NO751571L - - Google Patents
Info
- Publication number
- NO751571L NO751571L NO751571A NO751571A NO751571L NO 751571 L NO751571 L NO 751571L NO 751571 A NO751571 A NO 751571A NO 751571 A NO751571 A NO 751571A NO 751571 L NO751571 L NO 751571L
- Authority
- NO
- Norway
- Prior art keywords
- mol
- triazolyl
- dimethyl
- formula
- whole numbers
- Prior art date
Links
- 229910052751 metal Inorganic materials 0.000 claims abstract description 18
- 239000002184 metal Substances 0.000 claims abstract description 18
- IEUQLXVHBHEVSJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yloxy)-1h-pyrrole Chemical class C=1C=CNC=1OC1=CC=CN1 IEUQLXVHBHEVSJ-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000000417 fungicide Substances 0.000 claims abstract description 5
- -1 amino, carboxy Chemical group 0.000 claims description 20
- 241000233866 Fungi Species 0.000 claims description 7
- 230000000855 fungicidal effect Effects 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 3
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000005199 aryl carbonyloxy group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000006331 halo benzoyl group Chemical group 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 150000004696 coordination complex Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- 239000013543 active substance Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- 241000196324 Embryophyta Species 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 238000003756 stirring Methods 0.000 description 14
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 239000007788 liquid Substances 0.000 description 9
- 241000220225 Malus Species 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000007921 spray Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 4
- 241000221785 Erysiphales Species 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 150000002460 imidazoles Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000005554 pickling Methods 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 206010039509 Scab Diseases 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229960003280 cupric chloride Drugs 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 238000011081 inoculation Methods 0.000 description 3
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 241000233626 Plasmopara Species 0.000 description 2
- 241001281803 Plasmopara viticola Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000228452 Venturia inaequalis Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZHOPTHGHOWZAPE-UHFFFAOYSA-N 1-(4-bromophenoxy)-1-(1h-imidazol-2-yl)-3,3-dimethylbutan-2-one Chemical compound N=1C=CNC=1C(C(=O)C(C)(C)C)OC1=CC=C(Br)C=C1 ZHOPTHGHOWZAPE-UHFFFAOYSA-N 0.000 description 1
- RLFAJZAARDKVED-UHFFFAOYSA-N 4-(2,4-dichlorophenoxy)-2,2-dimethylpentan-3-one Chemical compound CC(C)(C)C(=O)C(C)OC1=CC=C(Cl)C=C1Cl RLFAJZAARDKVED-UHFFFAOYSA-N 0.000 description 1
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241001157813 Cercospora Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- 241000489964 Fusicladium Species 0.000 description 1
- 241001181532 Hemileia vastatrix Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 240000008790 Musa x paradisiaca Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000896242 Podosphaera Species 0.000 description 1
- 241001337928 Podosphaera leucotricha Species 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 241000184297 Pseudocercospora musae Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 241000592344 Spermatophyta Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229940068911 chloride hexahydrate Drugs 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- JHPVVOXKINUOSC-UHFFFAOYSA-N diethyl(methyl)azanium;iodide Chemical compound [I-].CC[NH+](C)CC JHPVVOXKINUOSC-UHFFFAOYSA-N 0.000 description 1
- HDITUCONWLWUJR-UHFFFAOYSA-N diethylazanium;chloride Chemical compound [Cl-].CC[NH2+]CC HDITUCONWLWUJR-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 235000014103 egg white Nutrition 0.000 description 1
