LU85254A1 - Verfahren zur herstellung von 3-(amino-oder subst.-amino)-4-(subst.-amino)-1,2,5-thiadiazol verbindungen - Google Patents
Verfahren zur herstellung von 3-(amino-oder subst.-amino)-4-(subst.-amino)-1,2,5-thiadiazol verbindungen Download PDFInfo
- Publication number
- LU85254A1 LU85254A1 LU85254A LU85254A LU85254A1 LU 85254 A1 LU85254 A1 LU 85254A1 LU 85254 A LU85254 A LU 85254A LU 85254 A LU85254 A LU 85254A LU 85254 A1 LU85254 A1 LU 85254A1
- Authority
- LU
- Luxembourg
- Prior art keywords
- general formula
- amino
- alkyl
- thiadiazole
- group
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 110
- -1 methylenedioxy group Chemical group 0.000 claims description 69
- 238000000034 method Methods 0.000 claims description 64
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 51
- 125000000217 alkyl group Chemical group 0.000 claims description 49
- 229910052757 nitrogen Inorganic materials 0.000 claims description 42
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 38
- 238000002360 preparation method Methods 0.000 claims description 32
- 239000012453 solvate Substances 0.000 claims description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 27
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000006308 propyl amino group Chemical group 0.000 claims description 24
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 20
- 231100000252 nontoxic Toxicity 0.000 claims description 20
- 230000003000 nontoxic effect Effects 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 239000003960 organic solvent Substances 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 13
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 101150009274 nhr-1 gene Proteins 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- RDJGIQPSSNMJPF-UHFFFAOYSA-N ethanediimidamide Chemical class NC(=N)C(N)=N RDJGIQPSSNMJPF-UHFFFAOYSA-N 0.000 claims description 6
- QYIWBOWEQBEAGP-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)sulfanylisoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1SN1C(=O)C2=CC=CC=C2C1=O QYIWBOWEQBEAGP-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 150000004677 hydrates Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 4
- JRHOBGUKGKDYFU-UHFFFAOYSA-N 3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 JRHOBGUKGKDYFU-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 3
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical compound C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 claims description 2
- DRGIXHISBNDJEL-UHFFFAOYSA-N 3-n-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCC2)=C1 DRGIXHISBNDJEL-UHFFFAOYSA-N 0.000 claims description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- VRALOCFIFDRXTC-UHFFFAOYSA-N 2-n'-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide Chemical compound NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCCC2)=C1 VRALOCFIFDRXTC-UHFFFAOYSA-N 0.000 claims 1
- IRQUPRKBBWVPAU-UHFFFAOYSA-N 2-n'-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide Chemical compound NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCC2)=C1 IRQUPRKBBWVPAU-UHFFFAOYSA-N 0.000 claims 1
- 239000000284 extract Substances 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 26
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 21
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 238000004458 analytical method Methods 0.000 description 19
