NO863083L - Nye (4-substituerte-piperazinyl)pyridaziner. - Google Patents
Nye (4-substituerte-piperazinyl)pyridaziner.Info
- Publication number
- NO863083L NO863083L NO863083A NO863083A NO863083L NO 863083 L NO863083 L NO 863083L NO 863083 A NO863083 A NO 863083A NO 863083 A NO863083 A NO 863083A NO 863083 L NO863083 L NO 863083L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- phenyl
- acid addition
- parts
- compounds
- Prior art date
Links
- -1 4-SUBSTITUTED-PIPERAZINYL Chemical class 0.000 title claims description 21
- 150000004892 pyridazines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 53
- 239000002253 acid Substances 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- NCPBMOFVRBEVJY-QPJJXVBHSA-N 3-chloro-6-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(C\C=C\C=2C=CC=CC=2)CC1 NCPBMOFVRBEVJY-QPJJXVBHSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- WGEIOMTZIIOUMA-QPJJXVBHSA-N 1-[(e)-3-phenylprop-2-enyl]piperazine Chemical compound C1CNCCN1C\C=C\C1=CC=CC=C1 WGEIOMTZIIOUMA-QPJJXVBHSA-N 0.000 claims description 3
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 claims description 3
- 238000007126 N-alkylation reaction Methods 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 150000002978 peroxides Chemical class 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 230000009466 transformation Effects 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000000815 N-oxide group Chemical group 0.000 claims 2
- 239000012442 inert solvent Substances 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- 239000000203 mixture Substances 0.000 description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000047 product Substances 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 13
- 229960001701 chloroform Drugs 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 11
- 241001465754 Metazoa Species 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000003480 eluent Substances 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- 150000001204 N-oxides Chemical group 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000004440 column chromatography Methods 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 230000000144 pharmacologic effect Effects 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- IQIRDYLRYALBIS-UHFFFAOYSA-N 3-chloro-4-methyl-6-piperazin-1-ylpyridazine Chemical compound N1=C(Cl)C(C)=CC(N2CCNCC2)=N1 IQIRDYLRYALBIS-UHFFFAOYSA-N 0.000 description 3
- NBHPMVPSEBQXEA-VMPITWQZSA-N 3-chloro-6-[2-methyl-4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound C1CN(C=2N=NC(Cl)=CC=2)C(C)CN1C\C=C\C1=CC=CC=C1 NBHPMVPSEBQXEA-VMPITWQZSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical group O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- IWTYTFSSTWXZFU-QPJJXVBHSA-N [(e)-3-chloroprop-1-enyl]benzene Chemical compound ClC\C=C\C1=CC=CC=C1 IWTYTFSSTWXZFU-QPJJXVBHSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000000954 anitussive effect Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 229920006324 polyoxymethylene Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- YXCGQEKEIHVMKB-UHFFFAOYSA-N 3-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-1-phenylpropan-1-one Chemical compound N1=NC(Cl)=CC=C1N1CCN(CCC(=O)C=2C=CC=CC=2)CC1 YXCGQEKEIHVMKB-UHFFFAOYSA-N 0.000 description 2