- 210000000969 egg white Anatomy 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 231100000162 fungitoxic Toxicity 0.000 description 1
- 230000002464 fungitoxic effect Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 230000010152 pollination Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE2423987A DE2423987C2 (de) | 1974-05-17 | 1974-05-17 | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
Publications (1)
Publication Number | Publication Date |
---|---|
NO751571L true NO751571L (de) | 1975-11-18 |
Family
ID=5915805
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO751571A NO751571L (de) | 1974-05-17 | 1975-05-02 |
Country Status (26)
Country | Link |
---|---|
US (1) | US4005083A (de) |
JP (1) | JPS6110476B2 (de) |
AT (1) | AT331568B (de) |
BE (1) | BE829124A (de) |
BR (1) | BR7503033A (de) |
CH (1) | CH577489A5 (de) |
CS (1) | CS181178B2 (de) |
DD (1) | DD119123A5 (de) |
DE (1) | DE2423987C2 (de) |
DK (1) | DK138180C (de) |
ES (1) | ES437715A1 (de) |
FI (1) | FI751429A (de) |
FR (1) | FR2271219B1 (de) |
GB (1) | GB1451038A (de) |
HU (1) | HU171714B (de) |
IE (1) | IE41065B1 (de) |
IL (1) | IL47294A (de) |
IT (1) | IT1038170B (de) |
LU (1) | LU72483A1 (de) |
NL (1) | NL180105C (de) |
NO (1) | NO751571L (de) |
PL (1) | PL97300B1 (de) |
SE (1) | SE7505596L (de) |
SU (1) | SU654145A3 (de) |
TR (1) | TR18370A (de) |
ZA (1) | ZA753172B (de) |
Families Citing this family (40)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4077968A (en) * | 1973-10-24 | 1978-03-07 | Shionogi & Co., Ltd. | Thiazole derivatives |
DE2502932C2 (de) * | 1975-01-24 | 1985-04-18 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von N-Trityl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
US4105762A (en) * | 1975-02-05 | 1978-08-08 | Rohm And Haas Company | Metal salt complexes of 1-substituted aralkyl imidazoles, and methods and compositions for controlling phytopathogenic fungi using them |
US4143137A (en) * | 1976-01-07 | 1979-03-06 | Rohm And Haas Company | Substituted arylcyanoalkyl and diarylcyanoalkylimidazole metal salt complexes and fungicidal compositions and methods utilizing them |
US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
DE2547953A1 (de) * | 1975-10-27 | 1977-04-28 | Bayer Ag | (1-phenyl-2-triazolyl-aethyl)-aether- derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
DE2604761A1 (de) * | 1976-02-07 | 1977-08-11 | Bayer Ag | Acylierte imidazolyl-o,n-acetale, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
US4349556A (en) * | 1976-06-24 | 1982-09-14 | Bayer Aktiengesellschaft | Pesticidally active 1-acyloxy-1-phenyl-2-azolyl-ethanes |
DE2635666A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | 1-azolyl-4-hydroxy-butan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide |
DE2635663A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | Azolyl-carbonsaeure-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
DE2635665A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | Antimikrobielle mittel |
IE45765B1 (en) * | 1976-08-19 | 1982-11-17 | Ici Ltd | Triazoles and imidazoles useful as plant fungicides and growth regulating agents |
GB1567521A (en) * | 1977-03-26 | 1980-05-14 | Boots Co Ltd | Funigicidal complexes of metal salts with imidazoles |
US4598085A (en) * | 1977-04-27 | 1986-07-01 | Janssen Pharmaceutica N.V. | Fungicidal 1-(2-aryl-2-R-ethyl)-1H-1,2,4-triazoles |
GB1601453A (en) * | 1977-05-05 | 1981-10-28 | Ici Ltd | Triazole and imidazole derivatives useful in agriculture |
US4366165A (en) * | 1977-05-19 | 1982-12-28 | Rohm And Haas Company | 1 and 4-Arylcyanoalkyl-1,2,4-triazoles and fungicidal use |
US5192783A (en) * | 1977-05-19 | 1993-03-09 | Rohm And Haas Company | 1-aralkyl-1,2,4-triazoles |
DE2725214A1 (de) * | 1977-06-03 | 1978-12-14 | Bayer Ag | Metallsalzkomplexe von 1-phenyl-2- triazolyl-aethyl-derivaten, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