- 229960001340 histamine Drugs 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 10
- 239000000523 sample Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 8
- 230000028327 secretion Effects 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 7
- 241000700159 Rattus Species 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 7
- 229960001380 cimetidine Drugs 0.000 description 7
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical class OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 7
- 230000002496 gastric effect Effects 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 4
- 241000700199 Cavia porcellus Species 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 239000005557 antagonist Substances 0.000 description 4
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 210000002837 heart atrium Anatomy 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 4
- WEKYWIBCHONDBC-UHFFFAOYSA-N 3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCCC2)=N1 WEKYWIBCHONDBC-UHFFFAOYSA-N 0.000 description 3
- 241000700198 Cavia Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- YOTIBQOCCYWJMZ-UHFFFAOYSA-N 1,2,5-thiadiazole 1,1-dioxide Chemical compound O=S1(=O)N=CC=N1 YOTIBQOCCYWJMZ-UHFFFAOYSA-N 0.000 description 2
- ZZGPYPVNEPAJHG-UHFFFAOYSA-N 1,2,5-thiadiazole 1-oxide Chemical compound O=S1N=CC=N1 ZZGPYPVNEPAJHG-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- KULYHDQCRCSIHF-UHFFFAOYSA-N 2-n'-[3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCC2)=C1 KULYHDQCRCSIHF-UHFFFAOYSA-N 0.000 description 2
- FZKWXDQZIXBDGQ-UHFFFAOYSA-N 3-n-[2-[[5-[(dimethylamino)methyl]thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound S1C(CN(C)C)=CC(CSCCNC=2C(=NSN=2)N)=C1 FZKWXDQZIXBDGQ-UHFFFAOYSA-N 0.000 description 2
- XGRRSCZJFCJRGY-UHFFFAOYSA-N 4-n-methyl-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 XGRRSCZJFCJRGY-UHFFFAOYSA-N 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical group CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- 206010065713 Gastric Fistula Diseases 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 101150029512 SCG2 gene Proteins 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000010009 beating Methods 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000003464 sulfur compounds Chemical class 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- XWMXMWHHTIEXRE-UHFFFAOYSA-N thiadiazole 1-oxide Chemical compound O=S1C=CN=N1 XWMXMWHHTIEXRE-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000002627 tracheal intubation Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- XIWSFHMGJRJKJR-UHFFFAOYSA-N 1,2,5-thiadiazol-3-amine Chemical compound NC=1C=NSN=1 XIWSFHMGJRJKJR-UHFFFAOYSA-N 0.000 description 1
- 150000004868 1,2,5-thiadiazoles Chemical class 0.000 description 1
- SOQFZXMZMHODLD-UHFFFAOYSA-N 1,2,5-thiadiazolidine Chemical class C1CNSN1 SOQFZXMZMHODLD-UHFFFAOYSA-N 0.000 description 1
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 1
- XSJGCCZBIPAMPM-UHFFFAOYSA-N 1-(benzimidazol-1-ylsulfanyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1SN1C2=CC=CC=C2N=C1 XSJGCCZBIPAMPM-UHFFFAOYSA-N 0.000 description 1
- NFPDNSMAFDHAHK-UHFFFAOYSA-N 1-(benzotriazol-1-ylsulfanyl)benzotriazole Chemical compound N1=NC2=CC=CC=C2N1SN1C2=CC=CC=C2N=N1 NFPDNSMAFDHAHK-UHFFFAOYSA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- WRFXINSCGSNPDG-UHFFFAOYSA-N 1-oxo-3-N-[3-[3-(pyrrolidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(N=C1NCCCSC1=CC(=CC=C1)CN1CCCC1)=O WRFXINSCGSNPDG-UHFFFAOYSA-N 0.000 description 1
