NO884231L - Fremgangsmaate for fremstilling av terapeutisk aktive imidazopyridin-derivater. - Google Patents
Fremgangsmaate for fremstilling av terapeutisk aktive imidazopyridin-derivater.Info
- Publication number
- NO884231L NO884231L NO88884231A NO884231A NO884231L NO 884231 L NO884231 L NO 884231L NO 88884231 A NO88884231 A NO 88884231A NO 884231 A NO884231 A NO 884231A NO 884231 L NO884231 L NO 884231L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- methyl
- amino
- salt
- propynyl
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 20
- 238000000034 method Methods 0.000 title claims description 37
- 230000001225 therapeutic effect Effects 0.000 title description 2
- 150000005232 imidazopyridines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 86
- 150000003839 salts Chemical class 0.000 claims abstract description 64
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 30
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 22
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- 125000001424 substituent group Chemical group 0.000 claims abstract description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 9
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims abstract description 8
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 6
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract 4
- -1 imidazopyridine compound Chemical class 0.000 claims description 147
- 238000006243 chemical reaction Methods 0.000 claims description 39
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 13
- 125000006239 protecting group Chemical group 0.000 claims description 9
- RPRUCFCRMFWFGW-UHFFFAOYSA-N methyl n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C RPRUCFCRMFWFGW-UHFFFAOYSA-N 0.000 claims description 8
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 238000006722 reduction reaction Methods 0.000 claims description 5
- 125000005281 alkyl ureido group Chemical group 0.000 claims description 4
- 125000003435 aroyl group Chemical group 0.000 claims description 4
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims description 4
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 5
- 208000025865 Ulcer Diseases 0.000 abstract description 4
- 239000000825 pharmaceutical preparation Substances 0.000 abstract description 4
- 231100000397 ulcer Toxicity 0.000 abstract description 4
- 230000000767 anti-ulcer Effects 0.000 abstract description 3
- 125000004857 imidazopyridinyl group Chemical class N1C(=NC2=C1C=CC=N2)* 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 60
- 239000000203 mixture Substances 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 238000004519 manufacturing process Methods 0.000 description 26
- 239000002904 solvent Substances 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 22
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 19
- 238000004458 analytical method Methods 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 125000001589 carboacyl group Chemical group 0.000 description 11
- 238000004440 column chromatography Methods 0.000 description 11
- VNHBYKHXBCYPBJ-UHFFFAOYSA-N 5-ethynylimidazo[1,2-a]pyridine Chemical compound C#CC1=CC=CC2=NC=CN12 VNHBYKHXBCYPBJ-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- BDQNBWFURXUSAJ-UHFFFAOYSA-N methyl n-[2-(chloromethyl)-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CCl BDQNBWFURXUSAJ-UHFFFAOYSA-N 0.000 description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- WYGLCSFHIBLIKZ-UHFFFAOYSA-N 2-oxohex-5-yn-3-yl methanesulfonate Chemical compound C#CCC(C(=O)C)OS(C)(=O)=O WYGLCSFHIBLIKZ-UHFFFAOYSA-N 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000004423 acyloxy group Chemical group 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000003379 elimination reaction Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- XPOWYMZSOYKPTP-UHFFFAOYSA-N n-[(2-amino-6-methylphenyl)methyl]-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1N XPOWYMZSOYKPTP-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 5
