KR20010014369A - 유로키나제 억제제 - Google Patents
유로키나제 억제제 Download PDFInfo
- Publication number
- KR20010014369A KR20010014369A KR1019997012528A KR19997012528A KR20010014369A KR 20010014369 A KR20010014369 A KR 20010014369A KR 1019997012528 A KR1019997012528 A KR 1019997012528A KR 19997012528 A KR19997012528 A KR 19997012528A KR 20010014369 A KR20010014369 A KR 20010014369A
- Authority
- KR
- South Korea
- Prior art keywords
- salt
- trifluoroacetate
- mono
- aminoiminomethyl
- naphthalenyl
- Prior art date
Links
- 239000002797 plasminogen activator inhibitor Substances 0.000 title abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 413
- 238000000034 method Methods 0.000 claims abstract description 220
- 239000000203 mixture Substances 0.000 claims abstract description 76
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims abstract description 15
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims abstract description 14
- 229960005356 urokinase Drugs 0.000 claims abstract description 11
- 230000005764 inhibitory process Effects 0.000 claims abstract description 7
- 241000124008 Mammalia Species 0.000 claims abstract description 4
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical class OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 487
- -1 2-hydroxyethoxy Chemical group 0.000 claims description 305
- 125000004432 carbon atom Chemical group C* 0.000 claims description 229
- 125000000217 alkyl group Chemical group 0.000 claims description 100
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 82
- 125000002947 alkylene group Chemical group 0.000 claims description 79
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 73
- 125000003118 aryl group Chemical group 0.000 claims description 54
- 229910052739 hydrogen Inorganic materials 0.000 claims description 54
- 239000001257 hydrogen Substances 0.000 claims description 53
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 47
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 47
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 45
- 125000000623 heterocyclic group Chemical group 0.000 claims description 45
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 44
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 39
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 37
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 32
- HCSHUEPPBIJJCB-UHFFFAOYSA-N carbamic acid;2,2,2-trifluoroacetic acid Chemical compound NC(O)=O.OC(=O)C(F)(F)F HCSHUEPPBIJJCB-UHFFFAOYSA-N 0.000 claims description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 20
- 125000003342 alkenyl group Chemical group 0.000 claims description 20
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 20
- 125000000304 alkynyl group Chemical group 0.000 claims description 16
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 13
- XCJLXFIGEMUOEE-UHFFFAOYSA-N acetamide;2,2,2-trifluoroacetic acid Chemical compound CC(N)=O.OC(=O)C(F)(F)F XCJLXFIGEMUOEE-UHFFFAOYSA-N 0.000 claims description 13
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 13
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims description 10
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 10
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 9
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 9
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 6
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 6
- XTIHVCQVRXHANI-UHFFFAOYSA-N (7-methoxy-8-prop-2-enoxynaphthalen-2-yl)methylidenehydrazine;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(C=NN)=CC2=C(OCC=C)C(OC)=CC=C21 XTIHVCQVRXHANI-UHFFFAOYSA-N 0.000 claims description 5
- ZLKAMNOYAQQCFP-UHFFFAOYSA-N 3-(7-methanehydrazonoyl-2-methoxynaphthalen-1-yl)oxypropan-1-ol;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(C=NN)=CC2=C(OCCCO)C(OC)=CC=C21 ZLKAMNOYAQQCFP-UHFFFAOYSA-N 0.000 claims description 5
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- WTTGZGRJCNKTTD-UHFFFAOYSA-N 4-(7-methanehydrazonoyl-2-methoxynaphthalen-1-yl)oxolan-2-one;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.COC1=CC=C2C=CC(C=NN)=CC2=C1C1COC(=O)C1 WTTGZGRJCNKTTD-UHFFFAOYSA-N 0.000 claims description 5
- 239000007983 Tris buffer Substances 0.000 claims description 5
- WSVATSVJOIPBPQ-UHFFFAOYSA-N [7-methoxy-8-(3-phenylpropoxy)naphthalen-2-yl]methylidenehydrazine;hydrochloride Chemical compound Cl.COC1=CC=C2C=CC(C=NN)=CC2=C1OCCCC1=CC=CC=C1 WSVATSVJOIPBPQ-UHFFFAOYSA-N 0.000 claims description 5
- WKVXOYXBUUHHLG-UHFFFAOYSA-N [8-(3-bromopropoxy)-7-methoxynaphthalen-2-yl]methylidenehydrazine;hydrochloride Chemical compound Cl.C1=CC(C=NN)=CC2=C(OCCCBr)C(OC)=CC=C21 WKVXOYXBUUHHLG-UHFFFAOYSA-N 0.000 claims description 5
- PAAZCQANMCYGAW-UHFFFAOYSA-N acetic acid;2,2,2-trifluoroacetic acid Chemical compound CC(O)=O.OC(=O)C(F)(F)F PAAZCQANMCYGAW-UHFFFAOYSA-N 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims description 5
- ZTDZEZYDHIKFBR-UHFFFAOYSA-N methyl 6-methanehydrazonoyl-4-(methoxycarbonylamino)naphthalene-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C(C=NN)C=C2C(NC(=O)OC)=CC(C(=O)OC)=CC2=C1 ZTDZEZYDHIKFBR-UHFFFAOYSA-N 0.000 claims description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 5
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 5
- WFQLDQZUUJUXQS-UHFFFAOYSA-N 1-(6-methanehydrazonoylnaphthalen-2-yl)-3-propan-2-ylurea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C(C=NN)C=CC2=CC(NC(=O)NC(C)C)=CC=C21 WFQLDQZUUJUXQS-UHFFFAOYSA-N 0.000 claims description 4
- HNAWACFBQYQKEC-UHFFFAOYSA-N 1-benzyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC2=CC(C=NN)=CC=C2C=C1NC(=O)NCC1=CC=CC=C1 HNAWACFBQYQKEC-UHFFFAOYSA-N 0.000 claims description 4
- DSCIZZBKVVQDOS-UHFFFAOYSA-N 1-cyclohexyl-3-(6-methanehydrazonoylnaphthalen-2-yl)urea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC2=CC(C=NN)=CC=C2C=C1NC(=O)NC1CCCCC1 DSCIZZBKVVQDOS-UHFFFAOYSA-N 0.000 claims description 4
