NO118106B - - Google Patents
Download PDFInfo
- Publication number
- NO118106B NO118106B NO148342A NO14834263A NO118106B NO 118106 B NO118106 B NO 118106B NO 148342 A NO148342 A NO 148342A NO 14834263 A NO14834263 A NO 14834263A NO 118106 B NO118106 B NO 118106B
- Authority
- NO
- Norway
- Prior art keywords
- dibenzo
- lower alkyl
- derivative
- cyclopropyl
- cycloheptene
- Prior art date
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 14
- -1 1-piperidyl- Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 229920006395 saturated elastomer Polymers 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000007818 Grignard reagent Substances 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical compound C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 claims description 4
- 150000004795 grignard reagents Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 231100000252 nontoxic Toxicity 0.000 claims description 4
- 230000003000 nontoxic effect Effects 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 230000026030 halogenation Effects 0.000 claims description 3
- 238000005658 halogenation reaction Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 239000000243 solution Substances 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 238000002360 preparation method Methods 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 17
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 17
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 238000004809 thin layer chromatography Methods 0.000 description 9
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- SNVTZAIYUGUKNI-UHFFFAOYSA-N dibenzo[1,2-a:1',2'-e][7]annulen-11-one Chemical compound C1=CC2=CC=CC=C2C(=O)C2=CC=CC=C21 SNVTZAIYUGUKNI-UHFFFAOYSA-N 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- MKKZZGYCTNAUEU-UHFFFAOYSA-N 11-cyclopropyldibenzo[1,2-a:1',2'-e][7]annulen-11-ol Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1(O)C1CC1 MKKZZGYCTNAUEU-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XLBRQXMETXPTTL-UHFFFAOYSA-N 2-(3-chloropropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene Chemical compound ClCCC=C1C2=C(C=CC3=C1C=CC=C3)C=CC=C2 XLBRQXMETXPTTL-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GNKCQOOXORIZGS-UHFFFAOYSA-N 11-(3-bromopropylidene)dibenzo[1,2-a:1',2'-e][7]annulene Chemical compound C1=CC2=CC=CC=C2C(=CCCBr)C2=CC=CC=C21 GNKCQOOXORIZGS-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- VFZXMEQGIIWBFJ-UHFFFAOYSA-M magnesium;cyclopropane;bromide Chemical compound [Mg+2].[Br-].C1C[CH-]1 VFZXMEQGIIWBFJ-UHFFFAOYSA-M 0.000 description 2
- 239000005297 pyrex Substances 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N 1-Heptene Chemical class CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- PUTNYTSNDOYJQP-UHFFFAOYSA-N 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-ol Chemical compound OCCC=C1C2=C(C=CC3=C1C=CC=C3)C=CC=C2 PUTNYTSNDOYJQP-UHFFFAOYSA-N 0.000 description 1
- CTWZJMQDNRRAAP-UHFFFAOYSA-N 3-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)propan-1-amine Chemical compound C1=CC2=CC=CC=C2C(=CCCN)C2=CC=CC=C21 CTWZJMQDNRRAAP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000272201 Columbiformes Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 150000008508 dibenzocycloheptenes Chemical class 0.000 description 1
- 230000003028 elevating effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QEHKBHWEUPXBCW-UHFFFAOYSA-N nitrogen trichloride Chemical compound ClN(Cl)Cl QEHKBHWEUPXBCW-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000003236 psychic effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US188873A US3272864A (en) | 1962-04-19 | 1962-04-19 | Process for preparing 5-(3-aminopropylidene)-5h-dibenzo [a, d] cycloheptene and 5h-dibenzo [a, d]-10, 11-dihydro-cycloheptene derivatives |
| US356346A US3329728A (en) | 1962-04-19 | 1964-02-10 | Process and intermediates for the preparation of dibenzo[a, d] cycloheptenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118106B true NO118106B (cs) | 1969-11-10 |
Family