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- TYSKGOAZKBLRRG-UHFFFAOYSA-N 2-hydroxy-n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]propanamide Chemical compound CC(O)C(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C TYSKGOAZKBLRRG-UHFFFAOYSA-N 0.000 description 4
- QYDGXNMMRPTHHZ-UHFFFAOYSA-N 2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound NC1=CC=CN2C(CC#C)=C(C)N=C21 QYDGXNMMRPTHHZ-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- BRAYBQOXUOLFNO-UHFFFAOYSA-N tert-butyl n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1NC(=O)OC(C)(C)C BRAYBQOXUOLFNO-UHFFFAOYSA-N 0.000 description 4
- LOIHCAGCQVZRTR-UHFFFAOYSA-N (2-amino-6-methylphenyl)methanol Chemical compound CC1=CC=CC(N)=C1CO LOIHCAGCQVZRTR-UHFFFAOYSA-N 0.000 description 3
- SHPUGBIHKJHKFK-UHFFFAOYSA-N 2-hydroxy-n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]acetamide Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1NC(=O)CO SHPUGBIHKJHKFK-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- ZGGCWWJBDJEBKZ-UHFFFAOYSA-N [1-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]anilino]-1-oxopropan-2-yl] acetate Chemical compound CC(=O)OC(C)C(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C ZGGCWWJBDJEBKZ-UHFFFAOYSA-N 0.000 description 3
- QAKHLHYJCWDMDX-UHFFFAOYSA-N [2-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]anilino]-2-oxoethyl] acetate Chemical compound CC(=O)OCC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C QAKHLHYJCWDMDX-UHFFFAOYSA-N 0.000 description 3
- KLDRRRNSUUGDQL-UHFFFAOYSA-N [3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]urea Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1NC(N)=O KLDRRRNSUUGDQL-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000009858 acid secretion Effects 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 3
- IJOYUOANBXRQRC-UHFFFAOYSA-N methyl 8-[[2-(methoxycarbonylamino)-6-methylphenyl]methylamino]-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridine-6-carboxylate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(C(=O)OC)=CN2C1=NC(C)=C2CC#C IJOYUOANBXRQRC-UHFFFAOYSA-N 0.000 description 3
- FODYBFAMPQBNIP-UHFFFAOYSA-N methyl n-[2-[[(2,5-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=C(C)N2C1=NC(C)=C2CC#C FODYBFAMPQBNIP-UHFFFAOYSA-N 0.000 description 3
- SYIAYIILRXUVFX-UHFFFAOYSA-N methyl n-[2-[[(2-aminopyridin-3-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN=C1N SYIAYIILRXUVFX-UHFFFAOYSA-N 0.000 description 3
- XINSFTKRKITMMP-UHFFFAOYSA-N methyl n-[2-[[(5-acetamido-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=C(NC(C)=O)N2C1=NC(C)=C2CC#C XINSFTKRKITMMP-UHFFFAOYSA-N 0.000 description 3
- JBAOTOGOHWOACG-UHFFFAOYSA-N methyl n-[2-[[(6-acetamido-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(NC(C)=O)=CN2C1=NC(C)=C2CC#C JBAOTOGOHWOACG-UHFFFAOYSA-N 0.000 description 3
- OMTXYGOYSSMFLX-UHFFFAOYSA-N methyl n-[2-[[(6-chloro-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(Cl)=CN2C1=NC(C)=C2CC#C OMTXYGOYSSMFLX-UHFFFAOYSA-N 0.000 description 3
- VIUQPQCGNYVUTH-UHFFFAOYSA-N methyl n-[2-[[[6-(dimethylsulfamoyl)-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl]amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(S(=O)(=O)N(C)C)=CN2C1=NC(C)=C2CC#C VIUQPQCGNYVUTH-UHFFFAOYSA-N 0.000 description 3
