NO794135L - Substituerte 4(3h)-kinazolinoner, fremgangsmaate ved fremstilling og anvendelse av disse - Google Patents
Substituerte 4(3h)-kinazolinoner, fremgangsmaate ved fremstilling og anvendelse av disseInfo
- Publication number
- NO794135L NO794135L NO794135A NO794135A NO794135L NO 794135 L NO794135 L NO 794135L NO 794135 A NO794135 A NO 794135A NO 794135 A NO794135 A NO 794135A NO 794135 L NO794135 L NO 794135L
- Authority
- NO
- Norway
- Prior art keywords
- group
- groups
- compound
- hydrogen atom
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 25
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 125
- 125000000217 alkyl group Chemical group 0.000 claims description 51
- 239000000203 mixture Substances 0.000 claims description 47
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 34
- -1 acetoxymethyl group Chemical group 0.000 claims description 33
- 239000000047 product Substances 0.000 claims description 26
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 125000005843 halogen group Chemical group 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 15
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- 125000003282 alkyl amino group Chemical group 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 229940124549 vasodilator Drugs 0.000 claims description 9
- 239000003071 vasodilator agent Substances 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 208000001953 Hypotension Diseases 0.000 claims description 6
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 claims description 6
- 230000000879 anti-atherosclerotic effect Effects 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 208000021822 hypotensive Diseases 0.000 claims description 6
- 230000001077 hypotensive effect Effects 0.000 claims description 6
- 125000006372 monohalo methyl group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 238000012546 transfer Methods 0.000 claims description 3
- JGICPIBJMZIJOF-UHFFFAOYSA-N ethyl 3-(2-chlorophenyl)-2,5,7-trimethyl-4-oxoquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=C(C)N1C1=CC=CC=C1Cl JGICPIBJMZIJOF-UHFFFAOYSA-N 0.000 claims description 2
- 235000007575 Calluna vulgaris Nutrition 0.000 claims 2
- OSXUBIXLFJGLBZ-UHFFFAOYSA-N 3-(2-nitrophenyl)quinazolin-4-one Chemical compound [O-][N+](=O)C1=CC=CC=C1N1C(=O)C2=CC=CC=C2N=C1 OSXUBIXLFJGLBZ-UHFFFAOYSA-N 0.000 claims 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 claims 1
- MCWQYUQZBJXMRL-UHFFFAOYSA-N ethyl 3-(2-chlorophenyl)-5,7-dimethyl-4-oxoquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=CN1C1=CC=CC=C1Cl MCWQYUQZBJXMRL-UHFFFAOYSA-N 0.000 claims 1
- UOYQSDVYEGFYOH-UHFFFAOYSA-N ethyl 5,7-dimethyl-3-(2-nitrophenyl)-4-oxoquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=CN1C1=CC=CC=C1[N+]([O-])=O UOYQSDVYEGFYOH-UHFFFAOYSA-N 0.000 claims 1
- 125000003431 oxalo group Chemical group 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 63
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 52
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 40
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000010410 layer Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 24
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- 239000002904 solvent Substances 0.000 description 18
- 235000019441 ethanol Nutrition 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 14
