NO130878B - - Google Patents
Download PDFInfo
- Publication number
- NO130878B NO130878B NO01784/69A NO178469A NO130878B NO 130878 B NO130878 B NO 130878B NO 01784/69 A NO01784/69 A NO 01784/69A NO 178469 A NO178469 A NO 178469A NO 130878 B NO130878 B NO 130878B
- Authority
- NO
- Norway
- Prior art keywords
- cyclohexylamide
- acid
- oxybutyric
- cyclohexylamine
- oxybutyric acid
- Prior art date
Links
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 24
- 230000000202 analgesic effect Effects 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 6
- FLCPERRDPXWFDK-UHFFFAOYSA-N n-cyclohexyl-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1CCCCC1 FLCPERRDPXWFDK-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 229940124277 aminobutyric acid Drugs 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000052 vinegar Substances 0.000 description 5
- 235000021419 vinegar Nutrition 0.000 description 5
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- -1 hydrogen halogen Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- PELFHYQVZBUDHG-UHFFFAOYSA-N 2-azaniumyl-2-cyclohexylbutanoate Chemical compound CCC(N)(C(O)=O)C1CCCCC1 PELFHYQVZBUDHG-UHFFFAOYSA-N 0.000 description 1
- HAAZMOAXEMIBAJ-UHFFFAOYSA-N 4-chloro-2-methylquinazoline Chemical compound C1=CC=CC2=NC(C)=NC(Cl)=C21 HAAZMOAXEMIBAJ-UHFFFAOYSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- 206010063659 Aversion Diseases 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000399233 Rita Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical compound CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E05—LOCKS; KEYS; WINDOW OR DOOR FITTINGS; SAFES
- E05D—HINGES OR SUSPENSION DEVICES FOR DOORS, WINDOWS OR WINGS
- E05D1/00—Pinless hinges; Substitutes for hinges
- E05D1/02—Pinless hinges; Substitutes for hinges made of one piece
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Closures For Containers (AREA)
- Hinges (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Rigid Containers With Two Or More Constituent Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681759430 DE1759430A1 (de) | 1968-04-30 | 1968-04-30 | Einteiliges scharnierartiges Gelenk aus Kunststoff |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO130878B true NO130878B (index.php) | 1974-11-18 |
| NO130878C NO130878C (index.php) | 1975-02-26 |
Family
ID=5695573
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1784/69A NO130878C (index.php) | 1968-04-30 | 1969-04-29 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3629901A (index.php) |
| AT (1) | AT281627B (index.php) |
| BE (1) | BE731834A (index.php) |
| CH (1) | CH488085A (index.php) |
| DE (1) | DE1759430A1 (index.php) |
| DK (1) | DK125211B (index.php) |
| ES (1) | ES165966Y (index.php) |
| FR (1) | FR2007294A1 (index.php) |
| GB (1) | GB1222761A (index.php) |
| NL (1) | NL6906547A (index.php) |
| NO (1) | NO130878C (index.php) |
| SE (1) | SE342069B (index.php) |
Families Citing this family (74)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3841528A (en) * | 1971-09-29 | 1974-10-15 | H Eisenberg | Container for liquids having hinged lid allowing easy stacking |
| US3817574A (en) * | 1972-08-25 | 1974-06-18 | Braun Co W | Portable container and seating device |
| US3870190A (en) * | 1973-02-12 | 1975-03-11 | Jr Edward Camp Tibbals | Container |
| US3999678A (en) * | 1975-12-01 | 1976-12-28 | Sobrefina Sa | Closing arrangement for packing containers |
| SE7701304L (sv) * | 1976-02-12 | 1977-08-13 | Georg | Veska, speciellt skolveska |
| NL7603602A (nl) * | 1976-04-06 | 1977-10-10 | Bredveld Interieurwerken Bv | Scharnier. |
| CH610853A5 (index.php) * | 1976-12-15 | 1979-05-15 | Createchnic Patent Ag | |