DE2756269A1 (de) * | 1977-12-16 | 1979-06-21 | Bayer Ag | Azolylalkyl-pyridinyl-aether, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
US4675316A (en) * | 1978-03-10 | 1987-06-23 | Rohm And Haas Company | Substituted azoylmethylarylsulfides and derivatives and pesticidal use thereof |
DE2846980A1 (de) * | 1978-10-28 | 1980-05-08 | Bayer Ag | 1-ethen-azol-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
DE2847441A1 (de) * | 1978-11-02 | 1980-05-22 | Basf Ag | Imidazol-kupferkomplexverbindungen |
DE2918893A1 (de) * | 1979-05-10 | 1980-11-20 | Bayer Ag | Fluorierte 1-imidazolyl-butan-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
DE2926280A1 (de) * | 1979-06-29 | 1981-01-08 | Basf Ag | Fungizide alpha -triazolylglykolderivate, ihre herstellung und verwendung |
DE2928967A1 (de) * | 1979-07-18 | 1981-02-12 | Bayer Ag | Azolyl-alkenole, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
DE3019049A1 (de) * | 1980-05-19 | 1981-12-03 | Basf Ag, 6700 Ludwigshafen | Neue azolverbindungen |
DE3172327D1 (en) * | 1980-07-03 | 1985-10-24 | Bayer Ag | Halogenated triazolylvinyl-keto and carbinol derivatives, process for their preparation and their use as fungicides and plant growth regulators |
DE3047726A1 (de) | 1980-12-18 | 1982-07-15 | Basf Ag, 6700 Ludwigshafen | Wachstumsregulierende (alpha)-azolylglykole, ihre herstellung und verwendung |
US4398942A (en) * | 1980-12-22 | 1983-08-16 | Rohm And Haas Company | Herbicidally-active phenylacetonitriles |
US4533659A (en) * | 1982-06-09 | 1985-08-06 | Ciba-Geigy Corporation | Microbicidal 2-(1H-1,2,4-triazolylmethyl-1'-yl)-2-siloxy-2-phenyl-acetates |
DE3234624A1 (de) * | 1982-09-18 | 1984-03-22 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
DE3315806A1 (de) * | 1983-04-30 | 1984-10-31 | Bayer Ag, 5090 Leverkusen | Phenoxytriazolyl-ketone und -carbinole, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
DE3345899A1 (de) | 1983-12-20 | 1985-06-27 | Bayer Ag, 5090 Leverkusen | Iminomethyl-azolyl-derivate |
JPS6169677U (de) * | 1984-10-03 | 1986-05-13 | ||
JPH0619969Y2 (ja) * | 1987-12-22 | 1994-05-25 | ガデリウスマリン株式会社 | 排ガス用熱交換器 |
DE4013524A1 (de) * | 1990-04-27 | 1991-10-31 | Bayer Ag | Verwendung von kupfersalzen als kristallisationsinhibitoren |
DE102005043138A1 (de) * | 2005-09-10 | 2007-03-15 | Lanxess Deutschland Gmbh | Fungizide Mischungen für den Holzschutz |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3647810A (en) * | 1969-07-03 | 1972-03-07 | Rohm & Haas | 1 2 4-triazole metal salt complexes |
DE2105490C3 (de) * | 1971-02-05 | 1979-06-13 | Bayer Ag, 5090 Leverkusen | 1 -Imidazolylketonderivate |
US3912752A (en) * | 1972-01-11 | 1975-10-14 | Bayer Ag | 1-Substituted-1,2,4-triazoles |
DE2306495A1 (de) * | 1973-02-09 | 1974-08-15 | Bayer Ag | Fungizide mittel |
DE2325156A1 (de) * | 1973-05-18 | 1974-12-05 | Bayer Ag | Fungizide und mikrobizide mittel |
-
1974
- 1974-05-17 DE DE2423987A patent/DE2423987C2/de not_active Expired
-
1975
- 1975-04-30 US US05/573,212 patent/US4005083A/en not_active Expired - Lifetime
- 1975-05-02 NO NO751571A patent/NO751571L/no unknown
- 1975-05-02 GB GB1846675A patent/GB1451038A/en not_active Expired
- 1975-05-11 SU SU752131839A patent/SU654145A3/ru active
- 1975-05-14 IL IL7547294A patent/IL47294A/xx unknown
- 1975-05-15 NL NLAANVRAGE7505752,A patent/NL180105C/xx not_active IP Right Cessation
- 1975-05-15 PL PL1975180399A patent/PL97300B1/pl unknown
- 1975-05-15 DD DD186079A patent/DD119123A5/xx unknown
- 1975-05-15 AT AT371975A patent/AT331568B/de not_active IP Right Cessation
- 1975-05-15 FI FI751429A patent/FI751429A/fi not_active Application Discontinuation
- 1975-05-15 BE BE156392A patent/BE829124A/xx not_active IP Right Cessation
- 1975-05-15 LU LU72483A patent/LU72483A1/xx unknown
- 1975-05-15 IT IT23385/75A patent/IT1038170B/it active
- 1975-05-15 SE SE7505596A patent/SE7505596L/xx unknown
- 1975-05-15 CH CH627775A patent/CH577489A5/xx not_active IP Right Cessation
- 1975-05-16 JP JP50057558A patent/JPS6110476B2/ja not_active Expired