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 238000005917 acylation reaction Methods 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 238000005481 NMR spectroscopy Methods 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 230000010933 acylation Effects 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 150000002431 hydrogen Chemical class 0.000 description 6
- 201000001320 Atherosclerosis Diseases 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 210000001841 basilar artery Anatomy 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 4
- XGZNTUBWIASUQW-UHFFFAOYSA-N 2-amino-4-ethoxycarbonyl-3,5-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(C(O)=O)C(N)=C1C XGZNTUBWIASUQW-UHFFFAOYSA-N 0.000 description 4
- GNGNMHQUAACNST-UHFFFAOYSA-N 6-amino-3-ethoxycarbonyl-2,4-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(N)C(C(O)=O)=C1C GNGNMHQUAACNST-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 206010020772 Hypertension Diseases 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 210000000709 aorta Anatomy 0.000 description 4
- 210000004204 blood vessel Anatomy 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 230000000302 ischemic effect Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 210000003975 mesenteric artery Anatomy 0.000 description 4
- CDAWCLOXVUBKRW-UHFFFAOYSA-N ortho-hydroxyaniline Natural products NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 230000000304 vasodilatating effect Effects 0.000 description 4
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical compound C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 3
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- ZUVPLKVDZNDZCM-UHFFFAOYSA-N 3-chloro-2-methylaniline Chemical compound CC1=C(N)C=CC=C1Cl ZUVPLKVDZNDZCM-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 208000018152 Cerebral disease Diseases 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000011067 equilibration Methods 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N m-Aminophenol Natural products NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000006462 rearrangement reaction Methods 0.000 description 2
- 230000002040 relaxant effect Effects 0.000 description 2
- 230000002048 spasmolytic effect Effects 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- LYUPJHVGLFETDG-UHFFFAOYSA-N 1-phenylbutan-2-ol Chemical compound CCC(O)CC1=CC=CC=C1 LYUPJHVGLFETDG-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- KWVPRPSXBZNOHS-UHFFFAOYSA-N 2,4,6-Trimethylaniline Chemical compound CC1=CC(C)=C(N)C(C)=C1 KWVPRPSXBZNOHS-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- CSEWAUGPAQPMDC-UHFFFAOYSA-N 2-(4-aminophenyl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)C=C1 CSEWAUGPAQPMDC-UHFFFAOYSA-N 0.000 description 1
- ITKZQPVFKHIJPC-UHFFFAOYSA-N 2-(7-ethoxycarbonyl-6,8-dimethyl-4-oxoquinazolin-3-yl)benzoic acid Chemical compound CC=1C(C(=O)OCC)=C(C)C=C(C2=O)C=1N=CN2C1=CC=CC=C1C(O)=O ITKZQPVFKHIJPC-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- VXZBYIWNGKSFOJ-UHFFFAOYSA-N 2-[4-[5-(2,3-dihydro-1H-inden-2-ylamino)pyrazin-2-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC=1N=CC(=NC=1)C=1C=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2 VXZBYIWNGKSFOJ-UHFFFAOYSA-N 0.000 description 1
- LAGLPAIWSZCALZ-UHFFFAOYSA-N 2-acetamido-4-ethoxycarbonyl-3,5-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(C(O)=O)C(NC(C)=O)=C1C LAGLPAIWSZCALZ-UHFFFAOYSA-N 0.000 description 1
