=CC=C(NC(=O)S2)C2=C1 JDWACPVTJUDWLO-QFIPXVFZSA-N 0.000 description 1
- UTLZVXVNOCKJPO-QHCPKHFHSA-N 6-[2-[6-[[(2s)-5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]-3h-1,3-benzothiazol-2-one Chemical compound C1CC2=C(O)C=CC=C2C[C@H]1N(CCC)CCCCCCNCCC1=CC=C(NC(=O)S2)C2=C1 UTLZVXVNOCKJPO-QHCPKHFHSA-N 0.000 description 1
- TZQABNGTTKRDAC-QHCPKHFHSA-N 6-[2-[7-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]heptylamino]ethyl]-3h-1,3-benzothiazol-2-one Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCCCNCCC1=CC=C(NC(=O)S2)C2=C1 TZQABNGTTKRDAC-QHCPKHFHSA-N 0.000 description 1
- GNWFXYGHCRMDRV-NRFANRHFSA-N 6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]-n-[2-(2-oxo-3h-1,3-benzothiazol-6-yl)ethyl]hexanamide Chemical compound C1CC(C(=C(O)C=C2)O)=C2C[C@H]1N(CCC)CCCCCC(=O)NCCC1=CC=C(NC(=O)S2)C2=C1 GNWFXYGHCRMDRV-NRFANRHFSA-N 0.000 description 1
- WYSUKHRTKJZVHO-UHFFFAOYSA-N 6-[[2-(2-methoxy-1,3-benzothiazol-6-yl)acetyl]amino]hexanoic acid Chemical compound C1=C(CC(=O)NCCCCCC(O)=O)C=C2SC(OC)=NC2=C1 WYSUKHRTKJZVHO-UHFFFAOYSA-N 0.000 description 1
- SRMZYUMOCKEVCS-UHFFFAOYSA-N 6-[[2-(4-methylsulfonylphenyl)acetyl]amino]hexanoic acid Chemical compound CS(=O)(=O)C1=CC=C(CC(=O)NCCCCCC(O)=O)C=C1 SRMZYUMOCKEVCS-UHFFFAOYSA-N 0.000 description 1
- HCCNBKFJYUWLEX-UHFFFAOYSA-N 7-(6-methoxypyridin-3-yl)-1-(2-propoxyethyl)-3-(pyrazin-2-ylmethylamino)pyrido[3,4-b]pyrazin-2-one Chemical compound O=C1N(CCOCCC)C2=CC(C=3C=NC(OC)=CC=3)=NC=C2N=C1NCC1=CN=CC=N1 HCCNBKFJYUWLEX-UHFFFAOYSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OJRUSAPKCPIVBY-KQYNXXCUSA-N C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N Chemical compound C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N OJRUSAPKCPIVBY-KQYNXXCUSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- 229940126639 Compound 33 Drugs 0.000 description 1
- OMFXVFTZEKFJBZ-UHFFFAOYSA-N Corticosterone Natural products O=C1CCC2(C)C3C(O)CC(C)(C(CC4)C(=O)CO)C4C3CCC2=C1 OMFXVFTZEKFJBZ-UHFFFAOYSA-N 0.000 description 1
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 241000283977 Oryctolagus Species 0.000 description 1
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOTMKOSCLKVOGG-UHFFFAOYSA-N SCH 23390 Chemical compound C1N(C)CCC2=CC(Cl)=C(O)C=C2C1C1=CC=CC=C1 GOTMKOSCLKVOGG-UHFFFAOYSA-N 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Chemical group 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- GIHYHSZRQQZERU-DEOSSOPVSA-N [4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]urea Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(NC(N)=O)C=C1 GIHYHSZRQQZERU-DEOSSOPVSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- OKTJSMMVPCPJKN-YPZZEJLDSA-N carbon-10 atom Chemical class [10C] OKTJSMMVPCPJKN-YPZZEJLDSA-N 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- QQZMWMKOWKGPQY-UHFFFAOYSA-N cerium(3+);trinitrate;hexahydrate Chemical compound O.O.O.O.O.O.[Ce+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O QQZMWMKOWKGPQY-UHFFFAOYSA-N 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 229940126540 compound 41 Drugs 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 229940125844 compound 46 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 229940126545 compound 53 Drugs 0.000 description 1
