NO830612L - Nye forbindelser, fremgangsmaate til deres fremstilling samt deres anvendelse i legemidler - Google Patents
Nye forbindelser, fremgangsmaate til deres fremstilling samt deres anvendelse i legemidlerInfo
- Publication number
- NO830612L NO830612L NO830612A NO830612A NO830612L NO 830612 L NO830612 L NO 830612L NO 830612 A NO830612 A NO 830612A NO 830612 A NO830612 A NO 830612A NO 830612 L NO830612 L NO 830612L
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- stands
- residue
- ester
- carbon atoms
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 39
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000003814 drug Substances 0.000 title description 9
- -1 heterocyclic radical Chemical class 0.000 claims abstract description 101
- 239000002253 acid Substances 0.000 claims abstract description 49
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 47
- 150000001875 compounds Chemical class 0.000 claims abstract description 46
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 42
- 125000001424 substituent group Chemical group 0.000 claims abstract description 38
- 125000003277 amino group Chemical group 0.000 claims abstract description 29
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 19
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 14
- 150000003839 salts Chemical class 0.000 claims abstract description 7
- 150000005840 aryl radicals Chemical class 0.000 claims abstract description 4
- 150000002148 esters Chemical class 0.000 claims description 44
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 239000003960 organic solvent Substances 0.000 claims description 30
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
- 125000004122 cyclic group Chemical group 0.000 claims description 18
- 229920006395 saturated elastomer Chemical group 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 14
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical class OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 239000011737 fluorine Substances 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001153 fluoro group Chemical group F* 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- QHJJSLUZWHFHTK-UHFFFAOYSA-N 3-amino-3-azaniumylidenepropanoate Chemical class NC(=N)CC(O)=O QHJJSLUZWHFHTK-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 7
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 125000004076 pyridyl group Chemical group 0.000 claims description 7
- 229930195734 saturated hydrocarbon Chemical group 0.000 claims description 7
- 125000001544 thienyl group Chemical group 0.000 claims description 7
- 229930195735 unsaturated hydrocarbon Chemical group 0.000 claims description 7
- 230000009471 action Effects 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 claims description 5
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 5
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000002971 oxazolyl group Chemical group 0.000 claims description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 5
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 5
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 5
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000005493 quinolyl group Chemical group 0.000 claims description 5
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 4
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 230000007774 longterm Effects 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 claims description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims 6
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 5
- 229940126601 medicinal product Drugs 0.000 claims 3
- 201000010099 disease Diseases 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 abstract 2
- 239000004215 Carbon black (E152) Substances 0.000 abstract 1
- 229930195733 hydrocarbon Natural products 0.000 abstract 1
- 230000001077 hypotensive effect Effects 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 86
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 41
- 235000019441 ethanol Nutrition 0.000 description 38
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 239000000126 substance Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 238000009835 boiling Methods 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 150000001298 alcohols Chemical class 0.000 description 9
- 239000003085 diluting agent Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 150000002170 ethers Chemical class 0.000 description 8
- UKVYVZLTGQVOPX-NSCUHMNNSA-N (e)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C/C(O)=O UKVYVZLTGQVOPX-NSCUHMNNSA-N 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 230000007306 turnover Effects 0.000 description 7
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 239000013543 active substance Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- IJBRUUXJLQCDOJ-SEYXRHQNSA-N decyl (z)-3-aminobut-2-enoate Chemical compound CCCCCCCCCCOC(=O)\C=C(\C)N IJBRUUXJLQCDOJ-SEYXRHQNSA-N 0.000 description 5
- KSZOTXZFYCRWQK-UHFFFAOYSA-N propan-2-yl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CC(C)OC(=O)C(C(C)=O)=CC1=CC=CC([N+]([O-])=O)=C1 KSZOTXZFYCRWQK-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 230000005923 long-lasting effect Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 230000002490 cerebral effect Effects 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- IBMUHJIDXFMZPI-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O.ClC1=CC=CC=C1C=O IBMUHJIDXFMZPI-UHFFFAOYSA-N 0.000 description 2
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- 201000004624 Dermatitis Diseases 0.000 description 2