- CQVKMVQRSNNAGO-UHFFFAOYSA-N 2-[4-formyl-3-methyl-n-(2-methylsulfonyloxyethyl)anilino]ethyl methanesulfonate Chemical class CC1=CC(N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)=CC=C1C=O CQVKMVQRSNNAGO-UHFFFAOYSA-N 0.000 claims description 4
- RZPQCZFTOKCPBO-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-(1h-pyrazol-5-yl)naphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2NN=CC=2)C=C1C=1C=COC=1 RZPQCZFTOKCPBO-UHFFFAOYSA-N 0.000 claims description 4
- UQIYBAFKTUYKRK-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC(=CC=2)C(F)(F)F)C=C1C=1C=COC=1 UQIYBAFKTUYKRK-UHFFFAOYSA-N 0.000 claims description 4
- KMHIDPUCWONCQT-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-phenylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC=CC=2)C=C1C=1C=COC=1 KMHIDPUCWONCQT-UHFFFAOYSA-N 0.000 claims description 4
- KIJACPZCGISLPN-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-pyridin-2-ylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2N=CC=CC=2)C=C1C=1C=COC=1 KIJACPZCGISLPN-UHFFFAOYSA-N 0.000 claims description 4
- BMOMXUZUTIVJML-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-pyridin-3-ylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=NC=CC=2)C=C1C=1C=COC=1 BMOMXUZUTIVJML-UHFFFAOYSA-N 0.000 claims description 4
- UYBIQUIIJUGJQQ-UHFFFAOYSA-N 4-(furan-3-yl)-6-methanehydrazonoyl-n-pyridin-4-ylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CN=CC=2)C=C1C=1C=COC=1 UYBIQUIIJUGJQQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- FAUMPMCJSGVOIQ-UHFFFAOYSA-N 5-(6-methanehydrazonoylnaphthalen-2-yl)oxypentanoic acid Chemical compound C1=C(OCCCCC(O)=O)C=CC2=CC(C=NN)=CC=C21 FAUMPMCJSGVOIQ-UHFFFAOYSA-N 0.000 claims description 4
- AOJOIBZOEOTKOK-UHFFFAOYSA-N FC(C(=O)O)(F)F.NN=CC=1C=C2C=CC(=CC2=CC=1)NC(=O)NOCC1=CC=CC=C1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C2C=CC(=CC2=CC=1)NC(=O)NOCC1=CC=CC=C1 AOJOIBZOEOTKOK-UHFFFAOYSA-N 0.000 claims description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical class [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims description 4
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- BDDWLYOZNHREES-UHFFFAOYSA-N methyl 3-[(7-methanehydrazonoylnaphthalen-1-yl)amino]-3-oxopropanoate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C(C=NN)C=C2C(NC(=O)CC(=O)OC)=CC=CC2=C1 BDDWLYOZNHREES-UHFFFAOYSA-N 0.000 claims description 4
- UHQVFNVYADXFIG-UHFFFAOYSA-N n-(7-methanehydrazonoylnaphthalen-1-yl)-1,3-benzodioxole-5-carboxamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C2OCOC2=CC(C(=O)NC2=CC=CC3=CC=C(C=C32)C=NN)=C1 UHQVFNVYADXFIG-UHFFFAOYSA-N 0.000 claims description 4
- XYOHXGZGVSBZFV-UHFFFAOYSA-N n-(7-methanehydrazonoylnaphthalen-1-yl)-1-phenylmethanesulfonamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C12=CC(C=NN)=CC=C2C=CC=C1NS(=O)(=O)CC1=CC=CC=C1 XYOHXGZGVSBZFV-UHFFFAOYSA-N 0.000 claims description 4
- MUFGHUSILDXRLR-UHFFFAOYSA-N n-[4-(aminomethyl)phenyl]-6-methanehydrazonoyl-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide Chemical compound C1=CC(CN)=CC=C1NC(=O)C1=CC(NC=2N=CC=CN=2)=C(C=C(C=NN)C=C2)C2=C1 MUFGHUSILDXRLR-UHFFFAOYSA-N 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- UMSVPCYSAUKCAZ-UHFFFAOYSA-N propane;hydrochloride Chemical compound Cl.CCC UMSVPCYSAUKCAZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- VHHODAGHZBQVSI-UHFFFAOYSA-N (7-methanehydrazonoylnaphthalen-1-yl)urea Chemical compound C1=CC=C(NC(N)=O)C2=CC(C=NN)=CC=C21 VHHODAGHZBQVSI-UHFFFAOYSA-N 0.000 claims description 3
- HEJYQELZHYVLPR-UHFFFAOYSA-N 1-(7-methanehydrazonoylnaphthalen-1-yl)-3-methylurea Chemical compound C1=C(C=NN)C=C2C(NC(=O)NC)=CC=CC2=C1 HEJYQELZHYVLPR-UHFFFAOYSA-N 0.000 claims description 3
- QIVKNOGLWZEDDP-UHFFFAOYSA-N 2-hydroxy-n-(7-methanehydrazonoylnaphthalen-1-yl)acetamide Chemical compound C1=CC=C(NC(=O)CO)C2=CC(C=NN)=CC=C21 QIVKNOGLWZEDDP-UHFFFAOYSA-N 0.000 claims description 3
- AYQPSMIQIORBCR-UHFFFAOYSA-N 3-(6-methanehydrazonoylnaphthalen-2-yl)-1-methyl-1-phenylurea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C=1C=C2C=C(C=NN)C=CC2=CC=1NC(=O)N(C)C1=CC=CC=C1 AYQPSMIQIORBCR-UHFFFAOYSA-N 0.000 claims description 3
- HJTVIWJNQYUICD-UHFFFAOYSA-N 4-[[7-methanehydrazonoyl-1-(pyrimidin-2-ylamino)naphthalen-2-yl]oxymethyl]benzoic acid Chemical compound N=1C=CC=NC=1NC=1C2=CC(C=NN)=CC=C2C=CC=1OCC1=CC=C(C(O)=O)C=C1 HJTVIWJNQYUICD-UHFFFAOYSA-N 0.000 claims description 3
- QCZZIFSYYMYJGO-UHFFFAOYSA-N 6-methanehydrazonoyl-4-(1-methylsulfonylpyrazol-4-yl)-n-phenylnaphthalene-2-carboxamide Chemical compound C1=NN(S(=O)(=O)C)C=C1C1=CC(C(=O)NC=2C=CC=CC=2)=CC2=CC=C(C=NN)C=C12 QCZZIFSYYMYJGO-UHFFFAOYSA-N 0.000 claims description 3
- QEPZBBLDWGNERQ-UHFFFAOYSA-N 6-methanehydrazonoyl-4-(oxolan-3-yl)-n-phenylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC=CC=2)C=C1C1CCOC1 QEPZBBLDWGNERQ-UHFFFAOYSA-N 0.000 claims description 3
- VWNOTMQDKWOKOV-UHFFFAOYSA-N 6-methanehydrazonoyl-n-phenyl-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC=CC=2)C=C1NC1=NC=CC=N1 VWNOTMQDKWOKOV-UHFFFAOYSA-N 0.000 claims description 3
- ZORXQIRZKAIZNR-UHFFFAOYSA-N N-(7-methanehydrazonoylnaphthalen-1-yl)propanamide Chemical compound C1=C(C=NN)C=C2C(NC(=O)CC)=CC=CC2=C1 ZORXQIRZKAIZNR-UHFFFAOYSA-N 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 3
- LGAMMXOQEBFTJM-UHFFFAOYSA-N n-(7-methanehydrazonoylnaphthalen-1-yl)-2-methoxyacetamide Chemical compound C1=C(C=NN)C=C2C(NC(=O)COC)=CC=CC2=C1 LGAMMXOQEBFTJM-UHFFFAOYSA-N 0.000 claims description 3
- VEGPWFAUVNNGEZ-UHFFFAOYSA-N n-[4-(hydroxymethyl)phenyl]-6-methanehydrazonoyl-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC(CO)=CC=2)C=C1NC1=NC=CC=N1 VEGPWFAUVNNGEZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000005493 quinolyl group Chemical group 0.000 claims description 3
- 125000000586 2-(4-morpholinyl)ethoxy group Chemical group [H]C([H])(O*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- XPZGCMZNGLIJMH-UHFFFAOYSA-N 2-(6-methanehydrazonoylnaphthalen-2-yl)oxyacetic acid Chemical compound C1=C(OCC(O)=O)C=CC2=CC(C=NN)=CC=C21 XPZGCMZNGLIJMH-UHFFFAOYSA-N 0.000 claims description 2
