KR20070038500A - erbB 수용체 타이로신 키나제로서의 퀴나졸린 유도체 - Google Patents
erbB 수용체 타이로신 키나제로서의 퀴나졸린 유도체 Download PDFInfo
- Publication number
- KR20070038500A KR20070038500A KR1020077000221A KR20077000221A KR20070038500A KR 20070038500 A KR20070038500 A KR 20070038500A KR 1020077000221 A KR1020077000221 A KR 1020077000221A KR 20077000221 A KR20077000221 A KR 20077000221A KR 20070038500 A KR20070038500 A KR 20070038500A
- Authority
- KR
- South Korea
- Prior art keywords
- oxy
- alkyl
- methyl
- quinazolin
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 title abstract description 119
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 title description 20
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 title description 20
- 238000000034 method Methods 0.000 claims abstract description 77
- 230000001028 anti-proliverative effect Effects 0.000 claims abstract description 6
- 239000003814 drug Substances 0.000 claims abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 795
- -1 cyano, nitro, hydroxy, amino, carboxy, carbamoyl Chemical group 0.000 claims description 707
- 125000001424 substituent group Chemical group 0.000 claims description 343
- 229910052757 nitrogen Inorganic materials 0.000 claims description 337
- 125000000623 heterocyclic group Chemical group 0.000 claims description 279
- 239000001257 hydrogen Substances 0.000 claims description 179
- 229910052739 hydrogen Inorganic materials 0.000 claims description 179
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 163
- 125000003545 alkoxy group Chemical group 0.000 claims description 162
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 140
- 125000005843 halogen group Chemical group 0.000 claims description 137
- 229910052760 oxygen Inorganic materials 0.000 claims description 106
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 104
- 125000000304 alkynyl group Chemical group 0.000 claims description 100
- 125000003342 alkenyl group Chemical group 0.000 claims description 98
- 125000003282 alkyl amino group Chemical group 0.000 claims description 92
- 150000001875 compounds Chemical class 0.000 claims description 90
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 87
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 80
- 238000006243 chemical reaction Methods 0.000 claims description 79
- 125000001589 carboacyl group Chemical group 0.000 claims description 63
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 62
- 150000003839 salts Chemical class 0.000 claims description 61
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 60
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 59
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 59
- 125000005842 heteroatom Chemical group 0.000 claims description 59
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 56
- 125000001153 fluoro group Chemical group F* 0.000 claims description 56
- 239000001301 oxygen Substances 0.000 claims description 56
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 56
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 55
- 229910052717 sulfur Inorganic materials 0.000 claims description 53
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 52
- 229910005965 SO 2 Inorganic materials 0.000 claims description 48
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 48
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 47
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 46
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 46
- 230000008569 process Effects 0.000 claims description 43
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 40
- 125000004414 alkyl thio group Chemical group 0.000 claims description 40
- 125000004423 acyloxy group Chemical group 0.000 claims description 39
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 38
- 150000001412 amines Chemical class 0.000 claims description 37
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 37
- 125000004043 oxo group Chemical group O=* 0.000 claims description 36
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 35
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 35
- 229920006395 saturated elastomer Polymers 0.000 claims description 33
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 30
- 125000000524 functional group Chemical group 0.000 claims description 30
- 125000004076 pyridyl group Chemical group 0.000 claims description 30
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 30
- 239000011593 sulfur Chemical group 0.000 claims description 30
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 29
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims description 29
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 29
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 26
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 24
- 229910052799 carbon Inorganic materials 0.000 claims description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 24
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 24
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 20
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 19
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 17
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 17
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 16
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 16
- 150000002431 hydrogen Chemical class 0.000 claims description 16
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 16
- 125000003386 piperidinyl group Chemical group 0.000 claims description 16
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 16
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 15
- 125000001072 heteroaryl group Chemical group 0.000 claims description 15
- 230000002401 inhibitory effect Effects 0.000 claims description 15
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 15
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 14
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 14
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 14
- 125000006239 protecting group Chemical group 0.000 claims description 14
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 13
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 claims description 12
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 12
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 11
- 125000002393 azetidinyl group Chemical group 0.000 claims description 10
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 claims description 10
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims description 10
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 10
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 10
- DRYRBWIFRVMRPV-UHFFFAOYSA-N quinazolin-4-amine Chemical compound C1=CC=C2C(N)=NC=NC2=C1 DRYRBWIFRVMRPV-UHFFFAOYSA-N 0.000 claims description 10
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 10
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 claims description 9
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 9
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 9
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 9
- 229920002554 vinyl polymer Polymers 0.000 claims description 9
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims description 8
- 101710100968 Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims description 8
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 8
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 8
- 125000001246 bromo group Chemical group Br* 0.000 claims description 8
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 claims description 8
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 8
- 239000001294 propane Substances 0.000 claims description 8
- 125000001422 pyrrolinyl group Chemical group 0.000 claims description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Natural products CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 7
- 125000005958 tetrahydrothienyl group Chemical group 0.000 claims description 7
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 6
- 241000156724 Antirhea Species 0.000 claims description 6
- 239000007822 coupling agent Substances 0.000 claims description 6
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 claims description 6
- 125000005053 dihydropyrimidinyl group Chemical group N1(CN=CC=C1)* 0.000 claims description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 6
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 6
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 claims description 6
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 claims description 6
- 239000012190 activator Substances 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 claims description 5
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 5
- 125000006173 tetrahydropyranylmethyl group Chemical group 0.000 claims description 5
