NO871594L - Fenyl-piperazin-derivater. - Google Patents
Fenyl-piperazin-derivater.Info
- Publication number
- NO871594L NO871594L NO871594A NO871594A NO871594L NO 871594 L NO871594 L NO 871594L NO 871594 A NO871594 A NO 871594A NO 871594 A NO871594 A NO 871594A NO 871594 L NO871594 L NO 871594L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- alkyl
- pyridyl
- compound
- form compounds
- Prior art date
Links
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical class C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 title claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 103
- 238000000034 method Methods 0.000 claims description 41
- 239000000203 mixture Substances 0.000 claims description 39
- -1 2-imidazolyl Chemical group 0.000 claims description 34
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 14
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 11
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 11
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 8
- 230000009467 reduction Effects 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- ABOYDMHGKWRPFD-UHFFFAOYSA-N phenylmethanesulfonamide Chemical compound NS(=O)(=O)CC1=CC=CC=C1 ABOYDMHGKWRPFD-UHFFFAOYSA-N 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 150000005748 halopyridines Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 150000001266 acyl halides Chemical class 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- JTVLDOZYZPSYDW-UHFFFAOYSA-N n-[4-[4-(4-nitropyridin-2-yl)piperazin-1-yl]phenyl]methanesulfonamide Chemical compound C1=CC(NS(=O)(=O)C)=CC=C1N1CCN(C=2N=CC=C(C=2)[N+]([O-])=O)CC1 JTVLDOZYZPSYDW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 claims description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims 1
- 229910003844 NSO2 Inorganic materials 0.000 claims 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 69
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 45
- 239000000047 product Substances 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 239000007787 solid Substances 0.000 description 22
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 8
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 6
- RJBAGSFWPCJRIT-UHFFFAOYSA-N 4-(4-pyridin-4-ylpiperazin-1-yl)aniline Chemical compound C1=CC(N)=CC=C1N1CCN(C=2C=CN=CC=2)CC1 RJBAGSFWPCJRIT-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 206010003119 arrhythmia Diseases 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- OQZBAQXTXNIPRA-UHFFFAOYSA-N 1-pyridin-4-ylpiperazine Chemical compound C1CNCCN1C1=CC=NC=C1 OQZBAQXTXNIPRA-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000003416 antiarrhythmic agent Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- DAHFLELRTZVUKW-UHFFFAOYSA-N 1-(1-methylimidazol-2-yl)-4-(4-nitrophenyl)piperazine Chemical compound CN1C=CN=C1N1CCN(C=2C=CC(=CC=2)[N+]([O-])=O)CC1 DAHFLELRTZVUKW-UHFFFAOYSA-N 0.000 description 3
- FIPQSNSVDULSJM-UHFFFAOYSA-N 1-(2-methylpyridin-4-yl)piperazine Chemical compound C1=NC(C)=CC(N2CCNCC2)=C1 FIPQSNSVDULSJM-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- 230000006793 arrhythmia Effects 0.000 description 3