- FDWLZDBSLRBFKM-UHFFFAOYSA-N 3-chloro-6-(3-methylpiperazin-1-yl)pyridazine Chemical compound C1CNC(C)CN1C1=CC=C(Cl)N=N1 FDWLZDBSLRBFKM-UHFFFAOYSA-N 0.000 description 2
- JYDFVSLFDARZNH-UHFFFAOYSA-N 3-chloro-6-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(CC#CC=2C=CC=CC=2)CC1 JYDFVSLFDARZNH-UHFFFAOYSA-N 0.000 description 2
- DXPPQFXYIZTQCV-UHFFFAOYSA-N 3-chloro-6-piperazin-1-ylpyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCNCC1 DXPPQFXYIZTQCV-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical compound CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700157 Rattus norvegicus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- PHFUCMDTUDKBLB-UHFFFAOYSA-N 1-(6-chloropyridazin-3-yl)-1,4-diazepane;hydrochloride Chemical compound Cl.N1=NC(Cl)=CC=C1N1CCNCCC1 PHFUCMDTUDKBLB-UHFFFAOYSA-N 0.000 description 1
- BZHONZCRWRTGTE-UHFFFAOYSA-N 1-(6-phenylpyridazin-3-yl)-1,4-diazepane Chemical compound C1CCNCCN1C1=CC=C(C=2C=CC=CC=2)N=N1 BZHONZCRWRTGTE-UHFFFAOYSA-N 0.000 description 1
- CLZRDHUBODXICN-UHFFFAOYSA-N 1-chloro-4-(3-chloroprop-1-enyl)benzene Chemical compound ClCC=CC1=CC=C(Cl)C=C1 CLZRDHUBODXICN-UHFFFAOYSA-N 0.000 description 1
- AKUNSTOMHUXJOZ-UHFFFAOYSA-N 1-hydroperoxybutane Chemical compound CCCCOO AKUNSTOMHUXJOZ-UHFFFAOYSA-N 0.000 description 1
- SQHKSSGQKNYXTA-UHFFFAOYSA-N 1-phenyl-3-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]propan-1-ol Chemical compound C=1C=CC=CC=1C(O)CCN(CC1)CCN1C(N=N1)=CC=C1C1=CC=CC=C1 SQHKSSGQKNYXTA-UHFFFAOYSA-N 0.000 description 1
- NBDNVCSZUHLWBG-UHFFFAOYSA-N 1-phenyl-3-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]propan-1-one;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1C(=O)CCN(CC1)CCN1C(N=N1)=CC=C1C1=CC=CC=C1 NBDNVCSZUHLWBG-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- JOMNTHCQHJPVAZ-UHFFFAOYSA-N 2-methylpiperazine Chemical compound CC1CNCCN1 JOMNTHCQHJPVAZ-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- IBQCDVCPQPVNBL-UHFFFAOYSA-N 2-piperazin-1-yl-1h-pyridazine Chemical class C1CNCCN1N1C=CC=CN1 IBQCDVCPQPVNBL-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- GHLUJLPGYZDALG-UHFFFAOYSA-N 3-[4-(6-chloro-5-methylpyridazin-3-yl)piperazin-1-yl]-1-phenylpropan-1-one Chemical compound N1=C(Cl)C(C)=CC(N2CCN(CCC(=O)C=3C=CC=CC=3)CC2)=N1 GHLUJLPGYZDALG-UHFFFAOYSA-N 0.000 description 1
- OBMLNXBUIFCTIR-QPJJXVBHSA-N 3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-1H-pyridazin-6-one Chemical compound C1(=CC=CC=C1)/C=C/CN1CCN(CC1)C=1C=CC(NN1)=O OBMLNXBUIFCTIR-QPJJXVBHSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PPYNHPQCZMMBGM-QPJJXVBHSA-N 3-bromo-6-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound N1=NC(Br)=CC=C1N1CCN(C\C=C\C=2C=CC=CC=2)CC1 PPYNHPQCZMMBGM-QPJJXVBHSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- RJPYRGLHJGPZKD-UHFFFAOYSA-N 3-chloro-6-(3,5-dimethylpiperazin-1-yl)pyridazine Chemical compound C1C(C)NC(C)CN1C1=CC=C(Cl)N=N1 RJPYRGLHJGPZKD-UHFFFAOYSA-N 0.000 description 1
- NRZLTTDVYGKHCS-RMKNXTFCSA-N 3-chloro-6-[3,5-dimethyl-4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound CC1CN(C=2N=NC(Cl)=CC=2)CC(C)N1C\C=C\C1=CC=CC=C1 NRZLTTDVYGKHCS-RMKNXTFCSA-N 0.000 description 1
- DPIKVJGVKPLODF-VMPITWQZSA-N 3-chloro-6-[3-methyl-4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound CC1CN(C=2N=NC(Cl)=CC=2)CCN1C\C=C\C1=CC=CC=C1 DPIKVJGVKPLODF-VMPITWQZSA-N 0.000 description 1
