NO822445L - Fremgangsmaate ved fremstilling av 6-(3,6-dihydro-1(2h)-pyridyl)-pyrimidin-3-oksyder - Google Patents
Fremgangsmaate ved fremstilling av 6-(3,6-dihydro-1(2h)-pyridyl)-pyrimidin-3-oksyderInfo
- Publication number
- NO822445L NO822445L NO822445A NO822445A NO822445L NO 822445 L NO822445 L NO 822445L NO 822445 A NO822445 A NO 822445A NO 822445 A NO822445 A NO 822445A NO 822445 L NO822445 L NO 822445L
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- alkyl
- dihydro
- methylene chloride
- pyridyl
- Prior art date
Links
- -1 3,6-DIHYDRO-1 (2H) -PYRIDYL Chemical class 0.000 title claims description 24
- 238000000034 method Methods 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000005905 mesyloxy group Chemical group 0.000 claims description 2
- 239000002023 wood Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 129
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 41
- 239000000243 solution Substances 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 22
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 16
- 238000003756 stirring Methods 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000000052 vinegar Substances 0.000 description 5
- 235000021419 vinegar Nutrition 0.000 description 5
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- VTAUYMBAQJQOII-UHFFFAOYSA-N [2-[carboxy(methyl)amino]-6-(4-methylphenyl)sulfonyloxy-3-oxidopyrimidin-3-ium-4-yl]-methylcarbamic acid Chemical compound CC1=CC=C(C=C1)S(=O)(=O)OC2=CC(=[N+](C(=N2)N(C)C(=O)O)[O-])N(C)C(=O)O VTAUYMBAQJQOII-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 150000007980 azole derivatives Chemical class 0.000 description 3
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 3
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229960000789 guanidine hydrochloride Drugs 0.000 description 3
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- POSWMWNNGRNENE-UHFFFAOYSA-N oxadiazolo[5,4-d]pyrimidine Chemical compound C1=NC=C2N=NOC2=N1 POSWMWNNGRNENE-UHFFFAOYSA-N 0.000 description 3
- 235000011118 potassium hydroxide Nutrition 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 230000007306 turnover Effects 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 2
- QJIUMVUZDYPQRT-UHFFFAOYSA-N 6-chloro-2,4-pyrimidinediamine Chemical compound NC1=CC(Cl)=NC(N)=N1 QJIUMVUZDYPQRT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- OVDVZCROWZMLKG-UHFFFAOYSA-N [2-[carboxy(methyl)amino]-6-(3,6-dihydro-2H-pyridin-1-yl)-3-oxidopyrimidin-3-ium-4-yl]-methylcarbamic acid Chemical compound CN(C1=[N+](C(=NC(=C1)N2CCC=CC2)N(C)C(=O)O)[O-])C(=O)O OVDVZCROWZMLKG-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 2
- 235000011116 calcium hydroxide Nutrition 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- AFCYWWIZGOUXCF-UHFFFAOYSA-N 1,2,3,6-tetrahydropyridine;hydrochloride Chemical compound Cl.C1CC=CCN1 AFCYWWIZGOUXCF-UHFFFAOYSA-N 0.000 description 1
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- PYEUBHBBJHTXEQ-UHFFFAOYSA-N 2-ethoxyethyl 3-methoxycarbonyliminopropanoate Chemical compound CCOCCOC(=O)CC=NC(=O)OC PYEUBHBBJHTXEQ-UHFFFAOYSA-N 0.000 description 1
- GZFMEBOTDSNSFW-UHFFFAOYSA-N 2-ethoxyprop-2-enoic acid;hydrochloride Chemical compound Cl.CCOC(=C)C(O)=O GZFMEBOTDSNSFW-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KDOMAJWJTHOGTR-UHFFFAOYSA-N COC(=O)NC1=CC(Cl)=NC(N)=[N+]1[O-] Chemical compound COC(=O)NC1=CC(Cl)=NC(N)=[N+]1[O-] KDOMAJWJTHOGTR-UHFFFAOYSA-N 0.000 description 1
- LNAYREKUNMZBMM-UHFFFAOYSA-N COC(=O)NC1=[N+]([O-])C(NC(=O)OC)=CC(N2CC=CCC2)=N1 Chemical compound COC(=O)NC1=[N+]([O-])C(NC(=O)OC)=CC(N2CC=CCC2)=N1 LNAYREKUNMZBMM-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical group COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GTXGKMGGTHZPGD-UHFFFAOYSA-N NC1=[N+]([O-])C(NC(=O)OC)=CC(OS(=O)(=O)C=2C=CC(C)=CC=2)=N1 Chemical compound NC1=[N+]([O-])C(NC(=O)OC)=CC(OS(=O)(=O)C=2C=CC(C)=CC=2)=N1 GTXGKMGGTHZPGD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- ZKCGHJHBKVDHPX-UHFFFAOYSA-N [2-amino-6-(methoxycarbonylamino)pyrimidin-4-yl] 4-methylbenzenesulfonate Chemical compound NC1=NC(NC(=O)OC)=CC(OS(=O)(=O)C=2C=CC(C)=CC=2)=N1 ZKCGHJHBKVDHPX-UHFFFAOYSA-N 0.000 description 1