- INCUMHZOKPBPGJ-UHFFFAOYSA-N 2-amino-3,5-dimethyl-4-propan-2-yloxycarbonylbenzoic acid Chemical compound CC(C)OC(=O)C1=C(C)C=C(C(O)=O)C(N)=C1C INCUMHZOKPBPGJ-UHFFFAOYSA-N 0.000 description 1
- SEPDXGKMSDCUSF-UHFFFAOYSA-N 2-amino-4-butoxycarbonyl-3,5-dimethylbenzoic acid Chemical compound CCCCOC(=O)C1=C(C)C=C(C(O)=O)C(N)=C1C SEPDXGKMSDCUSF-UHFFFAOYSA-N 0.000 description 1
- NCCKAGUPTIEMOC-UHFFFAOYSA-N 2-amino-6-ethoxycarbonyl-4,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid Chemical compound CCOC(=O)C1(C)C=C(C)C=C(N)C1C(O)=O NCCKAGUPTIEMOC-UHFFFAOYSA-N 0.000 description 1
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 1
- UVRRJILIXQAAFK-UHFFFAOYSA-N 2-bromo-4-methylaniline Chemical compound CC1=CC=C(N)C(Br)=C1 UVRRJILIXQAAFK-UHFFFAOYSA-N 0.000 description 1
- MBBUTABXEITVNY-UHFFFAOYSA-N 2-chloro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1Cl MBBUTABXEITVNY-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- NIPDVSLAMPAWTP-UHFFFAOYSA-N 2-methoxy-5-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C=C1N NIPDVSLAMPAWTP-UHFFFAOYSA-N 0.000 description 1
- ICNCZFQYZKPYMS-UHFFFAOYSA-N 2-methylpropanoyl bromide Chemical compound CC(C)C(Br)=O ICNCZFQYZKPYMS-UHFFFAOYSA-N 0.000 description 1
- ZSFPJJJRNUZCEV-UHFFFAOYSA-N 2-methylpyridin-3-amine Chemical compound CC1=NC=CC=C1N ZSFPJJJRNUZCEV-UHFFFAOYSA-N 0.000 description 1
- ATXBGHLILIABGX-UHFFFAOYSA-N 2-nitro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O ATXBGHLILIABGX-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- CKQHAYFOPRIUOM-UHFFFAOYSA-N 3'-Aminoacetophenone Chemical compound CC(=O)C1=CC=CC(N)=C1 CKQHAYFOPRIUOM-UHFFFAOYSA-N 0.000 description 1
- WEYTUUBWDDEAGG-UHFFFAOYSA-N 3,4-dihydro-1h-2,3-benzoxazin-7-amine Chemical compound C1NOCC2=CC(N)=CC=C21 WEYTUUBWDDEAGG-UHFFFAOYSA-N 0.000 description 1
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- NJXPYZHXZZCTNI-UHFFFAOYSA-N 3-aminobenzonitrile Chemical compound NC1=CC=CC(C#N)=C1 NJXPYZHXZZCTNI-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- BYBATGPHXWCUNK-UHFFFAOYSA-N 3-ethoxycarbonyl-2,4-dimethyl-6-(2-methylpropanoylamino)benzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(NC(=O)C(C)C)C(C(O)=O)=C1C BYBATGPHXWCUNK-UHFFFAOYSA-N 0.000 description 1
- QXKOTGNGIJLXOX-UHFFFAOYSA-N 3-ethoxycarbonyl-6-formamido-2,4-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(NC=O)C(C(O)=O)=C1C QXKOTGNGIJLXOX-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- FREZLSIGWNCSOQ-UHFFFAOYSA-N 3-methylbutanoyl 3-methylbutanoate Chemical compound CC(C)CC(=O)OC(=O)CC(C)C FREZLSIGWNCSOQ-UHFFFAOYSA-N 0.000 description 1
- LBXKQIWKQYEXRO-UHFFFAOYSA-N 3-methylbutanoyl bromide Chemical compound CC(C)CC(Br)=O LBXKQIWKQYEXRO-UHFFFAOYSA-N 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- JIFKAJPSIFIUQR-UHFFFAOYSA-N 3-o-ethyl 1-o-methyl 6-amino-3,5-dimethylcyclohexa-1,5-diene-1,3-dicarboxylate Chemical compound CCOC(=O)C1(C)CC(C)=C(N)C(C(=O)OC)=C1 JIFKAJPSIFIUQR-UHFFFAOYSA-N 0.000 description 1
- WAIHFZPSLVDBRV-UHFFFAOYSA-N 3-phenylquinazolin-4-one Chemical class C1=NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1 WAIHFZPSLVDBRV-UHFFFAOYSA-N 0.000 description 1
- AFHLJRYAVLIEMS-UHFFFAOYSA-N 4-(diethylaminomethyl)aniline Chemical compound CCN(CC)CC1=CC=C(N)C=C1 AFHLJRYAVLIEMS-UHFFFAOYSA-N 0.000 description 1