- BTNBMGWBIOYPAU-FXAWDEMLSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-[(3r)-3-hydroxypyrrolidin-1-yl]propan-1-one Chemical compound O([C@@H](C)C(=O)N1C[C@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 BTNBMGWBIOYPAU-FXAWDEMLSA-N 0.000 claims description 4
- BTNBMGWBIOYPAU-PXNSSMCTSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-[(3s)-3-hydroxypyrrolidin-1-yl]propan-1-one Chemical compound O([C@@H](C)C(=O)N1C[C@@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 BTNBMGWBIOYPAU-PXNSSMCTSA-N 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 125000006125 ethylsulfonyl group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000006223 tetrahydrofuranylmethyl group Chemical group 0.000 claims description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- ZBYCKCQLRHBIOI-JOCHJYFZSA-N (2r)-1-(4-ethylpiperazin-1-yl)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound C1CN(CC)CCN1C(=O)[C@@H](C)OC1=CC=CC2=NC=NC(NC=3C=C(C)C(OC=4C=NC(C)=CC=4)=CC=3)=C12 ZBYCKCQLRHBIOI-JOCHJYFZSA-N 0.000 claims description 2
- UXGHRLFRUHPVAO-HXUWFJFHSA-N (2r)-1-(4-hydroxypiperidin-1-yl)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1CCC(O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 UXGHRLFRUHPVAO-HXUWFJFHSA-N 0.000 claims description 2
- POQPMXJVRGTDHK-LJQANCHMSA-N (2r)-1-(azetidin-1-yl)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1CCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 POQPMXJVRGTDHK-LJQANCHMSA-N 0.000 claims description 2
- WHSWMMPWNOZHIK-IFMALSPDSA-N (2r)-1-[(2r)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1[C@H](CCC1)CO)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 WHSWMMPWNOZHIK-IFMALSPDSA-N 0.000 claims description 2
- WHSWMMPWNOZHIK-IRLDBZIGSA-N (2r)-1-[(2s)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1[C@@H](CCC1)CO)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 WHSWMMPWNOZHIK-IRLDBZIGSA-N 0.000 claims description 2
- BHKXUDXNCBTWQC-TZIWHRDSSA-N (2r)-1-[(3r)-3-hydroxypiperidin-1-yl]-2-[4-(3-methyl-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@H](O)CCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CC=N1 BHKXUDXNCBTWQC-TZIWHRDSSA-N 0.000 claims description 2
- WACRWIYZJJPTCG-TZIWHRDSSA-N (2r)-1-[(3r)-3-hydroxypiperidin-1-yl]-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O=C([C@@H](C)OC=1C=CC=C2N=CN=C(C=12)NC=1C=C(C(=CC=1)OC=1C=NC(C)=CC=1)OC)N1CCC[C@@H](O)C1 WACRWIYZJJPTCG-TZIWHRDSSA-N 0.000 claims description 2
- HACPXTPHGGTGJL-IFMALSPDSA-N (2r)-1-[(3r)-3-hydroxypiperidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@H](O)CCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 HACPXTPHGGTGJL-IFMALSPDSA-N 0.000 claims description 2
- CUXVZRKCEYEHCD-TZIWHRDSSA-N (2r)-1-[(3r)-3-hydroxypyrrolidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 CUXVZRKCEYEHCD-TZIWHRDSSA-N 0.000 claims description 2
- DTKCUTKZQAYHLJ-DENIHFKCSA-N (2r)-1-[(3r)-3-hydroxypyrrolidin-1-yl]-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 DTKCUTKZQAYHLJ-DENIHFKCSA-N 0.000 claims description 2
- HACPXTPHGGTGJL-IRLDBZIGSA-N (2r)-1-[(3s)-3-hydroxypiperidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@@H](O)CCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 HACPXTPHGGTGJL-IRLDBZIGSA-N 0.000 claims description 2
- CUXVZRKCEYEHCD-CTNGQTDRSA-N (2r)-1-[(3s)-3-hydroxypyrrolidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 CUXVZRKCEYEHCD-CTNGQTDRSA-N 0.000 claims description 2
- STTQEGIPIRVTBK-OAQYLSRUSA-N (2r)-1-[4-(hydroxymethyl)piperidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1CCC(CO)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 STTQEGIPIRVTBK-OAQYLSRUSA-N 0.000 claims description 2
- YHXQGEWKBGXUHP-GOSISDBHSA-N (2r)-1-morpholin-4-yl-2-[4-(4-pyridin-3-yloxyanilino)quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1)=CC=C1OC1=CC=CN=C1 YHXQGEWKBGXUHP-GOSISDBHSA-N 0.000 claims description 2
- BUVVFLDHQZDVQL-DUSLRRAJSA-N (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxy-1-(3-hydroxypiperidin-1-yl)propan-1-one Chemical compound O([C@H](C)C(=O)N1CC(O)CCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 BUVVFLDHQZDVQL-DUSLRRAJSA-N 0.000 claims description 2
- GQGOLYCZKGIRHT-OAHLLOKOSA-N (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxy-n,n-dimethylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 GQGOLYCZKGIRHT-OAHLLOKOSA-N 0.000 claims description 2
- BSMOUWVKFROESP-MRXNPFEDSA-N (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 BSMOUWVKFROESP-MRXNPFEDSA-N 0.000 claims description 2
- WEZZNWQATVXVDW-QGZVFWFLSA-N (2r)-2-[4-(3-fluoro-4-pyridin-3-yloxyanilino)quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1F)=CC=C1OC1=CC=CN=C1 WEZZNWQATVXVDW-QGZVFWFLSA-N 0.000 claims description 2
- OAWKJLALCNLYTB-GOSISDBHSA-N (2r)-2-[4-(3-methoxy-4-pyridin-3-yloxyanilino)quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O=C([C@@H](C)OC=1C=CC=C2N=CN=C(C=12)NC=1C=C(C(=CC=1)OC=1C=NC=CC=1)OC)N1CCOCC1 OAWKJLALCNLYTB-GOSISDBHSA-N 0.000 claims description 2
- RFHNMCRURAMFHZ-GOSISDBHSA-N (2r)-2-[4-(3-methyl-4-pyridazin-3-yloxyanilino)quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CN=N1 RFHNMCRURAMFHZ-GOSISDBHSA-N 0.000 claims description 2
- CQLYORSHVYBLMS-GOSISDBHSA-N (2r)-2-[4-(3-methyl-4-pyrimidin-5-yloxyanilino)quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CN=CN=C1 CQLYORSHVYBLMS-GOSISDBHSA-N 0.000 claims description 2
- TYPJWHGRDVHRRZ-OAHLLOKOSA-N (2r)-2-[4-[3-chloro-4-(1,3-thiazol-2-yloxy)anilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=NC=CS1 TYPJWHGRDVHRRZ-OAHLLOKOSA-N 0.000 claims description 2
- BKUNUATYQBJKAW-MRXNPFEDSA-N (2r)-2-[4-[3-chloro-4-(1-methylpyrazol-4-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC=1C=NN(C)C=1 BKUNUATYQBJKAW-MRXNPFEDSA-N 0.000 claims description 2
- CTFGDXFXTZFJLD-GOSISDBHSA-N (2r)-2-[4-[3-chloro-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=C(C)N=C1 CTFGDXFXTZFJLD-GOSISDBHSA-N 0.000 claims description 2
- DYOHMTPFQDFJSG-MRXNPFEDSA-N (2r)-2-[4-[3-chloro-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-n,n-dimethylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=C(C)N=C1 DYOHMTPFQDFJSG-MRXNPFEDSA-N 0.000 claims description 2
- ZGBFXAWADCAOJE-QGZVFWFLSA-N (2r)-2-[4-[3-chloro-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=C(C)N=C1 ZGBFXAWADCAOJE-QGZVFWFLSA-N 0.000 claims description 2
- BTNBMGWBIOYPAU-YLJYHZDGSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-[(3r)-3-hydroxypyrrolidin-1-yl]propan-1-one Chemical compound O([C@H](C)C(=O)N1C[C@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 BTNBMGWBIOYPAU-YLJYHZDGSA-N 0.000 claims description 2
- UTHNMKVUDJYYFU-GOSISDBHSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-pyrrolidin-1-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 UTHNMKVUDJYYFU-GOSISDBHSA-N 0.000 claims description 2
- FYQLSGTZXNFLBP-AREMUKBSSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-1-(4-methylpiperazin-1-yl)butan-1-one Chemical compound C1CN(C)CCN1C(=O)[C@@H](CCO)OC1=CC=CC2=NC=NC(NC=3C=C(Cl)C(OCC=4N=CC=CC=4)=CC=3)=C12 FYQLSGTZXNFLBP-AREMUKBSSA-N 0.000 claims description 2
- KXKMLDJBINFBMA-RUZDIDTESA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-1-morpholin-4-ylbutan-1-one Chemical compound O([C@H](CCO)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 KXKMLDJBINFBMA-RUZDIDTESA-N 0.000 claims description 2
- CBUHIHJVWPRZBD-RUZDIDTESA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-1-pyrrolidin-1-ylbutan-1-one Chemical compound O([C@H](CCO)C(=O)N1CCCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 CBUHIHJVWPRZBD-RUZDIDTESA-N 0.000 claims description 2
- UFOUYPHVNFLZQT-HSZRJFAPSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-n,n-dimethylbutanamide Chemical compound C=12C(O[C@H](CCO)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 UFOUYPHVNFLZQT-HSZRJFAPSA-N 0.000 claims description 2
- WVPHLDMWUKZQRT-XMMPIXPASA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-n-(2-hydroxyethyl)-n-methylbutanamide Chemical compound C=12C(O[C@H](CCO)C(=O)N(CCO)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 WVPHLDMWUKZQRT-XMMPIXPASA-N 0.000 claims description 2
- LAOAMPGLBWUUOH-JOCHJYFZSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-4-hydroxy-n-methylbutanamide Chemical compound C=12C(O[C@H](CCO)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 LAOAMPGLBWUUOH-JOCHJYFZSA-N 0.000 claims description 2
- QPPYSOHWFOUKPX-MRXNPFEDSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n,n-dimethylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 QPPYSOHWFOUKPX-MRXNPFEDSA-N 0.000 claims description 2
- WZEUNGUUUBFSGF-QGZVFWFLSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 WZEUNGUUUBFSGF-QGZVFWFLSA-N 0.000 claims description 2
- QCTACFWJSRSNOJ-OAHLLOKOSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 QCTACFWJSRSNOJ-OAHLLOKOSA-N 0.000 claims description 2
- DMWWQRAYTXZZJP-CQSZACIVSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(N)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DMWWQRAYTXZZJP-CQSZACIVSA-N 0.000 claims description 2
