NO132932B - - Google Patents
Download PDFInfo
- Publication number
- NO132932B NO132932B NO3078/71A NO307871A NO132932B NO 132932 B NO132932 B NO 132932B NO 3078/71 A NO3078/71 A NO 3078/71A NO 307871 A NO307871 A NO 307871A NO 132932 B NO132932 B NO 132932B
- Authority
- NO
- Norway
- Prior art keywords
- pyridyl
- chloro
- product
- prepared
- filtration
- Prior art date
Links
- -1 piperazine-substituted isoindoline Chemical class 0.000 claims description 83
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 7
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical class C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 claims description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 102
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 81
- 239000000047 product Substances 0.000 description 80
- 238000002844 melting Methods 0.000 description 68
- 230000008018 melting Effects 0.000 description 67
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 63
- 238000001914 filtration Methods 0.000 description 61
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- 239000000243 solution Substances 0.000 description 58
- 239000000155 melt Substances 0.000 description 50
- 239000000203 mixture Substances 0.000 description 48
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 41
- 238000001035 drying Methods 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 33
- 239000000725 suspension Substances 0.000 description 31
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 26
- 238000001953 recrystallisation Methods 0.000 description 24
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 20
- 229910052700 potassium Inorganic materials 0.000 description 20
- 239000011591 potassium Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 15
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- 239000000126 substance Substances 0.000 description 13
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000013078 crystal Substances 0.000 description 11
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 11
- 235000011121 sodium hydroxide Nutrition 0.000 description 11
- FBAIGEMWTOSCRU-UHFFFAOYSA-N 4-methylpiperazine-1-carbonyl chloride Chemical compound CN1CCN(C(Cl)=O)CC1 FBAIGEMWTOSCRU-UHFFFAOYSA-N 0.000 description 10
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical compound C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 239000002480 mineral oil Substances 0.000 description 7
- 235000010446 mineral oil Nutrition 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- GOLGHPDYJWOEFX-UHFFFAOYSA-N 2-(3-chloropyridin-2-yl)isoindole-1,3-dione Chemical compound ClC=1C(=NC=CC1)N1C(C=2C(C1=O)=CC=CC2)=O GOLGHPDYJWOEFX-UHFFFAOYSA-N 0.000 description 3
- NDRYOSXROYUCMG-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)-3-hydroxy-3h-isoindol-1-one Chemical compound O=C1C2=CC=CC=C2C(O)N1C1=CC=C(Cl)C=N1 NDRYOSXROYUCMG-UHFFFAOYSA-N 0.000 description 3
- XNQAHKGAKUEWGJ-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)isoindole-1,3-dione Chemical compound N1=CC(Cl)=CC=C1N1C(=O)C2=CC=CC=C2C1=O XNQAHKGAKUEWGJ-UHFFFAOYSA-N 0.000 description 3
