NO761937L - - Google Patents
Info
- Publication number
- NO761937L NO761937L NO761937A NO761937A NO761937L NO 761937 L NO761937 L NO 761937L NO 761937 A NO761937 A NO 761937A NO 761937 A NO761937 A NO 761937A NO 761937 L NO761937 L NO 761937L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- compounds
- hydrogen
- addition salts
- acid addition
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- DNXIQMQGKSQHPC-UHFFFAOYSA-N 7-methoxy-3,4,5,6-tetrahydro-2h-azepine Chemical compound COC1=NCCCCC1 DNXIQMQGKSQHPC-UHFFFAOYSA-N 0.000 description 1
- XNARWRIFLYFVNN-UHFFFAOYSA-N 8-chloro-5,10-dihydro-4h-benzo[3,4]cyclohepta[1,3-b]thiophen-10-amine;hydrochloride Chemical compound Cl.C1CC2=CC=C(Cl)C=C2C(N)C2=C1SC=C2 XNARWRIFLYFVNN-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- -1 chloro-9,10-dihydro-4-hydroxyimino-4H-benzo(4,5)cyclohepta(1,2-b)thiophene Chemical compound 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid group Chemical group C(\C=C/C(=O)O)(=O)O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008664 renal activity Effects 0.000 description 1
- 230000000054 salidiuretic effect Effects 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH776275 | 1975-06-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO761937L true NO761937L (ja) | 1976-12-17 |
Family
ID=4330098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO761937A NO761937L (ja) | 1975-06-16 | 1976-06-08 |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4032640A (ja) |
| JP (1) | JPS52261A (ja) |
| AT (1) | ATA435076A (ja) |
| AU (1) | AU508261B2 (ja) |
| BE (1) | BE842943A (ja) |
| CA (1) | CA1068268A (ja) |
| DD (1) | DD125078A5 (ja) |
| DE (1) | DE2625641A1 (ja) |
| DK (1) | DK253676A (ja) |
| ES (1) | ES448849A1 (ja) |
| FI (1) | FI761607A (ja) |
| FR (1) | FR2314723A1 (ja) |
| GB (1) | GB1547838A (ja) |
| IL (1) | IL49785A (ja) |
| NL (1) | NL7606315A (ja) |
| NO (1) | NO761937L (ja) |
| NZ (1) | NZ181146A (ja) |
| PH (1) | PH13401A (ja) |
| PT (1) | PT65224B (ja) |
| SE (1) | SE7606405L (ja) |
| YU (1) | YU147476A (ja) |
| ZA (1) | ZA763572B (ja) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5643327Y2 (ja) * | 1978-03-27 | 1981-10-09 | ||
| JPS5727473Y2 (ja) * | 1979-02-10 | 1982-06-15 | ||
| US4965284A (en) * | 1988-05-19 | 1990-10-23 | American Cyanamid Company | Substituted dibenzothiophenes |
| EP0342433A3 (en) * | 1988-05-19 | 1991-06-19 | American Cyanamid Company | Substituted dibenzothiaphenes |
| JPH0446080U (ja) * | 1990-08-22 | 1992-04-20 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH504466A (de) * | 1969-02-07 | 1971-03-15 | Sandoz Ag | Verfahren zur Herstellung von 4-(1-Methyl-4-piperidyliden-N-oxid)- -9,10-dihydro-4H-benzo(4,5)cycloheptal(1,2-b)thiophen |
| CH531000A (de) * | 1970-03-11 | 1972-11-30 | Sandoz Ag | Verfahren zur Herstellung neuer Benzocycloheptathiophene |
| BE794377A (fr) * | 1972-01-24 | 1973-07-23 | Sandoz Sa | Nouveaux derives du benzo-cyclohepta-thiophene |
| US3960894A (en) * | 1972-01-24 | 1976-06-01 | Sandoz Ltd. | 9-Bromo-or chloro-9,10-dihydro-10-dihydro-10-alkoxy-4H-benzo[4,5]cyclo-hepta[1,2-b]thiophen-4-ones |
-
1976
- 1976-06-07 FI FI761607A patent/FI761607A/fi not_active Application Discontinuation
- 1976-06-08 NO NO761937A patent/NO761937L/no unknown
- 1976-06-08 DE DE19762625641 patent/DE2625641A1/de not_active Withdrawn
- 1976-06-08 DK DK253676A patent/DK253676A/da not_active Application Discontinuation
- 1976-06-08 SE SE7606405A patent/SE7606405L/xx not_active Application Discontinuation
- 1976-06-09 US US05/694,152 patent/US4032640A/en not_active Expired - Lifetime
- 1976-06-11 NL NL7606315A patent/NL7606315A/xx not_active Application Discontinuation