- ZIHGLKQTSBXMBZ-QGZVFWFLSA-N (2r)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-n,n-dimethylpropanamide Chemical compound COC1=CC(NC=2C3=C(O[C@H](C)C(=O)N(C)C)C=CC=C3N=CN=2)=CC=C1OC1=CC=C(C)N=C1 ZIHGLKQTSBXMBZ-QGZVFWFLSA-N 0.000 claims description 2
- CLVHWHRMEZJEAB-QGZVFWFLSA-N (2r)-2-[4-[3-methyl-4-(1,3-thiazol-2-yloxy)anilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=NC=CS1 CLVHWHRMEZJEAB-QGZVFWFLSA-N 0.000 claims description 2
- AMBLTSYRYALCDZ-QGZVFWFLSA-N (2r)-2-[4-[3-methyl-4-(1,3-thiazol-5-yloxy)anilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CN=CS1 AMBLTSYRYALCDZ-QGZVFWFLSA-N 0.000 claims description 2
- ORUUGJFPIMRJJV-GOSISDBHSA-N (2r)-2-[4-[3-methyl-4-(1-methylpyrazol-4-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC=1C=NN(C)C=1 ORUUGJFPIMRJJV-GOSISDBHSA-N 0.000 claims description 2
- OPNCWWJMTAZREJ-OAQYLSRUSA-N (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-(4-methylpiperazin-1-yl)propan-1-one Chemical compound O([C@H](C)C(=O)N1CCN(C)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 OPNCWWJMTAZREJ-OAQYLSRUSA-N 0.000 claims description 2
- SHUGRJASNGVPQD-HXUWFJFHSA-N (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 SHUGRJASNGVPQD-HXUWFJFHSA-N 0.000 claims description 2
- ZYLSCLXBHVKVII-HXUWFJFHSA-N (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-piperazin-1-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCNCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 ZYLSCLXBHVKVII-HXUWFJFHSA-N 0.000 claims description 2
- KCYROHOXZDSAHS-MRXNPFEDSA-N (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(N)=O)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 KCYROHOXZDSAHS-MRXNPFEDSA-N 0.000 claims description 2
- LJZISAWYNKRWIO-HXUWFJFHSA-N (2r)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-pyrrolidin-1-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 LJZISAWYNKRWIO-HXUWFJFHSA-N 0.000 claims description 2
- QFLYTKONAPWVDG-GOSISDBHSA-N (2r)-2-[4-[4-(6-fluoropyridin-3-yl)oxy-3-methylanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(F)N=C1 QFLYTKONAPWVDG-GOSISDBHSA-N 0.000 claims description 2
- YJBCUEJJNJKFEU-LJQANCHMSA-N (2r)-2-[4-[4-(6-methoxypyridin-3-yl)oxy-3-methylanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound C1=NC(OC)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(O[C@H](C)C(=O)N3CCOCC3)=C12 YJBCUEJJNJKFEU-LJQANCHMSA-N 0.000 claims description 2
- GKIPTIQEDVKHHB-LJQANCHMSA-N (2r)-2-[4-[4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1)=CC=C1OC1=CC=C(C)N=C1 GKIPTIQEDVKHHB-LJQANCHMSA-N 0.000 claims description 2
- PCBSKIFMBDGJTQ-LJQANCHMSA-N (2r)-2-[4-[4-[6-(fluoromethyl)pyridin-3-yl]oxy-3-methylanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(CF)N=C1 PCBSKIFMBDGJTQ-LJQANCHMSA-N 0.000 claims description 2
- MKPQIRLXEPRMTF-LJQANCHMSA-N (2r)-2-[4-[4-[6-(hydroxymethyl)pyridin-3-yl]oxy-3-methylanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(CO)N=C1 MKPQIRLXEPRMTF-LJQANCHMSA-N 0.000 claims description 2
- RZTBEOJPWQNXQS-HXUWFJFHSA-N (2r)-n,n-diethyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(CC)CC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 RZTBEOJPWQNXQS-HXUWFJFHSA-N 0.000 claims description 2
- XNXUDGXKTVZKLB-GOSISDBHSA-N (2r)-n,n-dimethyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 XNXUDGXKTVZKLB-GOSISDBHSA-N 0.000 claims description 2
- FRIZWTSUZGRCOM-GOSISDBHSA-N (2r)-n-(2-hydroxyethyl)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-n-methylpropanamide Chemical compound COC1=CC(NC=2C3=C(O[C@H](C)C(=O)N(C)CCO)C=CC=C3N=CN=2)=CC=C1OC1=CC=C(C)N=C1 FRIZWTSUZGRCOM-GOSISDBHSA-N 0.000 claims description 2
- AEOJOWVJRRLUDH-GOSISDBHSA-N (2r)-n-(2-hydroxyethyl)-n-methyl-2-[4-(3-methyl-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CC=N1 AEOJOWVJRRLUDH-GOSISDBHSA-N 0.000 claims description 2
- RHKOFLSVENLYDP-LJQANCHMSA-N (2r)-n-(2-hydroxyethyl)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 RHKOFLSVENLYDP-LJQANCHMSA-N 0.000 claims description 2
- FALHGGCCRVONDY-LJQANCHMSA-N (2r)-n-(2-hydroxyethyl)-n-methyl-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 FALHGGCCRVONDY-LJQANCHMSA-N 0.000 claims description 2
- ZEQVZRKILUBAEF-LJQANCHMSA-N (2r)-n-(2-methoxyethyl)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCOC)=CC=CC2=NC=NC=1NC(C=C1OC)=CC=C1OC1=CC=C(C)N=C1 ZEQVZRKILUBAEF-LJQANCHMSA-N 0.000 claims description 2
- SNIBNOLMGURVKM-HXUWFJFHSA-N (2r)-n-(2-methoxyethyl)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCOC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 SNIBNOLMGURVKM-HXUWFJFHSA-N 0.000 claims description 2
- XOPDMYXFRHOXFS-HXUWFJFHSA-N (2r)-n-(3-hydroxypropyl)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCCO)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 XOPDMYXFRHOXFS-HXUWFJFHSA-N 0.000 claims description 2
- LJVILAHBLHROHD-QGZVFWFLSA-N (2r)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 LJVILAHBLHROHD-QGZVFWFLSA-N 0.000 claims description 2
- QSDGLFJIKRMVDL-QGZVFWFLSA-N (2r)-n-methyl-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@H](C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 QSDGLFJIKRMVDL-QGZVFWFLSA-N 0.000 claims description 2
- CUXVZRKCEYEHCD-FPOVZHCZSA-N (2s)-1-[(3s)-3-hydroxypyrrolidin-1-yl]-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropan-1-one Chemical compound O([C@@H](C)C(=O)N1C[C@@H](O)CC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 CUXVZRKCEYEHCD-FPOVZHCZSA-N 0.000 claims description 2
- QPPYSOHWFOUKPX-INIZCTEOSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n,n-dimethylpropanamide Chemical compound C=12C(O[C@@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 QPPYSOHWFOUKPX-INIZCTEOSA-N 0.000 claims description 2
- WZEUNGUUUBFSGF-KRWDZBQOSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n-methylpropanamide Chemical compound C=12C(O[C@@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 WZEUNGUUUBFSGF-KRWDZBQOSA-N 0.000 claims description 2
- QCTACFWJSRSNOJ-HNNXBMFYSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methylpropanamide Chemical compound C=12C(O[C@@H](C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 QCTACFWJSRSNOJ-HNNXBMFYSA-N 0.000 claims description 2
- DMWWQRAYTXZZJP-AWEZNQCLSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@@H](C)C(N)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DMWWQRAYTXZZJP-AWEZNQCLSA-N 0.000 claims description 2
- KCYROHOXZDSAHS-INIZCTEOSA-N (2s)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@@H](C)C(N)=O)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 KCYROHOXZDSAHS-INIZCTEOSA-N 0.000 claims description 2
- XNXUDGXKTVZKLB-SFHVURJKSA-N (2s)-n,n-dimethyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@@H](C)C(=O)N(C)C)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 XNXUDGXKTVZKLB-SFHVURJKSA-N 0.000 claims description 2
- RHKOFLSVENLYDP-IBGZPJMESA-N (2s)-n-(2-hydroxyethyl)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@@H](C)C(=O)N(C)CCO)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 RHKOFLSVENLYDP-IBGZPJMESA-N 0.000 claims description 2
- LJVILAHBLHROHD-KRWDZBQOSA-N (2s)-n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanamide Chemical compound C=12C(O[C@@H](C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 LJVILAHBLHROHD-KRWDZBQOSA-N 0.000 claims description 2
- IQNBHURYIWAEOA-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-(4-methylpiperazin-1-yl)ethanone Chemical compound C1CN(C)CCN1C(=O)COC1=CC=CC2=NC=NC(NC=3C=C(Cl)C(OCC=4N=CC=CC=4)=CC=3)=C12 IQNBHURYIWAEOA-UHFFFAOYSA-N 0.000 claims description 2
- ABIIALBXPJPBAM-HXUWFJFHSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-[(3r)-3-hydroxypyrrolidin-1-yl]-2-methylpropan-1-one Chemical compound C([C@H](O)CC1)N1C(=O)C(C)(C)OC(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ABIIALBXPJPBAM-HXUWFJFHSA-N 0.000 claims description 2
- IIDKWOQWPGRLIW-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-morpholin-4-ylethanone Chemical compound C=1C=C(OCC=2N=CC=CC=2)C(Cl)=CC=1NC(C=12)=NC=NC2=CC=CC=1OCC(=O)N1CCOCC1 IIDKWOQWPGRLIW-UHFFFAOYSA-N 0.000 claims description 2
- IOSVSLOBJIGVKD-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-1-piperazin-1-ylethanone Chemical compound C=1C=C(OCC=2N=CC=CC=2)C(Cl)=CC=1NC(C=12)=NC=NC2=CC=CC=1OCC(=O)N1CCNCC1 IOSVSLOBJIGVKD-UHFFFAOYSA-N 0.000 claims description 2
- ZTDGISKEIHFQJM-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-2-methylpropanamide Chemical compound C=12C(OC(C)(C)C(N)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZTDGISKEIHFQJM-UHFFFAOYSA-N 0.000 claims description 2
- UUJIQLYAPKAFLJ-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n,2-dimethylpropanamide Chemical compound C=12C(OC(C)(C)C(=O)NC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 UUJIQLYAPKAFLJ-UHFFFAOYSA-N 0.000 claims description 2
- WNSZUBQSBHVHRR-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n,n-bis(2-hydroxyethyl)-2-methylpropanamide Chemical compound C=12C(OC(C)(C)C(=O)N(CCO)CCO)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 WNSZUBQSBHVHRR-UHFFFAOYSA-N 0.000 claims description 2