- 230000001746 atrial effect Effects 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 230000002861 ventricular Effects 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- MRIXZZDFPKRTIO-UHFFFAOYSA-N 4-[4-(1,5-dimethylimidazol-2-yl)piperazin-1-yl]aniline Chemical compound CN1C(C)=CN=C1N1CCN(C=2C=CC(N)=CC=2)CC1 MRIXZZDFPKRTIO-UHFFFAOYSA-N 0.000 description 2
- CLFCPUVAINSFJI-UHFFFAOYSA-N 4-[4-(1-methylimidazol-2-yl)piperazin-1-yl]aniline Chemical compound CN1C=CN=C1N1CCN(C=2C=CC(N)=CC=2)CC1 CLFCPUVAINSFJI-UHFFFAOYSA-N 0.000 description 2
- AOEWLGJSBGMCLO-UHFFFAOYSA-N 4-[4-(2-methylpyridin-4-yl)piperazin-1-yl]aniline Chemical compound C1=NC(C)=CC(N2CCN(CC2)C=2C=CC(N)=CC=2)=C1 AOEWLGJSBGMCLO-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 206010042600 Supraventricular arrhythmias Diseases 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 206010047281 Ventricular arrhythmia Diseases 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- XEVRDFDBXJMZFG-UHFFFAOYSA-N carbonyl dihydrazine Chemical compound NNC(=O)NN XEVRDFDBXJMZFG-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 210000002837 heart atrium Anatomy 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 210000003205 muscle Anatomy 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002504 physiological saline solution Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 208000003663 ventricular fibrillation Diseases 0.000 description 2
- IIJSGELUDDNORD-UHFFFAOYSA-N 1-(1,5-dimethylimidazol-2-yl)-4-(4-nitrophenyl)piperazine Chemical compound CN1C(C)=CN=C1N1CCN(C=2C=CC(=CC=2)[N+]([O-])=O)CC1 IIJSGELUDDNORD-UHFFFAOYSA-N 0.000 description 1
- FQZLZYQOQIIHDL-UHFFFAOYSA-N 1-(2-methylpyridin-4-yl)-4-(4-nitrophenyl)piperazine Chemical compound C1=NC(C)=CC(N2CCN(CC2)C=2C=CC(=CC=2)[N+]([O-])=O)=C1 FQZLZYQOQIIHDL-UHFFFAOYSA-N 0.000 description 1
- XCMIZXWXNZQJDJ-UHFFFAOYSA-N 1-(3-methylpyridin-4-yl)-4-(4-nitrophenyl)piperazine Chemical compound CC1=CN=CC=C1N1CCN(C=2C=CC(=CC=2)[N+]([O-])=O)CC1 XCMIZXWXNZQJDJ-UHFFFAOYSA-N 0.000 description 1
- QIELQJJSSZTEJW-UHFFFAOYSA-N 1-(3-methylpyridin-4-yl)piperazine Chemical compound CC1=CN=CC=C1N1CCNCC1 QIELQJJSSZTEJW-UHFFFAOYSA-N 0.000 description 1
- CUOTYNOZPMJLBX-UHFFFAOYSA-N 1-(4-nitrophenyl)-4-pyridin-2-ylpiperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCN(C=2N=CC=CC=2)CC1 CUOTYNOZPMJLBX-UHFFFAOYSA-N 0.000 description 1
- PDPKKGUSHFEBDZ-UHFFFAOYSA-N 1-(4-nitrophenyl)-4-pyridin-4-ylpiperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCN(C=2C=CN=CC=2)CC1 PDPKKGUSHFEBDZ-UHFFFAOYSA-N 0.000 description 1
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 1
- AFVUJJNEILZYJQ-UHFFFAOYSA-N 1-[4-(4-aminophenyl)-1-piperazinyl]ethanone Chemical compound C1CN(C(=O)C)CCN1C1=CC=C(N)C=C1 AFVUJJNEILZYJQ-UHFFFAOYSA-N 0.000 description 1
- QUZMCJMGHMRZHA-UHFFFAOYSA-N 1-[4-(4-nitrophenyl)piperazin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCN1C1=CC=C([N+]([O-])=O)C=C1 QUZMCJMGHMRZHA-UHFFFAOYSA-N 0.000 description 1
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 1