- 229940127113 compound 57 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- OMFXVFTZEKFJBZ-HJTSIMOOSA-N corticosterone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@H](CC4)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OMFXVFTZEKFJBZ-HJTSIMOOSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 229960003914 desipramine Drugs 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- DXBULVYHTICWKT-UHFFFAOYSA-N ethyl 6-bromohexanoate Chemical compound CCOC(=O)CCCCCBr DXBULVYHTICWKT-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- NMCHYWGKBADVMK-UHFFFAOYSA-N fenetylline Chemical compound C1=NC=2N(C)C(=O)N(C)C(=O)C=2N1CCNC(C)CC1=CC=CC=C1 NMCHYWGKBADVMK-UHFFFAOYSA-N 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- FTHUKEBATJXQFL-UHFFFAOYSA-N formic acid;hydrochloride Chemical compound Cl.OC=O FTHUKEBATJXQFL-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000002050 international nonproprietary name Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 235000013847 iso-butane Nutrition 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- XGBXOGQDEAGJKO-UHFFFAOYSA-N methyl 4-(2-aminoethyl)benzoate Chemical compound COC(=O)C1=CC=C(CCN)C=C1 XGBXOGQDEAGJKO-UHFFFAOYSA-N 0.000 description 1
- PAVJQKRRGHAVNA-VWLOTQADSA-N methyl 4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]benzoate Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(C(=O)OC)C=C1 PAVJQKRRGHAVNA-VWLOTQADSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- YNWLUFOACPMSLB-UHFFFAOYSA-N n'-ethylhexanediamide Chemical compound CCNC(=O)CCCCC(N)=O YNWLUFOACPMSLB-UHFFFAOYSA-N 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- JVKVWDHUEBTNBR-GFCCVEGCSA-N n-[(2r)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propanamide Chemical compound COC1=CC=C2C[C@H](NC(=O)CC)CCC2=C1 JVKVWDHUEBTNBR-GFCCVEGCSA-N 0.000 description 1
- VTKLAZRSHVKURE-DHUJRADRSA-N n-[(2s)-5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino]-n-propylhexanamide Chemical compound C([C@@H](C1)N(CCC)C(=O)CCCCCNC(=O)CC=2C=C(OC)C(O)=CC=2)CC(C=2OCC=3C=CC=CC=3)=C1C=CC=2OCC1=CC=CC=C1 VTKLAZRSHVKURE-DHUJRADRSA-N 0.000 description 1
- ANWDGWRQAYOURH-NSHDSACASA-N n-[(2s)-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]propanamide Chemical compound C1=CC(OC)=C(OC)C2=C1C[C@@H](NC(=O)CC)CC2 ANWDGWRQAYOURH-NSHDSACASA-N 0.000 description 1
- ZDNGRLXEOOQNAJ-VWLOTQADSA-N n-[(6s)-2-hydroxy-6-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]methanesulfonamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)NS(C)(=O)=O)CC1)CCCCCCNCCC1=CC=CC=C1 ZDNGRLXEOOQNAJ-VWLOTQADSA-N 0.000 description 1
- DFTRIDLIXPGEGB-VWLOTQADSA-N n-[(6s)-2-hydroxy-6-[6-[2-(4-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]methanesulfonamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)NS(C)(=O)=O)CC1)CCCCCCNCCC1=CC=C(S(C)(=O)=O)C=C1 DFTRIDLIXPGEGB-VWLOTQADSA-N 0.000 description 1
- HUNDYPIAXLKPRS-AREMUKBSSA-N n-[(7r)-3-hydroxy-7-[6-(2-phenylethylamino)hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide Chemical compound CCCN([C@H]1CC2=CC(NC=O)=C(O)C=C2CC1)CCCCCCNCCC1=CC=CC=C1 HUNDYPIAXLKPRS-AREMUKBSSA-N 0.000 description 1
- JXQVWIOYUGCIKZ-XMMPIXPASA-N n-[(7r)-3-hydroxy-7-[6-[2-(2-oxo-3h-1,3-benzothiazol-6-yl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide Chemical compound C1CC2=CC(O)=C(NC=O)C=C2C[C@@H]1N(CCC)CCCCCCNCCC1=CC=C(NC(=O)S2)C2=C1 JXQVWIOYUGCIKZ-XMMPIXPASA-N 0.000 description 1