- NVOUARGRHDIUQA-UHFFFAOYSA-N 3-chloro-6-[4-(2-methoxyphenyl)piperazin-1-yl]pyridazine Chemical compound COC1=CC=CC=C1N1CCN(C=2N=NC(Cl)=CC=2)CC1 NVOUARGRHDIUQA-UHFFFAOYSA-N 0.000 description 1
- NCPBMOFVRBEVJY-UHFFFAOYSA-N 3-chloro-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyridazine Chemical compound N1=NC(Cl)=CC=C1N1CCN(CC=CC=2C=CC=CC=2)CC1 NCPBMOFVRBEVJY-UHFFFAOYSA-N 0.000 description 1
- ZXMCCYQSURCBKM-OWOJBTEDSA-N 3-chloro-6-[4-[(e)-3-(4-chlorophenyl)prop-2-enyl]piperazin-1-yl]pyridazine Chemical compound C1=CC(Cl)=CC=C1\C=C\CN1CCN(C=2N=NC(Cl)=CC=2)CC1 ZXMCCYQSURCBKM-OWOJBTEDSA-N 0.000 description 1
- KNLWGAFXODUBHR-RDRKJGRWSA-N 3-chloro-6-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine;dihydrochloride Chemical compound Cl.Cl.N1=NC(Cl)=CC=C1N1CCN(C\C=C\C=2C=CC=CC=2)CC1 KNLWGAFXODUBHR-RDRKJGRWSA-N 0.000 description 1
- GTCJSIPWGUYQOL-KQGICBIGSA-N 3-chloro-6-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine;hydrochloride Chemical compound Cl.N1=NC(Cl)=CC=C1N1CCN(C\C=C\C=2C=CC=CC=2)CC1 GTCJSIPWGUYQOL-KQGICBIGSA-N 0.000 description 1
- RNXYFEJFDHXQSN-VMPITWQZSA-N 3-methoxy-6-[4-[(e)-3-phenylprop-2-enyl]piperazin-1-yl]pyridazine Chemical compound N1=NC(OC)=CC=C1N1CCN(C\C=C\C=2C=CC=CC=2)CC1 RNXYFEJFDHXQSN-VMPITWQZSA-N 0.000 description 1
- UHUQMOCHDLJAKS-UHFFFAOYSA-N 3-methoxy-6-piperazin-1-ylpyridazine Chemical compound N1=NC(OC)=CC=C1N1CCNCC1 UHUQMOCHDLJAKS-UHFFFAOYSA-N 0.000 description 1
- QSUUFOOZHRIYJX-RMZRELHQSA-N 3-methyl-1-[(e)-3-phenylprop-2-enyl]piperazine;dihydrochloride Chemical compound Cl.Cl.C1CNC(C)CN1C\C=C\C1=CC=CC=C1 QSUUFOOZHRIYJX-RMZRELHQSA-N 0.000 description 1
- GSQDWXKOJGHXCX-UHFFFAOYSA-N 3-phenyl-6-piperazin-1-ylpyridazine Chemical compound C1CNCCN1C1=CC=C(C=2C=CC=CC=2)N=N1 GSQDWXKOJGHXCX-UHFFFAOYSA-N 0.000 description 1
- JIKURRKHUVXAJT-UHFFFAOYSA-N 3-phenylprop-2-ynyl methanesulfonate Chemical compound CS(=O)(=O)OCC#CC1=CC=CC=C1 JIKURRKHUVXAJT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- LQJFVQZPYMAIQD-MOGJOVFKSA-N Cl.ClC=1N=NC(=CC1)N1[C@H](CN([C@H](C1)C)CC=CC1=CC=CC=C1)C Chemical compound Cl.ClC=1N=NC(=CC1)N1[C@H](CN([C@H](C1)C)CC=CC1=CC=CC=C1)C LQJFVQZPYMAIQD-MOGJOVFKSA-N 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000002908 adrenolytic effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 229940075894 denatured ethanol Drugs 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MMDGAGXPGKJVLU-UHFFFAOYSA-N ethyl 4-(6-chloro-5-methylpyridazin-3-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=CC(C)=C(Cl)N=N1 MMDGAGXPGKJVLU-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229920000642 polymer Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000452 restraining effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/22—Nitrogen and oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US76084585A | 1985-07-31 | 1985-07-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO863083D0 NO863083D0 (no) | 1986-07-30 |
| NO863083L true NO863083L (no) | 1987-02-02 |
Family
ID=25060338
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO863083A NO863083L (no) | 1985-07-31 | 1986-07-30 | Nye (4-substituerte-piperazinyl)pyridaziner. |
Country Status (18)
| Country | Link |
|---|---|
| EP (1) | EP0211457A3 (es) |
| JP (1) | JPS6229575A (es) |
| KR (1) | KR870001192A (es) |
| CN (1) | CN86105558A (es) |
| AU (1) | AU6073986A (es) |
| DK (1) | DK363186A (es) |
| ES (1) | ES8802151A1 (es) |
| FI (1) | FI863120A (es) |