- LYIIBVSRGJSHAV-UHFFFAOYSA-N 2-aminoacetaldehyde Chemical compound NCC=O LYIIBVSRGJSHAV-UHFFFAOYSA-N 0.000 description 1
- LIEPVGBDUYKPLC-UHFFFAOYSA-N 2-chloro-4-nitropyridine Chemical compound [O-][N+](=O)C1=CC=NC(Cl)=C1 LIEPVGBDUYKPLC-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- QDACQOOLIVCDNP-UHFFFAOYSA-N 2-nitro-1-oxidopyridin-1-ium Chemical compound [O-][N+](=O)C1=CC=CC=[N+]1[O-] QDACQOOLIVCDNP-UHFFFAOYSA-N 0.000 description 1
- HLTDBMHJSBSAOM-UHFFFAOYSA-N 2-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CC=N1 HLTDBMHJSBSAOM-UHFFFAOYSA-N 0.000 description 1
- HYRSKOBIXWROEI-UHFFFAOYSA-N 3-chloro-2-nitro-1-oxidopyridin-1-ium Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=[N+]1[O-] HYRSKOBIXWROEI-UHFFFAOYSA-N 0.000 description 1
- MBHLTDWOVIYXEW-UHFFFAOYSA-N 3-chloro-4-nitro-1-oxidopyridin-1-ium Chemical compound [O-][N+](=O)C1=CC=[N+]([O-])C=C1Cl MBHLTDWOVIYXEW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- NIIDHHVRWBGULA-UHFFFAOYSA-N 4-(4-pyridin-3-ylpiperazin-1-yl)aniline Chemical compound C1=CC(N)=CC=C1N1CCN(C=2C=NC=CC=2)CC1 NIIDHHVRWBGULA-UHFFFAOYSA-N 0.000 description 1
- ZVMCENOJZASNTF-UHFFFAOYSA-N 4-chloro-2-methylpyridine;nitric acid Chemical compound O[N+]([O-])=O.CC1=CC(Cl)=CC=N1 ZVMCENOJZASNTF-UHFFFAOYSA-N 0.000 description 1
- JORBLRWFTPDRLZ-UHFFFAOYSA-N 4-chloropyridine-2-carbohydrazide Chemical compound NNC(=O)C1=CC(Cl)=CC=N1 JORBLRWFTPDRLZ-UHFFFAOYSA-N 0.000 description 1
- LFLSATHZMYYIAQ-UHFFFAOYSA-N 4-flourobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(F)C=C1 LFLSATHZMYYIAQ-UHFFFAOYSA-N 0.000 description 1
- RDRBNXNITJCMPV-UHFFFAOYSA-N 4-fluoro-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(F)C=C1 RDRBNXNITJCMPV-UHFFFAOYSA-N 0.000 description 1
- AEKVBBNGWBBYLL-UHFFFAOYSA-N 4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C=C1 AEKVBBNGWBBYLL-UHFFFAOYSA-N 0.000 description 1
- VAVOYRCCWLRTMS-UHFFFAOYSA-N 4-piperazin-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCNCC1 VAVOYRCCWLRTMS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- 206010003658 Atrial Fibrillation Diseases 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000036982 action potential Effects 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000005171 halobenzenes Chemical class 0.000 description 1
- QULAJXAYTLPVCP-UHFFFAOYSA-N hydrazine;pyridine-2-carboxylic acid Chemical compound NN.OC(=O)C1=CC=CC=N1 QULAJXAYTLPVCP-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 150000007928 imidazolide derivatives Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- USJUUYYGHABIBU-UHFFFAOYSA-N methanesulfonamide;hydrochloride Chemical compound Cl.CS(N)(=O)=O USJUUYYGHABIBU-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- XTCHLADGBZLOCT-UHFFFAOYSA-N n-(4-piperazin-1-ylphenyl)methanesulfonamide;hydrochloride Chemical compound Cl.C1=CC(NS(=O)(=O)C)=CC=C1N1CCNCC1 XTCHLADGBZLOCT-UHFFFAOYSA-N 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 210000003540 papillary muscle Anatomy 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- DHEVFPWZNUQDAF-UHFFFAOYSA-N piperazin-1-ylmethanesulfonamide Chemical compound NS(=O)(=O)CN1CCNCC1 DHEVFPWZNUQDAF-UHFFFAOYSA-N 0.000 description 1