- ZQEOKSZEICUDMV-UHFFFAOYSA-N 4-(5-ethylsulfanylfuran-3-yl)-6-methanehydrazonoyl-n-phenylnaphthalene-2-carboxamide Chemical compound O1C(SCC)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 ZQEOKSZEICUDMV-UHFFFAOYSA-N 0.000 claims description 2
- NPVYQNNGPMZHJS-UHFFFAOYSA-N 4-(5-ethylsulfanyloxolan-3-yl)-6-methanehydrazonoyl-n-phenylnaphthalene-2-carboxamide Chemical compound C1OC(SCC)CC1C1=CC(C(=O)NC=2C=CC=CC=2)=CC2=CC=C(C=NN)C=C12 NPVYQNNGPMZHJS-UHFFFAOYSA-N 0.000 claims description 2
- UVRKTQYXPIILCM-UHFFFAOYSA-N 6-(n'-hydroxycarbamimidoyl)-n-phenyl-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide Chemical compound C12=CC(C(=NO)N)=CC=C2C=C(C(=O)NC=2C=CC=CC=2)C=C1NC1=NC=CC=N1 UVRKTQYXPIILCM-UHFFFAOYSA-N 0.000 claims description 2
- WAGIJTNCWWGNLK-UHFFFAOYSA-N 6-methanehydrazonoyl-4-(5-methylsulfonylfuran-3-yl)-n-phenylnaphthalene-2-carboxamide Chemical compound O1C(S(=O)(=O)C)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 WAGIJTNCWWGNLK-UHFFFAOYSA-N 0.000 claims description 2
- PKDBUFCNUHPYET-UHFFFAOYSA-N 6-methanehydrazonoyl-4-[5-(methoxymethyl)furan-3-yl]-n-phenylnaphthalene-2-carboxamide Chemical compound O1C(COC)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 PKDBUFCNUHPYET-UHFFFAOYSA-N 0.000 claims description 2
- KFCJHDWNLRCWAU-UHFFFAOYSA-N 6-methanehydrazonoyl-n-phenyl-4-(5-propylsulfanylfuran-3-yl)naphthalene-2-carboxamide Chemical compound O1C(SCCC)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 KFCJHDWNLRCWAU-UHFFFAOYSA-N 0.000 claims description 2
- HIVCWELAPNFYRW-UHFFFAOYSA-N 6-methanehydrazonoyl-n-phenyl-4-(5-propylsulfonylfuran-3-yl)naphthalene-2-carboxamide Chemical compound O1C(S(=O)(=O)CCC)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 HIVCWELAPNFYRW-UHFFFAOYSA-N 0.000 claims description 2
- AHFHTUVEHKLUNW-UHFFFAOYSA-N 6-methanehydrazonoyl-n-phenyl-4-pyrrolidin-2-ylnaphthalene-2-carboxamide Chemical compound C12=CC(C=NN)=CC=C2C=C(C(=O)NC=2C=CC=CC=2)C=C1C1CCCN1 AHFHTUVEHKLUNW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 239000001294 propane Substances 0.000 claims description 2
- KHKBTFBPMAIWCS-UHFFFAOYSA-N CCCCC(O)=O.OC(=O)C(F)(F)F Chemical compound CCCCC(O)=O.OC(=O)C(F)(F)F KHKBTFBPMAIWCS-UHFFFAOYSA-N 0.000 claims 1
- ICQMZIWOQSJVFD-UHFFFAOYSA-N n-[4-(aminomethyl)phenyl]-6-(n'-hydroxycarbamimidoyl)-4-(pyrimidin-2-ylamino)naphthalene-2-carboxamide Chemical compound C1=CC(CN)=CC=C1NC(=O)C1=CC(NC=2N=CC=CN=2)=C(C=C(C=C2)C(N)=NO)C2=C1 ICQMZIWOQSJVFD-UHFFFAOYSA-N 0.000 claims 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical class CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 claims 1
- 201000010099 disease Diseases 0.000 abstract description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 380
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 202
- 238000000921 elemental analysis Methods 0.000 description 158
- 238000005481 NMR spectroscopy Methods 0.000 description 156
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 150
- 239000000243 solution Substances 0.000 description 136
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 135
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 125
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 122
- 239000000047 product Substances 0.000 description 121
- 239000007787 solid Substances 0.000 description 121
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 111
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 61
- 238000006243 chemical reaction Methods 0.000 description 60
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 57
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 55
- 239000012267 brine Substances 0.000 description 54
- 239000000284 extract Substances 0.000 description 52
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 47
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 47
- 239000000741 silica gel Substances 0.000 description 47
- 229910002027 silica gel Inorganic materials 0.000 description 47
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 47
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 44
- 239000011541 reaction mixture Substances 0.000 description 41
- 239000011734 sodium Substances 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 38
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 34
- 239000002904 solvent Substances 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- 238000003756 stirring Methods 0.000 description 30
- 239000000725 suspension Substances 0.000 description 29
- 239000003921 oil Substances 0.000 description 26
- 235000019198 oils Nutrition 0.000 description 26
- 238000005160 1H NMR spectroscopy Methods 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 22
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 22
- 229920006395 saturated elastomer Polymers 0.000 description 22
- 239000003480 eluent Substances 0.000 description 21
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- 239000000843 powder Substances 0.000 description 20
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 239000000463 material Substances 0.000 description 18
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 17
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 15
- 239000000758 substrate Substances 0.000 description 15
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 14
- 229910004298 SiO 2 Inorganic materials 0.000 description 14
- 239000002585 base Substances 0.000 description 14
- 239000012044 organic layer Substances 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 13
- 238000000746 purification Methods 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 12
- 125000003545 alkoxy group Chemical group 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 11
- 238000004587 chromatography analysis Methods 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 11