- WHODQVWERNSQEO-UHFFFAOYSA-N 4-Amino-2-nitrophenol Chemical compound NC1=CC=C(O)C([N+]([O-])=O)=C1 WHODQVWERNSQEO-UHFFFAOYSA-N 0.000 description 1
- NNCCQALFJIMRKB-UHFFFAOYSA-N 4-[(dimethylamino)methyl]aniline Chemical compound CN(C)CC1=CC=C(N)C=C1 NNCCQALFJIMRKB-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical class NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical class NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- CVINWVPRKDIGLL-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1C(F)(F)F CVINWVPRKDIGLL-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical class NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- LGMWBTURBRPNCJ-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methoxybenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(OC)=C1 LGMWBTURBRPNCJ-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- YUHNYTAOELVPQD-UHFFFAOYSA-N 4-o-ethyl 1-o-methyl 2-amino-3,5-dimethylbenzene-1,4-dicarboxylate Chemical compound CCOC(=O)C1=C(C)C=C(C(=O)OC)C(N)=C1C YUHNYTAOELVPQD-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- VQXMTVHDPIEKRU-UHFFFAOYSA-N 6-[(2-chloroacetyl)amino]-3-ethoxycarbonyl-2,4-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(NC(=O)CCl)C(C(O)=O)=C1C VQXMTVHDPIEKRU-UHFFFAOYSA-N 0.000 description 1
- YHAHJOJWRJOXOI-UHFFFAOYSA-N 6-acetamido-3-ethoxycarbonyl-2,4-dimethylbenzoic acid Chemical compound CCOC(=O)C1=C(C)C=C(NC(C)=O)C(C(O)=O)=C1C YHAHJOJWRJOXOI-UHFFFAOYSA-N 0.000 description 1
- NHSPMRASBXMXFG-UHFFFAOYSA-N 6-amino-2,4-dimethyl-3-(2-methylpropoxycarbonyl)benzoic acid Chemical compound CC(C)COC(=O)C1=C(C)C=C(N)C(C(O)=O)=C1C NHSPMRASBXMXFG-UHFFFAOYSA-N 0.000 description 1
- NUUGQUDKEKGRLY-UHFFFAOYSA-N 6-amino-2,4-dimethyl-3-propan-2-yloxycarbonylbenzoic acid Chemical compound CC(C)OC(=O)C1=C(C)C=C(N)C(C(O)=O)=C1C NUUGQUDKEKGRLY-UHFFFAOYSA-N 0.000 description 1
- GFXIGTZCRHWQJF-UHFFFAOYSA-N 6-amino-2,4-dimethyl-3-propoxycarbonylbenzoic acid Chemical compound CCCOC(=O)C1=C(C)C=C(N)C(C(O)=O)=C1C GFXIGTZCRHWQJF-UHFFFAOYSA-N 0.000 description 1
- UPQWOMAUWQAJEA-UHFFFAOYSA-N 6-amino-3-butoxycarbonyl-2,4-dimethylbenzoic acid Chemical compound CCCCOC(=O)C1=C(C)C=C(N)C(C(O)=O)=C1C UPQWOMAUWQAJEA-UHFFFAOYSA-N 0.000 description 1
- QUXLCYFNVNNRBE-UHFFFAOYSA-N 6-methylpyridin-2-amine Chemical compound CC1=CC=CC(N)=N1 QUXLCYFNVNNRBE-UHFFFAOYSA-N 0.000 description 1
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 102100022404 E3 ubiquitin-protein ligase Midline-1 Human genes 0.000 description 1
- 101710102210 E3 ubiquitin-protein ligase Midline-1 Proteins 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- 206010015719 Exsanguination Diseases 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- JEYCTXHKTXCGPB-UHFFFAOYSA-N Methaqualone Chemical compound CC1=CC=CC=C1N1C(=O)C2=CC=CC=C2N=C1C JEYCTXHKTXCGPB-UHFFFAOYSA-N 0.000 description 1
- 241001442654 Percnon planissimum Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 235000013832 Valeriana officinalis Nutrition 0.000 description 1
- 244000126014 Valeriana officinalis Species 0.000 description 1