- PMYRQDIKMXVAIG-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(1-hydroxy-2-methylpropan-2-yl)-2-methylpropanamide Chemical compound C=12C(OC(C)(C)C(=O)NC(C)(CO)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 PMYRQDIKMXVAIG-UHFFFAOYSA-N 0.000 claims description 2
- INQQFMUBAXLUJS-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n,2-dimethylpropanamide Chemical compound C=12C(OC(C)(C)C(=O)N(CCO)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 INQQFMUBAXLUJS-UHFFFAOYSA-N 0.000 claims description 2
- DQSMJIPNCYLKDQ-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-hydroxyethyl)-n-methylacetamide Chemical class C=12C(OCC(=O)N(CCO)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DQSMJIPNCYLKDQ-UHFFFAOYSA-N 0.000 claims description 2
- GAIHXYHHTKIHDB-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-methoxyethyl)acetamide Chemical compound C=12C(OCC(=O)NCCOC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 GAIHXYHHTKIHDB-UHFFFAOYSA-N 0.000 claims description 2
- HXVZBSLWEFSIDC-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-(2-methylsulfonylethyl)acetamide Chemical compound C=12C(OCC(=O)NCCS(=O)(=O)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 HXVZBSLWEFSIDC-UHFFFAOYSA-N 0.000 claims description 2
- ZHJQWJWANKXJCA-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-[2-(dimethylamino)ethyl]-n-methylacetamide Chemical class C=12C(OCC(=O)N(C)CCN(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZHJQWJWANKXJCA-UHFFFAOYSA-N 0.000 claims description 2
- HNILLTAIVGZWKT-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-cyclobutylacetamide Chemical compound C=1C=C(OCC=2N=CC=CC=2)C(Cl)=CC=1NC(C=12)=NC=NC2=CC=CC=1OCC(=O)NC1CCC1 HNILLTAIVGZWKT-UHFFFAOYSA-N 0.000 claims description 2
- QVFTYRILTKIJRJ-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-cyclopropylacetamide Chemical compound C=1C=C(OCC=2N=CC=CC=2)C(Cl)=CC=1NC(C=12)=NC=NC2=CC=CC=1OCC(=O)NC1CC1 QVFTYRILTKIJRJ-UHFFFAOYSA-N 0.000 claims description 2
- DHBDAUZNAMLHQZ-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-ethyl-n-methylacetamide Chemical compound C=12C(OCC(=O)N(C)CC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DHBDAUZNAMLHQZ-UHFFFAOYSA-N 0.000 claims description 2
- XTDATAMURAGLJB-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-ethylacetamide Chemical compound C=12C(OCC(=O)NCC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 XTDATAMURAGLJB-UHFFFAOYSA-N 0.000 claims description 2
- UPENTKJYYQBAOY-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methyl-n-(1-methylpiperidin-4-yl)acetamide Chemical compound C=1C=CC2=NC=NC(NC=3C=C(Cl)C(OCC=4N=CC=CC=4)=CC=3)=C2C=1OCC(=O)N(C)C1CCN(C)CC1 UPENTKJYYQBAOY-UHFFFAOYSA-N 0.000 claims description 2
- OAOJKRWXBFFKPW-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methyl-n-(2-methylsulfonylethyl)acetamide Chemical compound C=12C(OCC(=O)N(CCS(C)(=O)=O)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 OAOJKRWXBFFKPW-UHFFFAOYSA-N 0.000 claims description 2
- YSVANPFEFQDDEF-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methyl-n-prop-2-ynylacetamide Chemical compound C=12C(OCC(=O)N(CC#C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 YSVANPFEFQDDEF-UHFFFAOYSA-N 0.000 claims description 2
- KTKJBYIXTZKZHP-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-n-methyl-n-propan-2-ylacetamide Chemical compound C=12C(OCC(=O)N(C)C(C)C)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 KTKJBYIXTZKZHP-UHFFFAOYSA-N 0.000 claims description 2
- DEDWEDQNCVGJQP-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxyacetamide Chemical compound C=12C(OCC(=O)N)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 DEDWEDQNCVGJQP-UHFFFAOYSA-N 0.000 claims description 2
- PBTDMULPNDZNOI-UHFFFAOYSA-N 2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-(4-methylpiperazin-1-yl)ethanone Chemical compound C1CN(C)CCN1C(=O)COC1=CC=CC2=NC=NC(NC=3C=C(C)C(OC=4C=NC(C)=CC=4)=CC=3)=C12 PBTDMULPNDZNOI-UHFFFAOYSA-N 0.000 claims description 2
- DBBOWDJNLYCSHP-UHFFFAOYSA-N 2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-piperazin-1-ylethanone Chemical compound C1=NC(C)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(OCC(=O)N3CCNCC3)=C12 DBBOWDJNLYCSHP-UHFFFAOYSA-N 0.000 claims description 2
- OQMPFANZXGBCKF-UHFFFAOYSA-N 2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-pyrrolidin-1-ylethanone Chemical compound C1=NC(C)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(OCC(=O)N3CCCC3)=C12 OQMPFANZXGBCKF-UHFFFAOYSA-N 0.000 claims description 2
- PXSWJYXXYJFXSI-UHFFFAOYSA-N 2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxyacetamide Chemical compound C1=NC(C)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(OCC(N)=O)=C12 PXSWJYXXYJFXSI-UHFFFAOYSA-N 0.000 claims description 2
- OVUYBBZPOKGMQD-UHFFFAOYSA-N 2-methyl-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanamide Chemical compound CC1=CC(NC=2C3=C(OC(C)(C)C(N)=O)C=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 OVUYBBZPOKGMQD-UHFFFAOYSA-N 0.000 claims description 2
- UBNGYIRTUXFYMI-MRXNPFEDSA-N 4-[(2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoyl]piperazin-2-one Chemical compound O([C@H](C)C(=O)N1CC(=O)NCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 UBNGYIRTUXFYMI-MRXNPFEDSA-N 0.000 claims description 2
- MFGZYITYUFKFHM-GOSISDBHSA-N 4-[(2r)-2-[4-(3-methyl-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoyl]piperazin-2-one Chemical compound O([C@H](C)C(=O)N1CC(=O)NCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CC=N1 MFGZYITYUFKFHM-GOSISDBHSA-N 0.000 claims description 2
- DVIMMYUPPSUXDO-LJQANCHMSA-N 4-[(2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoyl]piperazin-2-one Chemical compound O([C@H](C)C(=O)N1CC(=O)NCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 DVIMMYUPPSUXDO-LJQANCHMSA-N 0.000 claims description 2
- HCGLYZMEYZJQJM-LJQANCHMSA-N 5-[2-methyl-4-[[5-[(2r)-1-morpholin-4-yl-1-oxopropan-2-yl]oxyquinazolin-4-yl]amino]phenoxy]pyridine-2-carbonitrile Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C#N)N=C1 HCGLYZMEYZJQJM-LJQANCHMSA-N 0.000 claims description 2
- PGZANCNVVXOVQP-GOSISDBHSA-N 5-[[5-[(2r)-1-morpholin-4-yl-1-oxopropan-2-yl]oxyquinazolin-4-yl]amino]-2-pyridin-3-yloxybenzonitrile Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C#N)=CC=C1OC1=CC=CN=C1 PGZANCNVVXOVQP-GOSISDBHSA-N 0.000 claims description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 claims description 2
- RXBOEADRGWCNCJ-UHFFFAOYSA-N n-(2-hydroxyethyl)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxyacetamide Chemical compound C1=NC(C)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(OCC(=O)NCCO)=C12 RXBOEADRGWCNCJ-UHFFFAOYSA-N 0.000 claims description 2
- NOMRZODRIRQWID-UHFFFAOYSA-N n-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxyacetamide Chemical compound C=12C(OCC(=O)NC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 NOMRZODRIRQWID-UHFFFAOYSA-N 0.000 claims description 2
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims description 2
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 claims description 2
- OTPMITWGYZDQSV-HSZRJFAPSA-N tert-butyl 4-[(2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoyl]piperazine-1-carboxylate Chemical compound O([C@H](C)C(=O)N1CCN(CC1)C(=O)OC(C)(C)C)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 OTPMITWGYZDQSV-HSZRJFAPSA-N 0.000 claims description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 2
- 150000003246 quinazolines Chemical class 0.000 claims 26
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 2
- XSSFNNOZFIXWDF-GOSISDBHSA-N (2r)-2-[4-[3-fluoro-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1F)=CC=C1OC1=CC=C(C)N=C1 XSSFNNOZFIXWDF-GOSISDBHSA-N 0.000 claims 1
- AXAMEWIVQQBQPF-LJQANCHMSA-N (2r)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-piperazin-1-ylpropan-1-one Chemical compound O=C([C@@H](C)OC=1C=CC=C2N=CN=C(C=12)NC=1C=C(C(=CC=1)OC=1C=NC(C)=CC=1)OC)N1CCNCC1 AXAMEWIVQQBQPF-LJQANCHMSA-N 0.000 claims 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 claims 1
- 206010028980 Neoplasm Diseases 0.000 abstract description 30
- 230000005764 inhibitory process Effects 0.000 abstract description 18
- 238000011282 treatment Methods 0.000 abstract description 14
- 102000001301 EGF receptor Human genes 0.000 abstract description 12
- 108060006698 EGF receptor Proteins 0.000 abstract description 12
- 238000002360 preparation method Methods 0.000 abstract description 6
- 239000003795 chemical substances by application Substances 0.000 abstract description 4
- 230000002265 prevention Effects 0.000 abstract description 2
- 229960005419 nitrogen Drugs 0.000 description 66
- 210000004027 cell Anatomy 0.000 description 55
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 34
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 28
- 239000002585 base Substances 0.000 description 25
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 25
- 238000012360 testing method Methods 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 230000000694 effects Effects 0.000 description 23