- 235000019341 magnesium sulphate Nutrition 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000002002 slurry Substances 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 125000004103 aminoalkyl group Chemical group 0.000 description 10
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 10
- 239000012141 concentrate Substances 0.000 description 10
- 235000008504 concentrate Nutrition 0.000 description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 10
- 150000002825 nitriles Chemical class 0.000 description 10
- 239000011780 sodium chloride Substances 0.000 description 10
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 10
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 9
- 239000000872 buffer Substances 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 229940079593 drug Drugs 0.000 description 9
- 239000003814 drug Substances 0.000 description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 9
- 239000008194 pharmaceutical composition Substances 0.000 description 9
- 125000005309 thioalkoxy group Chemical group 0.000 description 9
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 8
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 8
- VLVCDUSVTXIWGW-UHFFFAOYSA-N 4-iodoaniline Chemical compound NC1=CC=C(I)C=C1 VLVCDUSVTXIWGW-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 8
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 7
- 239000005695 Ammonium acetate Substances 0.000 description 7
- 229940043376 ammonium acetate Drugs 0.000 description 7
- 235000019257 ammonium acetate Nutrition 0.000 description 7
- 238000003556 assay Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 239000002502 liposome Substances 0.000 description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 description 7
- 229910052763 palladium Inorganic materials 0.000 description 7
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 7
- 239000000546 pharmaceutical excipient Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- 239000006196 drop Substances 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 229920001774 Perfluoroether Polymers 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 159000000021 acetate salts Chemical class 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 5
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 description 5
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 5
- 125000004104 aryloxy group Chemical group 0.000 description 5
- 125000005335 azido alkyl group Chemical group 0.000 description 5
- 125000001589 carboacyl group Chemical group 0.000 description 5
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 5
- 125000000000 cycloalkoxy group Chemical group 0.000 description 5
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001188 haloalkyl group Chemical group 0.000 description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 5
- 125000004971 nitroalkyl group Chemical group 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 239000000651 prodrug Substances 0.000 description 5
- 229940002612 prodrug Drugs 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 210000001519 tissue Anatomy 0.000 description 5
- JIVGSHFYXPRRSZ-UHFFFAOYSA-N 2,3-dimethoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1OC JIVGSHFYXPRRSZ-UHFFFAOYSA-N 0.000 description 4
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 4
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 4
- 239000007821 HATU Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 210000002744 extracellular matrix Anatomy 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- IBIKHMZPHNKTHM-RDTXWAMCSA-N merck compound 25 Chemical compound C1C[C@@H](C(O)=O)[C@H](O)CN1C(C1=C(F)C=CC=C11)=NN1C(=O)C1=C(Cl)C=CC=C1C1CC1 IBIKHMZPHNKTHM-RDTXWAMCSA-N 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 4
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 4
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical class CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 3
- VXXSAIHCZASEMT-UHFFFAOYSA-N 1-(4-aminophenyl)-3-(6-methanehydrazonoylnaphthalen-2-yl)urea Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1NC(=O)NC1=CC=C(N)C=C1 VXXSAIHCZASEMT-UHFFFAOYSA-N 0.000 description 3
- FOFDSVNKLYUFEZ-UHFFFAOYSA-N 1-(6-methanehydrazonoylnaphthalen-2-yl)-3-methylurea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=C(C=NN)C=CC2=CC(NC(=O)NC)=CC=C21 FOFDSVNKLYUFEZ-UHFFFAOYSA-N 0.000 description 3
- BQGHQNKAQHIKRT-UHFFFAOYSA-N 1-(6-methanehydrazonoylnaphthalen-2-yl)-3-phenylurea;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC2=CC(C=NN)=CC=C2C=C1NC(=O)NC1=CC=CC=C1 BQGHQNKAQHIKRT-UHFFFAOYSA-N 0.000 description 3
- CHDGRAZVKGIQQV-UHFFFAOYSA-N 2-[4-(6-methanehydrazonoylnaphthalen-2-yl)oxyphenyl]-n-methylacetamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(CC(=O)NC)=CC=C1OC1=CC=C(C=C(C=NN)C=C2)C2=C1 CHDGRAZVKGIQQV-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 3
- BFWYZZPDZZGSLJ-UHFFFAOYSA-N 4-(aminomethyl)aniline Chemical compound NCC1=CC=C(N)C=C1 BFWYZZPDZZGSLJ-UHFFFAOYSA-N 0.000 description 3
- VGXKVBFGKPVPQR-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(1,2,3,4-tetrahydroquinolin-6-yl)naphthalene-2-carboxamide Chemical compound N1CCCC2=CC(NC(=O)C3=CC4=CC=C(C=C4C=C3)C=NN)=CC=C21 VGXKVBFGKPVPQR-UHFFFAOYSA-N 0.000 description 3
- PLQFTWQDDOWXPC-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-methylphenyl)naphthalene-2-carboxamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 PLQFTWQDDOWXPC-UHFFFAOYSA-N 0.000 description 3
- ARLLEMYCEBAJAR-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(4-methylphenyl)naphthalene-2-carboxamide Chemical compound C1=CC(C)=CC=C1NC(=O)C1=CC=C(C=C(C=NN)C=C2)C2=C1 ARLLEMYCEBAJAR-UHFFFAOYSA-N 0.000 description 3