- LIGHQFMXKLNVMQ-UHFFFAOYSA-N [Cl].[Cl].[Cl].[P] Chemical compound [Cl].[Cl].[Cl].[P] LIGHQFMXKLNVMQ-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- ORWKVZNEPHTCQE-UHFFFAOYSA-N acetic formic anhydride Chemical compound CC(=O)OC=O ORWKVZNEPHTCQE-UHFFFAOYSA-N 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 210000002376 aorta thoracic Anatomy 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- QAWBXZYPFCFQLA-UHFFFAOYSA-N butanoyl bromide Chemical compound CCCC(Br)=O QAWBXZYPFCFQLA-UHFFFAOYSA-N 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 210000001627 cerebral artery Anatomy 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- MLNDZNTWRDUDEO-UHFFFAOYSA-N ethyl 2,5,7-trimethyl-3-(2-methylphenyl)-4-oxoquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=C(C)N1C1=CC=CC=C1C MLNDZNTWRDUDEO-UHFFFAOYSA-N 0.000 description 1
- KTPBRBKPQFPNCN-UHFFFAOYSA-N ethyl 2,5,7-trimethyl-3-(2-nitrophenyl)-4-oxoquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=C(C)N1C1=CC=CC=C1[N+]([O-])=O KTPBRBKPQFPNCN-UHFFFAOYSA-N 0.000 description 1
- MEZYHQSFMFKJJH-UHFFFAOYSA-N ethyl 2-(chloromethyl)-3-(2-chlorophenyl)-5,7-dimethyl-4-oxoquinazoline-6-carboxylate Chemical compound ClCC1=NC2=CC(=C(C(=C2C(N1C1=C(C=CC=C1)Cl)=O)C)C(=O)OCC)C MEZYHQSFMFKJJH-UHFFFAOYSA-N 0.000 description 1
- VQGBANGKKGIXSO-UHFFFAOYSA-N ethyl 3-(2-chlorophenyl)-5,7-dimethyl-4-oxo-2-propan-2-ylquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=C(C(C)C)N1C1=CC=CC=C1Cl VQGBANGKKGIXSO-UHFFFAOYSA-N 0.000 description 1
- CFGLSJLCMOHHID-UHFFFAOYSA-N ethyl 3-(2-ethoxycarbonylphenyl)-6,8-dimethyl-4-oxoquinazoline-7-carboxylate Chemical compound CCOC(=O)C1=CC=CC=C1N1C(=O)C2=CC(C)=C(C(=O)OCC)C(C)=C2N=C1 CFGLSJLCMOHHID-UHFFFAOYSA-N 0.000 description 1
- VGQGGSFWWHDBEE-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)-2,6,8-trimethyl-4-oxoquinazoline-7-carboxylate Chemical compound CC=1C(C(=O)OCC)=C(C)C=C(C2=O)C=1N=C(C)N2C1=CC=CC(Cl)=C1 VGQGGSFWWHDBEE-UHFFFAOYSA-N 0.000 description 1
- IXWUXVSEQHFPMI-UHFFFAOYSA-N ethyl 5,7-dimethyl-4-oxo-3-phenylquinazoline-6-carboxylate Chemical compound O=C1C2=C(C)C(C(=O)OCC)=C(C)C=C2N=CN1C1=CC=CC=C1 IXWUXVSEQHFPMI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000012737 fresh medium Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- NIPYIXMXODGEES-UHFFFAOYSA-N hexanoyl bromide Chemical compound CCCCCC(Br)=O NIPYIXMXODGEES-UHFFFAOYSA-N 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 208000023589 ischemic disease Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical class CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 210000001363 mesenteric artery superior Anatomy 0.000 description 1
- XRCRCNXSQYQLAQ-UHFFFAOYSA-N methyl 2-amino-3,5-dimethylbenzoate Chemical compound COC(=O)C1=CC(C)=CC(C)=C1N XRCRCNXSQYQLAQ-UHFFFAOYSA-N 0.000 description 1
- OEBNORXUIYOXGB-UHFFFAOYSA-N methyl 2-amino-4,5-dimethylbenzoate Chemical compound COC(=O)C1=CC(C)=C(C)C=C1N OEBNORXUIYOXGB-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- RGRJVHFINXMQCY-UHFFFAOYSA-N n,n-bis(1,3-benzodioxol-5-yl)methanimidamide Chemical compound C1=C2OCOC2=CC(N(C=2C=C3OCOC3=CC=2)C=N)=C1 RGRJVHFINXMQCY-UHFFFAOYSA-N 0.000 description 1
- UKTHBCMHYFIUQD-UHFFFAOYSA-N n,n-bis(2,4-dimethylphenyl)methanimidamide Chemical compound CC1=CC(C)=CC=C1N(C=N)C1=CC=C(C)C=C1C UKTHBCMHYFIUQD-UHFFFAOYSA-N 0.000 description 1
- CJCNXAKLVTWRAO-UHFFFAOYSA-N n,n-bis(2,6-dichlorophenyl)methanimidamide Chemical compound ClC1=CC=CC(Cl)=C1N(C=N)C1=C(Cl)C=CC=C1Cl CJCNXAKLVTWRAO-UHFFFAOYSA-N 0.000 description 1
- VOOMGKLPBCQVAD-UHFFFAOYSA-N n,n-bis(2,6-difluorophenyl)methanimidamide Chemical compound FC1=CC=CC(F)=C1N(C=N)C1=C(F)C=CC=C1F VOOMGKLPBCQVAD-UHFFFAOYSA-N 0.000 description 1