- POGQFCMYZGFOSU-UHFFFAOYSA-N 3-hydroxy-2-(1-oxidopyridin-1-ium-2-yl)-3H-isoindol-1-one Chemical compound OC1N(C(C2=CC=CC=C12)=O)C1=[N+](C=CC=C1)[O-] POGQFCMYZGFOSU-UHFFFAOYSA-N 0.000 description 3
- QTZBTBLHYPSFMG-UHFFFAOYSA-N 5-chloro-3-methylpyridin-2-amine Chemical compound CC1=CC(Cl)=CN=C1N QTZBTBLHYPSFMG-UHFFFAOYSA-N 0.000 description 3
- MMVIDXVHQANYAE-UHFFFAOYSA-N 5-nitro-2-benzofuran-1,3-dione Chemical compound [O-][N+](=O)C1=CC=C2C(=O)OC(=O)C2=C1 MMVIDXVHQANYAE-UHFFFAOYSA-N 0.000 description 3
- QUXLCYFNVNNRBE-UHFFFAOYSA-N 6-methylpyridin-2-amine Chemical compound CC1=CC=CC(N)=N1 QUXLCYFNVNNRBE-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CJGMMHYRSDUGEU-UHFFFAOYSA-N 2-(3,5-dichloropyridin-2-yl)isoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CN=C1N1C(=O)C2=CC=CC=C2C1=O CJGMMHYRSDUGEU-UHFFFAOYSA-N 0.000 description 2
- BNHLVLAEUJXVMW-UHFFFAOYSA-N 2-(4-chloropyridin-2-yl)isoindole-1,3-dione Chemical compound ClC1=CC(=NC=C1)N1C(C=2C(C1=O)=CC=CC2)=O BNHLVLAEUJXVMW-UHFFFAOYSA-N 0.000 description 2
- KQISZVJNRJCEHV-UHFFFAOYSA-N 2-(5-bromopyridin-2-yl)isoindole-1,3-dione Chemical compound N1=CC(Br)=CC=C1N1C(=O)C2=CC=CC=C2C1=O KQISZVJNRJCEHV-UHFFFAOYSA-N 0.000 description 2
- MZIDXSFYUWDXIU-UHFFFAOYSA-N 2-(5-chloropyridin-2-yl)-5-nitroisoindole-1,3-dione Chemical compound O=C1C2=CC([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=C(Cl)C=N1 MZIDXSFYUWDXIU-UHFFFAOYSA-N 0.000 description 2
- ZCZPLRYTBRYPGQ-UHFFFAOYSA-N 2-(5-methylpyridin-2-yl)isoindole-1,3-dione Chemical compound N1=CC(C)=CC=C1N1C(=O)C2=CC=CC=C2C1=O ZCZPLRYTBRYPGQ-UHFFFAOYSA-N 0.000 description 2
- ZRBRCHDUESCYMY-UHFFFAOYSA-N 2-(5-nitropyridin-2-yl)isoindole-1,3-dione Chemical compound N1=CC([N+](=O)[O-])=CC=C1N1C(=O)C2=CC=CC=C2C1=O ZRBRCHDUESCYMY-UHFFFAOYSA-N 0.000 description 2
- CFNKFWRAPXKASS-UHFFFAOYSA-N 2-(6-methylpyridin-2-yl)isoindole-1,3-dione Chemical compound CC1=CC=CC(N2C(C3=CC=CC=C3C2=O)=O)=N1 CFNKFWRAPXKASS-UHFFFAOYSA-N 0.000 description 2
- NHDHNZXQMPZJDV-UHFFFAOYSA-N 2-pyridin-2-ylisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=N1 NHDHNZXQMPZJDV-UHFFFAOYSA-N 0.000 description 2
- IOFPIPAAYHPSKO-UHFFFAOYSA-N 3-hydroxy-2-(5-methylpyridin-2-yl)-3h-isoindol-1-one Chemical compound N1=CC(C)=CC=C1N1C(=O)C2=CC=CC=C2C1O IOFPIPAAYHPSKO-UHFFFAOYSA-N 0.000 description 2
- RQMWVVBHJMUJNZ-UHFFFAOYSA-N 4-chloropyridin-2-amine Chemical compound NC1=CC(Cl)=CC=N1 RQMWVVBHJMUJNZ-UHFFFAOYSA-N 0.000 description 2
- HWPRPPGFAUEIEJ-UHFFFAOYSA-N 4-methylpiperazine-1-carbothioyl chloride Chemical compound CN1CCN(C(Cl)=S)CC1 HWPRPPGFAUEIEJ-UHFFFAOYSA-N 0.000 description 2
- ULSOWUBMELTORB-UHFFFAOYSA-N 5,6-dichloro-2-benzofuran-1,3-dione Chemical compound C1=C(Cl)C(Cl)=CC2=C1C(=O)OC2=O ULSOWUBMELTORB-UHFFFAOYSA-N 0.000 description 2
- AMRQNTQHLAXFQL-UHFFFAOYSA-N 5,6-dichloro-2-pyridin-2-ylisoindole-1,3-dione Chemical compound O=C1C=2C=C(Cl)C(Cl)=CC=2C(=O)N1C1=CC=CC=N1 AMRQNTQHLAXFQL-UHFFFAOYSA-N 0.000 description 2
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 2
- DGRCJSWXMGENMG-UHFFFAOYSA-N 5-chloro-4-methylpyridin-2-amine Chemical compound CC1=CC(N)=NC=C1Cl DGRCJSWXMGENMG-UHFFFAOYSA-N 0.000 description 2