- NYZSHRYPSPJIRM-UHFFFAOYSA-N methyl n-[3-methyl-2-[[(2-methyl-6-nitro-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC([N+]([O-])=O)=CN2C1=NC(C)=C2CC#C NYZSHRYPSPJIRM-UHFFFAOYSA-N 0.000 description 3
- BXAAGXQBOOAKDI-UHFFFAOYSA-N methyl n-[3-methyl-2-[[[2-methyl-3-prop-2-ynyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl]amino]methyl]phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(C(F)(F)F)=CN2C1=NC(C)=C2CC#C BXAAGXQBOOAKDI-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- DRMCULNGNIWVKD-UHFFFAOYSA-N n-[[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamothioyl]benzamide Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1NC(=S)NC(=O)C1=CC=CC=C1 DRMCULNGNIWVKD-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HMNOWJXZZZWUGM-UHFFFAOYSA-N 1-methyl-3-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]urea Chemical compound CNC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C HMNOWJXZZZWUGM-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 102100021022 Gastrin Human genes 0.000 description 2
- 108010052343 Gastrins Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- XTZNCVSCVHTPAI-UHFFFAOYSA-N Salmeterol xinafoate Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CC=C21.C1=C(O)C(CO)=CC(C(O)CNCCCCCCOCCCCC=2C=CC=CC=2)=C1 XTZNCVSCVHTPAI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 2
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- UDPPGOBZKNOXKG-UHFFFAOYSA-N ethyl n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]carbamate Chemical compound CCOC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C UDPPGOBZKNOXKG-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- MKTVQURZAPBXKN-UHFFFAOYSA-N methyl n-(2-formyl-3-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1C=O MKTVQURZAPBXKN-UHFFFAOYSA-N 0.000 description 2
- ZLWZXWGDYTXSKK-UHFFFAOYSA-N methyl n-[2-[[(2,7-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=C(C)C=CN2C1=NC(C)=C2CC#C ZLWZXWGDYTXSKK-UHFFFAOYSA-N 0.000 description 2
- UIMPQPIXAGNIBM-UHFFFAOYSA-N methyl n-[2-[[(5-chloro-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=C(Cl)N2C1=NC(C)=C2CC#C UIMPQPIXAGNIBM-UHFFFAOYSA-N 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- GFAFQSQABQVTDQ-UHFFFAOYSA-N n-[2-(chloromethyl)-3-methylphenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(C)=C1CCl GFAFQSQABQVTDQ-UHFFFAOYSA-N 0.000 description 2
- IFZZAZZEZPBTMG-UHFFFAOYSA-N n-[3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]propanamide Chemical compound CCC(=O)NC1=CC=CC(C)=C1CNC1=CC=CN2C1=NC(C)=C2CC#C IFZZAZZEZPBTMG-UHFFFAOYSA-N 0.000 description 2
- 231100000989 no adverse effect Toxicity 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- CUTFOSSLIVVFDF-UHFFFAOYSA-N 2,5-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound NC1=CC=C(C)N2C(CC#C)=C(C)N=C21 CUTFOSSLIVVFDF-UHFFFAOYSA-N 0.000 description 1
- NFOYBSKKWQOHBJ-UHFFFAOYSA-N 2,6-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound NC1=CC(C)=CN2C(CC#C)=C(C)N=C21 NFOYBSKKWQOHBJ-UHFFFAOYSA-N 0.000 description 1
- BROWYQJKKRYAIX-UHFFFAOYSA-N 2,7-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound NC1=C(C)C=CN2C(CC#C)=C(C)N=C21 BROWYQJKKRYAIX-UHFFFAOYSA-N 0.000 description 1