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 20
- 239000002953 phosphate buffered saline Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 20
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 19
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 description 19
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 description 19
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 15
- 201000011510 cancer Diseases 0.000 description 15
- 150000001721 carbon Chemical group 0.000 description 15
- 230000026731 phosphorylation Effects 0.000 description 15
- 238000006366 phosphorylation reaction Methods 0.000 description 15
- 239000007858 starting material Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 13
- 239000012442 inert solvent Substances 0.000 description 13
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 12
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 12
- 239000003701 inert diluent Substances 0.000 description 11
- 102000005962 receptors Human genes 0.000 description 11
- 108020003175 receptors Proteins 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 10
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 10
- 238000003556 assay Methods 0.000 description 10
- 239000003112 inhibitor Substances 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000007796 conventional method Methods 0.000 description 9
- 150000002170 ethers Chemical class 0.000 description 9
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 9
- 125000002950 monocyclic group Chemical group 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 210000004881 tumor cell Anatomy 0.000 description 9
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 8
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 239000003849 aromatic solvent Substances 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 8
- 125000002883 imidazolyl group Chemical group 0.000 description 8
- 125000000842 isoxazolyl group Chemical group 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 230000035755 proliferation Effects 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 7
- 108700020796 Oncogene Proteins 0.000 description 7
- 108091000080 Phosphotransferase Proteins 0.000 description 7
- 239000000010 aprotic solvent Substances 0.000 description 7
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 7
- 238000011534 incubation Methods 0.000 description 7
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 7
- 102000020233 phosphotransferase Human genes 0.000 description 7
- 102000004169 proteins and genes Human genes 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 7
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 239000003513 alkali Substances 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 230000035772 mutation Effects 0.000 description 6
- MTSNDBYBIZSILH-UHFFFAOYSA-N n-phenylquinazolin-4-amine Chemical group N=1C=NC2=CC=CC=C2C=1NC1=CC=CC=C1 MTSNDBYBIZSILH-UHFFFAOYSA-N 0.000 description 6
- 229920000136 polysorbate Polymers 0.000 description 6
- 108090000765 processed proteins & peptides Proteins 0.000 description 6
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 description 6
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 5
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical group NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 5
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 5
- 102400001368 Epidermal growth factor Human genes 0.000 description 5
- 101800003838 Epidermal growth factor Proteins 0.000 description 5
- 239000007995 HEPES buffer Substances 0.000 description 5
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 229940116977 epidermal growth factor Drugs 0.000 description 5
- 239000003797 essential amino acid Substances 0.000 description 5
- 235000020776 essential amino acid Nutrition 0.000 description 5
- 229960002584 gefitinib Drugs 0.000 description 5
- BRZYSWJRSDMWLG-CAXSIQPQSA-N geneticin Natural products O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(C)O)O2)N)[C@@H](N)C[C@H]1N BRZYSWJRSDMWLG-CAXSIQPQSA-N 0.000 description 5
- 239000001963 growth medium Substances 0.000 description 5
- 230000003834 intracellular effect Effects 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 125000004193 piperazinyl group Chemical group 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 5
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 5
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 5
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 4
- 150000008046 alkali metal hydrides Chemical class 0.000 description 4
- 230000000259 anti-tumor effect Effects 0.000 description 4
- 210000003050 axon Anatomy 0.000 description 4
- 230000000903 blocking effect Effects 0.000 description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 4
- 239000012091 fetal bovine serum Substances 0.000 description 4
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 230000003389 potentiating effect Effects 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 230000004083 survival effect Effects 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 3
- 238000006751 Mitsunobu reaction Methods 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- 102000004257 Potassium Channel Human genes 0.000 description 3
- 229920004890 Triton X-100 Polymers 0.000 description 3
- 239000013504 Triton X-100 Substances 0.000 description 3
- GLNADSQYFUSGOU-GPTZEZBUSA-J Trypan blue Chemical compound [Na+].[Na+].[Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(/N=N/C3=CC=C(C=C3C)C=3C=C(C(=CC=3)\N=N\C=3C(=CC4=CC(=CC(N)=C4C=3O)S([O-])(=O)=O)S([O-])(=O)=O)C)=C(O)C2=C1N GLNADSQYFUSGOU-GPTZEZBUSA-J 0.000 description 3
- 102000004142 Trypsin Human genes 0.000 description 3
- 108090000631 Trypsin Proteins 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 238000007080 aromatic substitution reaction Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 210000000170 cell membrane Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000010520 demethylation reaction Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 230000002255 enzymatic effect Effects 0.000 description 3
- 238000001640 fractional crystallisation Methods 0.000 description 3
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 3
- 239000006166 lysate Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 102000037979 non-receptor tyrosine kinases Human genes 0.000 description 3
- 108091008046 non-receptor tyrosine kinases Proteins 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 150000003003 phosphines Chemical group 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 108020001213 potassium channel Proteins 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 102000004196 processed proteins & peptides Human genes 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000009822 protein phosphorylation Effects 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 230000019491 signal transduction Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 239000012588 trypsin Substances 0.000 description 3
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 3
- 235000002374 tyrosine Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 2
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 2
- AZKSAVLVSZKNRD-UHFFFAOYSA-M 3-(4,5-dimethylthiazol-2-yl)-2,5-diphenyltetrazolium bromide Chemical compound [Br-].S1C(C)=C(C)N=C1[N+]1=NC(C=2C=CC=CC=2)=NN1C1=CC=CC=C1 AZKSAVLVSZKNRD-UHFFFAOYSA-M 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- 125000001963 4 membered heterocyclic group Chemical group 0.000 description 2
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 2
- UXEZULVIMJVIFB-UHFFFAOYSA-N 5-fluoro-1h-quinazolin-4-one Chemical compound N1C=NC(=O)C2=C1C=CC=C2F UXEZULVIMJVIFB-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 2
- UYIFTLBWAOGQBI-BZDYCCQFSA-N Benzhormovarine Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4O)C)CC2=CC=3OC(=O)C1=CC=CC=C1 UYIFTLBWAOGQBI-BZDYCCQFSA-N 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 230000004544 DNA amplification Effects 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- 102000001332 SRC Human genes 0.000 description 2
- 108060006706 SRC Proteins 0.000 description 2
- 229940124639 Selective inhibitor Drugs 0.000 description 2
- 229910021607 Silver chloride Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 2
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 238000001516 cell proliferation assay Methods 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940121647 egfr inhibitor Drugs 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 229960001433 erlotinib Drugs 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000006534 ethyl amino methyl group Chemical group [H]N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000012744 immunostaining Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 239000012139 lysis buffer Substances 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- JQSVJGUNGQUEQH-CQSZACIVSA-N methyl (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 JQSVJGUNGQUEQH-CQSZACIVSA-N 0.000 description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000027405 negative regulation of phosphorylation Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 125000003551 oxepanyl group Chemical group 0.000 description 2