- 230000009090 positive inotropic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000000644 propagated effect Effects 0.000 description 1
- BAQLNPIEFOYKNB-UHFFFAOYSA-N pyridine-2-carbohydrazide Chemical compound NNC(=O)C1=CC=CC=N1 BAQLNPIEFOYKNB-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/04—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB868609630A GB8609630D0 (en) | 1986-04-19 | 1986-04-19 | Anti-arrhythmia agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO871594D0 NO871594D0 (no) | 1987-04-15 |
| NO871594L true NO871594L (no) | 1987-10-20 |
Family
ID=10596521
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO871594A NO871594L (no) | 1986-04-19 | 1987-04-15 | Fenyl-piperazin-derivater. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4788196A (xx) |
| EP (1) | EP0244115A3 (xx) |
| JP (1) | JPS62255480A (xx) |
| KR (1) | KR870010015A (xx) |
| CN (1) | CN87102873A (xx) |
| AU (1) | AU577218B2 (xx) |
| DD (1) | DD261787A5 (xx) |
| DK (1) | DK195587A (xx) |
| FI (1) | FI871694A (xx) |
| GB (1) | GB8609630D0 (xx) |
| HU (1) | HUT44027A (xx) |
| IL (1) | IL82221A0 (xx) |
| MY (1) | MY101208A (xx) |
| NO (1) | NO871594L (xx) |
| PL (1) | PL265207A1 (xx) |
| PT (1) | PT84695B (xx) |
| YU (1) | YU70787A (xx) |
| ZA (1) | ZA872744B (xx) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8800694D0 (en) * | 1988-01-13 | 1988-02-10 | Pfizer Ltd | Antiarrhythmic agents |
| US4906634A (en) * | 1988-03-08 | 1990-03-06 | Schering A.G. | Novel N-[4-(aminosubstituted)phenyl]methanesulfonamides and their use as cardiovascular agents |
| GB8819307D0 (en) * | 1988-08-13 | 1988-09-14 | Pfizer Ltd | Antiarrhythmic agents |
| FR2644787B1 (fr) * | 1989-03-22 | 1995-02-03 | Roussel Uclaf | Nouveaux steroides 21 aminosubstitues, leur procede de preparation et les intermediaires de ce procede, leur application comme medicaments et les compositions pharmaceutiques les contenant |
| US5032604A (en) * | 1989-12-08 | 1991-07-16 | Merck & Co., Inc. | Class III antiarrhythmic agents |
| US5206240A (en) * | 1989-12-08 | 1993-04-27 | Merck & Co., Inc. | Nitrogen-containing spirocycles |
| US5032598A (en) * | 1989-12-08 | 1991-07-16 | Merck & Co., Inc. | Nitrogens containing heterocyclic compounds as class III antiarrhythmic agents |
| US5215989A (en) * | 1989-12-08 | 1993-06-01 | Merck & Co., Inc. | Nitrogen-containing heterocyclic compounds as class III antiarrhythmic agents |
| US5112824A (en) * | 1989-12-08 | 1992-05-12 | Merck & Co., Inc. | Benzofuran compounds as class III antiarrhythmic agents |
| US5356559A (en) * | 1991-07-19 | 1994-10-18 | Hoffmann-La Roche Inc. | Optically active piperazinyl derivatives as liquid crystals |
| US5753659A (en) * | 1993-03-29 | 1998-05-19 | Zeneca Limited | Heterocyclic compouds |
| US5652242A (en) * | 1993-03-29 | 1997-07-29 | Zeneca Limited | Heterocyclic derivatives |
| US5750754A (en) * | 1993-03-29 | 1998-05-12 | Zeneca Limited | Heterocyclic compounds |