- QVCCJPFFXNEUHB-AREMUKBSSA-N n-[(7r)-3-hydroxy-7-[6-[2-(4-methylsulfonylphenyl)ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]formamide Chemical compound CCCN([C@H]1CC2=CC(NC=O)=C(O)C=C2CC1)CCCCCCNCCC1=CC=C(S(C)(=O)=O)C=C1 QVCCJPFFXNEUHB-AREMUKBSSA-N 0.000 description 1
- KJYUEXYAADIRQE-XMMPIXPASA-N n-[(7r)-7-[6-[2-(3-chloro-4-hydroxyphenyl)ethylamino]hexyl-propylamino]-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]formamide Chemical compound CCCN([C@H]1CC2=CC(NC=O)=C(O)C=C2CC1)CCCCCCNCCC1=CC=C(O)C(Cl)=C1 KJYUEXYAADIRQE-XMMPIXPASA-N 0.000 description 1
- VBOSLEPDXVTBSW-SANMLTNESA-N n-[4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]acetamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(NC(C)=O)C=C1 VBOSLEPDXVTBSW-SANMLTNESA-N 0.000 description 1
- DUZMFBYSXGVQRA-VWLOTQADSA-N n-[4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]formamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(NC=O)C=C1 DUZMFBYSXGVQRA-VWLOTQADSA-N 0.000 description 1
- JIRKGSWLXNBXJC-VWLOTQADSA-N n-[4-[2-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexylamino]ethyl]phenyl]methanesulfonamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNCCC1=CC=C(NS(C)(=O)=O)C=C1 JIRKGSWLXNBXJC-VWLOTQADSA-N 0.000 description 1
- HTYZWSGYAJSXJB-QFIPXVFZSA-N n-[6-[[(2s)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]-propylamino]hexyl]-2-(2-methoxyphenoxy)acetamide Chemical compound CCCN([C@@H]1CC2=C(C(=C(O)C=C2)O)CC1)CCCCCCNC(=O)COC1=CC=CC=C1OC HTYZWSGYAJSXJB-QFIPXVFZSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IOMMMLWIABWRKL-WUTDNEBXSA-N nazartinib Chemical compound C1N(C(=O)/C=C/CN(C)C)CCCC[C@H]1N1C2=C(Cl)C=CC=C2N=C1NC(=O)C1=CC=NC(C)=C1 IOMMMLWIABWRKL-WUTDNEBXSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000005556 structure-activity relationship Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BPNWQZYMRBKZPB-MHZLTWQESA-N tert-butyl n-[(2s)-5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-n-propylcarbamate Chemical compound C([C@@H](C1)N(CCC)C(=O)OC(C)(C)C)CC(C=2OCC=3C=CC=CC=3)=C1C=CC=2OCC1=CC=CC=C1 BPNWQZYMRBKZPB-MHZLTWQESA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 229960003732 tyramine Drugs 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/33—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings
- C07C211/39—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings of an unsaturated carbon skeleton
- C07C211/41—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings of an unsaturated carbon skeleton containing condensed ring systems
- C07C211/42—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings of an unsaturated carbon skeleton containing condensed ring systems with six-membered aromatic rings being part of the condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/46—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C215/64—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with rings other than six-membered aromatic rings being part of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/80—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/20—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/60—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms linked by carbon chains having two carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/74—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with rings other than six-membered aromatic rings being part of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/38—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino groups bound to acyclic carbon atoms and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/42—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/43—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/18—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides
- C07C235/20—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/30—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having the nitrogen atom of the carboxamide group bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/30—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a six-membered aromatic ring being part of a condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/28—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/45—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/46—Sulfonic acids having sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton having the sulfo groups bound to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/08—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/16—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C317/22—Sulfones; Sulfoxides having sulfone or sulfoxide groups and singly-bound oxygen atoms bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/20—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring with substituents attached to the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Epidemiology (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Endocrinology (AREA)
- Reproductive Health (AREA)
- Urology & Nephrology (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
ITMI941868A IT1271007B (it) | 1994-09-13 | 1994-09-13 | Derivati del 2-ammino-1,2,3,4-tetraidronaftalene attivi sul sistema cardiovascolare |
PCT/EP1995/003562 WO1996008228A2 (en) | 1994-09-13 | 1995-09-11 | Derivatives of 2-amino-1,2,3,4-tetrahydro-naphthalene active on the cardiovascular system |
Publications (2)
Publication Number | Publication Date |
---|---|
NO971134D0 NO971134D0 (no) | 1997-03-12 |
NO971134L true NO971134L (no) | 1997-05-12 |
Family
ID=11369548
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO971134A NO971134L (no) | 1994-09-13 | 1997-03-12 | Derivater av 2-amino-1,2,3,4-tetrahydronaftalen som er aktive på det kardiovaskulære system |
Country Status (19)
Country | Link |
---|---|
US (1) | US5674909A (ja) |
EP (1) | EP0781126B1 (ja) |
JP (1) | JPH11501006A (ja) |
KR (1) | KR970705989A (ja) |
AT (1) | ATE210433T1 (ja) |
AU (1) | AU694563B2 (ja) |
CA (1) | CA2199484A1 (ja) |
CZ (1) | CZ76597A3 (ja) |
DE (1) | DE69524610T2 (ja) |
DK (1) | DK0781126T3 (ja) |
ES (1) | ES2168384T3 (ja) |
FI (1) | FI971039A0 (ja) |
HU (1) | HUT76837A (ja) |
IT (1) | IT1271007B (ja) |
NO (1) | NO971134L (ja) |
NZ (1) | NZ293258A (ja) |
PT (1) | PT781126E (ja) |
RU (1) | RU2149158C1 (ja) |
WO (1) | WO1996008228A2 (ja) |
Families Citing this family (13)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IT1271411B (it) * | 1993-09-14 | 1997-05-28 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
IT1289980B1 (it) | 1997-02-26 | 1998-10-19 | Zambon Spa | Derivati idrossimetilici del 2-ammino-1,2,3,4-tetraidronaftalene attivi in campo cardiovascolare |
US6486178B1 (en) * | 1998-06-03 | 2002-11-26 | Nissan Chemical Industries, Ltd. | Indane derivatives |
DE10109859A1 (de) * | 2001-03-01 | 2002-09-05 | Bayer Ag | Neuartige Aminodicarbonsäurederivate |
GB2389582A (en) * | 2002-06-13 | 2003-12-17 | Bayer Ag | Pharmaceutically active carboxamides |