- AHJMOFANVWLNNR-UHFFFAOYSA-N 1-oxo-3-n-[2-[[4-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCSCC1=CC(CN2CCCCC2)=CC=N1 AHJMOFANVWLNNR-UHFFFAOYSA-N 0.000 description 1
- OOYDKECBDSSEAP-UHFFFAOYSA-N 1-oxo-3-n-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CSC(CN2CCCCC2)=C1 OOYDKECBDSSEAP-UHFFFAOYSA-N 0.000 description 1
- NMNIHVKUIGROBN-UHFFFAOYSA-N 1-oxo-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-4-prop-2-ynyl-1,2,5-thiadiazol-3-amine Chemical compound O=S1N=C(CC#C)C(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 NMNIHVKUIGROBN-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- VCLHHRGZKNUOAQ-UHFFFAOYSA-N 2,5-dichloro-n-[4-[(2,5-dichlorobenzoyl)amino]phenyl]benzamide Chemical compound ClC1=CC=C(Cl)C(C(=O)NC=2C=CC(NC(=O)C=3C(=CC=C(Cl)C=3)Cl)=CC=2)=C1 VCLHHRGZKNUOAQ-UHFFFAOYSA-N 0.000 description 1
- VPSXHKGJZJCWLV-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(1-ethylpiperidin-4-yl)oxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OC1CCN(CC1)CC VPSXHKGJZJCWLV-UHFFFAOYSA-N 0.000 description 1
- LSZMVESSGLHDJE-UHFFFAOYSA-N 2-bromo-4-methylpyridine Chemical compound CC1=CC=NC(Br)=C1 LSZMVESSGLHDJE-UHFFFAOYSA-N 0.000 description 1
- GXZDYRYYNXYPMQ-UHFFFAOYSA-N 2-chloro-6-methylpyridine Chemical compound CC1=CC=CC(Cl)=N1 GXZDYRYYNXYPMQ-UHFFFAOYSA-N 0.000 description 1
- MDAGFERLPSGSPT-UHFFFAOYSA-N 2-n'-[2-[[5-[(dimethylamino)methyl]thiophen-3-yl]methylsulfanyl]ethyl]ethanediimidamide Chemical compound CN(C)CC1=CC(CSCCNC(=N)C(N)=N)=CS1 MDAGFERLPSGSPT-UHFFFAOYSA-N 0.000 description 1
- QVPBOYHTCFDNFM-UHFFFAOYSA-N 2-n'-[3-[6-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]ethanediimidamide;trihydrochloride Chemical compound Cl.Cl.Cl.NC(=N)C(=N)NCCCOC1=CC=CC(CN2CCCCC2)=N1 QVPBOYHTCFDNFM-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- CBQUTBMJYCJEQC-UHFFFAOYSA-N 3-N-[3-[3-(azepan-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCCC2)=C1 CBQUTBMJYCJEQC-UHFFFAOYSA-N 0.000 description 1
- FAIBGOCQOUIHDC-UHFFFAOYSA-N 3-N-[3-[3-(piperidin-1-ylmethyl)phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1 FAIBGOCQOUIHDC-UHFFFAOYSA-N 0.000 description 1
- SXAKEWROCCBLGU-UHFFFAOYSA-N 3-N-[3-[3-[(dimethylamino)methyl]phenyl]sulfanylpropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCSC1=CC(=CC=C1)CN(C)C SXAKEWROCCBLGU-UHFFFAOYSA-N 0.000 description 1
- QCHHKUYJOJEKBO-UHFFFAOYSA-N 3-[6-[(dimethylamino)methyl]pyridin-2-yl]oxypropan-1-amine Chemical compound CN(C)CC1=CC=CC(OCCCN)=N1 QCHHKUYJOJEKBO-UHFFFAOYSA-N 0.000 description 1
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 1
- ORHJOWGHOUCVBZ-UHFFFAOYSA-N 3-n-(1,3-benzodioxol-5-ylmethyl)-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound N=1SN=C(NCC=2C=C3OCOC3=CC=2)C=1NCCCOC(C=1)=CC=CC=1CN1CCCCC1 ORHJOWGHOUCVBZ-UHFFFAOYSA-N 0.000 description 1
- GKOTVAAPBWUUDR-UHFFFAOYSA-N 3-n-[2-[[4-(piperidin-1-ylmethyl)pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CC(CN2CCCCC2)=CC=N1 GKOTVAAPBWUUDR-UHFFFAOYSA-N 0.000 description 1
- JAZTUSIZPLFSSZ-UHFFFAOYSA-N 3-n-[2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(CSCCNC=2C(=NSN=2)N)=C1 JAZTUSIZPLFSSZ-UHFFFAOYSA-N 0.000 description 1
- ZQHHHMVXDKTKQW-UHFFFAOYSA-N 3-n-[2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=NC(CSCCNC=2C(=NS(=O)N=2)N)=C1 ZQHHHMVXDKTKQW-UHFFFAOYSA-N 0.000 description 1