| ZW4194A1 (en) * | 1993-03-29 | 1994-12-21 | Zeneca Ltd | Heterocyclic compounds |
| DE69411900T2 (de) * | 1993-03-29 | 1998-12-10 | Zeneca Ltd., London | Heterozyklische derivate als plätchenaggregationsinhibitoren |
| US5382587A (en) * | 1993-06-30 | 1995-01-17 | Merck & Co., Inc. | Spirocycles |
| US5403846A (en) * | 1993-11-22 | 1995-04-04 | Merck & Co., Inc. | Spirocycles |
| GB9326232D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
| GB9326373D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
| US5439914A (en) * | 1994-02-18 | 1995-08-08 | Merck & Co., Inc. | Spirocycles |
| IL115420A0 (en) | 1994-09-26 | 1995-12-31 | Zeneca Ltd | Aminoheterocyclic derivatives |
| US5690944A (en) * | 1994-12-20 | 1997-11-25 | Chesebrough-Pond's Usa Co., Division Of Conopco, Inc. | Cosmetic compositions containing lactate dehydrogenase inhibitors |
| PL318440A1 (en) * | 1995-06-01 | 1997-06-09 | Zeneca Ltd | (-)-(3r)-3-methyl-4-{4-[4-pyridyl)piperazin-1-yl]phenoxy}butyric acid as cellular adhesion inhibitor |
| DK0874836T3 (da) * | 1995-11-17 | 2003-02-10 | Warner Lambert Co | Sulfonamidinhibitorer af matrix metalloproteinaser |
| AU1608397A (en) * | 1996-02-02 | 1997-08-22 | Zeneca Limited | Heterocyclic compounds useful as pharmaceutical agents |
| GB9602166D0 (en) | 1996-02-02 | 1996-04-03 | Zeneca Ltd | Aminoheterocyclic derivatives |
| TR199900303T2 (xx) * | 1996-08-14 | 1999-06-21 | Zeneca Limited | �kame edilmi� pirimidin t�revleri ve bunlar�n farmas�tik kullan�m�. |
| UA56197C2 (uk) | 1996-11-08 | 2003-05-15 | Зенека Лімітед | Гетероциклічні похідні |
| ATE242774T1 (de) | 1997-02-13 | 2003-06-15 | Astrazeneca Ab | Heterozyklische verbindungen die als oxido- squalen-zyklase-inhibitoren anwendung finden |
| JP2001511798A (ja) | 1997-02-13 | 2001-08-14 | ゼネカ・リミテッド | オキシド−スクアレンシクラーゼ抑制剤として有用な複素環化合物 |
| US6083991A (en) | 1997-06-04 | 2000-07-04 | University Of Florida Research Foundation, Inc. | Anti-arrhythmic composition and methods of treatment |
| GB9715895D0 (en) | 1997-07-29 | 1997-10-01 | Zeneca Ltd | Heterocyclic compounds |
| ATE491689T1 (de) * | 1997-10-27 | 2011-01-15 | Neurosearch As | Heteroaryl diazacycloalkane als cholinergische ligande für nikotin-acetylcholin-rezeptoren |
| GB9801392D0 (en) * | 1998-01-22 | 1998-03-18 | Smithkline Beecham Plc | Novel compounds |
| JP4327915B2 (ja) * | 1998-03-30 | 2009-09-09 | 株式会社デ・ウエスタン・セラピテクス研究所 | スルフォンアミド誘導体 |
| GB9902989D0 (en) | 1999-02-11 | 1999-03-31 | Zeneca Ltd | Heterocyclic derivatives |
| US20070249620A1 (en) * | 2004-07-02 | 2007-10-25 | Hitoshi Kurata | Urea Derivative |
| WO2007074753A1 (ja) * | 2005-12-27 | 2007-07-05 | Daiichi Sankyo Company, Limited | 置換されたウレア誘導体を含有する医薬 |
| BRPI0913986A2 (pt) | 2008-03-26 | 2015-10-20 | Daiichi Sankyo Co Ltd | composto, composição farmacêutica, e, uso de um composto |
| MY158927A (en) | 2008-06-12 | 2016-11-30 | Janssen Pharmaceutica Nv | Diamino-pyridine, pyrimidine, and pyridazine modulators of the histamine h4 receptor |
| GB0818241D0 (en) * | 2008-10-06 | 2008-11-12 | Cancer Res Technology | Compounds and their use |