- 125000003566 oxetanyl group Chemical group 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 2
- YBYRMVIVWMBXKQ-UHFFFAOYSA-N phenylmethanesulfonyl fluoride Chemical compound FS(=O)(=O)CC1=CC=CC=C1 YBYRMVIVWMBXKQ-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 230000002062 proliferating effect Effects 0.000 description 2
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 2
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000012679 serum free medium Substances 0.000 description 2
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 2
- QKSQWQOAUQFORH-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate Chemical compound CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C QKSQWQOAUQFORH-UHFFFAOYSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- ZMAHCPKWJSLWEH-QGZVFWFLSA-N (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxy-n-(2-methoxyethyl)-n-methylpropanamide Chemical compound C=12C(O[C@H](C)C(=O)N(C)CCOC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 ZMAHCPKWJSLWEH-QGZVFWFLSA-N 0.000 description 1
- GWFUBXUZJFABMV-CYBMUJFWSA-N (2r)-2-[4-(3-chloro-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=CC=N1 GWFUBXUZJFABMV-CYBMUJFWSA-N 0.000 description 1
- QAZOKRQIRVUVAX-OAHLLOKOSA-N (2r)-2-[4-(3-methyl-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CC=N1 QAZOKRQIRVUVAX-OAHLLOKOSA-N 0.000 description 1
- QDHNOYPCQADHDW-OAHLLOKOSA-N (2r)-2-[4-[3-chloro-4-(1,3-thiazol-5-yloxy)anilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CN=CS1 QDHNOYPCQADHDW-OAHLLOKOSA-N 0.000 description 1
- ODBSSWNSVZQHTQ-CQSZACIVSA-N (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ODBSSWNSVZQHTQ-CQSZACIVSA-N 0.000 description 1
- UHXLCYNHLMZSRW-OAHLLOKOSA-N (2r)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoic acid Chemical compound COC1=CC(NC=2C3=C(O[C@H](C)C(O)=O)C=CC=C3N=CN=2)=CC=C1OC1=CC=C(C)N=C1 UHXLCYNHLMZSRW-OAHLLOKOSA-N 0.000 description 1
- XJHISJBSZUYOKF-MRXNPFEDSA-N (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 XJHISJBSZUYOKF-MRXNPFEDSA-N 0.000 description 1
- ODBSSWNSVZQHTQ-AWEZNQCLSA-N (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ODBSSWNSVZQHTQ-AWEZNQCLSA-N 0.000 description 1
- SHUGRJASNGVPQD-FQEVSTJZSA-N (2s)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxy-1-morpholin-4-ylpropan-1-one Chemical compound O([C@@H](C)C(=O)N1CCOCC1)C(C=12)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 SHUGRJASNGVPQD-FQEVSTJZSA-N 0.000 description 1
- XJHISJBSZUYOKF-INIZCTEOSA-N (2s)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoic acid Chemical compound C=12C(O[C@@H](C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 XJHISJBSZUYOKF-INIZCTEOSA-N 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- LLAPDLPYIYKTGQ-UHFFFAOYSA-N 1-aminoethyl Chemical group C[CH]N LLAPDLPYIYKTGQ-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- LDKSCZJUIURGMW-UHFFFAOYSA-N 1-isothiocyanato-3-methylsulfanylpropane Chemical group CSCCCN=C=S LDKSCZJUIURGMW-UHFFFAOYSA-N 0.000 description 1
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 1
- GXVUZYLYWKWJIM-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanamine Chemical compound NCCOCCN GXVUZYLYWKWJIM-UHFFFAOYSA-N 0.000 description 1
- AXOMOOKEPXCVET-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxy-2-methylpropanoic acid Chemical compound C=12C(OC(C)(C)C(O)=O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 AXOMOOKEPXCVET-UHFFFAOYSA-N 0.000 description 1
- KEWCVXBRUWXPSD-UHFFFAOYSA-N 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxyacetic acid Chemical compound C=12C(OCC(=O)O)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 KEWCVXBRUWXPSD-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- LQWQUKZCWUPLGW-UHFFFAOYSA-N 2-methyl-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoic acid Chemical compound C1=NC(C)=CC=C1OC(C(=C1)C)=CC=C1NC1=NC=NC2=CC=CC(OC(C)(C)C(O)=O)=C12 LQWQUKZCWUPLGW-UHFFFAOYSA-N 0.000 description 1
- RFUBUFMTVVQVSS-UHFFFAOYSA-N 2-methyl-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoic acid Chemical compound CC1=CC(NC=2C3=C(OC(C)(C)C(O)=O)C=CC=C3N=CN=2)=CC=C1OCC1=CC=CC=N1 RFUBUFMTVVQVSS-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- IITIZHOBOIBGBW-UHFFFAOYSA-N 3-ethyl-2h-1,3-benzothiazole Chemical compound C1=CC=C2N(CC)CSC2=C1 IITIZHOBOIBGBW-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- VQZRVPWIZFFSQD-UHFFFAOYSA-N 6h-quinazolin-5-one Chemical compound C1=NC=C2C(=O)CC=CC2=N1 VQZRVPWIZFFSQD-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 239000012103 Alexa Fluor 488 Substances 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 108091006146 Channels Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 102000018832 Cytochromes Human genes 0.000 description 1
- 108010052832 Cytochromes Proteins 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 239000006145 Eagle's minimal essential medium Substances 0.000 description 1
- 102000044591 ErbB-4 Receptor Human genes 0.000 description 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 1
- 102100029951 Estrogen receptor beta Human genes 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 108700024394 Exon Proteins 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 101001047090 Homo sapiens Potassium voltage-gated channel subfamily H member 2 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 108010052185 Myotonin-Protein Kinase Proteins 0.000 description 1
- 102000018658 Myotonin-Protein Kinase Human genes 0.000 description 1
- PVCJKHHOXFKFRP-UHFFFAOYSA-N N-acetylethanolamine Chemical compound CC(=O)NCCO PVCJKHHOXFKFRP-UHFFFAOYSA-N 0.000 description 1
- 208000002454 Nasopharyngeal Carcinoma Diseases 0.000 description 1
- 206010061306 Nasopharyngeal cancer Diseases 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 229920005439 Perspex® Polymers 0.000 description 1
- 108010001441 Phosphopeptides Proteins 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 229940124158 Protease/peptidase inhibitor Drugs 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 108010072960 Proto-Oncogene Proteins c-fyn Proteins 0.000 description 1
- 102000007131 Proto-Oncogene Proteins c-fyn Human genes 0.000 description 1
- 108010021833 Proto-Oncogene Proteins c-yes Proteins 0.000 description 1
- 229940127361 Receptor Tyrosine Kinase Inhibitors Drugs 0.000 description 1
- 101710100963 Receptor tyrosine-protein kinase erbB-4 Proteins 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 208000015634 Rectal Neoplasms Diseases 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 102100021788 Tyrosine-protein kinase Yes Human genes 0.000 description 1
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 1
- 108091008605 VEGF receptors Proteins 0.000 description 1
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 238000011481 absorbance measurement Methods 0.000 description 1
- 108010076089 accutase Proteins 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 208000009956 adenocarcinoma Diseases 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 239000012491 analyte Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 229940124650 anti-cancer therapies Drugs 0.000 description 1
- 238000011319 anticancer therapy Methods 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000012911 assay medium Substances 0.000 description 1
- OHDRQQURAXLVGJ-HLVWOLMTSA-N azane;(2e)-3-ethyl-2-[(e)-(3-ethyl-6-sulfo-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonic acid Chemical compound [NH4+].[NH4+].S/1C2=CC(S([O-])(=O)=O)=CC=C2N(CC)C\1=N/N=C1/SC2=CC(S([O-])(=O)=O)=CC=C2N1CC OHDRQQURAXLVGJ-HLVWOLMTSA-N 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000002146 bilateral effect Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229960000074 biopharmaceutical Drugs 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 208000035269 cancer or benign tumor Diseases 0.000 description 1
- 239000011545 carbonate/bicarbonate buffer Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000008568 cell cell communication Effects 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000012136 culture method Methods 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 125000004652 decahydroisoquinolinyl group Chemical group C1(NCCC2CCCCC12)* 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000002900 effect on cell Effects 0.000 description 1
- 230000007831 electrophysiology Effects 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 229940082789 erbitux Drugs 0.000 description 1
- 201000004101 esophageal cancer Diseases 0.000 description 1
- 229950002007 estradiol benzoate Drugs 0.000 description 1