WO2004091596A2 (en) * | 2003-04-18 | 2004-10-28 | Pharmacia & Upjohn Company Llc | Combination therapies for chronic obstructive pulmonary disease (copd) |
US8710045B2 (en) | 2004-01-22 | 2014-04-29 | The Trustees Of Columbia University In The City Of New York | Agents for preventing and treating disorders involving modulation of the ryanodine receptors |
UA95454C2 (uk) | 2005-07-15 | 2011-08-10 | Амр Текнолоджи, Інк. | Арил- і гетероарилзаміщені тетрагідробензазепіни і їх застосування для блокування зворотного захоплення норепінефрину, допаміну і серотоніну |
CA2685860A1 (en) * | 2007-05-10 | 2008-11-20 | Amr Technology, Inc. | Aryl- and heteroaryl-substituted tetrahydrobenzo-1,4-diazepines and use thereof to block reuptake of norepinephrine, dopamine, and serotonin |
JP6163105B2 (ja) * | 2010-11-16 | 2017-07-12 | ユニバーシティー オブ サザン カリフォルニア | 体性幹細胞の非対称分裂を促進するためのcbp/カテニン拮抗剤 |
US10874669B2 (en) | 2012-11-29 | 2020-12-29 | Wayne State University | Neuroprotective agents for treatment of neurodegenerative diseases |
US10125127B2 (en) * | 2012-11-29 | 2018-11-13 | Wayne State University | Neuroprotective agents for treatment of neurodegenerative diseases |
US11285147B2 (en) | 2018-09-07 | 2022-03-29 | Wayne State University | Neuroprotective agents for treatment of neurodegenerative diseases |
Family Cites Families (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS50135063A (ja) * | 1974-03-28 | 1975-10-25 | ||
DE3263531D1 (en) * | 1981-08-05 | 1985-06-20 | Fisons Plc | Amine derivatives, processes for their production and pharmaceutical compositions containing them |
EP0142283B1 (en) * | 1983-10-25 | 1991-01-30 | FISONS plc | Phenylethylamines, process for their preparation and compositions containing them |
US4720586A (en) * | 1983-12-06 | 1988-01-19 | Fisons, Plc | Substituted 3,4-dihydroxy-phenylethylamino compounds |
IT1224405B (it) * | 1987-12-23 | 1990-10-04 | Simes | Composti attivi sul sistema cardiovascolare |
US5358971A (en) * | 1989-07-05 | 1994-10-25 | Whitby Research, Inc. | Substituted 2-aminotetralins |
IT1254521B (it) * | 1992-03-17 | 1995-09-25 | Zambon Spa | Derivati della 2-ammino-tetralina attivi sul sistema cardiovascolare |
IT1271411B (it) * | 1993-09-14 | 1997-05-28 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
-
1994
- 1994-09-13 IT ITMI941868A patent/IT1271007B/it active IP Right Grant
-
1995
- 1995-06-06 US US08/465,636 patent/US5674909A/en not_active Expired - Fee Related
- 1995-09-11 ES ES95932708T patent/ES2168384T3/es not_active Expired - Lifetime
- 1995-09-11 KR KR1019970701644A patent/KR970705989A/ko not_active Application Discontinuation
- 1995-09-11 CZ CZ97765A patent/CZ76597A3/cs unknown
- 1995-09-11 DE DE69524610T patent/DE69524610T2/de not_active Expired - Fee Related
- 1995-09-11 DK DK95932708T patent/DK0781126T3/da active
- 1995-09-11 PT PT95932708T patent/PT781126E/pt unknown
- 1995-09-11 HU HU9701331A patent/HUT76837A/hu unknown
- 1995-09-11 EP EP95932708A patent/EP0781126B1/en not_active Expired - Lifetime
- 1995-09-11 RU RU97106097/04A patent/RU2149158C1/ru not_active IP Right Cessation
- 1995-09-11 AT AT95932708T patent/ATE210433T1/de not_active IP Right Cessation
- 1995-09-11 CA CA002199484A patent/CA2199484A1/en not_active Abandoned
- 1995-09-11 WO PCT/EP1995/003562 patent/WO1996008228A2/en not_active Application Discontinuation