- AMOYMEBHYUTMKJ-UHFFFAOYSA-N 2-(2-phenylethoxy)ethylbenzene Chemical compound C=1C=CC=CC=1CCOCCC1=CC=CC=C1 AMOYMEBHYUTMKJ-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- FETAMGUXMBZISE-UHFFFAOYSA-N 2-amino-6-methylbenzaldehyde Chemical compound CC1=CC=CC(N)=C1C=O FETAMGUXMBZISE-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- AVZBOAGCVKEESJ-UHFFFAOYSA-O 2-ethyl-1,2-benzoxazol-2-ium-7-ol Chemical class C1=CC(O)=C2O[N+](CC)=CC2=C1 AVZBOAGCVKEESJ-UHFFFAOYSA-O 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- MDQHTWMXYBVSHU-UHFFFAOYSA-N 2-trimethylsilylacetamide Chemical compound C[Si](C)(C)CC(N)=O MDQHTWMXYBVSHU-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- RWGGFJXJRPCCGD-UHFFFAOYSA-N 4-methylpyridine-2,3-diamine Chemical compound CC1=CC=NC(N)=C1N RWGGFJXJRPCCGD-UHFFFAOYSA-N 0.000 description 1
- GNZLREQLWHGCSX-UHFFFAOYSA-N 5,6-diamino-n,n-dimethylpyridine-3-sulfonamide Chemical compound CN(C)S(=O)(=O)C1=CN=C(N)C(N)=C1 GNZLREQLWHGCSX-UHFFFAOYSA-N 0.000 description 1
- RNSZENVDZWTPPG-UHFFFAOYSA-N 5-(trifluoromethyl)pyridine-2,3-diamine Chemical compound NC1=CC(C(F)(F)F)=CN=C1N RNSZENVDZWTPPG-UHFFFAOYSA-N 0.000 description 1
- ZRCMCGQDIYNWDX-UHFFFAOYSA-N 5-chloropyridine-2,3-diamine Chemical compound NC1=CC(Cl)=CN=C1N ZRCMCGQDIYNWDX-UHFFFAOYSA-N 0.000 description 1
- AITFREYTVOPXOT-UHFFFAOYSA-N 5-methylpyridine-2,3-diamine Chemical compound CC1=CN=C(N)C(N)=C1 AITFREYTVOPXOT-UHFFFAOYSA-N 0.000 description 1
- JOQJNCSAEMIZOU-UHFFFAOYSA-N 5-nitropyridine-2,3-diamine Chemical compound NC1=CC([N+]([O-])=O)=CN=C1N JOQJNCSAEMIZOU-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- ZYOFNUANFHDYQE-UHFFFAOYSA-N 6-chloro-2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-amine Chemical compound NC1=CC(Cl)=CN2C(CC#C)=C(C)N=C21 ZYOFNUANFHDYQE-UHFFFAOYSA-N 0.000 description 1
- QEIRYIILFUVXAM-UHFFFAOYSA-N 6-chloropyridine-2,3-diamine Chemical compound NC1=CC=C(Cl)N=C1N QEIRYIILFUVXAM-UHFFFAOYSA-N 0.000 description 1
- XATOCNYGIWXIQM-UHFFFAOYSA-N 6-methylpyridine-2,3-diamine Chemical compound CC1=CC=C(N)C(N)=N1 XATOCNYGIWXIQM-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 206010042220 Stress ulcer Diseases 0.000 description 1
- 108010012944 Tetragastrin Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- SVSMNNWVHRRWOV-UHFFFAOYSA-N [3-methyl-2-[[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]phenyl]thiourea Chemical compound C=1C=CN2C(CC#C)=C(C)N=C2C=1NCC1=C(C)C=CC=C1NC(N)=S SVSMNNWVHRRWOV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000316 alkaline earth metal phosphate Inorganic materials 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- FLLNLJJKHKZKMB-UHFFFAOYSA-N boron;tetramethylazanium Chemical compound [B].C[N+](C)(C)C FLLNLJJKHKZKMB-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- CJYQQUPRURWLOW-YDLUHMIOSA-M dmsc Chemical compound [Na+].OP(=O)=O.OP(=O)=O.OP(=O)=O.[O-]P(=O)=O.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]1[C@H]2O CJYQQUPRURWLOW-YDLUHMIOSA-M 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- XAZLLXDFOJYFOR-UHFFFAOYSA-N ethyl n-[2-(chloromethyl)-3-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=CC(C)=C1CCl XAZLLXDFOJYFOR-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- VEPSWGHMGZQCIN-UHFFFAOYSA-H ferric oxalate Chemical compound [Fe+3].[Fe+3].[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O.[O-]C(=O)C([O-])=O VEPSWGHMGZQCIN-UHFFFAOYSA-H 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 125000000350 glycoloyl group Chemical group O=C([*])C([H])([H])O[H] 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- PDJAZCSYYQODQF-UHFFFAOYSA-N iodine monofluoride Chemical compound IF PDJAZCSYYQODQF-UHFFFAOYSA-N 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- KZFTZZIOEVUOOT-UHFFFAOYSA-N methyl 5,6-diaminopyridine-3-carboxylate Chemical compound COC(=O)C1=CN=C(N)C(N)=C1 KZFTZZIOEVUOOT-UHFFFAOYSA-N 0.000 description 1