ID=26884535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO148342A NO118106B (cs) | 1962-04-19 | 1963-04-18 |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3329728A (cs) |
| BR (1) | BR6348552D0 (cs) |
| CH (1) | CH446309A (cs) |
| DK (2) | DK112654B (cs) |
| FI (1) | FI41019B (cs) |
| GB (3) | GB1039374A (cs) |
| NL (1) | NL291744A (cs) |
| NO (1) | NO118106B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3832405A (en) * | 1970-05-18 | 1974-08-27 | American Home Prod | 5-cycloalkylidene dibenzocycloheptene derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL270132A (cs) * | 1960-10-12 | |||
| US3189657A (en) * | 1960-11-03 | 1965-06-15 | Lilly Co Eli | 5-(3-bromopropylidene) dibenzo-[a, d] cyclohepta (1.4)diene |
-
0
- NL NL291744D patent/NL291744A/xx unknown
-
1963
- 1963-04-17 GB GB31825/65A patent/GB1039374A/en not_active Expired
- 1963-04-17 GB GB31826/65A patent/GB1039375A/en not_active Expired
- 1963-04-17 GB GB15086/63A patent/GB1039373A/en not_active Expired
- 1963-04-18 DK DK182163AA patent/DK112654B/da unknown
- 1963-04-18 FI FI0770/63A patent/FI41019B/fi active
- 1963-04-18 NO NO148342A patent/NO118106B/no unknown
- 1963-04-19 BR BR148552/63A patent/BR6348552D0/pt unknown
- 1963-04-19 CH CH490863A patent/CH446309A/de unknown
-
1964
- 1964-02-10 US US356346A patent/US3329728A/en not_active Expired - Lifetime
- 1964-09-29 DK DK478664AA patent/DK112167B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3329728A (en) | 1967-07-04 |
| CH446309A (de) | 1967-11-15 |
| BR6348552D0 (pt) | 1973-07-17 |
| GB1039373A (en) | 1966-08-17 |
| GB1039374A (en) | 1966-08-17 |
| FI41019B (cs) | 1969-04-30 |
| DK112167B (da) | 1968-11-18 |
| DK112654B (da) | 1969-01-06 |
| NL291744A (cs) | |
| GB1039375A (en) | 1966-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU640289B2 (en) | New oxazolopyridine derivatives, processes for preparing these and pharmaceutical compositions containing them | |
| US4675319A (en) | Antianaphylactic and antibronchospastic piperazinyl-(N-substituted phenyl)carboxamides, compositions and use | |
| EP0306996A2 (en) | Process for the preparation of 3,5-dioxo cyclohexane carboxylic acid derivatives | |
| JPS587626B2 (ja) | ナフチリジン オヨビ キノリンユウドウタイノセイホウ | |
| PL113623B1 (en) | Process for preparing novel,substituted in position 11 5,11-dihydro-6h-pyrido/2,3-b//1,4/benzodiazepin-6-ones | |
| DE2646671A1 (de) | 1,2,4-triazolo eckige klammer auf 4,3-b eckige klammer zu pyridazin-3- on-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| US4254056A (en) | 2-Aminomethyl phenol derivative and process for preparing thereof | |
| SU592350A3 (ru) | Способ получени производных бутирофенона или их солей | |
| NO118106B (cs) | ||
| JPS634544B2 (cs) | ||
| US6043371A (en) | Organic compound synthesis | |
| Schweizer et al. | Reactions of azines. 12. Preparation and reactions of triphenyl [2-([phenyl (methoxycarbonyl) methylene] hydrazono) propyl] phosphonium bromide | |
| NO832810L (no) | 1,3-dioksolo(4,5-g)-kinoliner og fremgangsmaate for deres fremstilling. | |
| NO160442B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive pyrazolo (1,5-a)pyridinderivater. | |
| NO152786B (no) | Fremgangsmaate ved fremstilling av 10,11-dihydro-5h-dibenzo-(a,d)-cyclohepten-5,10-iminer | |
| SU535034A3 (ru) | Способ получени производных хинолина,их солей или их изомеров | |
| US3666752A (en) | 4,4-diphenylhexahydroazepine compounds | |
| US3446806A (en) | Process for the preparation of 1,4-benzodiazepine 4-oxides | |
| NO750278L (cs) | ||
| NO147108B (no) | Analogifremgangsmaate for fremstilling av terapeutisk virksomme 1-amino-lavere-alkyl-3,4-difenyl-1h-pyrazoler | |
| NO167288B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive dipyrazoler. | |
| US4017490A (en) | Pyrido (3,4-d)pyridazines | |
| DK152131B (da) | Fremgangsmaade til fremstilling af 5,6,7,7a-tetrahydro-4h-thieno(3,2-c)-pyridin-2-on-derivater | |
| Balenovic et al. | Synthesis of Aminomethylglyoxal Derivatives | |
| US4302463A (en) | 1-Azaxanthone-3-carboxylic acids and their production |