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 230000004531 blood pressure lowering effect Effects 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000812 cholinergic antagonist Substances 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- WTWBUQJHJGUZCY-UHFFFAOYSA-N cuminaldehyde Chemical compound CC(C)C1=CC=C(C=O)C=C1 WTWBUQJHJGUZCY-UHFFFAOYSA-N 0.000 description 2
- XHZIAKNLOQIMKT-UHFFFAOYSA-N decyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCCCCOC(=O)CC(N)=N XHZIAKNLOQIMKT-UHFFFAOYSA-N 0.000 description 2
- CLCYRHCSVWOLHG-UHFFFAOYSA-N decyl 3-oxobutanoate Chemical compound CCCCCCCCCCOC(=O)CC(C)=O CLCYRHCSVWOLHG-UHFFFAOYSA-N 0.000 description 2
- LEFDOQZAJXGOHF-UHFFFAOYSA-N decyl 3-oxopentanoate Chemical compound CCCCCCCCCCOC(=O)CC(=O)CC LEFDOQZAJXGOHF-UHFFFAOYSA-N 0.000 description 2
- FXWLFHWSIXGHQH-UHFFFAOYSA-N decyl 5-(2,3-dichlorophenyl)-3-oxopent-4-enoate Chemical compound CCCCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC(Cl)=C1Cl FXWLFHWSIXGHQH-UHFFFAOYSA-N 0.000 description 2
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 2
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- ZSKGQVFRTSEPJT-UHFFFAOYSA-N pyrrole-2-carboxaldehyde Chemical compound O=CC1=CC=CN1 ZSKGQVFRTSEPJT-UHFFFAOYSA-N 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- UVUYMKHXMPYIPH-UHFFFAOYSA-N tetradecyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCCCCCCCCOC(=O)CC(N)=N UVUYMKHXMPYIPH-UHFFFAOYSA-N 0.000 description 2
- FUCMCKCYPNPVSS-UHFFFAOYSA-N tetradecyl 3-oxobutanoate Chemical compound CCCCCCCCCCCCCCOC(=O)CC(C)=O FUCMCKCYPNPVSS-UHFFFAOYSA-N 0.000 description 2
- XOZPNYARJTVGMO-UHFFFAOYSA-N tetradecyl 5-(3-nitrophenyl)-3-oxopent-4-enoate Chemical compound CCCCCCCCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC([N+]([O-])=O)=C1 XOZPNYARJTVGMO-UHFFFAOYSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- XHKYMSYGSDMBPQ-UHFFFAOYSA-N 1,2,3-benzoxadiazole-4-carbaldehyde Chemical compound O=CC1=CC=CC2=C1N=NO2 XHKYMSYGSDMBPQ-UHFFFAOYSA-N 0.000 description 1
- WNVZOHNNPDZYFN-UHFFFAOYSA-N 1,2-oxazole-3-carbaldehyde Chemical compound O=CC=1C=CON=1 WNVZOHNNPDZYFN-UHFFFAOYSA-N 0.000 description 1
- JMDWCJKHCBSPBS-UHFFFAOYSA-N 1,3-benzoxazole-4-carbaldehyde Chemical compound O=CC1=CC=CC2=C1N=CO2 JMDWCJKHCBSPBS-UHFFFAOYSA-N 0.000 description 1
- TYHOSUCCUICRLM-UHFFFAOYSA-N 1,3-oxazole-2-carbaldehyde Chemical compound O=CC1=NC=CO1 TYHOSUCCUICRLM-UHFFFAOYSA-N 0.000 description 1
- ZGTFNNUASMWGTM-UHFFFAOYSA-N 1,3-thiazole-2-carbaldehyde Chemical compound O=CC1=NC=CS1 ZGTFNNUASMWGTM-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- GXPIVRKDWZKIKZ-UHFFFAOYSA-N 1-fluoro-2-methyl-3-nitrobenzene Chemical compound CC1=C(F)C=CC=C1[N+]([O-])=O GXPIVRKDWZKIKZ-UHFFFAOYSA-N 0.000 description 1
- DQOSJWYZDQIMGM-UHFFFAOYSA-N 1H-benzimidazole-2-carbaldehyde Chemical compound C1=CC=C2NC(C=O)=NC2=C1 DQOSJWYZDQIMGM-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- LRGBDJBDJXZTTD-UHFFFAOYSA-N 1h-pyrazole-4-carbaldehyde Chemical compound O=CC=1C=NNC=1 LRGBDJBDJXZTTD-UHFFFAOYSA-N 0.000 description 1
- WYVJHLQPKOHCOS-UHFFFAOYSA-N 2,2,2-trifluoroethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC(F)(F)F WYVJHLQPKOHCOS-UHFFFAOYSA-N 0.000 description 1
- KOBDSTDYIDZNDZ-UHFFFAOYSA-N 2,2,2-trifluoroethyl 5-(2-chlorophenyl)-3-oxopent-4-enoate Chemical compound FC(F)(F)COC(=O)CC(=O)C=CC1=CC=CC=C1Cl KOBDSTDYIDZNDZ-UHFFFAOYSA-N 0.000 description 1
- YMLUHRKEHWONBM-UHFFFAOYSA-N 2,2-dimethylpropyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC(C)(C)C YMLUHRKEHWONBM-UHFFFAOYSA-N 0.000 description 1
- GISVICWQYMUPJF-UHFFFAOYSA-N 2,4-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(C)=C1 GISVICWQYMUPJF-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- TZDPJNSHSWMCPN-UHFFFAOYSA-N 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C)NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 TZDPJNSHSWMCPN-UHFFFAOYSA-N 0.000 description 1
- WHFZQNNDIJKLIO-UHFFFAOYSA-N 2,6-dinitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1C=O WHFZQNNDIJKLIO-UHFFFAOYSA-N 0.000 description 1
- YPXZBUQPDJHULR-UHFFFAOYSA-N 2-(cyclopropylmethoxy)benzaldehyde Chemical compound O=CC1=CC=CC=C1OCC1CC1 YPXZBUQPDJHULR-UHFFFAOYSA-N 0.000 description 1
- QPBNHDFPMRENBC-UHFFFAOYSA-N 2-(difluoromethoxy)benzaldehyde Chemical compound FC(F)OC1=CC=CC=C1C=O QPBNHDFPMRENBC-UHFFFAOYSA-N 0.000 description 1
- URQYRQBJRMLNGH-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-cyanoacetate Chemical compound CN(C)CCOC(=O)CC#N URQYRQBJRMLNGH-UHFFFAOYSA-N 0.000 description 1
- JHXYOBFDPBHSHT-UHFFFAOYSA-N 2-(dimethylamino)ethyl 3-amino-3-iminopropanoate Chemical compound CN(C)CCOC(=O)CC(N)=N JHXYOBFDPBHSHT-UHFFFAOYSA-N 0.000 description 1
- LWFQGLZKTGSAQC-UHFFFAOYSA-N 2-(dimethylamino)ethyl 3-oxobutanoate Chemical compound CN(C)CCOC(=O)CC(C)=O LWFQGLZKTGSAQC-UHFFFAOYSA-N 0.000 description 1
- KZAVVRFEOXIXSW-UHFFFAOYSA-N 2-(hydroxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid Chemical compound OC(=O)C1=C(CO)NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 KZAVVRFEOXIXSW-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 description 1
- PJLFEWNFTBTVNM-UHFFFAOYSA-N 2-acetyloxyethyl 2-cyanoacetate Chemical compound CC(=O)OCCOC(=O)CC#N PJLFEWNFTBTVNM-UHFFFAOYSA-N 0.000 description 1
- NGAVSCAXDJMZQP-UHFFFAOYSA-N 2-acetyloxyethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCOC(C)=O NGAVSCAXDJMZQP-UHFFFAOYSA-N 0.000 description 1
- QDSVJXFUZGIBQZ-UHFFFAOYSA-N 2-acetyloxyethyl 5-[2-(difluoromethoxy)phenyl]-3-oxopent-4-enoate Chemical compound CC(=O)OCCOC(=O)CC(=O)C=CC1=CC=CC=C1OC(F)F QDSVJXFUZGIBQZ-UHFFFAOYSA-N 0.000 description 1
- DWBVURAGFFCDHB-UHFFFAOYSA-N 2-amino-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid Chemical compound OC(=O)C1=C(N)NC(C)=C(C(O)=O)C1C1=CC=CC([N+]([O-])=O)=C1 DWBVURAGFFCDHB-UHFFFAOYSA-N 0.000 description 1