- QFNHAUBDOIMJPK-UHFFFAOYSA-N methyl 6-amino-5-[[2-(methoxycarbonylamino)-6-methylphenyl]methylamino]pyridine-3-carboxylate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(C(=O)OC)=CN=C1N QFNHAUBDOIMJPK-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- LMDAPNNHIGIBQH-UHFFFAOYSA-N methyl n-[2-[(2-aminopyridin-3-yl)iminomethyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1C=NC1=CC=CN=C1N LMDAPNNHIGIBQH-UHFFFAOYSA-N 0.000 description 1
- WWZFGZJNWIFEQE-UHFFFAOYSA-N methyl n-[2-[[(2,6-dimethyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(C)=CN2C1=NC(C)=C2CC#C WWZFGZJNWIFEQE-UHFFFAOYSA-N 0.000 description 1
- IGHWUQJWZGNWQA-UHFFFAOYSA-N methyl n-[2-[[(2-amino-5-nitropyridin-3-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC([N+]([O-])=O)=CN=C1N IGHWUQJWZGNWQA-UHFFFAOYSA-N 0.000 description 1
- JBRFTDLWWXGLEZ-UHFFFAOYSA-N methyl n-[2-[[(2-amino-6-chloropyridin-3-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=C(Cl)N=C1N JBRFTDLWWXGLEZ-UHFFFAOYSA-N 0.000 description 1
- ZPHREGLVIYRTBE-UHFFFAOYSA-N methyl n-[2-[[(6-acetamido-2-aminopyridin-3-yl)amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC=C(NC(C)=O)N=C1N ZPHREGLVIYRTBE-UHFFFAOYSA-N 0.000 description 1
- KKMOWGBARODZIB-UHFFFAOYSA-N methyl n-[2-[[[2-amino-5-(dimethylsulfamoyl)pyridin-3-yl]amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(S(=O)(=O)N(C)C)=CN=C1N KKMOWGBARODZIB-UHFFFAOYSA-N 0.000 description 1
- ZGVCMUJZNVIXCA-UHFFFAOYSA-N methyl n-[2-[[[2-amino-5-(trifluoromethyl)pyridin-3-yl]amino]methyl]-3-methylphenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1CNC1=CC(C(F)(F)F)=CN=C1N ZGVCMUJZNVIXCA-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- DGEQCFRQROTERF-UHFFFAOYSA-N n-(5,6-diaminopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C(N)=N1 DGEQCFRQROTERF-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001308 pyruvoyl group Chemical group O=C([*])C(=O)C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- DASHHAJXFSJHIG-UHFFFAOYSA-N tert-butyl n-[2-(chloromethyl)-3-methylphenyl]carbamate Chemical compound CC1=CC=CC(NC(=O)OC(C)(C)C)=C1CCl DASHHAJXFSJHIG-UHFFFAOYSA-N 0.000 description 1
- 125000005934 tert-pentyloxycarbonyl group Chemical group 0.000 description 1
- RGYLYUZOGHTBRF-BIHRQFPBSA-N tetragastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C2=CC=CC=C2NC=1)CCSC)C(N)=O)C1=CC=CC=C1 RGYLYUZOGHTBRF-BIHRQFPBSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB878722488A GB8722488D0 (en) | 1987-09-24 | 1987-09-24 | Imidazopyridine compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO884231D0 NO884231D0 (no) | 1988-09-23 |
| NO884231L true NO884231L (no) | 1989-03-28 |
Family
ID=10624306
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO88884231A NO884231L (no) | 1987-09-24 | 1988-09-23 | Fremgangsmaate for fremstilling av terapeutisk aktive imidazopyridin-derivater. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4920129A (ko) |
| EP (1) | EP0308917A3 (ko) |
| JP (1) | JPH01151579A (ko) |
| KR (1) | KR890005100A (ko) |
| CN (1) | CN1033628A (ko) |
| AU (1) | AU2278388A (ko) |
| DK (1) | DK532088A (ko) |
| FI (1) | FI884318A (ko) |
| GB (1) | GB8722488D0 (ko) |
| HU (1) | HU201934B (ko) |
| IL (1) | IL87809A0 (ko) |
| NO (1) | NO884231L (ko) |
| ZA (1) | ZA886831B (ko) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1327796C (en) * | 1987-07-16 | 1994-03-15 | Jorg Senn-Bilfinger | Diazoles |
| CA2082796A1 (en) * | 1990-05-25 | 1991-11-26 | Mitsuaki Ohta | Tetrahydroimidazopyridine derivatives and salts thereof |
| US5244908A (en) * | 1990-07-30 | 1993-09-14 | Takeda Chemical Industries, Ltd. | Imidazopyridine derivatives and their pharmaceutical use |