- MUCHQCDFDOMZDU-UHFFFAOYSA-N 6-methanehydrazonoyl-n-naphthalen-2-ylnaphthalene-2-carboxamide Chemical compound C1=CC=CC2=CC(NC(=O)C3=CC4=CC=C(C=C4C=C3)C=NN)=CC=C21 MUCHQCDFDOMZDU-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QRDPYDWCIHRTTA-UHFFFAOYSA-N CS(=O)(=O)O.C1(=CC=CC=C1)NC(=O)C1=CC2=CC=C(C=C2C=C1)C=NN Chemical compound CS(=O)(=O)O.C1(=CC=CC=C1)NC(=O)C1=CC2=CC=C(C=C2C=C1)C=NN QRDPYDWCIHRTTA-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- QFRUWKRQYFOMQH-UHFFFAOYSA-N FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NC1=CC=C(C=C1)NC(=O)C1=CC2=CC=C(C=C2C=C1)C=NN Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NC1=CC=C(C=C1)NC(=O)C1=CC2=CC=C(C=C2C=C1)C=NN QFRUWKRQYFOMQH-UHFFFAOYSA-N 0.000 description 3
- UVKUEMJRKIIQQY-YTMBAFHBSA-N FC(C(=O)O)(F)F.NN=CC=1C=C2C=CC(=CC2=CC1)/C=C/C1=CC=C(C(=O)O)C=C1 Chemical compound FC(C(=O)O)(F)F.NN=CC=1C=C2C=CC(=CC2=CC1)/C=C/C1=CC=C(C(=O)O)C=C1 UVKUEMJRKIIQQY-YTMBAFHBSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- AKQCVTMMUBCWQD-UHFFFAOYSA-N N-[4-(aminomethyl)phenyl]-6-methanehydrazonoylnaphthalene-2-carboxamide 2,2,2-trifluoroacetic acid Chemical compound FC(C(=O)O)(F)F.FC(C(=O)O)(F)F.NCC1=CC=C(C=C1)NC(=O)C1=CC2=CC=C(C=C2C=C1)C=NN AKQCVTMMUBCWQD-UHFFFAOYSA-N 0.000 description 3
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 101150003085 Pdcl gene Proteins 0.000 description 3
- 102100039419 Plasminogen activator inhibitor 2 Human genes 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- 150000001409 amidines Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229960003375 aminomethylbenzoic acid Drugs 0.000 description 3
- 230000033115 angiogenesis Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical group BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 3
- PIVRIHDBOCTNKP-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-5-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=C2CCCC2=CC(NC(=O)C2=CC3=CC=C(C=C3C=C2)C=NN)=C1 PIVRIHDBOCTNKP-UHFFFAOYSA-N 0.000 description 3
- NCZIQGLKLVBNEI-UHFFFAOYSA-N n-(4-ethylphenyl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC(CC)=CC=C1NC(=O)C1=CC=C(C=C(C=NN)C=C2)C2=C1 NCZIQGLKLVBNEI-UHFFFAOYSA-N 0.000 description 3
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 3
- VEDDBHYQWFOITD-UHFFFAOYSA-N para-bromobenzyl alcohol Chemical compound OCC1=CC=C(Br)C=C1 VEDDBHYQWFOITD-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 108010065822 urokinase inhibitor Proteins 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- DGUWACLYDSWXRZ-UHFFFAOYSA-N (2-formylphenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1C=O DGUWACLYDSWXRZ-UHFFFAOYSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- AXKGIPZJYUNAIW-UHFFFAOYSA-N (4-aminophenyl)methanol Chemical compound NC1=CC=C(CO)C=C1 AXKGIPZJYUNAIW-UHFFFAOYSA-N 0.000 description 2
- QACMXJJLQXUOPQ-UHFFFAOYSA-N 1,2-dichloroethane;3-(ethyliminomethylideneamino)-n,n-dimethylpropan-1-amine Chemical compound ClCCCl.CCN=C=NCCCN(C)C QACMXJJLQXUOPQ-UHFFFAOYSA-N 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 2
- ZISWRXJZUKDIOO-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)propan-1-ol Chemical compound COC1=CC=C(CCCO)C=C1OC ZISWRXJZUKDIOO-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- DRZCPHGVEATLFR-UHFFFAOYSA-N 4,4-diethoxybutanenitrile Chemical compound CCOC(OCC)CCC#N DRZCPHGVEATLFR-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- HXDOZKJGKXYMEW-UHFFFAOYSA-N 4-ethylphenol Chemical compound CCC1=CC=C(O)C=C1 HXDOZKJGKXYMEW-UHFFFAOYSA-N 0.000 description 2
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 2
- VWAVZAMMNJMAEM-UHFFFAOYSA-N 5-ethenyl-1,3-benzodioxole Chemical compound C=CC1=CC=C2OCOC2=C1 VWAVZAMMNJMAEM-UHFFFAOYSA-N 0.000 description 2
- GMXOMMPNBWZNBW-UHFFFAOYSA-N 6-[(e)-n'-hydroxycarbamimidoyl]-n-phenylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C(=NO)N)=CC=C2C=C1C(=O)NC1=CC=CC=C1 GMXOMMPNBWZNBW-UHFFFAOYSA-N 0.000 description 2
- GVUVTAZRRLAJLS-UHFFFAOYSA-N 6-aminonaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(N)=CC=C21 GVUVTAZRRLAJLS-UHFFFAOYSA-N 0.000 description 2
- YLDFTMJPQJXGSS-UHFFFAOYSA-N 6-bromo-2-naphthol Chemical compound C1=C(Br)C=CC2=CC(O)=CC=C21 YLDFTMJPQJXGSS-UHFFFAOYSA-N 0.000 description 2
- BJSPCGGTSJPMBH-UHFFFAOYSA-N 6-cyano-n-phenylnaphthalene-2-carboxamide Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1C(=O)NC1=CC=CC=C1 BJSPCGGTSJPMBH-UHFFFAOYSA-N 0.000 description 2
- YYTAYINRPUJPNH-UHFFFAOYSA-N 6-methoxy-1,2,3,4-tetrahydroisoquinoline Chemical compound C1NCCC2=CC(OC)=CC=C21 YYTAYINRPUJPNH-UHFFFAOYSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 2
- NFBPHZSDBOVNAL-UHFFFAOYSA-N 7-hydroxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=CC(O)=CC=C21 NFBPHZSDBOVNAL-UHFFFAOYSA-N 0.000 description 2
- JYNOVHIIZNWROY-UHFFFAOYSA-N 7-methoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=CC(OC)=CC=C21 JYNOVHIIZNWROY-UHFFFAOYSA-N 0.000 description 2
- LSNDVETVEUBXIU-UHFFFAOYSA-N 8-aminonaphthalene-2-carbonitrile;hydrobromide Chemical compound Br.C1=C(C#N)C=C2C(N)=CC=CC2=C1 LSNDVETVEUBXIU-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- 108010088842 Fibrinolysin Proteins 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 241000206672 Gelidium Species 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- 208000017442 Retinal disease Diseases 0.000 description 2
- 206010038923 Retinopathy Diseases 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 229940072056 alginate Drugs 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001345 alkine derivatives Chemical class 0.000 description 2
- 238000005899 aromatization reaction Methods 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 235000012216 bentonite Nutrition 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 229920002988 biodegradable polymer Polymers 0.000 description 2
- 239000004621 biodegradable polymer Substances 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- LNAMMBFJMYMQTO-FNEBRGMMSA-N chloroform;(1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].ClC(Cl)Cl.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 LNAMMBFJMYMQTO-FNEBRGMMSA-N 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- SGDINNZGYDHHKM-UHFFFAOYSA-N dilithium;trimethylsilylazanide Chemical compound [Li+].[Li+].C[Si](C)(C)[NH-].C[Si](C)(C)[NH-] SGDINNZGYDHHKM-UHFFFAOYSA-N 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 2