- BJCGBIIWZVXIAW-UHFFFAOYSA-N 2-amino-6-methyl-4-(3-nitrophenyl)-4H-pyran-3,5-dicarboxylic acid Chemical compound NC=1OC(=C(C(C1C(=O)O)C1=CC(=CC=C1)[N+](=O)[O-])C(=O)O)C BJCGBIIWZVXIAW-UHFFFAOYSA-N 0.000 description 1
- IIBAAYFFTSJSFH-UHFFFAOYSA-N 2-butylbenzaldehyde Chemical compound CCCCC1=CC=CC=C1C=O IIBAAYFFTSJSFH-UHFFFAOYSA-N 0.000 description 1
- RZDOUWDCYULHJX-UHFFFAOYSA-N 2-chloro-6-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1C=O RZDOUWDCYULHJX-UHFFFAOYSA-N 0.000 description 1
- LVTILMGBUWGXNU-UHFFFAOYSA-N 2-chloroethyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound ClCCOC(=O)C(C(=O)C)=CC1=CC=CC([N+]([O-])=O)=C1 LVTILMGBUWGXNU-UHFFFAOYSA-N 0.000 description 1
- JGDPLBFWBNURTR-UHFFFAOYSA-N 2-chloroethyl 3-amino-3-iminopropanoate Chemical compound NC(=N)CC(=O)OCCCl JGDPLBFWBNURTR-UHFFFAOYSA-N 0.000 description 1
- JAEUQHNZRROYID-UHFFFAOYSA-N 2-chloroethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCCl JAEUQHNZRROYID-UHFFFAOYSA-N 0.000 description 1
- JKVDVCMKSIAKNT-UHFFFAOYSA-N 2-chloroethyl 5-(3-cyanophenyl)-3-oxopent-4-enoate Chemical compound ClCCOC(=O)CC(=O)C=CC1=CC=CC(C#N)=C1 JKVDVCMKSIAKNT-UHFFFAOYSA-N 0.000 description 1
- LDLQXVWVVZEXIF-UHFFFAOYSA-N 2-cyanoethyl 3-oxo-5-[2-(trifluoromethyl)phenyl]pent-4-enoate Chemical compound FC(F)(F)C1=CC=CC=C1C=CC(=O)CC(=O)OCCC#N LDLQXVWVVZEXIF-UHFFFAOYSA-N 0.000 description 1
- SWJVFAOGXDGTCX-UHFFFAOYSA-N 2-cyanoethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCC#N SWJVFAOGXDGTCX-UHFFFAOYSA-N 0.000 description 1
- ZVDXHSUCDWVQEY-UHFFFAOYSA-N 2-cyclopropylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C1CC1 ZVDXHSUCDWVQEY-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 1
- JZFWTYAFWKHWKH-QXMHVHEDSA-N 2-heptoxyethyl (z)-3-aminobut-2-enoate Chemical compound CCCCCCCOCCOC(=O)\C=C(\C)N JZFWTYAFWKHWKH-QXMHVHEDSA-N 0.000 description 1
- NCYOSAQHHUSNJJ-UHFFFAOYSA-N 2-heptoxyethyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCOCCOC(=O)CC(N)=N NCYOSAQHHUSNJJ-UHFFFAOYSA-N 0.000 description 1
- NLNUDYDKZPYYOV-KHPPLWFESA-N 2-hexoxyethyl (z)-3-aminobut-2-enoate Chemical compound CCCCCCOCCOC(=O)\C=C(\C)N NLNUDYDKZPYYOV-KHPPLWFESA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- SGLKIEOMYXTGBH-UHFFFAOYSA-N 2-methoxyethyl 2-cyanoacetate Chemical compound COCCOC(=O)CC#N SGLKIEOMYXTGBH-UHFFFAOYSA-N 0.000 description 1
- GMFAQQPCXDHUCQ-UHFFFAOYSA-N 2-methoxyethyl 3-amino-3-iminopropanoate Chemical compound COCCOC(=O)CC(N)=N GMFAQQPCXDHUCQ-UHFFFAOYSA-N 0.000 description 1
- PLHCSZRZWOWUBW-UHFFFAOYSA-N 2-methoxyethyl 3-oxobutanoate Chemical compound COCCOC(=O)CC(C)=O PLHCSZRZWOWUBW-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- PNLSPPFFGFKEDC-UHFFFAOYSA-N 2-methylpropyl 5-(2-nitrophenyl)-3-oxopent-4-enoate Chemical compound CC(C)COC(=O)CC(=O)C=CC1=CC=CC=C1[N+]([O-])=O PNLSPPFFGFKEDC-UHFFFAOYSA-N 0.000 description 1
- PZCVDBMEAFEAHK-UHFFFAOYSA-N 2-methylpyridine-3-carbothialdehyde Chemical compound CC1=NC=CC=C1C=S PZCVDBMEAFEAHK-UHFFFAOYSA-N 0.000 description 1
- GKNAAYXCSYJWCK-UHFFFAOYSA-N 2-methylsulfinylbenzaldehyde Chemical compound CS(=O)C1=CC=CC=C1C=O GKNAAYXCSYJWCK-UHFFFAOYSA-N 0.000 description 1
- HFOCAQPWSXBFFN-UHFFFAOYSA-N 2-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=CC=C1C=O HFOCAQPWSXBFFN-UHFFFAOYSA-N 0.000 description 1
- CTUPBAXICGISQP-UHFFFAOYSA-N 2-methylthiobenzaldehyde Chemical compound CC1=CC=CC=C1C=S CTUPBAXICGISQP-UHFFFAOYSA-N 0.000 description 1
- OLFFSWTVWZQGNF-KTKRTIGZSA-N 2-pentoxyethyl (z)-3-aminobut-2-enoate Chemical compound CCCCCOCCOC(=O)\C=C(\C)N OLFFSWTVWZQGNF-KTKRTIGZSA-N 0.000 description 1
- CHWGFWZZHUPNIN-UHFFFAOYSA-N 2-pentoxyethyl 2-cyanoacetate Chemical compound CCCCCOCCOC(=O)CC#N CHWGFWZZHUPNIN-UHFFFAOYSA-N 0.000 description 1
- RQPSDPVFAMQUJE-UHFFFAOYSA-N 2-pentoxyethyl 3-amino-3-iminopropanoate Chemical compound CCCCCOCCOC(=O)CC(N)=N RQPSDPVFAMQUJE-UHFFFAOYSA-N 0.000 description 1
- YLWORMXRWXXRHW-UHFFFAOYSA-N 2-pentoxyethyl 3-oxobutanoate Chemical compound CCCCCOCCOC(=O)CC(C)=O YLWORMXRWXXRHW-UHFFFAOYSA-N 0.000 description 1
- IZVOIGVFEWKZNE-UHFFFAOYSA-N 2-pentoxyethyl 5-(2-nitrophenyl)-3-oxopent-4-enoate Chemical compound CCCCCOCCOC(=O)CC(=O)C=CC1=CC=CC=C1[N+]([O-])=O IZVOIGVFEWKZNE-UHFFFAOYSA-N 0.000 description 1
- JDWZQOGWSGQVPB-UHFFFAOYSA-N 2-phenoxyethyl 2-cyanoacetate Chemical compound N#CCC(=O)OCCOC1=CC=CC=C1 JDWZQOGWSGQVPB-UHFFFAOYSA-N 0.000 description 1
- LXXZDTQGESTBLQ-UHFFFAOYSA-N 2-phenoxyethyl 3-amino-3-iminopropanoate Chemical compound NC(=N)CC(=O)OCCOC1=CC=CC=C1 LXXZDTQGESTBLQ-UHFFFAOYSA-N 0.000 description 1
- OWKVONYXJNKQRG-UHFFFAOYSA-N 2-phenoxyethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCOC1=CC=CC=C1 OWKVONYXJNKQRG-UHFFFAOYSA-N 0.000 description 1
- LCRCBXLHWTVPEQ-UHFFFAOYSA-N 2-phenylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C1=CC=CC=C1 LCRCBXLHWTVPEQ-UHFFFAOYSA-N 0.000 description 1
- QOMFXOOKFCCSND-UHFFFAOYSA-N 2-phenylethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCC1=CC=CC=C1 QOMFXOOKFCCSND-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- DTALCVXXATYTQJ-UHFFFAOYSA-N 2-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC=C1C=O DTALCVXXATYTQJ-UHFFFAOYSA-N 0.000 description 1
- XNUZWPJIKWPVQF-UHFFFAOYSA-N 2-propoxyethyl 2-cyanoacetate Chemical compound CCCOCCOC(=O)CC#N XNUZWPJIKWPVQF-UHFFFAOYSA-N 0.000 description 1
- APFKQGOJGXYXLX-UHFFFAOYSA-N 2-propoxyethyl 3-amino-3-iminopropanoate Chemical compound CCCOCCOC(=O)CC(N)=N APFKQGOJGXYXLX-UHFFFAOYSA-N 0.000 description 1
- HFIUSWPRDIPIPN-UHFFFAOYSA-N 3-(difluoromethoxy)benzaldehyde Chemical compound FC(F)OC1=CC=CC(C=O)=C1 HFIUSWPRDIPIPN-UHFFFAOYSA-N 0.000 description 1