- SHIKRPPKGCWKJO-UHFFFAOYSA-N 5-chloro-6-methylpyridin-2-amine Chemical compound CC1=NC(N)=CC=C1Cl SHIKRPPKGCWKJO-UHFFFAOYSA-N 0.000 description 2
- ZOXBWJMCXHTKNU-UHFFFAOYSA-N 5-methyl-2-benzofuran-1,3-dione Chemical compound CC1=CC=C2C(=O)OC(=O)C2=C1 ZOXBWJMCXHTKNU-UHFFFAOYSA-N 0.000 description 2
- RKJUQKISWPWPJM-UHFFFAOYSA-N 5-nitro-2-pyridin-2-ylisoindole-1,3-dione Chemical compound O=C1C2=CC([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=CC=N1 RKJUQKISWPWPJM-UHFFFAOYSA-N 0.000 description 2
- UGSBCCAHDVCHGI-UHFFFAOYSA-N 5-nitropyridin-2-amine Chemical compound NC1=CC=C([N+]([O-])=O)C=N1 UGSBCCAHDVCHGI-UHFFFAOYSA-N 0.000 description 2
- XRBWUAAJIPTVTL-UHFFFAOYSA-N 6-(1,3-dioxoisoindol-2-yl)pyridine-3-carbonitrile Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1=CC=C(C#N)C=N1 XRBWUAAJIPTVTL-UHFFFAOYSA-N 0.000 description 2
- KDVBYUUGYXUXNL-UHFFFAOYSA-N 6-aminopyridine-3-carbonitrile Chemical compound NC1=CC=C(C#N)C=N1 KDVBYUUGYXUXNL-UHFFFAOYSA-N 0.000 description 2
- OBYJTLDIQBWBHM-UHFFFAOYSA-N 6-chloropyridin-2-amine Chemical compound NC1=CC=CC(Cl)=N1 OBYJTLDIQBWBHM-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000003927 aminopyridines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000010413 mother solution Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- 229940075930 picrate Drugs 0.000 description 2
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- BIIBYWQGRFWQKM-JVVROLKMSA-N (2S)-N-[4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4,4-dimethylpentanamide Chemical compound CC(C)(C)C[C@@H](C(NC(C[C@H](CCN1)C1=O)C(C(NC1CC1)=O)=O)=O)NC(/C=C/C(C=CC(Cl)=C1)=C1Cl)=O BIIBYWQGRFWQKM-JVVROLKMSA-N 0.000 description 1
- CCFJHZRWSXQQLC-UHFFFAOYSA-N (3-oxo-2-pyridin-2-yl-1h-isoindol-1-yl) 4-propan-2-ylpiperazine-1-carboxylate Chemical compound C1CN(C(C)C)CCN1C(=O)OC1C2=CC=CC=C2C(=O)N1C1=CC=CC=N1 CCFJHZRWSXQQLC-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- HTGCVLNFLVVCST-UHFFFAOYSA-N 1-piperazin-1-ylethanol Chemical compound CC(O)N1CCNCC1 HTGCVLNFLVVCST-UHFFFAOYSA-N 0.000 description 1
- ZWAQJGHGPPDZSF-UHFFFAOYSA-N 1-prop-2-enylpiperazine Chemical compound C=CCN1CCNCC1 ZWAQJGHGPPDZSF-UHFFFAOYSA-N 0.000 description 1
- WHKWMTXTYKVFLK-UHFFFAOYSA-N 1-propan-2-ylpiperazine Chemical compound CC(C)N1CCNCC1 WHKWMTXTYKVFLK-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- OCWBGKZFOYMCCN-UHFFFAOYSA-N 3,5-dichloropyridin-2-amine Chemical compound NC1=NC=C(Cl)C=C1Cl OCWBGKZFOYMCCN-UHFFFAOYSA-N 0.000 description 1
- RZJPBQGRCNJYBU-UHFFFAOYSA-N 3-chloropyridin-2-amine Chemical compound NC1=NC=CC=C1Cl RZJPBQGRCNJYBU-UHFFFAOYSA-N 0.000 description 1
- DXBXGNJUFFXTPF-UHFFFAOYSA-N 3-hydroxy-2-pyridin-2-yl-3h-isoindol-1-one Chemical compound O=C1C2=CC=CC=C2C(O)N1C1=CC=CC=N1 DXBXGNJUFFXTPF-UHFFFAOYSA-N 0.000 description 1
- RGDQRXPEZUNWHX-UHFFFAOYSA-N 3-methylpyridin-2-amine Chemical compound CC1=CC=CN=C1N RGDQRXPEZUNWHX-UHFFFAOYSA-N 0.000 description 1
- HRMOFUIZGCUFKK-UHFFFAOYSA-N 4-chlorophthalaldehyde Chemical class ClC1=CC=C(C=O)C(C=O)=C1 HRMOFUIZGCUFKK-UHFFFAOYSA-N 0.000 description 1