| IL108520A (en) * | 1993-02-15 | 1997-09-30 | Byk Gulden Lomberg Chem Fab | 2, 3, 8-TRISUBSTITUTED IMIDAZO £1, 2-a| PYRIDINE DERIVATIVES, PROCESSES FOR THE PREPARATION THEREOF AND PHARMACEUTICAL COMPOSITIONS CONTAINING THEM |
| UA48122C2 (uk) * | 1993-10-11 | 2002-08-15 | Бік Гульден Ломберг Хеміше Фабрік Гмбх | АЛКОКСІАЛКІЛКАРБАМАТИ ІМІДАЗО[1,2-а]ПІРИДИНІВ, СПОСІБ ЇХ ОДЕРЖАННЯ ТА ЛІКАРСЬКИЙ ЗАСІБ НА ЇХ ОСНОВІ |
| EP0773944A1 (de) * | 1994-07-28 | 1997-05-21 | Byk Gulden Lomberg Chemische Fabrik GmbH | Benzylimidazopyridine |
| JPH10505330A (ja) * | 1994-07-28 | 1998-05-26 | ビイク グルデン ロンベルク ヒェーミッシェ ファブリーク ゲゼルシャフト ミット ベシュレンクテル ハフツング | ハロゲンイミダゾピリジン |
| CA2196076A1 (en) * | 1994-07-28 | 1996-02-08 | Gerhard Grundler | Acyl imidazopyridines |
| CZ22697A3 (en) * | 1994-07-28 | 1997-07-16 | Byk Gulden Lomberg Chem Fab | Imidazopyridine-azolidinone derivatives, process of their preparation and pharmaceutical composition containing thereof |
| WO1997027193A1 (de) * | 1996-01-26 | 1997-07-31 | Byk Gulden Lomberg Chemische Fabrik Gmbh | Halogenimidazopyridine |
| DE59712297D1 (de) * | 1996-01-26 | 2005-06-09 | Altana Pharma Ag | 3-alkylimidazopyridine |
| SE9801526D0 (sv) * | 1998-04-29 | 1998-04-29 | Astra Ab | New compounds |
| US20050037490A1 (en) * | 1999-10-29 | 2005-02-17 | Lawrence Rosenberg | Medium for preparing dedifferentiated cells |
| US6900324B2 (en) | 2000-09-07 | 2005-05-31 | Astrazeneca Ab | Process for preparing a substituted imidazopyridine compound |
| SE0003186D0 (sv) * | 2000-09-07 | 2000-09-07 | Astrazeneca Ab | New process |
| UA80393C2 (uk) | 2000-12-07 | 2007-09-25 | Алтана Фарма Аг | Фармацевтична композиція, яка містить інгібітор фде 4, диспергований в матриці |
| DE10145457A1 (de) | 2001-09-14 | 2003-04-03 | Basf Ag | Substituierte Imidazo[1,2-a]-5,6,7,8-tetrahydropyridin-8-one, Verfahren zu ihrer Herstellung, sowie deren Verwendung zur Herstellung von Imidazo[1,2,-a]pyridinen |
| MY140561A (en) | 2002-02-20 | 2009-12-31 | Nycomed Gmbh | Dosage form containing pde 4 inhibitor as active ingredient |
| KR101179012B1 (ko) | 2003-03-10 | 2012-09-03 | 니코메드 게엠베하 | 로플루미라스트 신규한 제조 방법 |
| EP1682133A1 (en) | 2003-11-03 | 2006-07-26 | AstraZeneca AB | Imidazo 1,2-a pyridine derivatives for the treatment of silent gastro-esophageal reflux |
| US7585997B2 (en) * | 2003-12-31 | 2009-09-08 | Chesterford Enterprises Limited | Compounds and compositions for treating dysproliferative diseases, and methods of use thereof |
| WO2006065204A1 (en) * | 2004-12-14 | 2006-06-22 | Astrazeneca Ab | Substituted aminopyridines and uses thereof |
| EP1861074B1 (en) * | 2005-03-16 | 2013-04-24 | Takeda GmbH | Taste masked dosage form containing roflumilast |
| BR112015014855A2 (pt) * | 2012-12-20 | 2017-07-11 | Qing Bin Lu | compostos radiossensibilizadores para uso em combinação com radiação |
| US9623047B2 (en) | 2012-12-27 | 2017-04-18 | Photo Finish Supplements, Llc | Composition and method for improving gastrointestinal health of equine |
| KR101777971B1 (ko) | 2016-07-05 | 2017-09-12 | 제일약품주식회사 | 이미다조[1,2-a]피리딘 유도체, 이의 제조방법 및 이의 용도 |
| MX2023010902A (es) | 2021-03-18 | 2023-09-27 | Seagen Inc | Liberacion selectiva de farmacos a partir de conjugados internalizados de compuestos biologicamente activos. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA81219B (en) * | 1980-01-23 | 1982-01-27 | Schering Corp | Imidazo (1,2-a) pyridines ,process for their preparation and pharmaceutical compositions containing them |