- FQEVHRCPXFKJHF-UHFFFAOYSA-N 3-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC(C=O)=C1 FQEVHRCPXFKJHF-UHFFFAOYSA-N 0.000 description 1
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 description 1
- ZVDOSRSQXYIYJC-UHFFFAOYSA-N 3-O-methyl 5-O-undecyl 2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1C(F)(F)F ZVDOSRSQXYIYJC-UHFFFAOYSA-N 0.000 description 1
- UCJDGRYGBYCWMS-UHFFFAOYSA-N 3-azidobenzaldehyde Chemical compound [N-]=[N+]=NC1=CC=CC(C=O)=C1 UCJDGRYGBYCWMS-UHFFFAOYSA-N 0.000 description 1
- ODKDFQDBMHPWEP-UHFFFAOYSA-N 3-chloro-2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=C(Cl)C=CC=C1C=O ODKDFQDBMHPWEP-UHFFFAOYSA-N 0.000 description 1
- YAOZCMANASAVFN-UHFFFAOYSA-N 3-chloro-2-fluorobenzaldehyde Chemical compound FC1=C(Cl)C=CC=C1C=O YAOZCMANASAVFN-UHFFFAOYSA-N 0.000 description 1
- UGRNLUNAHZKZTG-UHFFFAOYSA-N 3-chloro-4-formylbenzonitrile Chemical compound ClC1=CC(C#N)=CC=C1C=O UGRNLUNAHZKZTG-UHFFFAOYSA-N 0.000 description 1
- SRWILAKSARHZPR-UHFFFAOYSA-N 3-chlorobenzaldehyde Chemical compound ClC1=CC=CC(C=O)=C1 SRWILAKSARHZPR-UHFFFAOYSA-N 0.000 description 1
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 1
- QQRFRROHBKANIX-UHFFFAOYSA-N 3-methyl-4-(trifluoromethyl)benzaldehyde Chemical compound CC1=CC(C=O)=CC=C1C(F)(F)F QQRFRROHBKANIX-UHFFFAOYSA-N 0.000 description 1
- STTTUGHXWAHUPN-UHFFFAOYSA-N 3-methylsulfinylbenzaldehyde Chemical compound CS(=O)C1=CC=CC(C=O)=C1 STTTUGHXWAHUPN-UHFFFAOYSA-N 0.000 description 1
- OVSMURBVBQUOSF-UHFFFAOYSA-N 3-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=CC(C=O)=C1 OVSMURBVBQUOSF-UHFFFAOYSA-N 0.000 description 1
- DNRIBXNMXFBONF-UHFFFAOYSA-N 3-methylthiobenzaldehyde Chemical compound CC1=CC=CC(C=S)=C1 DNRIBXNMXFBONF-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- ZPVFCJHHLKWJND-UHFFFAOYSA-N 3-o-dodecyl 5-o-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 ZPVFCJHHLKWJND-UHFFFAOYSA-N 0.000 description 1
- PISXIDWEEZZHBI-UHFFFAOYSA-N 3-o-ethyl 5-o-octyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 PISXIDWEEZZHBI-UHFFFAOYSA-N 0.000 description 1
- FMSHDPYNGDJOSP-UHFFFAOYSA-N 3-o-ethyl 5-o-undecyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 FMSHDPYNGDJOSP-UHFFFAOYSA-N 0.000 description 1
- ALFNSKPVSHRQJQ-UHFFFAOYSA-N 3-o-heptyl 5-o-tetradecyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCC)C1C1=CC=CC=C1[N+]([O-])=O ALFNSKPVSHRQJQ-UHFFFAOYSA-N 0.000 description 1
- FPKHRIZMEOMLJD-UHFFFAOYSA-N 3-o-methyl 5-o-octyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 FPKHRIZMEOMLJD-UHFFFAOYSA-N 0.000 description 1
- CTPKKMRWUKXBEE-UHFFFAOYSA-N 3-o-methyl 5-o-undecyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O CTPKKMRWUKXBEE-UHFFFAOYSA-N 0.000 description 1
- UKXSIHYJGUFJDI-UHFFFAOYSA-N 3-o-methyl 5-o-undecyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 UKXSIHYJGUFJDI-UHFFFAOYSA-N 0.000 description 1
- KFKSIUOALVIACE-UHFFFAOYSA-N 3-phenylbenzaldehyde Chemical compound O=CC1=CC=CC(C=2C=CC=CC=2)=C1 KFKSIUOALVIACE-UHFFFAOYSA-N 0.000 description 1
- FFQXEFNKZVGJDI-UHFFFAOYSA-N 3-propan-2-ylbenzaldehyde Chemical compound CC(C)C1=CC=CC(C=O)=C1 FFQXEFNKZVGJDI-UHFFFAOYSA-N 0.000 description 1
- ZWCXOJYJJINQGU-UHFFFAOYSA-N 4-(difluoromethoxy)benzaldehyde Chemical compound FC(F)OC1=CC=C(C=O)C=C1 ZWCXOJYJJINQGU-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- ARIREUPIXAKDAY-UHFFFAOYSA-N 4-butylbenzaldehyde Chemical compound CCCCC1=CC=C(C=O)C=C1 ARIREUPIXAKDAY-UHFFFAOYSA-N 0.000 description 1
- MZPNQUMLOFWSEK-UHFFFAOYSA-N 4-chloro-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1C=O MZPNQUMLOFWSEK-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 1
- CZUQVKFJAJAHGK-UHFFFAOYSA-N 4-cyclopropylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1CC1 CZUQVKFJAJAHGK-UHFFFAOYSA-N 0.000 description 1
- GVWRWNKPXVHRPJ-UHFFFAOYSA-N 4-formyl-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1C=O GVWRWNKPXVHRPJ-UHFFFAOYSA-N 0.000 description 1
- KNKVNTDAQHBEAW-UHFFFAOYSA-N 4-formyl-3-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC=C1C=O KNKVNTDAQHBEAW-UHFFFAOYSA-N 0.000 description 1
- KLTDQLIGNSBZPO-UHFFFAOYSA-N 4-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C(C=O)C([N+]([O-])=O)=C1 KLTDQLIGNSBZPO-UHFFFAOYSA-N 0.000 description 1
- NZJSGBXNOJOCJI-UHFFFAOYSA-N 4-methylsulfinylbenzaldehyde Chemical compound CS(=O)C1=CC=C(C=O)C=C1 NZJSGBXNOJOCJI-UHFFFAOYSA-N 0.000 description 1
- PSVPUHBSBYJSMQ-UHFFFAOYSA-N 4-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=C(C=O)C=C1 PSVPUHBSBYJSMQ-UHFFFAOYSA-N 0.000 description 1
- PIMQQGJMDMAZGT-UHFFFAOYSA-N 4-methylthiobenzaldehyde Chemical compound CC1=CC=C(C=S)C=C1 PIMQQGJMDMAZGT-UHFFFAOYSA-N 0.000 description 1
- 150000000531 4H-pyrans Chemical class 0.000 description 1
- ABAGNOHSGSJIOD-UHFFFAOYSA-N 5-(3-nitrophenyl)-3-oxopent-4-enoic acid Chemical compound OC(=O)CC(=O)C=CC1=CC=CC([N+]([O-])=O)=C1 ABAGNOHSGSJIOD-UHFFFAOYSA-N 0.000 description 1
- FZLSDZZNPXXBBB-KDURUIRLSA-N 5-chloro-N-[3-cyclopropyl-5-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-amine Chemical compound C[C@H]1CN(Cc2cc(Nc3ncc(Cl)c(n3)-c3c[nH]c4cc(C)ccc34)cc(c2)C2CC2)C[C@@H](C)N1 FZLSDZZNPXXBBB-KDURUIRLSA-N 0.000 description 1
- ISDHDETWWXDBOQ-UHFFFAOYSA-N 5-o-decyl 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 ISDHDETWWXDBOQ-UHFFFAOYSA-N 0.000 description 1
- NENZLVJAGVUDPI-UHFFFAOYSA-N 5-o-dodecyl 3-o-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC([N+]([O-])=O)=C1 NENZLVJAGVUDPI-UHFFFAOYSA-N 0.000 description 1
- KGTUMRLHQPWENE-UHFFFAOYSA-N 5-o-dodecyl 3-o-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC([N+]([O-])=O)=C1 KGTUMRLHQPWENE-UHFFFAOYSA-N 0.000 description 1
- CIXHMEWPHNPYMV-UHFFFAOYSA-N 5-o-propan-2-yl 3-o-undecyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCCCCCCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1C1=CC=CC([N+]([O-])=O)=C1 CIXHMEWPHNPYMV-UHFFFAOYSA-N 0.000 description 1