- HCBVAPDYYRYBBB-UHFFFAOYSA-N 3-n-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCSCC1=CSC(CN2CCCCC2)=C1 HCBVAPDYYRYBBB-UHFFFAOYSA-N 0.000 description 1
- KPBLLYORSFDJHH-UHFFFAOYSA-N 3-n-[3-[3-(3-azabicyclo[3.2.2]nonan-3-ylmethyl)phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CC3CCC(CC3)C2)=C1 KPBLLYORSFDJHH-UHFFFAOYSA-N 0.000 description 1
- PVEWDBAOTMTTOX-UHFFFAOYSA-N 3-n-[3-[3-(morpholin-4-ylmethyl)phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCOCC2)=C1 PVEWDBAOTMTTOX-UHFFFAOYSA-N 0.000 description 1
- SSTYCGCTOJCTIB-UHFFFAOYSA-N 3-n-[3-[3-[(2-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1CCCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 SSTYCGCTOJCTIB-UHFFFAOYSA-N 0.000 description 1
- RIOYHEJVKJDCEJ-UHFFFAOYSA-N 3-n-[3-[3-[(2-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CC1CCCN1CC1=CC=CC(OCCCNC=2C(=NS(=O)N=2)N)=C1 RIOYHEJVKJDCEJ-UHFFFAOYSA-N 0.000 description 1
- SSGNTSIJJRKNEV-UHFFFAOYSA-N 3-n-[3-[3-[(3-methylpyrrolidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C1C(C)CCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 SSGNTSIJJRKNEV-UHFFFAOYSA-N 0.000 description 1
- VYWFSBLVIIXXOR-UHFFFAOYSA-N 3-n-[3-[3-[(4-methylpiperazin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C1CN(C)CCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 VYWFSBLVIIXXOR-UHFFFAOYSA-N 0.000 description 1
- IGKOAKXAZCJSQI-UHFFFAOYSA-N 3-n-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C1CC(C)CCN1CC1=CC=CC(OCCCNC=2C(=NSN=2)N)=C1 IGKOAKXAZCJSQI-UHFFFAOYSA-N 0.000 description 1
- PPMYJUCFCTXGKV-UHFFFAOYSA-N 3-n-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound C1CC(C)CCN1CC1=CC=CC(OCCCNC=2C(=NS(=O)N=2)N)=C1 PPMYJUCFCTXGKV-UHFFFAOYSA-N 0.000 description 1
- QFIBCDPEQSLPBP-UHFFFAOYSA-N 3-n-[3-[3-[(dimethylamino)methyl]phenyl]sulfanylpropyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound CN(C)CC1=CC=CC(SCCCNC=2C(=NS(=O)N=2)N)=C1 QFIBCDPEQSLPBP-UHFFFAOYSA-N 0.000 description 1
- URWJRJYKNKXOGW-UHFFFAOYSA-N 3-n-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound NC1=NSN=C1NCCCOC1=CSC(CN2CCCCC2)=C1 URWJRJYKNKXOGW-UHFFFAOYSA-N 0.000 description 1
- CWVKQJBALYEZMX-UHFFFAOYSA-N 3-n-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound S1C(CN(C)C)=CC(OCCCNC=2C(=NSN=2)N)=C1 CWVKQJBALYEZMX-UHFFFAOYSA-N 0.000 description 1
- NBGRTVUJNQQBDR-UHFFFAOYSA-N 3-n-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine Chemical compound S1C(CN(C)C)=CC(OCCCNC=2C(=NS(=O)N=2)N)=C1 NBGRTVUJNQQBDR-UHFFFAOYSA-N 0.000 description 1
- MIUWQWMRZOEFEX-UHFFFAOYSA-N 3-n-benzyl-4-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound C=1C=CC(CN2CCCCC2)=CC=1OCCCNC1=NSN=C1NCC1=CC=CC=C1 MIUWQWMRZOEFEX-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- OHLUAARMJNNWIK-UHFFFAOYSA-N 4-methoxy-1-oxo-1,2,5-thiadiazol-3-amine Chemical compound COC1=NS(=O)N=C1N OHLUAARMJNNWIK-UHFFFAOYSA-N 0.000 description 1
- BRYKZFSZHNTNOI-UHFFFAOYSA-N 4-n-ethyl-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CCNC1=NSN=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 BRYKZFSZHNTNOI-UHFFFAOYSA-N 0.000 description 1
- DGCCBFCPKIIWKR-UHFFFAOYSA-N 4-n-methyl-1-oxo-3-n-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,5-thiadiazole-3,4-diamine Chemical compound CNC1=NS(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 DGCCBFCPKIIWKR-UHFFFAOYSA-N 0.000 description 1
- JOOXCMJARBKPKM-UHFFFAOYSA-N 4-oxopentanoic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 1