| JPS5815580Y2 (ja) * | 1978-04-28 | 1983-03-29 | 日産自動車株式会社 | パンタグラフ式開閉具 |
| US4276725A (en) * | 1979-07-12 | 1981-07-07 | Ash John E | Method and apparatus for releasing an elevated pressure developed behind a wall |
| US4277015A (en) * | 1979-11-07 | 1981-07-07 | Industrial Designs & Services | Container for produce and the like having releasably securable flaps |
| CH653639A5 (de) * | 1981-01-21 | 1986-01-15 | Zeller Plastik Koehn Graebner | Einstueckiges klappscharnier aus kunststoff. |
| US4414705A (en) * | 1981-07-17 | 1983-11-15 | Ethyl Products Company | Overcenter hinge |
| US4407427A (en) * | 1982-04-30 | 1983-10-04 | Reuter Edward J | Integral hinge covers for waste container |
| GB2130488B (en) * | 1982-11-18 | 1986-09-17 | Protectair Ltd | Fracture cast-braces and casts incorporating them |
| CH661488A5 (de) * | 1983-06-10 | 1987-07-31 | Alfatechnic Ag | Kunststoffverschluss. |
| US4638916A (en) * | 1985-07-12 | 1987-01-27 | Owens-Illinois, Inc. | Closure with snap-type hinge cap |
| US4702398A (en) * | 1986-01-24 | 1987-10-27 | Risdon Corporation | Product dispenser with advance/retract-type delivery means |
| EP0254099A1 (de) * | 1986-07-17 | 1988-01-27 | Siemens Aktiengesellschaft | Gurt zum maschinengerechten Zuführen von Stückgütern, insbesondere von elektrischen bauelementen und Bauelementegruppen in Bestückungsautomaten für Leiterplatten |
| US4723693A (en) * | 1986-10-02 | 1988-02-09 | Dart Industries, Inc. | Double hinging cap |
| US4732340A (en) * | 1986-12-10 | 1988-03-22 | Texas Instruments Incorporated | Article holder |
| CH673631A5 (index.php) * | 1987-09-25 | 1990-03-30 | Alfatechnic Ag | |
| US4778071A (en) * | 1988-02-16 | 1988-10-18 | Owens-Illinois Closure Inc. | Closure with snap type hinge |
| US4813560A (en) * | 1988-05-04 | 1989-03-21 | Continental White Cap, Inc. | Spring hinge for dispensing cap |
| GB8825141D0 (en) * | 1988-10-27 | 1988-11-30 | Bxl Plastics Ltd | Hinged devices |
| US5145068A (en) * | 1989-11-14 | 1992-09-08 | Blackbourn Inc. | Cassette album with channel-form hinges and method |
| US4966283A (en) * | 1989-11-14 | 1990-10-30 | Blackbourn Inc | Cassette album with channel-form hinges and method |
| US5016777A (en) * | 1990-01-11 | 1991-05-21 | Morley Marvin | Expandable polystyrene container hinge and method of forming |
| US5033633A (en) * | 1990-01-12 | 1991-07-23 | Continental White Cap, Inc. | Plastic closure with safety button and method of forming same |
| US5322176A (en) * | 1990-03-12 | 1994-06-21 | Sreatechnic Ag | Plastic snap hinge with a flexible element generating the snap action |
| CH680430A5 (index.php) * | 1990-03-12 | 1992-08-31 | Createchnic Ag | |
| US5435456A (en) * | 1991-02-12 | 1995-07-25 | Createchnic Ag | Plastic snap hinge closure |
| CH683092A5 (de) * | 1991-02-12 | 1994-01-14 | Createchnic Ag | Kunststoffschnappscharnierverschluss. |
| US5257708A (en) * | 1991-02-12 | 1993-11-02 | Createchnic Ag | Plastic snap hinge closure |
| CN1038404C (zh) * | 1993-10-01 | 1998-05-20 | 吉原宏 | 盖体开启机构 |
| US5489035A (en) | 1994-10-13 | 1996-02-06 | Owens-Illinois Closure Inc. | Closure with snap-type hinge cap |
| CA2169486C (en) * | 1995-02-15 | 2007-08-07 | Tsutomu Kobayashi | Snap-hinged cap |
| US5639018A (en) * | 1995-08-31 | 1997-06-17 | Combibloc, Inc. | Push-tab hinge for a container closure apparatus |
| US6015071A (en) | 1997-03-11 | 2000-01-18 | Prince Corporation | Vehicle storage divider |
| US5913435A (en) * | 1997-04-21 | 1999-06-22 | Owens-Illinois Closure Inc. | Closure with snap-type hinge cap |
| USD404307S (en) | 1997-09-09 | 1999-01-19 | Johnson & Johnson Consumer Products, Inc. | Bottle |
| USD411745S (en) | 1997-09-09 | 1999-06-29 | Johnson & Johnson Consumer Products, Inc. | Angled cap |