| WO2010141805A1 (en) | 2009-06-05 | 2010-12-09 | Janssen Pharmaceutica Nv | Heterocyclic amides as modulators of trpa1 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL72956C (xx) * | 1947-11-12 | |||
| US2606906A (en) * | 1948-10-14 | 1952-08-12 | American Cyanamid Co | 1-(2-pyridyl) piperazine and process of preparing same |
| DE942029C (de) * | 1951-06-22 | 1956-04-26 | American Cyanamid Co | Verfahren zur Herstellung von neuen, in 1-Stellung substituierten 4-Aminopiperazinderivaten |
| US3306903A (en) * | 1965-10-07 | 1967-02-28 | Council Scient Ind Res | 1-aminopyridyl-4-(phenyl or pyridyl)-piperazines and intermediates |
| US4287195A (en) * | 1978-07-14 | 1981-09-01 | Janssen Pharmaceutica, N.V. | Heterocyclic derivatives of [4-(piperazin-1-yl-phenyloxymethyl)-1,3-dioxolan-2-ylmethyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| US4255575A (en) * | 1979-05-04 | 1981-03-10 | Richardson-Merrell Inc. | 2-Hydroxy-5-(1-hydroxy-2-piperazinylethyl)-benzoic acid derivatives |
| AU2108283A (en) * | 1979-07-13 | 1984-03-29 | Dr. Karl Thomae Gmbh | 2-amino benzoic acid derivatives |
| US4613598A (en) * | 1984-03-13 | 1986-09-23 | Mitsubishi Chemical Industries Limited | Piperazine derivatives and their acid addition salts |
| US4544654A (en) * | 1984-03-20 | 1985-10-01 | Schering A.G. | Substituted sulfonamidobenzamides, antiarrhythmic agents and compositions thereof |
| US4639524A (en) * | 1984-07-09 | 1987-01-27 | G. D. Searle & Co. | Monobasic disobutamide derivatives |
| DE3428526A1 (de) * | 1984-08-02 | 1986-02-13 | Boehringer Mannheim Gmbh, 6800 Mannheim | Neue aminoalkohole, verfahren zu deren herstellung sowie diese verbindung enthaltende arzneimittel |
| US4569801A (en) * | 1984-10-15 | 1986-02-11 | Eli Lilly And Company | Alkylsulfonamidophenylalkylamines |
| US4596827A (en) * | 1984-10-15 | 1986-06-24 | Eli Lilly And Company | Alkylsulfonamidophenylalkylamine compounds used for treating arrhythmia |
| GB8603120D0 (en) * | 1986-02-07 | 1986-03-12 | Pfizer Ltd | Anti-dysrhythmia agents |
| AU7642187A (en) * | 1986-07-01 | 1988-01-29 | Maude, A.E. | Impregnation process and apparatus with a vacuum pump valve control system |
-
1986
- 1986-04-19 GB GB868609630A patent/GB8609630D0/en active Pending
-
1987
- 1987-04-14 EP EP87303234A patent/EP0244115A3/en not_active Ceased
- 1987-04-15 NO NO871594A patent/NO871594L/no unknown
- 1987-04-15 DK DK195587A patent/DK195587A/da not_active Application Discontinuation
- 1987-04-15 CN CN198787102873A patent/CN87102873A/zh active Pending
- 1987-04-16 ZA ZA872744A patent/ZA872744B/xx unknown
- 1987-04-16 IL IL82221A patent/IL82221A0/xx unknown
- 1987-04-16 FI FI871694A patent/FI871694A/fi not_active Application Discontinuation
- 1987-04-16 PT PT84695A patent/PT84695B/pt unknown
- 1987-04-16 DD DD87301901A patent/DD261787A5/de unknown
- 1987-04-16 PL PL1987265207A patent/PL265207A1/xx unknown
- 1987-04-16 AU AU71731/87A patent/AU577218B2/en not_active Expired - Fee Related
- 1987-04-17 US US07/039,508 patent/US4788196A/en not_active Expired - Lifetime
- 1987-04-17 MY MYPI87000499A patent/MY101208A/en unknown