| GR (1) | GR862022B (es) |
| HU (1) | HU195501B (es) |
| IL (1) | IL79549A0 (es) |
| NO (1) | NO863083L (es) |
| NZ (1) | NZ216918A (es) |
| PH (1) | PH22884A (es) |
| PT (1) | PT83098B (es) |
| TN (1) | TNSN86117A1 (es) |
| ZA (1) | ZA865700B (es) |
| ZW (1) | ZW14886A1 (es) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MY104343A (en) * | 1987-11-23 | 1994-03-31 | Janssen Pharmaceutica Nv | Novel pyridizinamine deravatives |
| US4992433A (en) * | 1987-11-23 | 1991-02-12 | Janssen Pharmaceutica N.V. | Novel pyridazinamine derivatives |
| GB8911158D0 (en) * | 1989-05-16 | 1989-07-05 | Janssen Pharmaceutica Nv | Antiviral pyridazinamines |
| US5070090A (en) * | 1989-05-15 | 1991-12-03 | Janssen Pharmaceutica N.V. | Antipicorpaviral herterocyclic-substituted morpholinyl alkylphenol ethers |
| US5270312A (en) * | 1990-11-05 | 1993-12-14 | Warner-Lambert Company | Substituted piperazines as central nervous system agents |
| DE69826883T2 (de) * | 1997-10-27 | 2005-02-03 | Neurosearch A/S | Heteroaryl diazacycloalkane als cholinergische ligande für nikotin-acetylcholin-rezeptoren |
| NZ514021A (en) | 1999-04-26 | 2001-09-28 | Neurosearch As | Heteroaryl diazacycloalkanes, their preparation and use |
| EP2264014A1 (en) | 2001-08-31 | 2010-12-22 | Université Louis Pasteur | Substituted pyridazines as anti-inflammatory agents and protein kinase inhibitors |
| US7390813B1 (en) | 2001-12-21 | 2008-06-24 | Xenon Pharmaceuticals Inc. | Pyridylpiperazines and aminonicotinamides and their use as therapeutic agents |
| US7759348B2 (en) | 2003-07-30 | 2010-07-20 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| RU2006105716A (ru) * | 2003-07-30 | 2007-09-10 | Зинон Фармасьютиклз Инк. (Ca) | Производные пиридазина и их применение в качестве терапевтических средств |
| TWI345974B (en) | 2003-07-30 | 2011-08-01 | Xenon Pharmaceuticals Inc | Pyridazine derivatives and their use in the inhibition of stearoyl-coa desaturase |
| US7754711B2 (en) * | 2003-07-30 | 2010-07-13 | Xenon Pharmaceuticals Inc. | Pyridazine derivatives and their use as therapeutic agents |
| EP1807085B1 (en) | 2004-09-20 | 2013-08-21 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-coa desaturase inhibitors |
| US7919496B2 (en) | 2004-09-20 | 2011-04-05 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-CoA desaturase enzymes |
| JP5094398B2 (ja) | 2004-09-20 | 2012-12-12 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | 複素環式誘導体およびステアロイル−ＣｏＡデサチュラーゼのメディエータとしてのそれらの使用 |
| BRPI0515489A (pt) | 2004-09-20 | 2008-07-29 | Xenon Pharmaceuticals Inc | derivados heterocìclicos e sua utilização como inibidores de estearoil-coa desaturase |
| CA2580857A1 (en) | 2004-09-20 | 2006-09-28 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-coa desaturase inhibitors |
| CN101083992A (zh) | 2004-09-20 | 2007-12-05 | 泽农医药公司 | 抑制人硬脂酰CoA去饱和酶的哒嗪衍生物 |
| JP5043668B2 (ja) | 2004-09-20 | 2012-10-10 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | 複素環誘導体および治療薬としてのそれらの使用 |
| AU2016203312B2 (en) * | 2004-11-02 | 2018-05-24 | Centre National De La Recherche Scientifique | Pyridazine compounds, compositions and methods |
| EP1812007B1 (en) | 2004-11-02 | 2011-09-07 | Northwestern University | Pyridazine compounds and methods |
| ES2543813T3 (es) | 2004-11-02 | 2015-08-24 | Northwestern University | Compuestos de piridazina para el tratamiento de enfermedades inflamatorias |