- WMYAVKOBHVWVCU-UHFFFAOYSA-N CC(N=C1)=CC=C1C1=N[S+](NC)N=C1NCCCOC1=CC(CN2CCCCC2)=CC=C1 Chemical compound CC(N=C1)=CC=C1C1=N[S+](NC)N=C1NCCCOC1=CC(CN2CCCCC2)=CC=C1 WMYAVKOBHVWVCU-UHFFFAOYSA-N 0.000 description 1
- VFZRFHFHJIOESV-UHFFFAOYSA-N CC1=CC=C(C=N1)C1=NS(N=C1NCCCOC1=CC(=CC=C1)CN1CCCCC1)(NC)=O Chemical compound CC1=CC=C(C=N1)C1=NS(N=C1NCCCOC1=CC(=CC=C1)CN1CCCCC1)(NC)=O VFZRFHFHJIOESV-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 206010016717 Fistula Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- BCAKQOWRRNAMTL-UHFFFAOYSA-N NC1=NS(N=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1)=O Chemical compound NC1=NS(N=C1NCCCSC1=CC(=CC=C1)CN1CCCCC1)=O BCAKQOWRRNAMTL-UHFFFAOYSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- MQUHRUPJGTWPRG-UHFFFAOYSA-N [O-][N+]1=CC=CN1 Chemical compound [O-][N+]1=CC=CN1 MQUHRUPJGTWPRG-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001260 acyclic compounds Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001746 atrial effect Effects 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- RTIXKCRFFJGDFG-UHFFFAOYSA-N chrysin Chemical compound C=1C(O)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=CC=C1 RTIXKCRFFJGDFG-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- KXOFUUASPAGCPE-UHFFFAOYSA-N ethanediimidamide trihydrochloride Chemical compound Cl.Cl.Cl.C(C(N)=N)(N)=N KXOFUUASPAGCPE-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 230000003890 fistula Effects 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 230000027119 gastric acid secretion Effects 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 229960004931 histamine dihydrochloride Drugs 0.000 description 1
- PPZMYIBUHIPZOS-UHFFFAOYSA-N histamine dihydrochloride Chemical compound Cl.Cl.NCCC1=CN=CN1 PPZMYIBUHIPZOS-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 238000013289 male long evans rat Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000011962 puddings Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000005554 pyridyloxy group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000611 regression analysis Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 235000001508 sulfur Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RKBCYCFRFCNLTO-UHFFFAOYSA-N triisopropylamine Chemical compound CC(C)N(C(C)C)C(C)C RKBCYCFRFCNLTO-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/10—1,2,5-Thiadiazoles; Hydrogenated 1,2,5-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/475,985 US4440933A (en) | 1983-03-16 | 1983-03-16 | Process for preparing 1,2,5-thiadiazoles |
| US47598583 | 1983-03-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| LU85254A1 true LU85254A1 (de) | 1984-11-14 |
Family
ID=23890020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| LU85254A LU85254A1 (de) | 1983-03-16 | 1984-03-15 | Verfahren zur herstellung von 3-(amino-oder subst.-amino)-4-(subst.-amino)-1,2,5-thiadiazol verbindungen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4440933A (cg-RX-API-DMAC7.html) |
| KR (1) | KR860002036B1 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1207763A (cg-RX-API-DMAC7.html) |
| CS (1) | CS241072B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD218364A5 (cg-RX-API-DMAC7.html) |
| DK (1) | DK155984A (cg-RX-API-DMAC7.html) |
| ES (1) | ES530590A0 (cg-RX-API-DMAC7.html) |
| FI (1) | FI79848C (cg-RX-API-DMAC7.html) |