- AHISYUZBWDSPQL-UHFFFAOYSA-N 6-methylpyridine-2-carbaldehyde Chemical compound CC1=CC=CC(C=O)=N1 AHISYUZBWDSPQL-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- WOFAGNLBCJWEOE-UHFFFAOYSA-N Benzyl acetoacetate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1 WOFAGNLBCJWEOE-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 206010049816 Muscle tightness Diseases 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000002969 artificial stone Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- RCUIWQWWDLZNMS-UHFFFAOYSA-N benzyl 2-cyanoacetate Chemical compound N#CCC(=O)OCC1=CC=CC=C1 RCUIWQWWDLZNMS-UHFFFAOYSA-N 0.000 description 1
- WQDXVQNWDVXTLQ-UHFFFAOYSA-N benzyl 3-amino-3-iminopropanoate Chemical compound NC(=N)CC(=O)OCC1=CC=CC=C1 WQDXVQNWDVXTLQ-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- DJACTCNGCHPGOI-UHFFFAOYSA-N butyl 2-cyanoacetate Chemical compound CCCCOC(=O)CC#N DJACTCNGCHPGOI-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- QVMCJHQMNPLHIR-UHFFFAOYSA-N cyclopentyl 2-cyanoacetate Chemical compound N#CCC(=O)OC1CCCC1 QVMCJHQMNPLHIR-UHFFFAOYSA-N 0.000 description 1
- LBWLAVVCVDJDEP-UHFFFAOYSA-N cyclopentyl 3-amino-3-iminopropanoate Chemical compound NC(=N)CC(=O)OC1CCCC1 LBWLAVVCVDJDEP-UHFFFAOYSA-N 0.000 description 1
- UGZNCYLVFNJCGV-UHFFFAOYSA-N cyclopentyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCC1 UGZNCYLVFNJCGV-UHFFFAOYSA-N 0.000 description 1
- KVPGBYAKYUBLFG-UHFFFAOYSA-N cyclopentyl 5-(2-nitrophenyl)-3-oxopent-4-enoate Chemical compound [O-][N+](=O)C1=CC=CC=C1C=CC(=O)CC(=O)OC1CCCC1 KVPGBYAKYUBLFG-UHFFFAOYSA-N 0.000 description 1
- KTLNCDKVIYUYBD-UHFFFAOYSA-N decyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCCCCCCCCCOC(=O)C(C(C)=O)=CC1=CC=CC([N+]([O-])=O)=C1 KTLNCDKVIYUYBD-UHFFFAOYSA-N 0.000 description 1
- GBMQWYFEWPXXDE-UHFFFAOYSA-N decyl 3-oxo-5-[2-(trifluoromethyl)phenyl]pent-4-enoate Chemical compound CCCCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC=C1C(F)(F)F GBMQWYFEWPXXDE-UHFFFAOYSA-N 0.000 description 1
- HFCVYBJVVCGYFQ-UHFFFAOYSA-N decyl 3-oxohexanoate Chemical compound CCCCCCCCCCOC(=O)CC(=O)CCC HFCVYBJVVCGYFQ-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- VQZSDRXKLXBRHJ-UHFFFAOYSA-N diethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1 VQZSDRXKLXBRHJ-UHFFFAOYSA-N 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- GKDUCGITQRHERJ-UHFFFAOYSA-N dodecyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCCCCCCOC(=O)CC(N)=N GKDUCGITQRHERJ-UHFFFAOYSA-N 0.000 description 1
- SSTPFVXERQSMPM-UHFFFAOYSA-N dodecyl 5-(3-nitrophenyl)-3-oxopent-4-enoate Chemical compound CCCCCCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC([N+]([O-])=O)=C1 SSTPFVXERQSMPM-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- YOPMSDPIOQUWFE-XYOKQWHBSA-N ethyl (2e)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(\C(C)=O)=C\C1=CC=CC([N+]([O-])=O)=C1 YOPMSDPIOQUWFE-XYOKQWHBSA-N 0.000 description 1
- YPMPTULBFPFSEQ-PLNGDYQASA-N ethyl (z)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(\C)N YPMPTULBFPFSEQ-PLNGDYQASA-N 0.000 description 1
- QXQWIOZONGXWQO-UHFFFAOYSA-N ethyl 2-[(2-chlorophenyl)methylidene]-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=CC1=CC=CC=C1Cl QXQWIOZONGXWQO-UHFFFAOYSA-N 0.000 description 1
- AYZGINZXVVKWKV-UHFFFAOYSA-N ethyl 2-benzylidene-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=CC1=CC=CC=C1 AYZGINZXVVKWKV-UHFFFAOYSA-N 0.000 description 1
- TYYXOWPEFVCPDV-UHFFFAOYSA-N ethyl 3-(2-nitrophenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=CC=C1[N+]([O-])=O TYYXOWPEFVCPDV-UHFFFAOYSA-N 0.000 description 1
- SLKLZDHEMCXMNH-UHFFFAOYSA-N ethyl 3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate Chemical compound CCOC(=O)C(C(C)=O)=CC1=CC=CC=C1C(F)(F)F SLKLZDHEMCXMNH-UHFFFAOYSA-N 0.000 description 1
- UDRCONFHWYGWFI-UHFFFAOYSA-N ethyl 3-oxopentanoate Chemical compound CCOC(=O)CC(=O)CC UDRCONFHWYGWFI-UHFFFAOYSA-N 0.000 description 1
- MUJGKWAHRHQNFY-UHFFFAOYSA-N ethyl 5-(2,3-dichlorophenyl)-3-oxopent-4-enoate Chemical compound CCOC(=O)CC(=O)C=CC1=CC=CC(Cl)=C1Cl MUJGKWAHRHQNFY-UHFFFAOYSA-N 0.000 description 1
- 230000002964 excitative effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 244000243234 giant cane Species 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- FZQFHQKKVFZDRX-UHFFFAOYSA-N hept-1-enyl 3-oxobutanoate Chemical compound CCCCCC=COC(=O)CC(C)=O FZQFHQKKVFZDRX-UHFFFAOYSA-N 0.000 description 1
- SJDCJXRWNRXTNZ-UHFFFAOYSA-N heptyl 2-cyanoacetate Chemical compound CCCCCCCOC(=O)CC#N SJDCJXRWNRXTNZ-UHFFFAOYSA-N 0.000 description 1
- ODHAQWMQLOGADE-UHFFFAOYSA-N heptyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCOC(=O)CC(N)=N ODHAQWMQLOGADE-UHFFFAOYSA-N 0.000 description 1
- YAVJSVDUZGIQPQ-UHFFFAOYSA-N heptyl 3-oxobutanoate Chemical compound CCCCCCCOC(=O)CC(C)=O YAVJSVDUZGIQPQ-UHFFFAOYSA-N 0.000 description 1
- DCXNRXBLAGAHIL-UHFFFAOYSA-N heptyl 3-phenylprop-2-enoate Chemical compound CCCCCCCOC(=O)C=CC1=CC=CC=C1 DCXNRXBLAGAHIL-UHFFFAOYSA-N 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- OLNJUISKUQQNIM-UHFFFAOYSA-N indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CNC2=C1 OLNJUISKUQQNIM-UHFFFAOYSA-N 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OVWYEQOVUDKZNU-UHFFFAOYSA-N m-tolualdehyde Chemical compound CC1=CC=CC(C=O)=C1 OVWYEQOVUDKZNU-UHFFFAOYSA-N 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- OXMOJULFKLVWDY-UHFFFAOYSA-N nonyl 3-oxobutanoate Chemical compound CCCCCCCCCOC(=O)CC(C)=O OXMOJULFKLVWDY-UHFFFAOYSA-N 0.000 description 1
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- VGACEMCIRWAOLF-KHPPLWFESA-N octyl (z)-3-aminobut-2-enoate Chemical compound CCCCCCCCOC(=O)\C=C(\C)N VGACEMCIRWAOLF-KHPPLWFESA-N 0.000 description 1