- BVRMLSLPGHBRIG-UHFFFAOYSA-N [U].O1CCCC1 Chemical compound [U].O1CCCC1 BVRMLSLPGHBRIG-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005011 alkyl ether group Chemical group 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- XLTPBSBNLKQLHB-AATRIKPKSA-N ethyl (e)-3-amino-3-ethoxyprop-2-enoate Chemical compound CCO\C(N)=C\C(=O)OCC XLTPBSBNLKQLHB-AATRIKPKSA-N 0.000 description 1
- XLTPBSBNLKQLHB-UHFFFAOYSA-N ethyl 3-amino-3-ethoxyprop-2-enoate Chemical compound CCOC(N)=CC(=O)OCC XLTPBSBNLKQLHB-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- JQCPMLVMNQVRCC-UHFFFAOYSA-N methyl imidazole-1-carboxylate Chemical compound COC(=O)N1C=CN=C1 JQCPMLVMNQVRCC-UHFFFAOYSA-N 0.000 description 1
- GDQFQDAFVQRGPV-UHFFFAOYSA-N methyl n-(2-amino-4-oxo-1h-pyrimidin-6-yl)carbamate Chemical compound COC(=O)NC1=CC(=O)NC(N)=N1 GDQFQDAFVQRGPV-UHFFFAOYSA-N 0.000 description 1
- STPVTPLYEDBMRZ-UHFFFAOYSA-N methyl n-(2-amino-6-chloropyrimidin-4-yl)carbamate Chemical compound COC(=O)NC1=CC(Cl)=NC(N)=N1 STPVTPLYEDBMRZ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH464081A CH648842A5 (en) | 1981-07-15 | 1981-07-15 | Process for the preparation of alkyl and alkoxyalkyl 2-amino- 6-(3,6-dihydro-1(2H)-pyridyl)-4-pyrimidinecarbamate-3-oxides |
| CH155982 | 1982-03-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO822445L true NO822445L (no) | 1983-01-17 |
Family
ID=25688003
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO822445A NO822445L (no) | 1981-07-15 | 1982-07-14 | Fremgangsmaate ved fremstilling av 6-(3,6-dihydro-1(2h)-pyridyl)-pyrimidin-3-oksyder |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4549019A (es) |
| AT (1) | AT384807B (es) |
| CA (1) | CA1179344A (es) |
| DE (1) | DE3226050A1 (es) |
| DK (1) | DK317182A (es) |
| ES (1) | ES8400111A1 (es) |
| FI (1) | FI822407L (es) |
| FR (1) | FR2518543B1 (es) |
| GB (1) | GB2102800B (es) |
| IT (1) | IT1190908B (es) |
| LU (1) | LU84269A1 (es) |
| NL (1) | NL8202705A (es) |
| NO (1) | NO822445L (es) |
| PT (1) | PT75251B (es) |
| SE (1) | SE8204331L (es) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH649291A5 (de) * | 1982-03-16 | 1985-05-15 | Hoffmann La Roche | Dicarbamate. |
| HU196067B (en) * | 1986-07-10 | 1988-09-28 | Richter Gedeon Vegyeszet | Process for production of 6-amin-1,2-dihydro-1-hydroxi-2-imino-4-piperidin-piramidin |
| HU196061B (en) * | 1986-07-10 | 1988-09-28 | Richter Gedeon Vegyeszet | Process for production of pirimidine-derivatives |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3435035A (en) * | 1964-02-10 | 1969-03-25 | Cilag Chemie | Pyrimidine sulfones |
| US3461461A (en) * | 1965-11-01 | 1969-08-12 | Upjohn Co | 6-amino-4-(substituted amino)-1,2-dihydro-1-hydroxy-2-iminopyrimidines |
| US4176119A (en) * | 1977-02-04 | 1979-11-27 | Hoffmann-La Roche Inc. | 2,4-Pyrimidine-dicarbamate-3-oxides |
| CH638215A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-derivate. |
| CA1103245A (en) * | 1978-07-21 | 1981-06-16 | Jean-Claude Muller | Process for the manufacture of novel oxadiazolopyrimidine derivatives |
| HU177601B (en) * | 1978-10-27 | 1981-11-28 | Egyt Gyogyszervegyeszeti Gyar | New process for preparing 6-piperidino-2,4-diamino-pyrimidine-3-oxide |
-
1982
- 1982-06-22 CA CA000405765A patent/CA1179344A/en not_active Expired
- 1982-07-01 US US06/394,392 patent/US4549019A/en not_active Expired - Fee Related
- 1982-07-06 IT IT22254/82A patent/IT1190908B/it active
- 1982-07-06 NL NL8202705A patent/NL8202705A/nl not_active Application Discontinuation