| GR (1) | GR81826B (cg-RX-API-DMAC7.html) |
| HU (1) | HU198925B (cg-RX-API-DMAC7.html) |
| IE (1) | IE57306B1 (cg-RX-API-DMAC7.html) |
| LU (1) | LU85254A1 (cg-RX-API-DMAC7.html) |
| NO (1) | NO158136C (cg-RX-API-DMAC7.html) |
| YU (1) | YU45597B (cg-RX-API-DMAC7.html) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4600779A (en) * | 1982-03-29 | 1986-07-15 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4578471A (en) * | 1982-03-29 | 1986-03-25 | Bristol-Myers Company | Substituted amino alkyl pyridyl ethanediimidamides |
| US4588826A (en) * | 1982-03-29 | 1986-05-13 | Bristol-Myers Company | Ethanediimidamide intermediates |
| US4595758A (en) * | 1982-03-29 | 1986-06-17 | Bristol-Myers Company | Ethanediimidamide intermediates |
| AU2222083A (en) * | 1982-12-14 | 1984-06-21 | Smith Kline & French Laboratories Limited | Pyridine derivatives |
| US4644006A (en) * | 1984-06-22 | 1987-02-17 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| US4692531A (en) * | 1984-06-22 | 1987-09-08 | Bristol-Myers Company | Substituted 3,4-diamino-1,2,5-thiadiazoles having histamine H2 -receptor antagonist activity |
| CA1275097A (en) * | 1984-10-02 | 1990-10-09 | Fujio Nohara | Pyridyloxy derivatives |
| DE3513184A1 (de) * | 1985-04-12 | 1986-10-16 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 1,3,4-thiadiazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US5248673A (en) * | 1992-12-23 | 1993-09-28 | Bristol-Myers Squibb Co. | Bisamidine derivatives as thrombin inhibitors |
| US5618816A (en) * | 1995-03-02 | 1997-04-08 | Bristol-Myers Squibb Company | Antimigraine 1,2,5-thiadiazole derivatives of indolylalkyl-pyridnyl and pyrimidinylpiperazines |
| TW200517114A (en) | 2003-10-15 | 2005-06-01 | Combinatorx Inc | Methods and reagents for the treatment of immunoinflammatory disorders |
| TWI435729B (zh) | 2005-11-09 | 2014-05-01 | Combinatorx Inc | 治療病症之方法,組合物及套組 |
| US20100092479A1 (en) * | 2008-08-18 | 2010-04-15 | Combinatorx (Singapore) Pte. Ltd. | Compositions and methods for treatment of viral diseases |
| US20110130711A1 (en) * | 2009-11-19 | 2011-06-02 | Follica, Inc. | Hair growth treatment |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI76795C (fi) * | 1979-09-04 | 1988-12-12 | Bristol Myers Co | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara 3,4-disubstituerade 1,2,5-tiadiazol-1-oxider och -1,1-dioxider samt nya mellanprodukter. |
| EP0040696B1 (en) * | 1980-04-30 | 1986-08-27 | Merck & Co. Inc. | Aminothiadiazoles as gastric secretion inhibitors |
| US4394508A (en) * | 1980-06-07 | 1983-07-19 | Bristol-Myers Company | Chemical compounds |
| US4380638A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Chemical compounds |
| US4380639A (en) * | 1981-03-03 | 1983-04-19 | Bristol-Myers Company | Substituted 1,2,5-thiadiazole derivatives |
-
1983
- 1983-03-16 US US06/475,985 patent/US4440933A/en not_active Expired - Fee Related
-
1984
- 1984-03-12 NO NO840929A patent/NO158136C/no unknown
- 1984-03-13 FI FI841009A patent/FI79848C/fi not_active IP Right Cessation
- 1984-03-14 DK DK155984A patent/DK155984A/da not_active Application Discontinuation
- 1984-03-14 ES ES530590A patent/ES530590A0/es active Granted
- 1984-03-15 CA CA000449644A patent/CA1207763A/en not_active Expired
- 1984-03-15 IE IE651/84A patent/IE57306B1/en not_active IP Right Cessation
- 1984-03-15 LU LU85254A patent/LU85254A1/de unknown
- 1984-03-15 CS CS841859A patent/CS241072B2/cs unknown