- KJCACLJVMZWFDX-UHFFFAOYSA-N octyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCCOC(=O)CC(N)=N KJCACLJVMZWFDX-UHFFFAOYSA-N 0.000 description 1
- IKYDDBGYKFPTGF-UHFFFAOYSA-N octyl 3-oxobutanoate Chemical compound CCCCCCCCOC(=O)CC(C)=O IKYDDBGYKFPTGF-UHFFFAOYSA-N 0.000 description 1
- PUUBORMRQBPVKM-UHFFFAOYSA-N octyl 5-(2-chlorophenyl)-3-oxopent-4-enoate Chemical compound CCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC=C1Cl PUUBORMRQBPVKM-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- AXLMPTNTPOWPLT-UHFFFAOYSA-N prop-2-enyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC=C AXLMPTNTPOWPLT-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- BESQLCCRQYTQQI-UHFFFAOYSA-N propan-2-yl 2-cyanoacetate Chemical compound CC(C)OC(=O)CC#N BESQLCCRQYTQQI-UHFFFAOYSA-N 0.000 description 1
- ZVWPDJQEKLAOHT-UHFFFAOYSA-N propan-2-yl 3-amino-3-iminopropanoate Chemical compound CC(C)OC(=O)CC(N)=N ZVWPDJQEKLAOHT-UHFFFAOYSA-N 0.000 description 1
- GVIIRWAJDFKJMJ-UHFFFAOYSA-N propan-2-yl 3-oxobutanoate Chemical compound CC(C)OC(=O)CC(C)=O GVIIRWAJDFKJMJ-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- YIYRXCXJFKZQBC-UHFFFAOYSA-N quinazoline-2-carbaldehyde Chemical compound C1=CC=CC2=NC(C=O)=NC=C21 YIYRXCXJFKZQBC-UHFFFAOYSA-N 0.000 description 1
- MGCGJBXTNWUHQE-UHFFFAOYSA-N quinoline-4-carbaldehyde Chemical compound C1=CC=C2C(C=O)=CC=NC2=C1 MGCGJBXTNWUHQE-UHFFFAOYSA-N 0.000 description 1
- XNGYMORBKJLAQE-UHFFFAOYSA-N quinoxaline-5-carbaldehyde Chemical compound C1=CN=C2C(C=O)=CC=CC2=N1 XNGYMORBKJLAQE-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- KKUINEOCDWINEA-UHFFFAOYSA-N tetradecyl 2-cyanoacetate Chemical compound CCCCCCCCCCCCCCOC(=O)CC#N KKUINEOCDWINEA-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- MOHSIYYBSXQRJW-UHFFFAOYSA-N undecyl 2-cyanoacetate Chemical compound CCCCCCCCCCCOC(=O)CC#N MOHSIYYBSXQRJW-UHFFFAOYSA-N 0.000 description 1
- SIYOGNMICUPYJA-UHFFFAOYSA-N undecyl 3-amino-3-iminopropanoate Chemical compound CCCCCCCCCCCOC(=O)CC(N)=N SIYOGNMICUPYJA-UHFFFAOYSA-N 0.000 description 1
- BVKRJXBHRPRZCL-UHFFFAOYSA-N undecyl 3-oxobutanoate Chemical compound CCCCCCCCCCCOC(=O)CC(C)=O BVKRJXBHRPRZCL-UHFFFAOYSA-N 0.000 description 1
- VURMIFNFKYSHAM-UHFFFAOYSA-N undecyl 5-(3-nitrophenyl)-3-oxopent-4-enoate Chemical compound CCCCCCCCCCCOC(=O)CC(=O)C=CC1=CC=CC([N+]([O-])=O)=C1 VURMIFNFKYSHAM-UHFFFAOYSA-N 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/86—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/32—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Neurosurgery (AREA)
- Urology & Nephrology (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Hospice & Palliative Care (AREA)
- Vascular Medicine (AREA)
- Psychiatry (AREA)
- Pulmonology (AREA)
- Endocrinology (AREA)
- Reproductive Health (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
- Saccharide Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Pyrane Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823208628 DE3208628A1 (de) | 1982-03-10 | 1982-03-10 | Neue verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO830612L true NO830612L (no) | 1983-09-12 |
Family
ID=6157837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO830612A NO830612L (no) | 1982-03-10 | 1983-02-22 | Nye forbindelser, fremgangsmaate til deres fremstilling samt deres anvendelse i legemidler |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4622332A (ko) |
| EP (1) | EP0088276B1 (ko) |
| JP (1) | JPS58164575A (ko) |
| KR (1) | KR840004074A (ko) |
| AT (1) | ATE19513T1 (ko) |
| AU (1) | AU1214383A (ko) |
| CA (1) | CA1239401A (ko) |
| DE (2) | DE3208628A1 (ko) |
| DK (1) | DK114783A (ko) |
| ES (1) | ES520441A0 (ko) |
| FI (1) | FI830776L (ko) |
| GR (1) | GR78508B (ko) |
| IL (1) | IL68075A0 (ko) |
| NO (1) | NO830612L (ko) |
| PH (1) | PH20468A (ko) |
| PT (1) | PT76316B (ko) |
| ZA (1) | ZA831633B (ko) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0080220B1 (en) * | 1981-11-17 | 1986-02-19 | FISONS plc | Dihydropyridines, methods for their production and their formulation and use as pharmaceuticals |
| US4414213A (en) * | 1982-03-22 | 1983-11-08 | Mead Johnson & Company | Dihydropyridyl cyclic imidate esters and their pharmaceutical use |
| US4656181A (en) * | 1982-11-24 | 1987-04-07 | Cermol S.A. | Esters of 1,4-dihydropyridines, processes for the preparation of the new esters, and medicaments containing the same |
| WO1985000169A1 (en) * | 1983-06-21 | 1985-01-17 | Sandoz Ag | 1,4-dihydropyridine derivatives, production thereof and pharmaceutical preparations containing them |
| JPS60120861A (ja) * | 1983-12-02 | 1985-06-28 | Otsuka Pharmaceut Co Ltd | ジヒドロピリジン誘導体 |
| DE4342196A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Neue 4-Phenyl-substituierte 1,4-Dihydropyridine |
| JPS60156671A (ja) * | 1984-01-25 | 1985-08-16 | Yamanouchi Pharmaceut Co Ltd | ジヒドロピリジン誘導体およびその製造法 |
| IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
| US4672068A (en) * | 1984-05-04 | 1987-06-09 | Fujirebio Kabushiki Kaisha | Antihypertensive 1,4-dihydropyridines having a conjugated ester |
| FR2568773B1 (fr) * | 1984-08-10 | 1989-03-03 | Sandoz Lab | Nouvelles compositions pharmaceutiques administrables par voie nasale |
| AT381306B (de) * | 1984-08-28 | 1986-09-25 | Bayer Ag | Verfahren zur herstellung von unsymmetrischen 1,4-dihydropyridindicarbonsaeureestern |
| NO854021L (no) * | 1984-10-26 | 1986-04-28 | Bayer Ag | 1,4-dihydropyridin-hydroksyaminer og fremgangsmaate til fremstilling derav. |
| NL8503262A (nl) * | 1984-12-10 | 1986-07-01 | Sandoz Ag | 1,4-dihydropyridinederivaten, werkwijze voor het bereiden van deze derivaten en farmaceutische preparaten die ze bevatten. |