- MREQWMQNIBUQJW-UHFFFAOYSA-N n,n-bis(2-chlorophenyl)methanimidamide Chemical compound ClC1=CC=CC=C1N(C=N)C1=CC=CC=C1Cl MREQWMQNIBUQJW-UHFFFAOYSA-N 0.000 description 1
- OHDYVFCQZVNDDL-UHFFFAOYSA-N n,n-bis(2-methylphenyl)methanimidamide Chemical compound CC1=CC=CC=C1N(C=N)C1=CC=CC=C1C OHDYVFCQZVNDDL-UHFFFAOYSA-N 0.000 description 1
- BZDAUNDIDZFYNB-UHFFFAOYSA-N n,n-bis(3,4-diethoxy-2-methylphenyl)methanimidamide Chemical compound CC1=C(OCC)C(OCC)=CC=C1N(C=N)C1=CC=C(OCC)C(OCC)=C1C BZDAUNDIDZFYNB-UHFFFAOYSA-N 0.000 description 1
- WCVSTUSKGZSIEQ-UHFFFAOYSA-N n,n-bis(3,4-diethoxyphenyl)methanimidamide Chemical compound C1=C(OCC)C(OCC)=CC=C1N(C=N)C1=CC=C(OCC)C(OCC)=C1 WCVSTUSKGZSIEQ-UHFFFAOYSA-N 0.000 description 1
- VPUPOKLIZDNYRZ-UHFFFAOYSA-N n,n-bis(3,4-dimethylphenyl)methanimidamide Chemical compound C1=C(C)C(C)=CC=C1N(C=N)C1=CC=C(C)C(C)=C1 VPUPOKLIZDNYRZ-UHFFFAOYSA-N 0.000 description 1
- SMGHFKFQYWSQGL-UHFFFAOYSA-N n,n-bis(3-methylphenyl)methanimidamide Chemical compound CC1=CC=CC(N(C=N)C=2C=C(C)C=CC=2)=C1 SMGHFKFQYWSQGL-UHFFFAOYSA-N 0.000 description 1
- JJPVPZCTSPHRIR-UHFFFAOYSA-N n,n-bis(4-methylphenyl)methanimidamide Chemical compound C1=CC(C)=CC=C1N(C=N)C1=CC=C(C)C=C1 JJPVPZCTSPHRIR-UHFFFAOYSA-N 0.000 description 1
- DCNUQRBLZWSGAV-UHFFFAOYSA-N n,n-diphenylformamide Chemical compound C=1C=CC=CC=1N(C=O)C1=CC=CC=C1 DCNUQRBLZWSGAV-UHFFFAOYSA-N 0.000 description 1
- XXTISPYPIAPDGY-UHFFFAOYSA-N n,n-diphenylmethanimidamide Chemical compound C=1C=CC=CC=1N(C=N)C1=CC=CC=C1 XXTISPYPIAPDGY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GTDQGKWDWVUKTI-UHFFFAOYSA-N o-aminoacetophenone Chemical compound CC(=O)C1=CC=CC=C1N GTDQGKWDWVUKTI-UHFFFAOYSA-N 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229960001789 papaverine Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229940084106 spermaceti Drugs 0.000 description 1
- 239000012177 spermaceti Substances 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- PNQBEPDZQUOCNY-UHFFFAOYSA-N trifluoroacetyl chloride Chemical compound FC(F)(F)C(Cl)=O PNQBEPDZQUOCNY-UHFFFAOYSA-N 0.000 description 1
- 235000016788 valerian Nutrition 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/91—Oxygen atoms with aryl or aralkyl radicals attached in position 2 or 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP15576478A JPS5583761A (en) | 1978-12-19 | 1978-12-19 | Novel 3-phenyl-4-quinazolone derivative |
JP12673879A JPS5651461A (en) | 1979-10-03 | 1979-10-03 | Novel 3-phenyl-4-quinazolone derivative |
JP13358279A JPS5657768A (en) | 1979-10-18 | 1979-10-18 | Novel 4-quinazolone derivative substituted by aromatic residue at 3-position |
JP14198779A JPS5665877A (en) | 1979-11-05 | 1979-11-05 | Preparation of 4-quinazolone derivative |
Publications (1)
Publication Number | Publication Date |
---|---|
NO794135L true NO794135L (no) | 1980-06-20 |
Family
ID=27471233
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO794135A NO794135L (no) | 1978-12-19 | 1979-12-18 | Substituerte 4(3h)-kinazolinoner, fremgangsmaate ved fremstilling og anvendelse av disse |
Country Status (16)
Country | Link |
---|---|
US (1) | US4276295A (sv) |
AR (1) | AR225028A1 (sv) |
AU (1) | AU526309B2 (sv) |
CH (1) | CH644112A5 (sv) |
DD (1) | DD150462A5 (sv) |
DE (1) | DE2950376A1 (sv) |
DK (1) | DK539979A (sv) |
FR (1) | FR2444671A1 (sv) |
GB (1) | GB2040927B (sv) |
HU (1) | HU182733B (sv) |
IT (1) | IT1126577B (sv) |
NL (1) | NL7909118A (sv) |