| USD426464S (en) * | 1997-09-09 | 2000-06-13 | Johnson & Johnson Consumer Companies, Inc. | Combined bottle and cap |
| USD441292S1 (en) | 1997-09-09 | 2001-05-01 | Johnson & Johnson Consumer Products, Inc. | Bottle |
| USD438801S1 (en) | 1997-09-09 | 2001-03-13 | Johnson&Johnson Consumer Products, Inc. | Combined bottle and cap |
| FR2770381B1 (fr) | 1997-10-31 | 2000-01-07 | Philippe Kleinmann | Dispositif de retenue et/ou d'immobilisation de lacets, en particulier pour chaussures de sport |
| MY131752A (en) | 1997-11-03 | 2007-08-30 | Artwright Technology Sdn Bhd | Bracket for lay-on cables within partition wall |
| FR2779125B1 (fr) * | 1998-05-27 | 2000-06-30 | Vg Emballage | Pot a contenant et bouchage injectes solidaires |
| US6321923B1 (en) * | 2000-04-26 | 2001-11-27 | Seaquist Closures Foreign, Inc. | Bistable hinge with reduced stress regions |
| US6685055B2 (en) | 2000-05-30 | 2004-02-03 | Sig Combibloc Inc. | Flip-top container closure apparatus |
| EP1192914A1 (en) * | 2000-09-27 | 2002-04-03 | Clearpac Limited | Container for sharp instruments |
| US6554147B1 (en) * | 2001-05-21 | 2003-04-29 | Inline Plastics Corporation | Hinge system for self-locking perimeter sealing container |
| US6839928B1 (en) * | 2002-02-05 | 2005-01-11 | Gelco Products, Llc | Seat cushion with integrated handle |
| US7134575B2 (en) | 2002-12-21 | 2006-11-14 | Gateway Plastics, Inc. | Closure for a container |
| FR2876085B1 (fr) * | 2004-10-05 | 2008-04-18 | Seaquist General Plastics Soc | Structure articulee pour relier un couvercle a un reservoir et dispositif de fermeture pour un reservoir |
| EP1801027A1 (de) * | 2005-12-23 | 2007-06-27 | Silvio Jähnke | Einteiliger Umzugsbehälter |
| US8056749B2 (en) * | 2007-05-07 | 2011-11-15 | Rexam Closure Systems Inc. | Flip-lid dispensing closure and package |
| FR2917566B1 (fr) * | 2007-06-12 | 2010-12-17 | Valeo Systemes Thermiques | Boitier constitue de coquilles assemblees entre elles pour la protection d'un dispositif electronique. |
| US9371162B2 (en) * | 2008-12-09 | 2016-06-21 | Weatherchem Corporation | One-piece dispensing closure |
| US20100224643A1 (en) * | 2009-03-03 | 2010-09-09 | Weatherchem Corporation | Dispensing closure |
| US8550313B2 (en) | 2009-03-12 | 2013-10-08 | Weatherchem Corporation | Sift-resistant dispensing closure |
| FR2962984B1 (fr) * | 2010-07-21 | 2013-12-27 | Babolat Vs | Capuchon de boite de balles de tennis et boite de balles comportant un tel capuchon |
| US8899437B2 (en) | 2012-01-20 | 2014-12-02 | Gateway Plastics, Inc. | Closure with integrated dosage cup |
| US9475623B2 (en) | 2012-03-26 | 2016-10-25 | Gateway Plastics, Inc. | Closure for a container |
| US8955705B2 (en) | 2012-03-26 | 2015-02-17 | Gateway Plastics, Inc. | Closure for a container |
| USD679181S1 (en) | 2012-03-26 | 2013-04-02 | Gateway Plastics, Inc. | Closure for a container |
| TWI520675B (zh) * | 2013-08-19 | 2016-02-01 | 緯創資通股份有限公司 | 可改變軸心位置之樞軸機構及其電子裝置 |
| FR3052511B1 (fr) * | 2016-06-13 | 2018-06-22 | Galien Garabiol | Charniere et cadre utilisant une telle charniere. |
| FR3055531B1 (fr) | 2016-09-08 | 2018-08-31 | L'oreal | Capsule de fermeture |
| US10433927B2 (en) * | 2016-10-25 | 2019-10-08 | Medtronic Vascular, Inc. | Hinged long sealed tray and method |
| JP7197784B2 (ja) * | 2018-01-30 | 2022-12-28 | キョーラク株式会社 | 構造体の製造方法 |
| EP3787442A1 (en) * | 2018-05-02 | 2021-03-10 | Kids2, Inc. | A children's play-yard apparatus |
| EP3733549B1 (de) * | 2019-04-30 | 2022-04-06 | Schoeller Allibert GmbH | Behälter mit selbsttragender abdeckung für auslass |
| WO2020237376A1 (en) * | 2019-05-30 | 2020-12-03 | Magna Closures Inc. | Compliant hinge for motor vehicle |