| US4833150A (en) * | 1985-03-14 | 1989-05-23 | Nelson Research & Development Co. | 1,4-dihydropyridines |
| US4659717A (en) * | 1985-08-21 | 1987-04-21 | Eli Lilly And Company | Dihydropyridines useful in the treatment of angina and stroke |
| US4735956A (en) * | 1985-09-13 | 1988-04-05 | Merck & Co., Inc. | Certain 1,4-dihydro-2,6-di-lower hydrocarbyl-4-heterocyclic-3,5-pyridine dicarboxylates which are useful as calcium channel blockers |
| JPS62174050A (ja) * | 1985-10-21 | 1987-07-30 | Nippon Shoji Kk | ３−アミノカルボニル−１，４−ジヒドロピリジン−５−カルボン酸誘導体、その製法および医薬組成物 |
| DE3544211A1 (de) * | 1985-12-13 | 1987-06-19 | Bayer Ag | Neue, fluorhaltige 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4771057A (en) * | 1986-02-03 | 1988-09-13 | University Of Alberta | Reduced pyridyl derivatives with cardiovascular regulating properties |
| US4849436A (en) * | 1986-03-11 | 1989-07-18 | Nelson Research & Development Co. | 1,4-dihydropyridines |
| FR2596760B1 (fr) * | 1986-04-02 | 1988-12-09 | Sori Soc Rech Ind | Derives dissymetriques de l'acide 1,4-dihydropyridine-3,5-dicarboxylique, procedes de preparation et utilisation en therapeutique |
| US4814455A (en) * | 1986-04-16 | 1989-03-21 | Bristol-Myers Company | Dihydro-3,5-dicarboxylates |
| US4769382A (en) * | 1986-09-30 | 1988-09-06 | Institut Organischeskogo Sinteza Leningradsky Nauchno-Issledovatelsky Institut | Preparation for preventing and treatment of skin radiation burn lesions |
| DE3724909A1 (de) * | 1987-07-28 | 1989-02-09 | Bayer Ag | Neue substituierte nitro-dihydropyridine, verfahren zu ihrer herstellung und ihre verwendung |
| US5470982A (en) * | 1988-01-20 | 1995-11-28 | Bayer Aktiengesellschaft | Disubstituted pyridines |
| JPH01151557A (ja) * | 1988-11-15 | 1989-06-14 | Otsuka Pharmaceut Co Ltd | 降圧剤 |
| JPH02149563A (ja) * | 1988-11-30 | 1990-06-08 | Nisshin Flour Milling Co Ltd | ２−ハロエトキシカルボニル基を含有する１，４−ジヒドロピリジン誘導体の製造法 |
| DK0595164T3 (da) * | 1992-10-30 | 1997-05-26 | Bayer Ag | 4-Heterocyclophenyl-substituerede dihydropyridiner |
| US6001857A (en) * | 1992-10-30 | 1999-12-14 | Bayer Aktiengesellschaft | Heterocyclyl substituted dihydropyridines |
| DE4236707A1 (de) * | 1992-10-30 | 1994-05-05 | Bayer Ag | 4-Heterocyclyl substituierte Dihydropyridine |
| DE4342193A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Arylsubstituierte Alkoxycarbonyl-1,4-dihydropyridin-5-carbonsäureester |
| EE03192B1 (et) * | 1993-12-10 | 1999-06-15 | Bayer Aktiengesellschaft | Isopropüül-(2-metoksüetüül)-4-(2-kloro-3-tsüanofenüül)-1,4-dihüdro-2,6-dimetüülpüri diin-3,5-dikarboksülaat, selle enantiomeerid ja vaheühend, meetodid nimetatud ühendite valmistamiseks ja kasutamine |
| DE59410255D1 (de) | 1993-12-10 | 2003-04-17 | Bayer Ag | Phenyl-substituierte 1,4-Dihydropyridine mit cerebraler Aktivität |
| DE4429786A1 (de) * | 1994-08-23 | 1996-02-29 | Bayer Ag | Verwendung von substituierten 6-Amino-4H-pyranen |
| DE19529858A1 (de) * | 1995-08-14 | 1997-02-20 | Bayer Ag | Substituierte 4H-Pyrane |
| DE19529859A1 (de) * | 1995-08-14 | 1997-02-20 | Bayer Ag | Verwendung von Acyl-substituierten Aminopyranen |
| US5977369A (en) * | 1995-12-28 | 1999-11-02 | Napp Technologies, Inc. | Process to prepare dihydropyridine and derivatives thereof |
| IT1283793B1 (it) * | 1996-08-23 | 1998-04-30 | Lusochimica Spa | Processo per la preparazione di diidropiridine |
| US6537504B1 (en) | 1998-04-06 | 2003-03-25 | Li Young | Method and apparatus for concurrent and sequential multi-step reactions for producing a plurality of different chemical compounds |
| US6538004B2 (en) | 2000-03-03 | 2003-03-25 | Abbott Laboratories | Tricyclic dihydropyrazolone and tricyclic dihydroisoxazolone potassium channel openers |
| CA2402179A1 (en) * | 2000-03-03 | 2001-09-13 | Abbott Laboratories | Tricyclic dihydropyrazolone and tricyclic dihydroisoxazolone potassium channel openers |
| CN105669532B (zh) * | 2014-12-03 | 2018-11-02 | 广州市恒诺康医药科技有限公司 | 尼莫地平水溶性衍生物及其制备方法和应用 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2117571C3 (de) * | 1971-04-10 | 1979-10-11 | Bayer Ag, 5090 Leverkusen | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3932645A (en) * | 1971-04-10 | 1976-01-13 | Farbenfabriken Bayer Ag | Pharmaceutical compositions containing unsymmetrical esters of 1,4-dihydropyridine 3,5-dicarboxylic acid |
| DE2117573C3 (de) * | 1971-04-10 | 1978-07-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von unsymmetrischen l,4-Dihydropyridin-3,5dicarbonsäureestern, sowie ihre Verwendung als Arzneimittel |
| DE2210672C3 (de) * | 1972-03-06 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| DE2235406C3 (de) * | 1972-07-19 | 1982-01-07 | Bayer Ag, 5090 Leverkusen | 2-Amino-4H-pyrane, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2650013C3 (de) * | 1976-10-30 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | 1.4-Dihydro-2.6-dimethyl-4-(3-nitrophenyl)-3.5-pyridindicarbonsäureisopropyl-(2-propoxy-äthyl)-ester, Verfahren zu seiner Herstellung sowie ihn enthaltende Arzneimittel |
| DE2659665A1 (de) * | 1976-12-30 | 1978-07-13 | Nattermann A & Cie | Neue 1,4-dihydropyridin-derivate |
| FI64938C (fi) * | 1977-06-20 | 1984-02-10 | Sandoz Ag | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara bensoxa- och bensotiadiazolyl-1,4-dihydropyridinderivat |
| SU740768A1 (ru) * | 1977-11-21 | 1980-06-15 | Институт Органического Синтеза Ан Латвийской Сср | Способ получени эфиров 2,6-диметил1,4-дигидропиридин-3,5-дикарбоновой кислоты |
| SU725406A1 (ru) * | 1978-08-08 | 1981-07-30 | Ордена Трудового Красного Знамениинститут Органического Синтеза Ah Латвий-Ской Ccp | Эфиры диметил дигидропиридин диКАРбОНОВОй КиСлОТы,ОблАдАющиЕ АНТи-МЕТАСТАТичЕСКОй АКТиВНОСТью |