- ZOSOBXDFALAPAI-UHFFFAOYSA-N ethyl 2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxyacetate Chemical compound C=12C(OCC(=O)OCC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZOSOBXDFALAPAI-UHFFFAOYSA-N 0.000 description 1
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 125000005290 ethynyloxy group Chemical group C(#C)O* 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 201000010536 head and neck cancer Diseases 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 229940022353 herceptin Drugs 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 238000010166 immunofluorescence Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000006662 intracellular pathway Effects 0.000 description 1
- 230000031146 intracellular signal transduction Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229940084651 iressa Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 210000005075 mammary gland Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VOKVQXLODBVDKS-MRXNPFEDSA-N methyl (2r)-2-[4-(3-methyl-4-pyridin-2-yloxyanilino)quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=CC=N1 VOKVQXLODBVDKS-MRXNPFEDSA-N 0.000 description 1
- ULFPNBOKLQPJGV-OAHLLOKOSA-N methyl (2r)-2-[4-[3-chloro-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OC1=CC=C(C)N=C1 ULFPNBOKLQPJGV-OAHLLOKOSA-N 0.000 description 1
- YHHUWJPCYHQTSV-OAHLLOKOSA-N methyl (2r)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 YHHUWJPCYHQTSV-OAHLLOKOSA-N 0.000 description 1
- ZYAQKSIEJHIWJO-MRXNPFEDSA-N methyl (2r)-2-[4-[3-methoxy-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1OC)=CC=C1OC1=CC=C(C)N=C1 ZYAQKSIEJHIWJO-MRXNPFEDSA-N 0.000 description 1
- NBDKYGHMFBTRLR-QGZVFWFLSA-N methyl (2r)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 NBDKYGHMFBTRLR-QGZVFWFLSA-N 0.000 description 1
- RWVBQNQYSPMONT-QGZVFWFLSA-N methyl (2r)-2-[4-[3-methyl-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OCC1=CC=CC=N1 RWVBQNQYSPMONT-QGZVFWFLSA-N 0.000 description 1
- YHHUWJPCYHQTSV-HNNXBMFYSA-N methyl (2s)-2-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 YHHUWJPCYHQTSV-HNNXBMFYSA-N 0.000 description 1
- NBDKYGHMFBTRLR-KRWDZBQOSA-N methyl (2s)-2-[4-[3-methyl-4-(6-methylpyridin-3-yl)oxyanilino]quinazolin-5-yl]oxypropanoate Chemical compound C=12C(O[C@@H](C)C(=O)OC)=CC=CC2=NC=NC=1NC(C=C1C)=CC=C1OC1=CC=C(C)N=C1 NBDKYGHMFBTRLR-KRWDZBQOSA-N 0.000 description 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 230000000394 mitotic effect Effects 0.000 description 1
- 230000037230 mobility Effects 0.000 description 1
- 239000003068 molecular probe Substances 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- AHLKSOXEVRYIRD-UHFFFAOYSA-N n-phenylquinazolin-2-amine Chemical group N=1C=C2C=CC=CC2=NC=1NC1=CC=CC=C1 AHLKSOXEVRYIRD-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 201000011216 nasopharynx carcinoma Diseases 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 210000004882 non-tumor cell Anatomy 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 125000005961 oxazepanyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N p-hydroxyphenylamine Natural products NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 238000012402 patch clamp technique Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 238000003566 phosphorylation assay Methods 0.000 description 1
- DCWXELXMIBXGTH-UHFFFAOYSA-N phosphotyrosine Chemical compound OC(=O)C(N)CC1=CC=C(OP(O)(O)=O)C=C1 DCWXELXMIBXGTH-UHFFFAOYSA-N 0.000 description 1
- 238000001782 photodegradation Methods 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000004574 piperidin-2-yl group Chemical group N1C(CCCC1)* 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 102000054765 polymorphisms of proteins Human genes 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000004393 prognosis Methods 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 125000004673 propylcarbonyl group Chemical group 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920005604 random copolymer Polymers 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 201000001275 rectum cancer Diseases 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000025053 regulation of cell proliferation Effects 0.000 description 1
- 230000008844 regulatory mechanism Effects 0.000 description 1
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 208000037803 restenosis Diseases 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 238000003118 sandwich ELISA Methods 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 235000020183 skimmed milk Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RZWQDAUIUBVCDD-UHFFFAOYSA-M sodium;benzenethiolate Chemical compound [Na+].[S-]C1=CC=CC=C1 RZWQDAUIUBVCDD-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000012353 t test Methods 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940120982 tarceva Drugs 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 102000027257 transmembrane receptors Human genes 0.000 description 1
- 108091008578 transmembrane receptors Proteins 0.000 description 1
- 229960000575 trastuzumab Drugs 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 231100000588 tumorigenic Toxicity 0.000 description 1
- 230000000381 tumorigenic effect Effects 0.000 description 1
- 231100000402 unacceptable toxicity Toxicity 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 239000002525 vasculotropin inhibitor Substances 0.000 description 1
- 230000035899 viability Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/78—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 2
- C07D239/84—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP04291393 | 2004-06-04 | ||
| EP04291393.9 | 2004-06-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20070038500A true KR20070038500A (ko) | 2007-04-10 |
Family
ID=34969245
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020077000221A Withdrawn KR20070038500A (ko) | 2004-06-04 | 2005-06-02 | erbB 수용체 타이로신 키나제로서의 퀴나졸린 유도체 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US20070232607A1 (https=) |
| EP (1) | EP1756088A1 (https=) |
| JP (1) | JP2008501675A (https=) |
| KR (1) | KR20070038500A (https=) |
| CN (1) | CN1993349A (https=) |
| AR (1) | AR049294A1 (https=) |
| AU (1) | AU2005250224A1 (https=) |
| BR (1) | BRPI0511741A (https=) |
| CA (1) | CA2567832A1 (https=) |
| IL (1) | IL179081A0 (https=) |
| MX (1) | MXPA06014125A (https=) |
| NO (1) | NO20066081L (https=) |
| TW (1) | TW200602328A (https=) |
| UY (1) | UY28940A1 (https=) |
| WO (1) | WO2005118572A1 (https=) |
| ZA (1) | ZA200609427B (https=) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2005515176A (ja) * | 2001-11-03 | 2005-05-26 | アストラゼネカ アクチボラグ | 抗腫瘍剤としてのキナゾリン誘導体 |
| GB0126433D0 (en) * | 2001-11-03 | 2002-01-02 | Astrazeneca Ab | Compounds |
| GB0309009D0 (en) * | 2003-04-22 | 2003-05-28 | Astrazeneca Ab | Quinazoline derivatives |
| GB0309850D0 (en) * | 2003-04-30 | 2003-06-04 | Astrazeneca Ab | Quinazoline derivatives |
| AU2004272346A1 (en) * | 2003-09-16 | 2005-03-24 | Astrazeneca Ab | Quinazoline derivatives |
| GB0321648D0 (en) * | 2003-09-16 | 2003-10-15 | Astrazeneca Ab | Quinazoline derivatives |
| ES2305844T3 (es) * | 2003-09-16 | 2008-11-01 | Astrazeneca Ab | Derivados de quinazolina como inhibidores de tirosina cinasa. |
| AU2004272345A1 (en) * | 2003-09-16 | 2005-03-24 | Astrazeneca Ab | Quinazoline derivatives |
| US20070032508A1 (en) * | 2003-09-16 | 2007-02-08 | Bradbury Robert H | Quinazoline derivatives as tyrosine kinase inhibitors |
| GB0322409D0 (en) * | 2003-09-25 | 2003-10-29 | Astrazeneca Ab | Quinazoline derivatives |
| GB0326459D0 (en) * | 2003-11-13 | 2003-12-17 | Astrazeneca Ab | Quinazoline derivatives |
| JP5032851B2 (ja) * | 2004-02-03 | 2012-09-26 | アストラゼネカ アクチボラグ | キナゾリン誘導体 |
| EP1838712B8 (en) * | 2004-12-14 | 2011-10-12 | AstraZeneca AB | Pyrazolopyrimidine compounds as antitumor agents |
| GB0504474D0 (en) * | 2005-03-04 | 2005-04-13 | Astrazeneca Ab | Chemical compounds |
| GB0508717D0 (en) * | 2005-04-29 | 2005-06-08 | Astrazeneca Ab | Chemical compounds |
| GB0508715D0 (en) * | 2005-04-29 | 2005-06-08 | Astrazeneca Ab | Chemical compounds |
| JP2009508917A (ja) * | 2005-09-20 | 2009-03-05 | アストラゼネカ アクチボラグ | 抗癌剤としてのキナゾリン誘導体 |
| WO2007034144A1 (en) * | 2005-09-20 | 2007-03-29 | Astrazeneca Ab | 4- (ih-indazol-s-yl-amino)-quinazoline compounds as erbb receptor tyrosine kinase inhibitors for the treatment of cancer |
| JP2009517450A (ja) * | 2005-12-02 | 2009-04-30 | アストラゼネカ アクチボラグ | チロシンキナーゼ阻害薬としての4−アニリノ置換キナゾリン誘導体 |
| JP2009517451A (ja) * | 2005-12-02 | 2009-04-30 | アストラゼネカ アクチボラグ | Erbbチロシンキナーゼの阻害剤として使用されるキナゾリン誘導体 |
| PE20080359A1 (es) | 2006-04-19 | 2008-06-06 | Novartis Ag | Compuestos de benzoxazol y benzotiazol 6-0-sustituidos y metodos de inhibicion de la senalizacion de csf-1r |
| WO2008041118A2 (en) | 2006-10-04 | 2008-04-10 | Pfizer Products Inc. | Pyrido[4,3-d]pyrimidin-4(3h)-one derivatives as calcium receptor antagonists |
| EP2174938A1 (en) * | 2006-10-12 | 2010-04-14 | SuperGen, Inc. | Quinoline derivatives for modulating DNA methylation |