- 229940043264 dodecyl sulfate Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- CYEFKCRAAGLNHW-UHFFFAOYSA-N furan-3-ylboronic acid Chemical compound OB(O)C=1C=COC=1 CYEFKCRAAGLNHW-UHFFFAOYSA-N 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- ZQBFAOFFOQMSGJ-UHFFFAOYSA-N hexafluorobenzene Chemical compound FC1=C(F)C(F)=C(F)C(F)=C1F ZQBFAOFFOQMSGJ-UHFFFAOYSA-N 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- RAVVJKCSZXAIQP-UHFFFAOYSA-N methyl 5-bromopentanoate Chemical compound COC(=O)CCCCBr RAVVJKCSZXAIQP-UHFFFAOYSA-N 0.000 description 2
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 230000035790 physiological processes and functions Effects 0.000 description 2
- 229940012957 plasmin Drugs 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 229960004063 propylene glycol Drugs 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000004007 reversed phase HPLC Methods 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- WJUFSDZVCOTFON-UHFFFAOYSA-N veratraldehyde Chemical compound COC1=CC=C(C=O)C=C1OC WJUFSDZVCOTFON-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- JZLZDBGQWRBTHN-NSHDSACASA-N (2s)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC1=CC=C(I)C=C1 JZLZDBGQWRBTHN-NSHDSACASA-N 0.000 description 1
- VDRYRSSOANYBEA-UHFFFAOYSA-N (3-bromofuran-2-yl)-trimethylsilane Chemical compound C[Si](C)(C)C=1OC=CC=1Br VDRYRSSOANYBEA-UHFFFAOYSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- GBJMURRFWZREHE-UHFFFAOYSA-N (4-iodophenyl)methylazanium;chloride Chemical compound Cl.NCC1=CC=C(I)C=C1 GBJMURRFWZREHE-UHFFFAOYSA-N 0.000 description 1
- FRNRXKFDZXFNKG-UHFFFAOYSA-N (6-bromonaphthalen-2-yl) trifluoromethanesulfonate Chemical compound C1=C(Br)C=CC2=CC(OS(=O)(=O)C(F)(F)F)=CC=C21 FRNRXKFDZXFNKG-UHFFFAOYSA-N 0.000 description 1
- HCBCJAFWOBCSRJ-UHFFFAOYSA-N (6-cyanonaphthalen-2-yl) trifluoromethanesulfonate Chemical compound C1=C(C#N)C=CC2=CC(OS(=O)(=O)C(F)(F)F)=CC=C21 HCBCJAFWOBCSRJ-UHFFFAOYSA-N 0.000 description 1
- BTCZGAYUQAAPLI-UHFFFAOYSA-N (6-cyanonaphthalen-2-yl)boronic acid Chemical compound C1=C(C#N)C=CC2=CC(B(O)O)=CC=C21 BTCZGAYUQAAPLI-UHFFFAOYSA-N 0.000 description 1
- CCENYYALCBKAJT-UHFFFAOYSA-N (7-cyano-2-methoxynaphthalen-1-yl) trifluoromethanesulfonate Chemical compound C1=CC(C#N)=CC2=C(OS(=O)(=O)C(F)(F)F)C(OC)=CC=C21 CCENYYALCBKAJT-UHFFFAOYSA-N 0.000 description 1
- JCYLGNNXACDGDA-UHFFFAOYSA-N (7-methoxynaphthalen-2-yl) trifluoromethanesulfonate Chemical compound C1=CC(OS(=O)(=O)C(F)(F)F)=CC2=CC(OC)=CC=C21 JCYLGNNXACDGDA-UHFFFAOYSA-N 0.000 description 1
- BVKGPGDOMCAILJ-UHFFFAOYSA-N (8-aminonaphthalen-2-yl) trifluoromethanesulfonate Chemical compound C1=C(OS(=O)(=O)C(F)(F)F)C=C2C(N)=CC=CC2=C1 BVKGPGDOMCAILJ-UHFFFAOYSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 1
- OXDSKEQSEGDAFN-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenylmethanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)NC1=CC=CC=C1 OXDSKEQSEGDAFN-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- BNIWTJAVDJYTIJ-UHFFFAOYSA-N 1,3-dimethylnaphthalene-2,6-dicarboxylic acid Chemical compound OC(=O)C1=CC=C2C(C)=C(C(O)=O)C(C)=CC2=C1 BNIWTJAVDJYTIJ-UHFFFAOYSA-N 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- FGROGLJVXNYNQC-UHFFFAOYSA-N 1-(4-bromophenyl)-2-hydroxyethanone Chemical compound OCC(=O)C1=CC=C(Br)C=C1 FGROGLJVXNYNQC-UHFFFAOYSA-N 0.000 description 1
- IVAYNEISSLSHBA-UHFFFAOYSA-N 1-(6-cyanonaphthalen-2-yl)-3-cyclohexylurea Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1NC(=O)NC1CCCCC1 IVAYNEISSLSHBA-UHFFFAOYSA-N 0.000 description 1
- UBVYDCGZJNWNAS-UHFFFAOYSA-N 1-(6-cyanonaphthalen-2-yl)-3-methylurea Chemical compound C1=C(C#N)C=CC2=CC(NC(=O)NC)=CC=C21 UBVYDCGZJNWNAS-UHFFFAOYSA-N 0.000 description 1
- UHUJXXNVJNKSLA-UHFFFAOYSA-N 1-(6-cyanonaphthalen-2-yl)-3-phenylmethoxyurea Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1NC(=O)NOCC1=CC=CC=C1 UHUJXXNVJNKSLA-UHFFFAOYSA-N 0.000 description 1
- OLVFGPPNMDOANW-UHFFFAOYSA-N 1-(6-cyanonaphthalen-2-yl)-3-phenylurea Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1NC(=O)NC1=CC=CC=C1 OLVFGPPNMDOANW-UHFFFAOYSA-N 0.000 description 1
- JDLKINDNLVINEO-UHFFFAOYSA-N 1-(6-cyanonaphthalen-2-yl)-3-propan-2-ylurea Chemical compound C1=C(C#N)C=CC2=CC(NC(=O)NC(C)C)=CC=C21 JDLKINDNLVINEO-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- VZNBQJFMMVFTBE-UHFFFAOYSA-N 1-benzyl-3-(6-cyanonaphthalen-2-yl)urea Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1NC(=O)NCC1=CC=CC=C1 VZNBQJFMMVFTBE-UHFFFAOYSA-N 0.000 description 1
- RUGOFYNHMCFJFD-UHFFFAOYSA-N 1-bromo-2-(2-bromoethyl)benzene Chemical compound BrCCC1=CC=CC=C1Br RUGOFYNHMCFJFD-UHFFFAOYSA-N 0.000 description 1
- ALAQDUSTXPEHMH-UHFFFAOYSA-N 1-bromo-2-methylsulfanylbenzene Chemical compound CSC1=CC=CC=C1Br ALAQDUSTXPEHMH-UHFFFAOYSA-N 0.000 description 1
- HVWZMGZBJCJDOX-UHFFFAOYSA-N 1-bromo-3-phenylmethoxybenzene Chemical compound BrC1=CC=CC(OCC=2C=CC=CC=2)=C1 HVWZMGZBJCJDOX-UHFFFAOYSA-N 0.000 description 1
- WGGLDBIZIQMEGH-UHFFFAOYSA-N 1-bromo-4-ethenylbenzene Chemical compound BrC1=CC=C(C=C)C=C1 WGGLDBIZIQMEGH-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 description 1
- GDKOYYDQISQOMH-UHFFFAOYSA-N 1-ethynylcyclohexan-1-amine Chemical compound C#CC1(N)CCCCC1 GDKOYYDQISQOMH-UHFFFAOYSA-N 0.000 description 1
- CPPGZWWUPFWALU-UHFFFAOYSA-N 1-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(N=C=O)=C1 CPPGZWWUPFWALU-UHFFFAOYSA-N 0.000 description 1
- ZYVYEJXMYBUCMN-UHFFFAOYSA-N 1-methoxy-2-methylpropane Chemical compound COCC(C)C ZYVYEJXMYBUCMN-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- HXYTVQUCDXBNCR-UHFFFAOYSA-N 1h-inden-5-amine Chemical compound NC1=CC=C2CC=CC2=C1 HXYTVQUCDXBNCR-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- UCTUXUGXIFRVGX-UHFFFAOYSA-N 2,3,4-trimethoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(OC)=C1OC UCTUXUGXIFRVGX-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- ADLOWZRDUHSVRU-UHFFFAOYSA-N 2-(2-bromophenyl)ethanol Chemical compound OCCC1=CC=CC=C1Br ADLOWZRDUHSVRU-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- FTPFHFXBCGZZFO-UHFFFAOYSA-N 2-(3-bromopropyl)oxane Chemical compound BrCCCC1CCCCO1 FTPFHFXBCGZZFO-UHFFFAOYSA-N 0.000 description 1