NO (1) | NO794135L (sv) |
NZ (1) | NZ192392A (sv) |
SE (1) | SE7910376L (sv) |
YU (1) | YU306379A (sv) |
Families Citing this family (17)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA1161036A (en) * | 1980-05-15 | 1984-01-24 | Masayuki Ishikawa | Quinazoline-dione compounds, process for production thereof and pharmaceutical use thereof |
AU543928B2 (en) * | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
US4419357A (en) * | 1982-01-18 | 1983-12-06 | The Dow Chemical Company | 3-(1H-Tetrazol-5-yl)-4(3H)-quinazolinones |
US4684654A (en) * | 1985-08-14 | 1987-08-04 | American Cyanamid Company | 3-heteroalkyl-2,4-quinzaolinediones |
EP0293500A1 (en) * | 1987-06-01 | 1988-12-07 | American Cyanamid Company | 3-heteroalkyl-2,4.quinzaoline-diones |
JPH05504969A (ja) * | 1990-02-13 | 1993-07-29 | メルク・エンド・カムパニー・インコーポレーテツド | 置換ベンジル要素を含有するアンギオテンシン2アンタゴニスト類 |
US5075313A (en) * | 1990-09-13 | 1991-12-24 | Eli Lilly And Company | 3-aryl-4(3H)quinazolinone CCK antagonists and pharmaceutical formulations thereof |
US5283247A (en) * | 1991-02-06 | 1994-02-01 | Research Corporation Technologies, Inc. | Anticonvulsant substituted quinazolones |
WO1992013535A1 (en) * | 1991-02-06 | 1992-08-20 | Research Corporation Technologies, Inc. | Anticonvulsant substituted quinazolones |
RU2139862C1 (ru) * | 1993-05-12 | 1999-10-20 | Е.И. Дю Пон де Немурс энд Компани | Замещенные 4(3н)-хиназолиноны, обладающие фунгицидными свойствами, композиции на их основе и способы борьбы с мучнистой росой |
US5756502A (en) * | 1994-08-08 | 1998-05-26 | Warner-Lambert Company | Quinazolinone derivatives as cholyecystokinin (CCK) ligands |
US6255311B1 (en) * | 1998-01-14 | 2001-07-03 | E. I. Du Pont De Nemours And Company | Fungicidal fused bicyclic pyrimidinones |
AU2002214546A1 (en) * | 2000-09-29 | 2002-04-08 | Cor Therapeutics, Inc. | Bicyclic pyrimidin-4-one based inhibitors of factor xa |
TW200306839A (en) * | 2002-02-06 | 2003-12-01 | Novartis Ag | Quinazolinone derivatives and their use as CB agonists |
AU2007202781B2 (en) * | 2002-02-06 | 2010-09-09 | Novartis Ag | Quinazolinone derivatives and their use as CB agonists |
NZ549046A (en) * | 2004-02-13 | 2010-06-25 | Banyu Pharma Co Ltd | Fused-ring 4-oxopyrimidine derivative |
KR101781922B1 (ko) | 2012-04-10 | 2017-09-26 | 안지 파마슈티컬 코퍼레이션 리미티드 | 히스톤 탈아세틸효소(hdacs) 억제제 |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3047462A (en) * | 1959-03-06 | 1962-07-31 | Lab Jacques Logeais Soc D Expl | Quinazolone anti-inflammatory composition |
DE1695799C3 (de) * | 1967-01-23 | 1974-10-17 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 5-Chlor-3- eckige Klammer auf pyridin-2'-yl eckige Klammer zu -4-(3H)- chinazolinone |
JPS5521748B2 (sv) * | 1972-09-19 | 1980-06-12 | ||
JPS5516425B2 (sv) * | 1972-09-19 | 1980-05-01 |
-
1979
- 1979-12-13 NZ NZ192392A patent/NZ192392A/xx unknown
- 1979-12-14 DE DE19792950376 patent/DE2950376A1/de not_active Withdrawn
- 1979-12-14 YU YU03063/79A patent/YU306379A/xx unknown
- 1979-12-14 US US06/103,841 patent/US4276295A/en not_active Expired - Lifetime
- 1979-12-17 SE SE7910376A patent/SE7910376L/sv not_active Application Discontinuation
- 1979-12-17 IT IT28062/79A patent/IT1126577B/it active
- 1979-12-17 AR AR279316A patent/AR225028A1/es active
- 1979-12-17 AU AU53932/79A patent/AU526309B2/en not_active Ceased
- 1979-12-18 NO NO794135A patent/NO794135L/no unknown