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 1
- ORLGLBZRQYOWNA-UHFFFAOYSA-N 4-methylpyridin-2-amine Chemical compound CC1=CC=NC(N)=C1 ORLGLBZRQYOWNA-UHFFFAOYSA-N 0.000 description 1
- FZBPJIVTHVXTOZ-UHFFFAOYSA-N 5-chloro-2-pyridin-2-ylisoindole-1,3-dione Chemical compound O=C1C2=CC(Cl)=CC=C2C(=O)N1C1=CC=CC=N1 FZBPJIVTHVXTOZ-UHFFFAOYSA-N 0.000 description 1
- WJRKNLONLOMALV-UHFFFAOYSA-N 5-chloropyridine Chemical compound ClC1=C=NC=C[CH]1 WJRKNLONLOMALV-UHFFFAOYSA-N 0.000 description 1
- CMBSSVKZOPZBKW-UHFFFAOYSA-N 5-methylpyridin-2-amine Chemical compound CC1=CC=C(N)N=C1 CMBSSVKZOPZBKW-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZTWYBFHLUJUUDX-UHFFFAOYSA-N 6-aminopyridin-3-ol Chemical compound NC1=CC=C(O)C=N1 ZTWYBFHLUJUUDX-UHFFFAOYSA-N 0.000 description 1
- DEUALFRBMNMGDS-UHFFFAOYSA-N 6-methoxypyridin-2-amine Chemical compound COC1=CC=CC(N)=N1 DEUALFRBMNMGDS-UHFFFAOYSA-N 0.000 description 1
- 241000252095 Congridae Species 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 230000016571 aggressive behavior Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229950011175 aminopicoline Drugs 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 230000006742 locomotor activity Effects 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7030393A FR2101081B1 (env) | 1970-08-19 | 1970-08-19 | |
| FR7042342A FR2115045B2 (env) | 1970-08-19 | 1970-11-25 | |
| FR7123465A FR2143537B2 (env) | 1970-08-19 | 1971-06-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO132932B true NO132932B (env) | 1975-10-27 |
| NO132932C NO132932C (env) | 1976-02-04 |
Family
ID=27249393
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3078/71A NO132932C (env) | 1970-08-19 | 1971-08-18 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3847921A (env) |
| JP (1) | JPS5414111B1 (env) |
| AT (1) | AT305276B (env) |
| BE (1) | BE771493A (env) |
| CA (1) | CA963470A (env) |
| CH (2) | CH532064A (env) |
| CS (2) | CS176200B2 (env) |
| DE (1) | DE2141634C3 (env) |
| DK (1) | DK138324B (env) |
| ES (2) | ES394370A1 (env) |
| FI (1) | FI53456C (env) |
| FR (3) | FR2101081B1 (env) |
| GB (1) | GB1307205A (env) |
| IE (1) | IE36106B1 (env) |
| IL (1) | IL37547A (env) |
| LU (1) | LU63741A1 (env) |
| NL (1) | NL173751C (env) |
| NO (1) | NO132932C (env) |
| OA (1) | OA03907A (env) |
| PH (1) | PH10035A (env) |
| PL (1) | PL85030B1 (env) |
| SE (1) | SE372014B (env) |
| SU (1) | SU455535A3 (env) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2205318A2 (en) * | 1972-11-09 | 1974-05-31 | Rhone Poulenc Sa | 6-substd 5-(4-methyl 1-piperazinyl)carbonyloxy 7-oxo - 5,6-dihydro-pyrrolo (3,4-b)pyrazines - tranquillizers and anticonvuls |
| BE793851A (fr) * | 1972-01-10 | 1973-07-10 | Rhone Poulenc Sa | Nouveaux derives de l'isoindoline, leur preparation et les compositions medicinales qui les contiennent |
| FR2206936A2 (en) * | 1972-11-21 | 1974-06-14 | Rhone Poulenc Sa | Isoindolino-quinoline derivs - useful as tranquillizers and anticonvulsants |
| AR207555A1 (es) * | 1972-12-04 | 1976-10-15 | Procedimiento para preparar aril-6-piperazinocarboniloxi-5 oxo-7 tetrahidro-2,3,6,7 ditiino(1,4)(2,3-c)pirroles | |