| US4725601A (en) * | 1985-06-04 | 1988-02-16 | Fujisawa Pharmaceutical Co., Ltd. | Certain imidazo[1,2-a]pyridines useful in the treatment of ulcers |
| US4831041A (en) * | 1986-11-26 | 1989-05-16 | Fujisawa Pharmaceutical Co., Ltd. | Imidazopyridine compounds and processes for preparation thereof |
-
1987
- 1987-09-24 GB GB878722488A patent/GB8722488D0/en active Pending
-
1988
- 1988-09-13 ZA ZA886831A patent/ZA886831B/xx unknown
- 1988-09-19 IL IL87809A patent/IL87809A0/xx unknown
- 1988-09-21 FI FI884318A patent/FI884318A/fi not_active Application Discontinuation
- 1988-09-22 EP EP88115541A patent/EP0308917A3/en not_active Withdrawn
- 1988-09-22 US US07/247,657 patent/US4920129A/en not_active Expired - Fee Related
- 1988-09-22 JP JP63238522A patent/JPH01151579A/ja active Pending
- 1988-09-23 CN CN88106859A patent/CN1033628A/zh active Pending
- 1988-09-23 KR KR1019880012440A patent/KR890005100A/ko not_active Application Discontinuation
- 1988-09-23 DK DK532088A patent/DK532088A/da not_active Application Discontinuation
- 1988-09-23 AU AU22783/88A patent/AU2278388A/en not_active Abandoned
- 1988-09-23 HU HU884996A patent/HU201934B/hu not_active IP Right Cessation
- 1988-09-23 NO NO88884231A patent/NO884231L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK532088D0 (da) | 1988-09-23 |
| KR890005100A (ko) | 1989-05-11 |
| HU201934B (en) | 1991-01-28 |
| DK532088A (da) | 1989-03-25 |
| EP0308917A3 (en) | 1990-07-11 |
| NO884231D0 (no) | 1988-09-23 |
| FI884318A (fi) | 1989-03-25 |
| US4920129A (en) | 1990-04-24 |
| EP0308917A2 (en) | 1989-03-29 |
| CN1033628A (zh) | 1989-07-05 |
| AU2278388A (en) | 1989-04-06 |
| HUT48245A (en) | 1989-05-29 |
| ZA886831B (en) | 1989-05-30 |
| FI884318A0 (fi) | 1988-09-21 |
| GB8722488D0 (en) | 1987-10-28 |
| IL87809A0 (en) | 1989-03-31 |
| JPH01151579A (ja) | 1989-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO884231L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive imidazopyridin-derivater. | |
| US4831041A (en) | Imidazopyridine compounds and processes for preparation thereof | |
| JP2848230B2 (ja) | 三環式化合物 | |
| KR910007976B1 (ko) | 티아졸 유도체의 제조방법 | |
| KR0147281B1 (ko) | 헤테로사이클릭 치환된 아실아미노티아졸 그 제조방법 및 그 화합물을 포함하는 약학적 조성물 | |
| JPH07252256A (ja) | 新規複素環誘導体 | |
| CA2896813A1 (en) | Protein kinase inhibitors | |
| JP2007510646A5 (ko) | ||
| EP0257897A1 (en) | Imidazole compounds, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| HU211275A9 (en) | New heterocyclic compounds | |
| AU2010246540A1 (en) | Inhibitors of protein tyrosine kinase activity | |
| EP0120589A1 (en) | Imidazo-heterocyclic compounds, processes for preparation thereof and pharmaceutical composition comprising the same | |
| RU2190612C2 (ru) | Новые производные индол-2,3-дион-3-оксима | |
| EP0807633A2 (en) | Novel 2,3-disubstituted-(5,6)- heteroarylfused-pyrimidine-4-ones | |
| NO171852B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive cefemforbindelser med to substituerte 5-leddede ringer | |
| US4782055A (en) | Imidazopyridine compounds useful in the treatment of ulcers | |
| JPH1087629A (ja) | 新規イソキノリン誘導体、およびその医薬用途 | |
| JPH08337583A (ja) | 複素環化合物およびその製造法 | |
| EP0900799B1 (en) | Novel atropisomers of 2,3-disubstituted-(5,6)-heteroarylfused-pyrimidin-4-ones | |
| AU7935298A (en) | Novel naphthyridine derivatives or salts thereof | |
| HU197749B (en) | Process for producing /3,4-d/pyrimidine derivatives and pharmaceutical compositions comprising these compounds as active ingredient | |
| EP0595924B1 (en) | Platelet activating factor antagonists | |
| JPH05222000A (ja) | ベンズイミダゾール誘導体およびその製造方法 | |
| HUT71352A (en) | Heterocyclic derivatives | |
| JPH05213971A (ja) | 新規セフェム化合物 |