- 1984-03-15 HU HU841026A patent/HU198925B/hu not_active IP Right Cessation
- 1984-03-15 GR GR74113A patent/GR81826B/el unknown
- 1984-03-16 DD DD84260980A patent/DD218364A5/de not_active IP Right Cessation
- 1984-03-16 YU YU46984A patent/YU45597B/sh unknown
- 1984-03-16 KR KR1019840001362A patent/KR860002036B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GR81826B (cg-RX-API-DMAC7.html) | 1984-12-12 |
| CS241072B2 (en) | 1986-03-13 |
| NO158136C (no) | 1988-07-20 |
| FI79848B (fi) | 1989-11-30 |
| US4440933A (en) | 1984-04-03 |
| HU198925B (en) | 1989-12-28 |
| KR840008005A (ko) | 1984-12-12 |
| NO840929L (no) | 1984-09-17 |
| DD218364A5 (de) | 1985-02-06 |
| YU46984A (en) | 1986-10-31 |
| KR860002036B1 (ko) | 1986-11-17 |
| CS185984A2 (en) | 1985-06-13 |
| IE57306B1 (en) | 1992-07-15 |
| FI841009A0 (fi) | 1984-03-13 |
| DK155984D0 (da) | 1984-03-14 |
| FI841009L (fi) | 1984-09-17 |
| NO158136B (no) | 1988-04-11 |
| DK155984A (da) | 1984-09-17 |
| FI79848C (fi) | 1990-03-12 |
| CA1207763A (en) | 1986-07-15 |
| ES8602721A1 (es) | 1985-12-01 |
| IE840651L (en) | 1984-09-16 |
| ES530590A0 (es) | 1985-12-01 |
| YU45597B (sh) | 1992-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3218584C2 (cg-RX-API-DMAC7.html) | ||
| DE69834842T2 (de) | Hemmung von raf-kinase unter verwendung von aryl- und heteroarylsubstituierten heterocyclischen harnstoffen | |
| EP0261539B1 (de) | Substituierte Phenylsulfonamide | |
| DE2322880C2 (de) | 4-(Imidazolin-2-ylamino)-2,1,3-benzothiadiazole und Verfahren zu deren Herstellung | |
| LU85254A1 (de) | Verfahren zur herstellung von 3-(amino-oder subst.-amino)-4-(subst.-amino)-1,2,5-thiadiazol verbindungen | |
| DE69201748T2 (de) | Pyrazinderivate. | |
| DE2925448A1 (de) | 3-aminopropoxyaryl-derivate, ihre herstellung und verwendung | |
| DE2238504A1 (de) | Propanolaminderivate | |
| DE69127976T2 (de) | Tropolonderivate und pharmazeutische zubereitungen davon zur vorbeugung und behandlung von ischämischen krankheiten | |
| DE68927311T2 (de) | Buten- oder Propensäure-Derivate | |
| DE69611783T2 (de) | Benzisoxazol- und indazol- derivate als antipsychotika | |
| DE2524277C2 (cg-RX-API-DMAC7.html) | ||
| EP0409048A2 (de) | Aminoalkylsubstituierte 2-Aminothiazole und diese enthaltende therapeutische Mittel | |
| DD210909A5 (de) | Verfahren zur herstellung von substituierten 3,4-diamino-1,2,5-thiadiazolverbindungen | |
| DE3133887A1 (de) | 2-arylhydrazino-2-imidazoline, deren acylderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von endo- und ektoparasiten | |
| DE69107874T2 (de) | Imidazolderivate und diese Imidazolderivate als Wirkstoffe enthaltende Antiepileptika. | |
| EP0177054B1 (de) | Neue Pyridinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE3406414A1 (de) | Substituierte n-(w-(lh-imidazol-l-yl)-alkyl)-amide | |
| DE3405632A1 (de) | Neue pleuromutilinderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DD159073A5 (de) | Verfahren zur herstellung neuer benzazolderivate | |
| AT387384B (de) | Verfahren zur herstellung von thiadiazolderivaten | |
| DE3204074C2 (cg-RX-API-DMAC7.html) | ||
| AT390790B (de) | Verfahren zur herstellung des neuen 3-amino-4-(2-((2-guanidinothiazol-4-yl)methylth o)-ethylamino)-1,2,5-thiadiazols | |
| CH641167A5 (en) | N-Cyano-N'-(2-((4-methyl-5-imidazolyl)-methylthio)ethyl)-N''-alkyny l guanidines | |
| EP0266532A1 (de) | 1,3-Disubstituierte Imidazoliumsalze |