| US3966931A (en) * | 1972-12-04 | 1976-06-29 | Rhone-Poulenc S.A. | 1,4-Dithino[2,3-c]pyrrole compositions |
| FR2208651A1 (en) * | 1972-12-04 | 1974-06-28 | Rhone Poulenc Sa | Piperazinyl carbonyloxy-dithiino pyrrols as tranquillisers - anticonvulsants and spasmolytics from aryloxycarbonates of dithiinopyrrols and piperazines |
| FR2322601A1 (fr) * | 1975-09-04 | 1977-04-01 | Rhone Poulenc Ind | Nouveaux derives de l'isoindoline, leur preparation et les compositions qui les contiennent |
| FR2313060A1 (fr) * | 1974-11-07 | 1976-12-31 | Rhone Poulenc Ind | Nouveaux derives de l'isoindoline, leur preparation et les compositions qui les contiennent |
| AR208414A1 (es) * | 1974-11-07 | 1976-12-27 | Rhone Poulenc Ind | Procedimiento para obtener nuevos derivados de la((acil-4piperazinil-1)carboniloxi-5 pirrolinona-2) |
| US4590189A (en) * | 1982-04-02 | 1986-05-20 | Takeda Chemical Industries, Ltd. | Condensed pyrrolinone derivatives, their production and use |
| WO1983003410A1 (fr) * | 1982-04-02 | 1983-10-13 | Takeda Chemical Industries Ltd | Derives d'isoindoline |
| FR2607504B1 (fr) * | 1986-12-02 | 1989-01-27 | Rhone Poulenc Sante | Nouveaux derives de l'isoindolinone, leur preparation et les compositions pharmaceutiques qui les contiennent |
| US5102890A (en) * | 1989-09-05 | 1992-04-07 | Rhone-Poulenc Sante | Pyrrole derivatives, their preparation and pharmaceutical compositions which contain them |
| JP2005502623A (ja) | 2001-07-02 | 2005-01-27 | ノボ ノルディスク アクティーゼルスカブ | 置換ピペラジンおよびジアゼパン |
| US7208497B2 (en) | 2001-07-02 | 2007-04-24 | Novo Nordisk A/S | Substituted piperazines and diazepanes |
| US7521451B2 (en) * | 2002-11-26 | 2009-04-21 | Maruishi Pharmaceutical Co., Ltd. | Isoindoline derivative |
| US7878326B2 (en) * | 2006-09-11 | 2011-02-01 | Apple Inc. | Packaging |
| US9682967B2 (en) | 2013-01-28 | 2017-06-20 | H. Lundbeck A/S | N-substituted-5-substituted phthalamic acids as sortilin inhibitors |
| CN113813895B (zh) * | 2021-07-20 | 2023-03-31 | 上海罕道医药科技有限公司 | 一种连续反应装置与一种5-硝基吡啶-3-甲酸的连续制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2838438A (en) * | 1956-08-23 | 1958-06-10 | Diamond Alkali Co | N-(2-pyridyl)-tetrachlorophthalimide, process and use as insecticide |
-
1970
- 1970-08-19 FR FR7030393A patent/FR2101081B1/fr not_active Expired
- 1970-11-25 FR FR7042342A patent/FR2115045B2/fr not_active Expired
-
1971
- 1971-06-28 FR FR7123465A patent/FR2143537B2/fr not_active Expired
- 1971-08-11 NL NLAANVRAGE7111074,A patent/NL173751C/xx not_active IP Right Cessation
- 1971-08-17 PL PL1971150067A patent/PL85030B1/pl unknown
- 1971-08-18 CA CA120,862*7A patent/CA963470A/en not_active Expired
- 1971-08-18 NO NO3078/71A patent/NO132932C/no unknown
- 1971-08-18 SE SE7110522A patent/SE372014B/xx unknown
- 1971-08-18 GB GB3880171A patent/GB1307205A/en not_active Expired
- 1971-08-18 OA OA54334A patent/OA03907A/xx unknown
- 1971-08-18 BE BE771493A patent/BE771493A/xx not_active IP Right Cessation
- 1971-08-18 CH CH1597872A patent/CH532064A/fr not_active IP Right Cessation