- 1987-04-17 YU YU00707/87A patent/YU70787A/xx unknown
- 1987-04-17 HU HU871713A patent/HUT44027A/hu unknown
- 1987-04-18 KR KR870003727A patent/KR870010015A/ko not_active Application Discontinuation
- 1987-04-20 JP JP62097245A patent/JPS62255480A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU7173187A (en) | 1987-11-05 |
| ZA872744B (en) | 1988-11-30 |
| PT84695A (en) | 1987-05-01 |
| IL82221A0 (en) | 1987-10-30 |
| PL265207A1 (en) | 1988-07-21 |
| FI871694A0 (fi) | 1987-04-16 |
| DD261787A5 (de) | 1988-11-09 |
| NO871594D0 (no) | 1987-04-15 |
| US4788196A (en) | 1988-11-29 |
| EP0244115A3 (en) | 1988-10-05 |
| DK195587A (da) | 1987-10-20 |
| MY101208A (en) | 1991-08-17 |
| DK195587D0 (da) | 1987-04-15 |
| EP0244115A2 (en) | 1987-11-04 |
| KR870010015A (ko) | 1987-11-30 |
| FI871694A (fi) | 1987-10-20 |
| YU70787A (en) | 1988-10-31 |
| JPS62255480A (ja) | 1987-11-07 |
| CN87102873A (zh) | 1987-10-28 |
| PT84695B (en) | 1989-05-23 |
| GB8609630D0 (en) | 1986-05-21 |
| HUT44027A (en) | 1988-01-28 |
| AU577218B2 (en) | 1988-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO871594L (no) | Fenyl-piperazin-derivater. | |
| EP0233051B1 (en) | Antiarrhythmic agents | |
| US7612076B2 (en) | Piperazinyl-pyridine derivatives | |
| US5057528A (en) | Amino-pyridine compounds useful as anti-arrhythmic agents | |
| AU2013269551A1 (en) | Heterocycles capable of modulating T-Cell responses, and methods of using same | |
| US4505910A (en) | Amino-pyrimidine derivatives, compositions and use | |
| DE19509950A1 (de) | Endothelin-Rezeptor-Antagonisten | |
| EP1208085A2 (en) | Benzanilides as potassium channel openers | |
| NO300924B1 (no) | Imidazopyridinderivater, farmasöytiske preparater og anvendelse av slike forbindelser til fremstilling av et legemiddel | |
| KR20070085672A (ko) | Ｈ3 길항제로서 3-치환된 피리딘 유도체 | |
| PL175788B1 (pl) | Amidowe pochodne indolu i zawierające je kompozycje farmaceutyczne | |
| EP0130735B1 (en) | Amino-pyrimidine derivatives | |
| NO832016L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive pyrazinon-derivater | |
| DK170818B1 (da) | Phenylpiperidin-derivater, farmaceutiske præparater indeholdende disse og deres anvendelse til fremstilling af lægemidler | |
| CA2504213A1 (en) | New beta-agonists, processes for preparing them and their use as pharmaceutical compositions | |
| EP0286979A1 (en) | Substituted anilide derivatives | |
| US4617393A (en) | 5-substituted-6-aminopyrimidines, composition and uses as cardiotonic agents for increasing cardiac contractility | |
| NO168421B (no) | Analogifremgangsmaate ved fremstilling av antiarytmiske midler | |
| US20040039045A1 (en) | (2-azabicyclo[2.2.1]hept-7yl) methanol derivatives as nicotinic acetylcholine receptor agonists | |
| US4847251A (en) | Pyridazinone derivatives, and pharmaceutical compositions containing them | |
| WO1992006080A1 (en) | Antiarrhythmic agents | |
| JPS61207384A (ja) | ピリミジノン誘導体 | |
| NO171635B (no) | Analogifremgangsmaate til fremstilling av et alkysulfonamidofenylalkylamin som er n-substituert over en metylenkjedemed en heterocyklisk gruppe |