- WZJCFSUUTUYLKJ-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-n-methylacetamide Chemical compound CNC(=O)CC1=CC=CC(O)=C1 WZJCFSUUTUYLKJ-UHFFFAOYSA-N 0.000 description 1
- ZSZCXAOQVBEPME-UHFFFAOYSA-N 2-(4-bromophenyl)ethanamine Chemical compound NCCC1=CC=C(Br)C=C1 ZSZCXAOQVBEPME-UHFFFAOYSA-N 0.000 description 1
- NWMRUSBUYMGDSC-UHFFFAOYSA-N 2-(5-bromo-2-methoxyphenyl)ethylazanium;bromide Chemical compound Br.COC1=CC=C(Br)C=C1CCN NWMRUSBUYMGDSC-UHFFFAOYSA-N 0.000 description 1
- IIBDOFNCCSIJQV-UHFFFAOYSA-N 2-(7-methanehydrazonoyl-2-methoxynaphthalen-1-yl)oxyacetic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1=CC(C=NN)=CC2=C(OCC(O)=O)C(OC)=CC=C21 IIBDOFNCCSIJQV-UHFFFAOYSA-N 0.000 description 1
- GPQNKZRZBZGWLX-UHFFFAOYSA-N 2-(hydroxymethylidene)-6-methoxy-8-phenylmethoxy-3,4-dihydronaphthalen-1-one Chemical compound C=1C(OC)=CC=2CCC(=CO)C(=O)C=2C=1OCC1=CC=CC=C1 GPQNKZRZBZGWLX-UHFFFAOYSA-N 0.000 description 1
- YJDGPUCAPUOFQD-UHFFFAOYSA-N 2-[(4-iodopyrazol-1-yl)methoxy]ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCN1C=C(I)C=N1 YJDGPUCAPUOFQD-UHFFFAOYSA-N 0.000 description 1
- AZJYGRGDICOUIR-UHFFFAOYSA-N 2-[4-(6-cyanonaphthalen-2-yl)oxyphenyl]-n-methylacetamide Chemical compound C1=CC(CC(=O)NC)=CC=C1OC1=CC=C(C=C(C=C2)C#N)C2=C1 AZJYGRGDICOUIR-UHFFFAOYSA-N 0.000 description 1
- DJKCVKIKLNGCNT-UHFFFAOYSA-N 2-aminoethyl n-[6-[(3-propan-2-yloxyphenyl)carbamoyl]-1h-naphthalen-2-ylidene]carbamate Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C=C3C=CC(CC3=CC=2)=NC(=O)OCCN)=C1 DJKCVKIKLNGCNT-UHFFFAOYSA-N 0.000 description 1
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- PGFIHORVILKHIA-UHFFFAOYSA-N 2-bromopyrimidine Chemical compound BrC1=NC=CC=N1 PGFIHORVILKHIA-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- KSUUBCNTSSDQAO-UHFFFAOYSA-N 2-cyano-6-methylnaphthalene-1-carboxylic acid Chemical compound OC(=O)C1=C(C#N)C=CC2=CC(C)=CC=C21 KSUUBCNTSSDQAO-UHFFFAOYSA-N 0.000 description 1
- QQBUHYQVKJQAOB-UHFFFAOYSA-N 2-ethenylfuran Chemical compound C=CC1=CC=CO1 QQBUHYQVKJQAOB-UHFFFAOYSA-N 0.000 description 1
- NHUBNHMFXQNNMV-UHFFFAOYSA-N 2-ethynylpyridine Chemical compound C#CC1=CC=CC=N1 NHUBNHMFXQNNMV-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- ORNUPNRNNSVZTC-UHFFFAOYSA-N 2-vinylthiophene Chemical compound C=CC1=CC=CS1 ORNUPNRNNSVZTC-UHFFFAOYSA-N 0.000 description 1
- SSCROYRFMPYJPF-UHFFFAOYSA-N 3,6-dioxocyclohexene-1,2-dicarbonitrile Chemical compound O=C1CCC(=O)C(C#N)=C1C#N SSCROYRFMPYJPF-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- CEUFYOGPMIHZGE-UHFFFAOYSA-N 3-(6-cyanonaphthalen-2-yl)-1-methyl-1-phenylurea Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1NC(=O)N(C)C1=CC=CC=C1 CEUFYOGPMIHZGE-UHFFFAOYSA-N 0.000 description 1
- ZWJAROXESBMMMV-UHFFFAOYSA-N 3-(6-methanehydrazonoylnaphthalen-2-yl)-1-methyl-1-phenylurea Chemical compound C=1C=C2C=C(C=NN)C=CC2=CC=1NC(=O)N(C)C1=CC=CC=C1 ZWJAROXESBMMMV-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- LIPGTGXBESLEMO-UHFFFAOYSA-N 3-[tert-butyl(dimethyl)silyl]oxypropyl 4-nitrobenzenesulfonate Chemical compound CC(C)(C)[Si](C)(C)OCCCOS(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 LIPGTGXBESLEMO-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- QGCCNWSXJHGUNL-UHFFFAOYSA-N 3-iodo-benzyl alcohol Chemical compound OCC1=CC=CC(I)=C1 QGCCNWSXJHGUNL-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- VYZCZBOCIVEDFF-UHFFFAOYSA-N 3-tributylstannylcyclopent-2-en-1-one Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CC(=O)CC1 VYZCZBOCIVEDFF-UHFFFAOYSA-N 0.000 description 1
- RTDAMORRDXWYPT-UHFFFAOYSA-N 4,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,2-dicarbonitrile Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O.ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O RTDAMORRDXWYPT-UHFFFAOYSA-N 0.000 description 1
- WNPSMKHXUKDOBN-UHFFFAOYSA-N 4-(2-bromoethyl)aniline Chemical compound NC1=CC=C(CCBr)C=C1 WNPSMKHXUKDOBN-UHFFFAOYSA-N 0.000 description 1
- COWGZRGEFNSWNK-UHFFFAOYSA-N 4-(3-bromopropyl)-1,2-dimethoxybenzene Chemical compound COC1=CC=C(CCCBr)C=C1OC COWGZRGEFNSWNK-UHFFFAOYSA-N 0.000 description 1
- HKJUOMPYMPXLFS-UHFFFAOYSA-N 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzoic acid Chemical compound IC1=CC(C(=O)O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 HKJUOMPYMPXLFS-UHFFFAOYSA-N 0.000 description 1
- PJVQBBTZILRXCV-UHFFFAOYSA-N 4-(5-ethylsulfonylfuran-3-yl)-6-methanehydrazonoyl-n-phenylnaphthalene-2-carboxamide Chemical compound O1C(S(=O)(=O)CC)=CC(C=2C3=CC(C=NN)=CC=C3C=C(C=2)C(=O)NC=2C=CC=CC=2)=C1 PJVQBBTZILRXCV-UHFFFAOYSA-N 0.000 description 1
- YZMAWMNDJDZCCQ-OWOJBTEDSA-N 4-[(e)-2-(6-cyanonaphthalen-2-yl)ethenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1\C=C\C1=CC=C(C=C(C=C2)C#N)C2=C1 YZMAWMNDJDZCCQ-OWOJBTEDSA-N 0.000 description 1
- QGHDLJAZIIFENW-UHFFFAOYSA-N 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenol Chemical group C1=C(CC=C)C(O)=CC=C1C(C(F)(F)F)(C(F)(F)F)C1=CC=C(O)C(CC=C)=C1 QGHDLJAZIIFENW-UHFFFAOYSA-N 0.000 description 1
- YBMRUQPRLBNSJV-UHFFFAOYSA-N 4-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]cyclohexane-1-carboxylic acid Chemical compound CC(C)(C)OC(=O)C(N)C1CCC(C(O)=O)CC1 YBMRUQPRLBNSJV-UHFFFAOYSA-N 0.000 description 1
- TXHJDEGAXDCZOB-UHFFFAOYSA-N 4-[[[(4-aminophenyl)methoxymethyl-tert-butyl-methylsilyl]oxy-tert-butyl-methylsilyl]methoxymethyl]aniline Chemical compound C=1C=C(N)C=CC=1COC[Si](C)(C(C)(C)C)O[Si](C)(C(C)(C)C)COCC1=CC=C(N)C=C1 TXHJDEGAXDCZOB-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- PTGNEPACMDNRGA-UHFFFAOYSA-N 4-bromo-2-methylsulfanylfuran Chemical compound CSC1=CC(Br)=CO1 PTGNEPACMDNRGA-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- IRQWEODKXLDORP-UHFFFAOYSA-N 4-ethenylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=C)C=C1 IRQWEODKXLDORP-UHFFFAOYSA-N 0.000 description 1