| US7776857B2 (en) | 2007-04-05 | 2010-08-17 | Amgen Inc. | Aurora kinase modulators and method of use |
| US7939546B2 (en) | 2007-10-12 | 2011-05-10 | Supergen, Inc. | Quinoline derivatives for modulating DNA methylation |
| US7790746B2 (en) | 2007-10-12 | 2010-09-07 | Supergen, Inc. | Quinoline derivatives for modulating DNA methylation |
| ES2413806T3 (es) | 2008-03-20 | 2013-07-17 | Amgen Inc. | Moduladores de la aurora cinasa y método de uso |
| US9126935B2 (en) | 2008-08-14 | 2015-09-08 | Amgen Inc. | Aurora kinase modulators and methods of use |
| CN105503835B (zh) * | 2015-12-03 | 2018-04-24 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1510及其制备方法和应用 |
| CN105503836B (zh) * | 2015-12-03 | 2018-04-24 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1502及其制备方法和应用 |
| CN105399733B (zh) * | 2015-12-03 | 2018-04-24 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1504及其制备方法和应用 |
| CN105541807B (zh) * | 2015-12-03 | 2018-04-24 | 中国人民解放军南京军区南京总医院 | 一种新型喹唑啉衍生物lu1506及其制备方法和应用 |
| CN106366020B (zh) * | 2016-08-31 | 2018-12-11 | 京博农化科技股份有限公司 | 一种合成手性稻瘟酰胺的方法 |
| CA3112043A1 (en) | 2018-09-10 | 2020-03-19 | Mirati Therapeutics, Inc. | Combination therapies |
Family Cites Families (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5538325A (en) * | 1978-09-11 | 1980-03-17 | Sankyo Co Ltd | 4-anilinoquinazoline derivative and its preparation |
| US4335127A (en) * | 1979-01-08 | 1982-06-15 | Janssen Pharmaceutica, N.V. | Piperidinylalkyl quinazoline compounds, composition and method of use |
| GB2160201B (en) * | 1984-06-14 | 1988-05-11 | Wyeth John & Brother Ltd | Quinazoline and cinnoline derivatives |
| US4921863A (en) * | 1988-02-17 | 1990-05-01 | Eisai Co., Ltd. | Cyclic amine derivatives |
| CA1340821C (en) * | 1988-10-06 | 1999-11-16 | Nobuyuki Fukazawa | Heterocyclic compounds and anticancer-drug reinforcing agents containing them as effective components |
| US5721237A (en) * | 1991-05-10 | 1998-02-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Protein tyrosine kinase aryl and heteroaryl quinazoline compounds having selective inhibition of HER-2 autophosphorylation properties |
| GB9510757D0 (en) * | 1994-09-19 | 1995-07-19 | Wellcome Found | Therapeuticaly active compounds |
| US5747498A (en) * | 1996-05-28 | 1998-05-05 | Pfizer Inc. | Alkynyl and azido-substituted 4-anilinoquinazolines |
| US6046206A (en) * | 1995-06-07 | 2000-04-04 | Cell Pathways, Inc. | Method of treating a patient having a precancerous lesions with amide quinazoline derivatives |
| GB9514265D0 (en) * | 1995-07-13 | 1995-09-13 | Wellcome Found | Hetrocyclic compounds |
| GB9624482D0 (en) * | 1995-12-18 | 1997-01-15 | Zeneca Phaema S A | Chemical compounds |
| KR100517060B1 (ko) * | 1996-01-31 | 2006-05-25 | 코스모페름 베.파우 | 안정화된생물학적유효화합물로이루어지는조성물의사용 |
| US6004967A (en) * | 1996-09-13 | 1999-12-21 | Sugen, Inc. | Psoriasis treatment with quinazoline compounds |
| US5929080A (en) * | 1997-05-06 | 1999-07-27 | American Cyanamid Company | Method of treating polycystic kidney disease |
| US6384223B1 (en) * | 1998-07-30 | 2002-05-07 | American Home Products Corporation | Substituted quinazoline derivatives |
| US6297258B1 (en) * | 1998-09-29 | 2001-10-02 | American Cyanamid Company | Substituted 3-cyanoquinolines |
| UA71945C2 (en) * | 1999-01-27 | 2005-01-17 | Pfizer Prod Inc | Substituted bicyclic derivatives being used as anticancer agents |
| TR200102505T2 (tr) * | 1999-02-27 | 2003-01-21 | Boehringer Ingelheim Pharma Kg | 4-amino-kinazolin ve kinolin türevleri. |
| US6080747A (en) * | 1999-03-05 | 2000-06-27 | Hughes Institute | JAK-3 inhibitors for treating allergic disorders |
| UA73993C2 (uk) * | 2000-06-06 | 2005-10-17 | Астразенека Аб | Хіназолінові похідні для лікування пухлин та фармацевтична композиція |
| US20020082270A1 (en) * | 2000-08-26 | 2002-06-27 | Frank Himmelsbach | Aminoquinazolines which inhibit signal transduction mediated by tyrosine kinases |
| US6562319B2 (en) * | 2001-03-12 | 2003-05-13 | Yissum Research Development Company Of The Hebrew University Of Jerusalem | Radiolabeled irreversible inhibitors of epidermal growth factor receptor tyrosine kinase and their use in radioimaging and radiotherapy |
| JPWO2002094790A1 (ja) * | 2001-05-23 | 2004-09-09 | 三菱ウェルファーマ株式会社 | 縮合ヘテロ環化合物およびその医薬用途 |
| JP2005515176A (ja) * | 2001-11-03 | 2005-05-26 | アストラゼネカ アクチボラグ | 抗腫瘍剤としてのキナゾリン誘導体 |
| GB0126433D0 (en) * | 2001-11-03 | 2002-01-02 | Astrazeneca Ab | Compounds |
| TWI324597B (en) * | 2002-03-28 | 2010-05-11 | Astrazeneca Ab | Quinazoline derivatives |
| US6924285B2 (en) * | 2002-03-30 | 2005-08-02 | Boehringer Ingelheim Pharma Gmbh & Co. | Bicyclic heterocyclic compounds, pharmaceutical compositions containing these compounds, their use and process for preparing them |
| GB0309009D0 (en) * | 2003-04-22 | 2003-05-28 | Astrazeneca Ab | Quinazoline derivatives |
| GB0309850D0 (en) * | 2003-04-30 | 2003-06-04 | Astrazeneca Ab | Quinazoline derivatives |
| JP2007500177A (ja) * | 2003-07-29 | 2007-01-11 | アストラゼネカ アクチボラグ | チロシンキナーゼ阻害剤としてのピペリジルキナゾリン誘導体 |
| GB0317665D0 (en) * | 2003-07-29 | 2003-09-03 | Astrazeneca Ab | Qinazoline derivatives |
| ES2305844T3 (es) * | 2003-09-16 | 2008-11-01 | Astrazeneca Ab | Derivados de quinazolina como inhibidores de tirosina cinasa. |
| AU2004272346A1 (en) * | 2003-09-16 | 2005-03-24 | Astrazeneca Ab | Quinazoline derivatives |
| US20070032508A1 (en) * | 2003-09-16 | 2007-02-08 | Bradbury Robert H | Quinazoline derivatives as tyrosine kinase inhibitors |
| GB0321648D0 (en) * | 2003-09-16 | 2003-10-15 | Astrazeneca Ab | Quinazoline derivatives |
| CN1882570B (zh) * | 2003-09-19 | 2010-12-08 | 阿斯利康(瑞典)有限公司 | 喹唑啉衍生物 |
| GB0322409D0 (en) * | 2003-09-25 | 2003-10-29 | Astrazeneca Ab | Quinazoline derivatives |
| KR20060100388A (ko) * | 2003-09-25 | 2006-09-20 | 아스트라제네카 아베 | 퀴나졸린 유도체 |
| GB0326459D0 (en) * | 2003-11-13 | 2003-12-17 | Astrazeneca Ab | Quinazoline derivatives |
| JP5032851B2 (ja) * | 2004-02-03 | 2012-09-26 | アストラゼネカ アクチボラグ | キナゾリン誘導体 |
-
2005
- 2005-06-02 AU AU2005250224A patent/AU2005250224A1/en not_active Abandoned
- 2005-06-02 KR KR1020077000221A patent/KR20070038500A/ko not_active Withdrawn
- 2005-06-02 US US11/628,011 patent/US20070232607A1/en not_active Abandoned
- 2005-06-02 WO PCT/GB2005/002215 patent/WO2005118572A1/en not_active Ceased
- 2005-06-02 MX MXPA06014125A patent/MXPA06014125A/es not_active Application Discontinuation
- 2005-06-02 CA CA002567832A patent/CA2567832A1/en not_active Abandoned
- 2005-06-02 CN CNA200580025966XA patent/CN1993349A/zh active Pending
- 2005-06-02 BR BRPI0511741-0A patent/BRPI0511741A/pt not_active IP Right Cessation
- 2005-06-02 EP EP05747243A patent/EP1756088A1/en not_active Withdrawn
- 2005-06-02 JP JP2007514135A patent/JP2008501675A/ja active Pending
- 2005-06-03 TW TW094118285A patent/TW200602328A/zh unknown
- 2005-06-03 UY UY28940A patent/UY28940A1/es not_active Application Discontinuation
- 2005-06-06 AR ARP050102306A patent/AR049294A1/es unknown
-
2006
- 2006-11-06 IL IL179081A patent/IL179081A0/en unknown
- 2006-11-13 ZA ZA200609427A patent/ZA200609427B/xx unknown
- 2006-12-29 NO NO20066081A patent/NO20066081L/no not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US20070232607A1 (en) | 2007-10-04 |
| AU2005250224A1 (en) | 2005-12-15 |
| CN1993349A (zh) | 2007-07-04 |
| JP2008501675A (ja) | 2008-01-24 |
| MXPA06014125A (es) | 2007-01-31 |
| NO20066081L (no) | 2007-02-20 |
| BRPI0511741A (pt) | 2008-01-02 |
| WO2005118572A1 (en) | 2005-12-15 |
| TW200602328A (en) | 2006-01-16 |
| CA2567832A1 (en) | 2005-12-15 |
| AR049294A1 (es) | 2006-07-12 |
| IL179081A0 (en) | 2007-03-08 |
| EP1756088A1 (en) | 2007-02-28 |
| UY28940A1 (es) | 2006-01-31 |
| ZA200609427B (en) | 2008-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20070038500A (ko) | erbB 수용체 타이로신 키나제로서의 퀴나졸린 유도체 | |
| US20070032508A1 (en) | Quinazoline derivatives as tyrosine kinase inhibitors | |
| US7632840B2 (en) | Quinazoline compounds for the treatment of hyperproliferative disorders | |
| US20070015743A1 (en) | Quinazoline derivatives as antitumor agents | |
| US7625908B2 (en) | Quinazoline derivatives | |
| KR20050042055A (ko) | 항종양제로서의 퀴나졸린 유도체 | |
| KR20070027487A (ko) | 퀴나졸린 유도체 | |
| EP1838712B1 (en) | Pyrazolopyrimidine compounds as antitumor agents | |
| CN101171245A (zh) | 抗肿瘤药吲哚氨基喹唑啉衍生物 | |
| JP2009508917A (ja) | 抗癌剤としてのキナゾリン誘導体 | |
| ES2361032T3 (es) | Compuestos de pirazolopirimidina como agentes antitumorales. | |
| KR20070023630A (ko) | 티로신 키나제 억제제로서의 퀴나졸린 유도체 | |
| HK1112462B (en) | Pyrazolopyrimidine compounds as antitumor agents | |
| HK1095590B (en) | Quinazoline derivatives | |
| KR20070023629A (ko) | 항종양제로서의 퀴나졸린 유도체 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20070104 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| PC1203 | Withdrawal of no request for examination | ||
| WITN | Application deemed withdrawn, e.g. because no request for examination was filed or no examination fee was paid |