- 1971-08-18 CH CH1215871A patent/CH532063A/fr not_active IP Right Cessation
- 1971-08-18 JP JP6237371A patent/JPS5414111B1/ja active Pending
- 1971-08-18 IE IE1043/71A patent/IE36106B1/xx unknown
- 1971-08-18 PH PH12761A patent/PH10035A/en unknown
- 1971-08-18 US US00172929A patent/US3847921A/en not_active Expired - Lifetime
- 1971-08-18 DK DK405071AA patent/DK138324B/da not_active IP Right Cessation
- 1971-08-18 LU LU63741D patent/LU63741A1/xx unknown
- 1971-08-19 CS CS8216A patent/CS176200B2/cs unknown
- 1971-08-19 CS CS5985A patent/CS176168B2/cs unknown
- 1971-08-19 FI FI2315/71A patent/FI53456C/fi active
- 1971-08-19 SU SU711686202A patent/SU455535A3/ru active
- 1971-08-19 ES ES71394370A patent/ES394370A1/es not_active Expired
- 1971-08-19 DE DE2141634A patent/DE2141634C3/de not_active Expired
- 1971-08-19 AT AT724771A patent/AT305276B/de not_active IP Right Cessation
- 1971-08-19 ES ES394369A patent/ES394369A1/es not_active Expired
- 1971-08-20 IL IL37547A patent/IL37547A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO132932B (env) | ||
| AU745579B2 (en) | Bicyclic kinase inhibitors | |
| FI65435C (fi) | Foerfarande foer framstaellning av immunitet raglerande och arrit motstaoende 5-(4-pyridyl)-6-(4-fluorfenyl)-2,3-dihydr oiidazo-(2,1-b)tiazol | |
| DE3406329A1 (de) | Pyridone | |
| CS277611B6 (en) | 3-(2,2,5,6-tetrahydropyridyl)-pyrrolopyridine derivatives | |
| EP0011142B1 (de) | Pyrido (2,1-b) chinazolinon-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| EP0041624A2 (en) | Method to beneficially influence & alter the development & life cycle of agronomic and horticultural crops with certain imidazolinyl nicotinic acids and derivatives thereof | |
| EP0228006A1 (en) | Imidazopyridine compounds and processes for preparation thereof | |
| JPS62149662A (ja) | N−含有複素環化合物 | |
| US4105767A (en) | Imidazo [1,2-a] pyridines substituted with a thienyl, thiazolyl, or thiadiazolyl group | |
| US4634710A (en) | Tricyclic imidazole derivatives | |
| NO140012B (no) | Analogifremgangsmaate for fremstilling av nye terapeutisk aktive derivater av naftyridin | |
| US4177274A (en) | Substituted imidazo [1,2-a] pyridines | |
| Tominaga et al. | Synthesis of 2‐methylthioindolizine‐3‐carbonitriles using nitro ketene dithioacetal | |
| US4129738A (en) | 5-Phenylpyrazolo[1,5-a]pyrimidin-7(1H)-ones | |
| US4237300A (en) | Certain 6-substituted-2-pyridinamines | |
| US4560510A (en) | Process and intermediates for the preparation of aryl substituted pyrido[1,4]benzodiazepines | |
| NO157578B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive imidazo(1,2-a)kinolinderivater | |
| JPH06192251A (ja) | 1−ヘテロアリールアゼチジン類および−ピロリジン類、それらの調製方法並びにそれらを含有する医薬組成物 | |
| JPH0568477B2 (env) | ||
| US4628100A (en) | Intermediates for the preparation of aryl substituted pyrido[1,4]benzodiazepines | |
| RU2002744C1 (ru) | Способ получени 1-замещенной 6-фтор-4-оксо-7-(1-пиперазинил)-1,4-дигидрохинолин-3-карбоновой кислоты | |
| Kurita et al. | Abnormal behavior of nitropyridines in substitution reactions with anions | |
| JPS58159462A (ja) | 1,4−ジヒドロピリジン−3,5−ジカルボン酸エステル誘導体 |