- 1975-05-16 FR FR7515410A patent/FR2271219B1/fr not_active Expired
- 1975-05-16 ES ES437715A patent/ES437715A1/es not_active Expired
- 1975-05-16 HU HU75BA00003272A patent/HU171714B/hu unknown
- 1975-05-16 ZA ZA00753172A patent/ZA753172B/xx unknown
- 1975-05-16 BR BR3865/75A patent/BR7503033A/pt unknown
- 1975-05-16 TR TR18370A patent/TR18370A/xx unknown
- 1975-05-16 DK DK219175A patent/DK138180C/da active
- 1975-05-16 CS CS7500003434A patent/CS181178B2/cs unknown
- 1975-05-16 IE IE1105/75A patent/IE41065B1/xx unknown
Also Published As
Publication number | Publication date |
---|---|
JPS5116668A (de) | 1976-02-10 |
IL47294A (en) | 1979-01-31 |
SE7505596L (sv) | 1975-11-18 |
JPS6110476B2 (de) | 1986-03-29 |
DK138180B (da) | 1978-07-24 |
DE2423987C2 (de) | 1986-01-16 |
IE41065L (en) | 1975-11-17 |
SU654145A3 (ru) | 1979-03-25 |
ZA753172B (en) | 1976-04-28 |
NL180105B (nl) | 1986-08-01 |
TR18370A (tr) | 1977-05-01 |
HU171714B (hu) | 1978-03-28 |
NL180105C (nl) | 1987-01-02 |
BE829124A (fr) | 1975-11-17 |
AU8115775A (en) | 1976-11-18 |
PL97300B1 (pl) | 1978-02-28 |
DE2423987A1 (de) | 1975-11-27 |
AT331568B (de) | 1976-08-25 |
DD119123A5 (de) | 1976-04-12 |
NL7505752A (nl) | 1975-11-19 |
CH577489A5 (de) | 1976-07-15 |
IL47294A0 (en) | 1975-07-28 |
IE41065B1 (en) | 1979-10-10 |
US4005083A (en) | 1977-01-25 |
FR2271219A1 (de) | 1975-12-12 |
ATA371975A (de) | 1975-11-15 |
BR7503033A (pt) | 1976-04-13 |
ES437715A1 (es) | 1977-02-01 |
GB1451038A (en) | 1976-09-29 |
LU72483A1 (de) | 1976-03-17 |
FR2271219B1 (de) | 1979-03-30 |
IT1038170B (it) | 1979-11-20 |
DK219175A (da) | 1975-11-18 |
DK138180C (da) | 1979-01-08 |
CS181178B2 (en) | 1978-03-31 |
FI751429A (de) | 1975-11-18 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO751571L (de) | ||
US4582843A (en) | Triazolyl-alkanones or triazolyl-alkanols | |
CA1054612A (en) | Triazolyl-o, n-acetals, process for their preparation and their use as fungicides | |
US4079062A (en) | Triazole derivatives | |
CA1212952A (en) | 1-phenyl-2-triazolyl-ethyl ether derivatives and their use as fungicides | |
US3940415A (en) | 1-(Imidazolyl-1)-2-aryloxy-3-hydroxy-alkanes | |
CA1054616A (en) | Imidazolyl-o, n-acetals and their salts, processes for their preparation and their use as fungicides | |
CS200238B2 (en) | Fungicide | |
CA1092130A (en) | Azolyl-carboxylic acid derivatives and their use as fungicides | |
US4945101A (en) | Fungicidal novel hydroxyalkynyl-azolyl derivatives | |
HU176919B (hu) | Fungicidnye preparaty soderzhahhie galogenozamehhjonnye proizvodnye 1-azolil-butana i sposob poluchenija aktivnykh vehhestv | |
NO791112L (no) | Oskimino-triazolyl-etaner, samt deres anvendelse som fungisider | |
CA1128053A (en) | Imidazolyl vinyl ethers | |
CA1131233A (en) | Acylated 1-azolyl-2-hydroxy-butane derivatives, processes for their preparation and their use as fungicides | |
JPS5941988B2 (ja) | 1−プロピル−1,2,4−トリアゾリル誘導体およびそれらの塩の製造法 | |
NO802616L (no) | Acylerte triazolyl-gamma-fluorpinakolyl-derivater, fremgangsmaate til deres fremstilling og deres anvendelse som fungicider | |
NO801243L (no) | Fluorerte 1-imidazolyl-butan-derivater og deres anvendelse som fungicider. | |
CS199530B2 (en) | Fungicide and method of producing active compounds | |
JPS6224425B2 (de) | ||
US4154842A (en) | Fungicidally and bactericidally active 1-azolyl-4-hydroxy-1-phenoxy-butane derivatives | |
CA1053241A (en) | Triazole derivatives halogenated in the heterocyclic ring, process for their preparation and their use as fungicides | |
US3754001A (en) | 9-imidazolyl-fluorene-9-carboxylic acid compounds | |
NO784041L (no) | Azolylalkyl-pyridinyl-etere, fremgangsmaate til deres fremstilling samt deres anvendelse som fungicider | |
NO792970L (no) | Halogenerte 1-azolyl-1-fluorfenoksy-butan-derivater, samt deres anvendelse som fungizider | |
EP0007707A1 (de) | 1,3-Diazol- und 1,2,4-Triazolderivate, Verfahren zu ihrer Herstellung, diese enthaltende Schädlingsbekämpfungsmittel und Verfahren zur Bekämpfung von Schädlingen |