- 1976-06-11 FR FR7617692A patent/FR2314723A1/fr active Granted
- 1976-06-14 PT PT65224A patent/PT65224B/pt unknown
- 1976-06-14 CA CA254,790A patent/CA1068268A/en not_active Expired
- 1976-06-14 BE BE167913A patent/BE842943A/xx unknown
- 1976-06-14 DD DD193361A patent/DD125078A5/xx unknown
- 1976-06-14 IL IL49785A patent/IL49785A/xx unknown
- 1976-06-14 NZ NZ181146A patent/NZ181146A/xx unknown
- 1976-06-14 PH PH18573A patent/PH13401A/en unknown
- 1976-06-14 ES ES448849A patent/ES448849A1/es not_active Expired
- 1976-06-15 AU AU14917/76A patent/AU508261B2/en not_active Expired
- 1976-06-15 GB GB24724/76A patent/GB1547838A/en not_active Expired
- 1976-06-15 AT AT435076A patent/ATA435076A/de not_active Application Discontinuation
- 1976-06-15 JP JP51069418A patent/JPS52261A/ja active Pending
- 1976-06-16 ZA ZA00763572A patent/ZA763572B/xx unknown
- 1976-06-16 YU YU01474/76A patent/YU147476A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU1491776A (en) | 1977-12-22 |
| US4032640A (en) | 1977-06-28 |
| JPS52261A (en) | 1977-01-05 |
| SE7606405L (sv) | 1976-12-17 |
| BE842943A (fr) | 1976-12-14 |
| FR2314723A1 (fr) | 1977-01-14 |
| NL7606315A (nl) | 1976-12-20 |
| IL49785A (en) | 1979-12-30 |
| IL49785A0 (en) | 1976-08-31 |
| ES448849A1 (es) | 1977-12-01 |
| FI761607A (ja) | 1976-12-17 |
| GB1547838A (en) | 1979-06-27 |
| CA1068268A (en) | 1979-12-18 |
| DE2625641A1 (de) | 1977-01-20 |
| DD125078A5 (ja) | 1977-03-30 |
| AU508261B2 (en) | 1980-03-13 |
| NZ181146A (en) | 1978-04-28 |
| ATA435076A (de) | 1980-05-15 |
| ZA763572B (en) | 1978-01-25 |
| FR2314723B1 (ja) | 1978-12-15 |
| YU147476A (en) | 1982-05-31 |
| PT65224B (fr) | 1978-03-24 |
| PH13401A (en) | 1980-03-28 |
| PT65224A (fr) | 1976-07-01 |
| DK253676A (da) | 1976-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4076820A (en) | Benzoquinolizines and hypotensive compositions containing them | |
| JPS59507B2 (ja) | 新規な複素環式化合物の製造方法 | |
| NO163816B (no) | Analogifremgangsmaate for fremstilling av nye, terapeutiskaktive piperazinderivater. | |
| DK162629B (da) | 2-substituerede 1-aralkyl-imidazoler og farmaceutiske midler der indeholder disse, anvendelse heraf til fremstilling af farmaceutiske midler samt fremgangsmaade til fremstilling heraf | |
| SU428597A3 (ru) | СПОСОБ ПОЛУЧЕНИЯ р-АРИЛ-2-АМИНОАЛКОКСИСТИРОЛОВ | |
| JPS60358B2 (ja) | ベンゾモルフアン化合物の製法 | |
| US4564613A (en) | Pyridoindole derivatives, compositions and use | |
| CA1335502C (en) | Psychotropic bicyclic imides | |
| IE42978B1 (en) | Triaryl alkyl azabicyclo compounds | |
| NO761937L (ja) | ||
| JP3057095B2 (ja) | イサチン誘導体、その製造方法及びその使用方法 | |
| KR900002246B1 (ko) | 테트라하이드로-2-헤테로사이클로알킬-피리도[4,3-b]인돌 및 그의 제조방법 | |
| DK145542B (da) | Analogifremgangsmaade til fremstilling af ergolinforbindelser | |
| CS241050B2 (en) | Method of phenylquinolizidines production | |
| NO901652L (no) | Angstdempende midler. | |
| SE431868B (sv) | Forfarande for framstellning av n-(1-cyklohexyl-3-pyrrolidinyl)-bensamider med antiemetisk verkan | |
| NO752078L (ja) | ||
| NO743980L (ja) | ||
| US4031223A (en) | Trifluoromethylthio derivatives of cyproheptadine | |
| KR880001715B1 (ko) | 1-푸릴-3,4-디하이드로이소퀴놀린의 제조방법 | |
| NO157782B (no) | Analogifremgangsmte for fremstilling av terapeutisk aktive kondenserte as-triazinderivater med et pyridoringsystem hvor de to ringsystemer har et felles n-atom. | |
| CA1108156A (en) | Phenanthrene derivatives, their preparation and pharmaceutical compositions containing them | |
| NO762489L (ja) | ||
| NO763062L (ja) | ||
| NO165419B (no) | Innretning for laasing og frigjoering av gjenstander beregnet for offentlig bruk, saasom bagasjetraller. |