- 1982-07-07 FI FI822407A patent/FI822407L/fi not_active Application Discontinuation
- 1982-07-12 DE DE19823226050 patent/DE3226050A1/de not_active Withdrawn
- 1982-07-13 FR FR8212304A patent/FR2518543B1/fr not_active Expired
- 1982-07-14 SE SE8204331A patent/SE8204331L/xx not_active Application Discontinuation
- 1982-07-14 DK DK317182A patent/DK317182A/da not_active Application Discontinuation
- 1982-07-14 NO NO822445A patent/NO822445L/no unknown
- 1982-07-14 PT PT75251A patent/PT75251B/pt unknown
- 1982-07-14 ES ES513953A patent/ES8400111A1/es not_active Expired
- 1982-07-14 GB GB08220466A patent/GB2102800B/en not_active Expired
- 1982-07-14 AT AT0273882A patent/AT384807B/de not_active IP Right Cessation
- 1982-07-15 LU LU84269A patent/LU84269A1/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3226050A1 (de) | 1983-02-03 |
| DK317182A (da) | 1983-01-16 |
| ES513953A0 (es) | 1983-10-16 |
| ES8400111A1 (es) | 1983-10-16 |
| AT384807B (de) | 1988-01-11 |
| IT1190908B (it) | 1988-02-24 |
| GB2102800B (en) | 1985-06-12 |
| FI822407L (fi) | 1983-01-16 |
| US4549019A (en) | 1985-10-22 |
| FI822407A0 (fi) | 1982-07-07 |
| SE8204331D0 (sv) | 1982-07-14 |
| SE8204331L (sv) | 1983-01-16 |
| FR2518543A1 (fr) | 1983-06-24 |
| IT8222254A0 (it) | 1982-07-06 |
| PT75251B (en) | 1985-10-04 |
| GB2102800A (en) | 1983-02-09 |
| CA1179344A (en) | 1984-12-11 |
| LU84269A1 (de) | 1984-03-22 |
| PT75251A (en) | 1982-08-01 |
| FR2518543B1 (fr) | 1985-12-06 |
| NL8202705A (nl) | 1983-02-01 |
| ATA273882A (de) | 1987-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0257781B1 (en) | A method for producing thiazolidinedione derivatives | |
| NO120426B (es) | ||
| NO160781B (no) | 1,2,5-tiadiazolderivater. | |
| NO832356L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive imidazolderivater. | |
| NO167947B (no) | Lagringsanordning for baand- eller plate-registreringsmedier | |
| EP1843820A1 (en) | Multicyclic bis-amide mmp inhibitors | |
| NO300874B1 (no) | Anvendelse av sulfonamider som virkestoffer ved fremstilling av legemidler for behandling av kretslöpssykdommer | |
| NO141163B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive pyrimidiner | |
| JP6568221B2 (ja) | ベンゾオキサゾールオキサジンケトン系化合物の製造方法及びその中間体と結晶形 | |
| WO2015188787A1 (en) | Method for preparing oxazolidinone compound and intermediates thereof | |
| NO752493L (es) | ||
| WO1998040378A1 (en) | Process for the preparation of 2-[[(2-pyridinyl)methyl]sulfinyl]-1h-benzimidazoles and novel compounds of use for such purpose | |
| NO822445L (no) | Fremgangsmaate ved fremstilling av 6-(3,6-dihydro-1(2h)-pyridyl)-pyrimidin-3-oksyder | |
| US4666915A (en) | 2-anilino-1,6-dihydro-6-oxo-5-pyrimidine-carboxylic acid derivatives, process for the preparation thereof, and antiallergic agent containing the same | |
| NO792412L (no) | Fremgangsmaate ved fremstilling av nye oxadiazolopyrimidinederivater | |
| SK161499A3 (en) | Process for producing isooxazolidinedione compound | |
| CA2108014A1 (en) | 4-aryl-3-(heteroarylureido)quinoline derivatives | |
| NO803160L (no) | Pyrimidin-derivater. | |
| DK153487B (da) | Analogifremgangsmaade til fremstilling af 2-(perhydro-1,4-diazino)-pyrimidooe5,4-daapyrimidinderivater | |
| US5849910A (en) | Process for the preparation of unsymmetrical 4,6-bis aryloxy-pyrimidine compounds | |
| JPH0546356B2 (es) | ||
| NO165248B (no) | Kammervegg for anvendelse i en konverter for behandling av stoepejernsmelter. | |
| Buscemi et al. | Heterocyclic rearrangements. Synthesis of 1, 2, 4‐oxadiazolo [2, 3‐a] pyrimidinium systems and their ring opening into pyrimidine N‐oxides | |
| De Tullio et al. | Synthesis and structural studies of 3-Alkylamino-pyrido [4, 3-e]-1, 2, 4-thiadiazine 1, 1-dioxides: a new class of heterocyclic compounds with therapeutical promises | |
| Katz et al. | A synthesis of some pyridinylpyrimidines from ketenedithioacetals |