| GB2610196B (en) * | 2021-08-25 | 2024-12-11 | Ocado Innovation Ltd | Single Part Hinge, and Related Methods and Uses |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2746087A (en) * | 1948-05-07 | 1956-05-22 | Dolezal Karel | Method of manufacture of spectacles |
| NL128141C (index.php) * | 1963-03-20 | |||
| GB1056999A (en) * | 1964-12-09 | 1967-02-01 | Initial Plastics Ltd | Improvements in hinges of flexible plastics material |
-
1968
- 1968-04-30 DE DE19681759430 patent/DE1759430A1/de active Pending
- 1968-08-09 AT AT783368A patent/AT281627B/de not_active IP Right Cessation
-
1969
- 1969-04-17 CH CH581569A patent/CH488085A/de not_active IP Right Cessation
- 1969-04-21 BE BE731834D patent/BE731834A/xx unknown
- 1969-04-22 DK DK220769AA patent/DK125211B/da unknown
- 1969-04-23 SE SE5762/69A patent/SE342069B/xx unknown
- 1969-04-28 NL NL6906547A patent/NL6906547A/xx unknown
- 1969-04-28 ES ES1969165966U patent/ES165966Y/es not_active Expired
- 1969-04-29 GB GB21717/69A patent/GB1222761A/en not_active Expired
- 1969-04-29 FR FR6913579A patent/FR2007294A1/fr not_active Withdrawn
- 1969-04-29 US US831806*A patent/US3629901A/en not_active Expired - Lifetime
- 1969-04-29 NO NO1784/69A patent/NO130878C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE342069B (index.php) | 1972-01-24 |
| US3629901A (en) | 1971-12-28 |
| BE731834A (index.php) | 1969-10-01 |
| GB1222761A (en) | 1971-02-17 |
| NO130878C (index.php) | 1975-02-26 |
| FR2007294A1 (index.php) | 1970-01-02 |
| NL6906547A (index.php) | 1969-11-03 |
| CH488085A (de) | 1970-03-31 |
| DK125211B (da) | 1973-01-15 |
| DE1759430A1 (de) | 1972-03-09 |
| ES165966U (es) | 1971-06-16 |
| AT281627B (de) | 1970-05-25 |
| ES165966Y (es) | 1971-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO130878B (index.php) | ||
| NO153082B (no) | Apparat for stapping av en rynket roerformet omhylling | |
| NO154554B (no) | Fremgangsmaate til fremstilling av armeringsfibre for mineralske byggematerialer. | |
| JPH0317825B2 (index.php) | ||
| IL36237A (en) | Substituted benzylimidazolidinones,their preparation and pharmaceutical compositions containing them | |
| NO125723B (index.php) | ||
| NO120686B (index.php) | ||
| BG60835B2 (bg) | Епинен естер, метод за получаването му и лекарства | |
| NO166164B (no) | Festeanordning til aa etablere elektrisk forbindelse med en engangs hudelektrode. | |
| CH639369A5 (fr) | Benzamides heterocycliques substitues et leurs procedes de preparation. | |
| NO121950B (index.php) | ||
| NO138547B (no) | Anvendelse av pullulan i faste og flytende naeringsmidler | |
| NO163814B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 1-substituerte 4-hydroksymetyl-pyrrolidinon-derivater. | |
| NO141208B (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme 2-(fenoksyalkyltio)imidazolforbindelser | |
| NO135338B (index.php) | ||
| SU535899A3 (ru) | Способ получени -(1-бисарилалкиламиноалкил)-аралкоксибензиловых спиртов или их солей, рацематов или оптически активных антиподов | |
| JPS6218545B2 (index.php) | ||
| US3775479A (en) | Amine compounds | |
| US2941002A (en) | Beta-hydroxy carboxylic acid amides substituted at the nitrogen atom | |
| US3972931A (en) | N,N'-Disubstituted benzamidines | |
| IE43830B1 (en) | Phenylpiperidine derivatives | |
| NO137236B (no) | Analogifremgangsm}te til fremstilling av et terapeutisk virksomt piperazinyl-pyrimidin-derivat. | |
| US3063899A (en) | beta-hydroxybutyric acid-cyclohexylamide and a process of preparing it | |
| US4478841A (en) | 3-[2-(Tetra- and Hexa- hydro-4-pyridyl)-ethyl]-indoles and their use as medicaments | |
| NO781896L (no) | 4-fenyl-8-amino-tetrahydroisokinoliner, farmasoeytiske preparater som inneholder disse, fremgangsmaate til fremstilling av disse preparater og deres anvendelse som antidepresjonsmidler |