- 1979-12-18 DK DK539979A patent/DK539979A/da not_active Application Discontinuation
- 1979-12-18 NL NL7909118A patent/NL7909118A/nl not_active Application Discontinuation
- 1979-12-18 GB GB7943565A patent/GB2040927B/en not_active Expired
- 1979-12-19 FR FR7931059A patent/FR2444671A1/fr active Granted
- 1979-12-19 HU HU79II311A patent/HU182733B/hu unknown
- 1979-12-19 DD DD79217854A patent/DD150462A5/de unknown
- 1979-12-19 CH CH1125779A patent/CH644112A5/de not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
GB2040927B (en) | 1983-01-26 |
AU5393279A (en) | 1980-06-26 |
FR2444671B1 (sv) | 1983-06-10 |
HU182733B (en) | 1984-03-28 |
IT7928062A0 (it) | 1979-12-17 |
NZ192392A (en) | 1983-02-15 |
FR2444671A1 (fr) | 1980-07-18 |
DE2950376A1 (de) | 1980-07-10 |
NL7909118A (nl) | 1980-06-23 |
GB2040927A (en) | 1980-09-03 |
US4276295A (en) | 1981-06-30 |
AU526309B2 (en) | 1983-01-06 |
AR225028A1 (es) | 1982-02-15 |
DK539979A (da) | 1980-06-20 |
SE7910376L (sv) | 1980-06-20 |
IT1126577B (it) | 1986-05-21 |
CH644112A5 (de) | 1984-07-13 |
DD150462A5 (de) | 1981-09-02 |
YU306379A (en) | 1983-12-31 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO794135L (no) | Substituerte 4(3h)-kinazolinoner, fremgangsmaate ved fremstilling og anvendelse av disse | |
FI57260C (fi) | Foerfarande foer framstaellning av terapeutiskt verksamma 2-amino-3,4-dihydro-5-metyl-imidazo-/5,1-f/-as-triaziner | |
US4066651A (en) | Alkanoic acid 2-quinoline derivatives | |
US4393062A (en) | Pharmaceutical compositions and method for the production of an anti-inflammatory effect | |
US4877793A (en) | Thieno[3,2-b]pyridine-6-carboxamide compounds useful in treating hypertension | |
CA2026890C (en) | Quinoline derivatives, their production and use | |
KR20050099525A (ko) | 피롤로트리아진 키나제 억제제의 제조 방법 | |
CA2071224C (en) | Quinoline derivatives, their production and use | |
US4405623A (en) | Quinazolinde-dione compounds, process for production thereof and pharmaceutical use thereof | |
FI57594B (fi) | Foerfarande foer framstaellning av antiallergiskt verksamma n-(bentstiazol-2-yl)-oxamidsyra-derivat | |
US4455311A (en) | Imidazoquinazoline derivatives which inhibit the aggregation of blood platelets, inhibit gastric secretion or have activity on the circulatory system | |
US4639518A (en) | Substituted quinazolinediones | |
US4801590A (en) | Pyrido(1,8)naphthyridinones, and their use as pharmaceuticals | |
HINO et al. | Synthesis and pharmacological activities of 3-phenyl-2-(1-piperazinyl) quinolines and related compounds | |
US5278186A (en) | Chromene derivatives, their production and use | |
US4071516A (en) | 4-(Acyloxyphenyl)-quinazolin-2(1H)-ones | |
US4424361A (en) | Process for preparing polycyclic triazoles used to inhibit allergic responses | |
CA1230123A (en) | 3-alkyl-8-chloro-5,6-dihydrofuro-¬3,2-f|-1,2- benzisoxazole-6-carboxylic acids | |
US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
US4044134A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
NO125314B (sv) | ||
US4134981A (en) | Pyrimidal [2,3,d]Pyrimidin-4(3H)-ones as antiallergy agents | |
CA1111849A (en) | 3-aromatic moiety substituted-4(3h)-quinazolinones, process for production thereof, and use thereof | |
US4187310A (en) | 1,2-Dihydro-2-oxoquinol-4-ylacetic acid derivatives and pharmaceutical compositions | |
HU201081B (en) | Process for preparing thiazolobenzimidazoles and intermediates used therein |