| WO2007130075A1 (en) | 2005-06-03 | 2007-11-15 | Xenon Pharmaceuticals Inc. | Aminothiazole derivatives as human stearoyl-coa desaturase inhibitors |
| JO2769B1 (en) | 2005-10-26 | 2014-03-15 | جانسين فارماسوتيكا ان. في | Rapid decomposition of physiologically antagonistic agents of the 2-dopamine receptor |
| US8158627B2 (en) | 2006-04-28 | 2012-04-17 | Northwestern University | Compositions and treatments using pyridazine compounds and cholinesterase inhibitors |
| CA2650625A1 (en) | 2006-04-28 | 2007-11-08 | Northwestern University | Formulations containing pyridazine compounds for treating neuroinflammatory diseases |
| JO2849B1 (en) | 2007-02-13 | 2015-03-15 | جانسين فارماسوتيكا ان. في | Dopamine 2 receptor antagonists are rapidly hydrolyzed |
| DK2148873T3 (da) | 2007-04-23 | 2012-11-26 | Janssen Pharmaceutica Nv | 4-alkoxypyridazinderivater som hurtigt dissocierende dopamin 2- receptorantagonister |
| EP2148879B1 (en) | 2007-04-23 | 2012-11-28 | Janssen Pharmaceutica, N.V. | Thia(dia)zoles as fast dissociating dopamine 2 receptor antagonists |
| JP5603770B2 (ja) * | 2007-05-31 | 2014-10-08 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | Ｃｃｒ２受容体拮抗薬およびその使用 |
| EA019048B1 (ru) | 2008-07-31 | 2013-12-30 | Янссен Фармацевтика Нв | Пиперазин-1-илтрифторметилзамещенные пиридины в качестве быстро диссоциирующихся антагонистов d-рецепторов дофамина |
| EP2816037A3 (en) | 2011-05-24 | 2015-04-01 | Università degli Studi di Bari "Aldo Moro" | New 1-arylpiperazinic ligands of 5-HT7 receptor and use thereof |
| BR112017028492B1 (pt) | 2015-07-02 | 2023-12-26 | Centrexion Therapeutics Corporation | Citrato de (4-((3r,4r)-3-metoxitetra-hidro-piran-4- ilamino)piperidin-1-il) (5- metil-6-(((2r, 6s)-6-(p-tolil) tetra-hidro-2h-piran-2-il)metilamino)pirimidin-4-il) metanona, seu uso e seu método de preparação, e composição farmacêutica |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985657A (en) * | 1959-10-12 | 1961-05-23 | Paul A J Janssen | 1-(aroylalkyl)-4-heterocyclylpiperazines |
| US5001125A (en) * | 1984-03-26 | 1991-03-19 | Janssen Pharmaceutica N.V. | Anti-virally active pyridazinamines |
-
1986
- 1986-06-25 ES ES556738A patent/ES8802151A1/es not_active Expired
- 1986-07-09 EP EP86201203A patent/EP0211457A3/en not_active Withdrawn
- 1986-07-14 KR KR1019860005671A patent/KR870001192A/ko not_active Application Discontinuation
- 1986-07-21 NZ NZ216918A patent/NZ216918A/xx unknown
- 1986-07-23 JP JP61171940A patent/JPS6229575A/ja active Pending
- 1986-07-28 CN CN198686105558A patent/CN86105558A/zh active Pending
- 1986-07-28 PH PH34070A patent/PH22884A/en unknown
- 1986-07-29 TN TNTNSN86117A patent/TNSN86117A1/fr unknown
- 1986-07-29 IL IL79549A patent/IL79549A0/xx unknown
- 1986-07-30 PT PT83098A patent/PT83098B/pt unknown
- 1986-07-30 ZA ZA865700A patent/ZA865700B/xx unknown
- 1986-07-30 ZW ZW148/86A patent/ZW14886A1/xx unknown
- 1986-07-30 HU HU863248A patent/HU195501B/hu unknown
- 1986-07-30 DK DK363186A patent/DK363186A/da not_active Application Discontinuation
- 1986-07-30 FI FI863120A patent/FI863120A/fi not_active IP Right Cessation
- 1986-07-30 GR GR862022A patent/GR862022B/el unknown
- 1986-07-30 NO NO863083A patent/NO863083L/no unknown
- 1986-07-31 AU AU60739/86A patent/AU6073986A/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| FI863120A0 (fi) | 1986-07-30 |
| IL79549A0 (en) | 1986-10-31 |