| JPS5527054A (en) * | 1978-08-15 | 1980-02-26 | Gen Foods Corp | Adsorption method |
| US4307103A (en) * | 1978-09-08 | 1981-12-22 | Fujisawa Pharmaceutical Co., Ltd. | Dihydropyridine derivative, processes for preparation thereof and pharmaceutical composition comprising the same |
| DE2847236A1 (de) * | 1978-10-31 | 1980-05-14 | Bayer Ag | Neue dihydropyridine mit substituierten estergruppierungen, mehrer verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4258042A (en) * | 1980-04-11 | 1981-03-24 | Usv Pharmaceutical Corporation | Antihypertensive pyridines and compositions |
| DE3018259A1 (de) * | 1980-05-13 | 1981-11-19 | Bayer Ag, 5090 Leverkusen | 1,4-dihydropyridine mit unterschiedlichen substituenten in 2- und 6-position, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
| DE3022030A1 (de) * | 1980-06-12 | 1981-12-17 | Bayer Ag, 5090 Leverkusen | 4-thiazol- bzw. 4-imidazol-substituierte, 1,4-dihydropyridine, verfahren zu deren herstellung sowie diese enthaltende arzneimittel |
| DE3042769A1 (de) * | 1980-11-13 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | C-3 verknuepfte 1,4-dihydropyridine, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung |
-
1982
- 1982-03-10 DE DE19823208628 patent/DE3208628A1/de not_active Withdrawn
-
1983
- 1983-02-21 DE DE8383101626T patent/DE3363244D1/de not_active Expired
- 1983-02-21 AT AT83101626T patent/ATE19513T1/de not_active IP Right Cessation
- 1983-02-21 EP EP83101626A patent/EP0088276B1/de not_active Expired
- 1983-02-22 NO NO830612A patent/NO830612L/no unknown
- 1983-02-22 US US06/468,621 patent/US4622332A/en not_active Expired - Fee Related
- 1983-03-01 PT PT76316A patent/PT76316B/pt unknown
- 1983-03-07 IL IL68075A patent/IL68075A0/xx unknown
- 1983-03-08 AU AU12143/83A patent/AU1214383A/en not_active Abandoned
- 1983-03-08 FI FI830776A patent/FI830776L/fi not_active Application Discontinuation
- 1983-03-08 CA CA000423079A patent/CA1239401A/en not_active Expired
- 1983-03-08 GR GR70727A patent/GR78508B/el unknown
- 1983-03-09 DK DK114783A patent/DK114783A/da not_active Application Discontinuation
- 1983-03-09 JP JP58037579A patent/JPS58164575A/ja active Pending
- 1983-03-09 PH PH28620A patent/PH20468A/en unknown
- 1983-03-09 KR KR1019830000953A patent/KR840004074A/ko not_active Application Discontinuation
- 1983-03-09 ZA ZA831633A patent/ZA831633B/xx unknown
- 1983-03-09 ES ES520441A patent/ES520441A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| ES8401466A1 (es) | 1983-12-16 |
| PH20468A (en) | 1987-01-14 |
| FI830776L (fi) | 1983-09-11 |
| FI830776A0 (fi) | 1983-03-08 |
| EP0088276A1 (de) | 1983-09-14 |
| GR78508B (ko) | 1984-09-27 |
| ATE19513T1 (de) | 1986-05-15 |
| DK114783A (da) | 1983-09-11 |
| EP0088276B1 (de) | 1986-04-30 |
| ES520441A0 (es) | 1983-12-16 |
| DE3363244D1 (en) | 1986-06-05 |
| ZA831633B (en) | 1983-12-28 |
| JPS58164575A (ja) | 1983-09-29 |
| AU1214383A (en) | 1983-09-15 |
| IL68075A0 (en) | 1983-06-15 |
| PT76316A (en) | 1983-04-01 |
| DK114783D0 (da) | 1983-03-09 |
| PT76316B (en) | 1985-11-25 |
| US4622332A (en) | 1986-11-11 |
| KR840004074A (ko) | 1984-10-06 |
| DE3208628A1 (de) | 1983-09-22 |
| CA1239401A (en) | 1988-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO830612L (no) | Nye forbindelser, fremgangsmaate til deres fremstilling samt deres anvendelse i legemidler | |
| EP0071819B1 (de) | Dihydropyridine mit positiv inotroper Wirkung, neue Verbindungen, ihre Verwendung in Arzneimitteln und Verfahren zu ihrer Herstellung | |
| EP0176956B1 (de) | Neue Diarylverbindungen | |
| NO159928B (no) | Fremgangsmaate til fremstilling av optisk aktive 1-,4-dihydropyridinkarboksylsyreestere. | |
| EP0002208A1 (de) | Nitrosubstituierte 1,4-Dihydropyridine, diese enthaltende Arzneimittel sowie deren Herstellung | |
| EP0012180A1 (de) | Neue 1,4-Dihydropyridinverbindungen, Verfahren zu ihrer Herstellung, die genannten Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel | |
| EP0296316A1 (de) | 1,4-Dihydropyridin-Enantiomere | |
| NO811424L (no) | 1,4-dihydropyridiner med forskjellige substiruenter i 2- og 6-stilling, fremgangsmaate til deres fremstilling og deres anvendelse i legemidler | |
| EP0001769A1 (de) | 1,4-Dihydropyridincarbonsäureester mit schwefelhaltigen Estergruppen, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| US4497821A (en) | Medicaments having antihypoxic and ischaemia-protective activity | |
| US4772612A (en) | Circulation-active 1,4-dihydropyridines | |
| US4565824A (en) | Certain nitratoalkyl ester dihydropyridines having antihypertensive properties | |
| DE3130041A1 (de) | Dihydropyridine mit positiv inotroper wirkung, neue verbindungen, ihre verwendung in arzneimitteln und verfahren zu ihrer herstellung | |
| JPS60228485A (ja) | テトラヒドロチエノピリジン類 | |
| EP0186028B1 (de) | Optisch aktive Nitrodihydropyridine, Verfahren zur Herstellung und ihre Verwendung in Arzneimitteln | |
| NO893756L (no) | Basiske 4-aryl-dhp-amider, fremgangsmaate til deres fremstilling og deres anvendelse i legemidler. | |
| EP0225574B1 (de) | Neue, fluorhaltige 1,4-Dihydropyridine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE3816361A1 (de) | 1,4-dihydropyridindicarbonsaeure-(-)-menthylester | |
| US5158963A (en) | 1-4-dihydropyridine derivative, process for preparing the same and pharmaceutical composition containing the same | |
| JPS6112663A (ja) | 光学的に活性な１，４‐ジヒドロピリジン類の製造方法 | |
| HU194170B (en) | Process for production of derivatives of dihydropiridin with positive inotrop influence and medical compounds containing thereof | |
| EP0314038A1 (de) | Neue Pyrrolidine | |
| DE3816360A1 (de) | 2-amino-1,4-dihydropyridindicarbonsaeure-(-)-menthylester | |
| CS271495B2 (en) | Method of new dihydropyridinamides production |