- 1995-09-11 NZ NZ293258A patent/NZ293258A/en unknown
- 1995-09-11 JP JP8509893A patent/JPH11501006A/ja not_active Ceased
- 1995-09-11 AU AU35653/95A patent/AU694563B2/en not_active Ceased
-
1997
- 1997-03-12 FI FI971039A patent/FI971039A0/fi unknown
- 1997-03-12 NO NO971134A patent/NO971134L/no not_active Application Discontinuation
Also Published As
Publication number | Publication date |
---|---|
FI971039A (fi) | 1997-03-12 |
EP0781126A2 (en) | 1997-07-02 |
RU2149158C1 (ru) | 2000-05-20 |
DE69524610T2 (de) | 2002-07-18 |
CZ76597A3 (en) | 1997-10-15 |
HUT76837A (en) | 1997-11-28 |
WO1996008228A3 (en) | 1996-07-25 |
NZ293258A (en) | 1998-06-26 |
KR970705989A (ko) | 1997-11-03 |
AU694563B2 (en) | 1998-07-23 |
FI971039A0 (fi) | 1997-03-12 |
ES2168384T3 (es) | 2002-06-16 |
JPH11501006A (ja) | 1999-01-26 |
AU3565395A (en) | 1996-03-29 |
NO971134D0 (no) | 1997-03-12 |
DK0781126T3 (da) | 2002-04-08 |
IT1271007B (it) | 1997-05-26 |
EP0781126B1 (en) | 2001-12-12 |
US5674909A (en) | 1997-10-07 |
ITMI941868A1 (it) | 1996-03-13 |
ITMI941868A0 (it) | 1994-09-13 |
DE69524610D1 (de) | 2002-01-24 |
PT781126E (pt) | 2002-06-28 |
WO1996008228A2 (en) | 1996-03-21 |
CA2199484A1 (en) | 1996-03-21 |
ATE210433T1 (de) | 2001-12-15 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR100389497B1 (ko) | 아미노(티오)에테르유도체 | |
TWI409247B (zh) | 4-取代之苯氧基苯基乙酸衍生物 | |
EP3200791B1 (en) | Processes and intermediates in the preparation of c5ar antagonists | |
NO971134L (no) | Derivater av 2-amino-1,2,3,4-tetrahydronaftalen som er aktive på det kardiovaskulære system | |
IL108507A (en) | Phenyl Sulfonamides are converted, their preparation and pharmaceutical preparations containing them | |
NZ570533A (en) | Compounds useful as Selective androgen receptor modulators (SARM), in particular (2S)-3-(4-cyano-3-fluorophenoxy)-N-(4-cyano-3-methylphenyl)-2-hydroxy-2-methylpropionamide useful in hormonal therapy | |
JP6348904B2 (ja) | 置換アルキルジアリール誘導体、その製造方法及び使用 | |
MXPA02009697A (es) | Compuestos de eter difenilico utiles en terapia. | |
HU224354B1 (hu) | 2-Aminoindán-származékok alkalmazása és az ezeket tartalmazó gyógyszerkészítmények | |
JP3626191B2 (ja) | 心臓血管系に活性な2−アミノ−1,2,3,4−テトラヒドロナフタレン誘導体 | |
JP3231775B2 (ja) | 心循環器系に作用する2−アミノ−1,2,3,4−テトラヒドロナフタレン誘導体、それらを製造する方法、及びそれらを含む医薬組成物 | |
JP2000290240A (ja) | 生物学的に活性なアミンの中間体 | |
TW202220952A (zh) | 茚烷化合物,其製備及其治療用途 | |
JP6867998B2 (ja) | ガンを処置するのに使用するための置換疎水性ベンゼンスルホンアミドチアゾール化合物 | |
TW200304825A (en) | Process for making chiral 1,4-disubstituted piperazines | |
JP2016505584A (ja) | ダウン症候群及びアルツハイマー病に関連する認知欠損の治療のための、dyrk1aタンパク質阻害剤としての3,5−ジアリールアザインドール類 | |
MXPA02009618A (es) | Sulfonatos arilicos y heteroarilicos. | |
WO2016169514A1 (zh) | 咪唑类化合物 | |
JP7478251B2 (ja) | イオンチャネルアンタゴニスト/遮断剤およびその用途 | |
WO2008118935A1 (en) | Compounds and processes for preparing substituted aminomethyl-2,3,8,9-tetrahydro-7h-1,4-dioxino[2,3-e]indol-8-ones | |
EP0781268B1 (en) | Derivatives of 2-amino-1,2,3,4-tetrahydronaphthalene active on the cardiovascular system | |
IL178102A (en) | Formamide derivatives, pharmaceutical compositions comprising them and use thereof in the preparation of medicaments for therapy | |
EP0966423A1 (en) | Hydroxymethyl derivatives of 2-amino-1,2,3,4-tetrahydronaphthalene as cardiovascular agent |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FC2A | Withdrawal, rejection or dismissal of laid open patent application |