| DK363186D0 (da) | 1986-07-30 |
| TNSN86117A1 (fr) | 1990-01-01 |
| EP0211457A3 (en) | 1987-07-22 |
| GR862022B (en) | 1986-12-24 |
| JPS6229575A (ja) | 1987-02-07 |
| DK363186A (da) | 1987-02-01 |
| ZA865700B (en) | 1988-03-30 |
| ES8802151A1 (es) | 1988-04-01 |
| ES556738A0 (es) | 1988-04-01 |
| FI863120A (fi) | 1987-02-01 |
| PH22884A (en) | 1989-01-19 |
| AU6073986A (en) | 1987-02-05 |
| EP0211457A2 (en) | 1987-02-25 |
| HU195501B (en) | 1988-05-30 |
| NO863083D0 (no) | 1986-07-30 |
| PT83098B (en) | 1988-07-13 |
| CN86105558A (zh) | 1987-01-28 |
| KR870001192A (ko) | 1987-03-12 |
| ZW14886A1 (en) | 1988-02-24 |
| HUT41772A (en) | 1987-05-28 |
| PT83098A (en) | 1986-08-01 |
| NZ216918A (en) | 1988-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO863083L (no) | Nye (4-substituerte-piperazinyl)pyridaziner. | |
| DK168537B1 (da) | 1,2-benzisoxazol-3-yl- og 1,2-benzisothiazol-3-yl-derivater, en fremgangsmåde til fremstilling deraf og farmaceutiske præparater indeholdende sådanne derivater | |
| EP0378255B1 (en) | 2-Aminopyrimidinone derivatives | |
| US5140029A (en) | 2-aminopyrimidinone derivatives | |
| EP0110435B1 (en) | Novel ((bis(aryl)methylene)-1-piperidinyl)alkyl-pyrimidinones | |
| DK173674B1 (da) | Anti-allergiske præparater indeholdende N-heterocyclyl-4-piperidinaminer, N-heterocyclyl-4-piperidinaminer til brug som antiallergikum og hidtil ukendte N-heterocyclyl-4-piperidinaminer samt fremgangsmåde til fremstilling deraf | |
| US4342870A (en) | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives | |
| DK166277B (da) | Anvendelse af pyridazinaminer til fremstilling af antivirale praeparater, pyridazinaminer til brug som antivirale midler, antivirale praeparater, pyridazinaminer og fremgangsmaade til fremstilling deraf | |
| US4581171A (en) | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones useful for treating psychotropic disorders | |
| NO177424B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive N-(4-piperidinyl)(dihydrobenzofuran- eller dihydro-2H-benzopyran)karboksamidderivater samt mellomprodukter | |
| US4957916A (en) | Antipsychotic 3-piperazinylbenzazole derivatives | |
| HU204827B (en) | Process for producing 2-(heterocyclic alkyl)-imidazopyridine and imidazopyridine derivatives and pharmaceutical compositions comprising same | |
| HU206350B (en) | Process for producing new 2-amino-pyrimidinone derivatives and pharmaceutical compositions containing them as active components | |
| DK175124B1 (da) | 3-piperazinylbenzazolderivater, fremstilling deraf og anvendelse deraf i et antipsykotisk præparat | |
| AU702931B2 (en) | Antipsychotic 4-(1H-indolyl-1-yl)-1-substituted piperidine derivatives | |
| US5015740A (en) | Antipsychotic 3-piperazinylbenzazole derivatives | |
| US5256659A (en) | 2-aminopyrimidinone derivatives | |
| DK169547B1 (da) | 3-piperidinyl-indazolderivater, fremgangsmåde til fremstilling deraf, præparater indeholdende disse samt anvendelse af derivaterne til fremstilling af farmaceutiske præparater | |
| US4533665A (en) | [[Bis(aryl)methylene]-1-piperidinyl]alkyl-pyrimidinones | |
| IL105594A (en) | History of 3-piperazinylbenzperazole | |
| SK280125B6 (sk) | 1,2-benzazoly a farmaceutické prostriedky na ich b | |
| NO173866B (no) | Mellomprodukter for fremstilling av ((4-(4-(-4-fenyl-1-piperazinyl)fenoksymetyl)-1,3-dioksolan-2-yl)-metyl)-1h-imidazoler og 1h-1,2,4-triazoler |