- LLNQWPTUJJYTTE-UHFFFAOYSA-N 4-iodopyrazole Chemical compound IC=1C=NNC=1 LLNQWPTUJJYTTE-UHFFFAOYSA-N 0.000 description 1
- IVNPXOUPZCTJAK-UHFFFAOYSA-N 4-methylmorpholin-4-ium;hydroxide Chemical compound O.CN1CCOCC1 IVNPXOUPZCTJAK-UHFFFAOYSA-N 0.000 description 1
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 1
- 229940044174 4-phenylenediamine Drugs 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- VJOWMORERYNYON-UHFFFAOYSA-N 5-ethenyl-2-methylpyridine Chemical compound CC1=CC=C(C=C)C=N1 VJOWMORERYNYON-UHFFFAOYSA-N 0.000 description 1
- RXCGXPRNYXOPHJ-UHFFFAOYSA-N 6,7,8-trimethoxynaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=C2C(OC)=C(OC)C(OC)=CC2=C1 RXCGXPRNYXOPHJ-UHFFFAOYSA-N 0.000 description 1
- ZSNPTAWENJOIHZ-UHFFFAOYSA-N 6,7-dimethoxynaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=C2C=C(OC)C(OC)=CC2=C1 ZSNPTAWENJOIHZ-UHFFFAOYSA-N 0.000 description 1
- PXVHOBFCMQGIMG-UHFFFAOYSA-N 6,8-dimethoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=C1C=C(OC)C=C2OC PXVHOBFCMQGIMG-UHFFFAOYSA-N 0.000 description 1
- OBXADLWUTNUCTG-UHFFFAOYSA-N 6-(2-formylphenoxy)naphthalene-2-carbonitrile Chemical compound O=CC1=CC=CC=C1OC1=CC=C(C=C(C=C2)C#N)C2=C1 OBXADLWUTNUCTG-UHFFFAOYSA-N 0.000 description 1
- ODZWIWSRVJIPKI-UHFFFAOYSA-N 6-(2-formylphenyl)naphthalene-2-carbonitrile Chemical compound O=CC1=CC=CC=C1C1=CC=C(C=C(C=C2)C#N)C2=C1 ODZWIWSRVJIPKI-UHFFFAOYSA-N 0.000 description 1
- GNIGBGCZWRGMSX-UHFFFAOYSA-N 6-(2-methylsulfanylphenyl)naphthalene-2-carbonitrile Chemical compound CSC1=CC=CC=C1C1=CC=C(C=C(C=C2)C#N)C2=C1 GNIGBGCZWRGMSX-UHFFFAOYSA-N 0.000 description 1
- WMODILQXKYZMSG-UHFFFAOYSA-N 6-(2-phenylethyl)naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1CCC1=CC=CC=C1 WMODILQXKYZMSG-UHFFFAOYSA-N 0.000 description 1
- FPTZYQBYCFAUNO-UHFFFAOYSA-N 6-(2-phenylethynyl)naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1C#CC1=CC=CC=C1 FPTZYQBYCFAUNO-UHFFFAOYSA-N 0.000 description 1
- RDQOBPORZRFWEK-UHFFFAOYSA-N 6-(2-trimethylsilylethynyl)naphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(C#C[Si](C)(C)C)=CC=C21 RDQOBPORZRFWEK-UHFFFAOYSA-N 0.000 description 1
- YCJGVFNFWDYREH-UHFFFAOYSA-N 6-(3-aminoprop-1-ynyl)naphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(C#CCN)=CC=C21 YCJGVFNFWDYREH-UHFFFAOYSA-N 0.000 description 1
- WDERPXHYKDXRBW-UHFFFAOYSA-N 6-(3-methoxyphenyl)naphthalene-2-carbonitrile Chemical compound COC1=CC=CC(C=2C=C3C=CC(=CC3=CC=2)C#N)=C1 WDERPXHYKDXRBW-UHFFFAOYSA-N 0.000 description 1
- PWSGJWFUDNMMRU-UHFFFAOYSA-N 6-(3-oxobut-1-enyl)naphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(C=CC(=O)C)=CC=C21 PWSGJWFUDNMMRU-UHFFFAOYSA-N 0.000 description 1
- PVWJGSYBZXRHBG-UHFFFAOYSA-N 6-(3-oxobutyl)naphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(CCC(=O)C)=CC=C21 PVWJGSYBZXRHBG-UHFFFAOYSA-N 0.000 description 1
- FMBABEQASPMWGT-UHFFFAOYSA-N 6-(3-phenylprop-1-ynyl)naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1C#CCC1=CC=CC=C1 FMBABEQASPMWGT-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- GLBCXZDHKKIJCR-UHFFFAOYSA-N 6-(4-methylpent-1-ynyl)naphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(C#CCC(C)C)=CC=C21 GLBCXZDHKKIJCR-UHFFFAOYSA-N 0.000 description 1
- OUXTVTLFTBNDMN-UHFFFAOYSA-N 6-(4-phenylbut-1-ynyl)naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1C#CCCC1=CC=CC=C1 OUXTVTLFTBNDMN-UHFFFAOYSA-N 0.000 description 1
- NOWBSMPLGDTXTH-UHFFFAOYSA-N 6-(5-phenylpent-1-ynyl)naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1C#CCCCC1=CC=CC=C1 NOWBSMPLGDTXTH-UHFFFAOYSA-N 0.000 description 1
- YKFUCBKYXBSCBN-VMPITWQZSA-N 6-[(e)-2-(furan-2-yl)ethenyl]naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1\C=C\C1=CC=CO1 YKFUCBKYXBSCBN-VMPITWQZSA-N 0.000 description 1
- VKGQVYSLZROWPH-FNORWQNLSA-N 6-[(e)-2-imidazol-1-ylethenyl]naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1\C=C\N1C=CN=C1 VKGQVYSLZROWPH-FNORWQNLSA-N 0.000 description 1
- NTVNJDUEESOJBK-VOTSOKGWSA-N 6-[(e)-2-phenylethenyl]naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1\C=C\C1=CC=CC=C1 NTVNJDUEESOJBK-VOTSOKGWSA-N 0.000 description 1
- KCCCMYIEJKIXQJ-ZHACJKMWSA-N 6-[(e)-2-phenylsulfanylethenyl]naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1\C=C\SC1=CC=CC=C1 KCCCMYIEJKIXQJ-ZHACJKMWSA-N 0.000 description 1
- BNANBGNTIBGHIC-VMPITWQZSA-N 6-[(e)-2-thiophen-2-ylethenyl]naphthalene-2-carbonitrile Chemical compound C1=CC2=CC(C#N)=CC=C2C=C1\C=C\C1=CC=CS1 BNANBGNTIBGHIC-VMPITWQZSA-N 0.000 description 1
- WDZAWPPPSAIJDV-UHFFFAOYSA-N 6-[2-(1-aminocyclohexyl)ethynyl]naphthalene-2-carbonitrile Chemical compound C=1C=C2C=C(C#N)C=CC2=CC=1C#CC1(N)CCCCC1 WDZAWPPPSAIJDV-UHFFFAOYSA-N 0.000 description 1
- BUGOPFFYUBOQEF-UHFFFAOYSA-N 6-[2-(4-aminophenyl)ethoxy]naphthalene-2-carbonitrile Chemical compound C1=CC(N)=CC=C1CCOC1=CC=C(C=C(C=C2)C#N)C2=C1 BUGOPFFYUBOQEF-UHFFFAOYSA-N 0.000 description 1
- OKVZQPHYIUSYBP-UHFFFAOYSA-N 6-[2-[4-(hydroxymethyl)phenyl]cyclopropyl]naphthalene-2-carboxamide Chemical compound C1C(C1C2=CC3=C(C=C2)C=C(C=C3)C(=O)N)C4=CC=C(C=C4)CO OKVZQPHYIUSYBP-UHFFFAOYSA-N 0.000 description 1
- HDMVMVPNLKOXTK-UHFFFAOYSA-N 6-bromonaphthalene-1-carbonitrile Chemical compound N#CC1=CC=CC2=CC(Br)=CC=C21 HDMVMVPNLKOXTK-UHFFFAOYSA-N 0.000 description 1
- BIIXVAHSLRLVJB-UHFFFAOYSA-N 6-bromonaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(Br)=CC=C21 BIIXVAHSLRLVJB-UHFFFAOYSA-N 0.000 description 1
- FRUWLHKIKWFMNV-UHFFFAOYSA-N 6-carbonochloridoylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(Cl)=O)C=CC2=CC(C(=O)O)=CC=C21 FRUWLHKIKWFMNV-UHFFFAOYSA-N 0.000 description 1
- BVBXDBFLHRXHCS-UHFFFAOYSA-N 6-cyano-4-(methoxycarbonylamino)naphthalene-2-carboxylic acid Chemical compound C1=C(C#N)C=C2C(NC(=O)OC)=CC(C(O)=O)=CC2=C1 BVBXDBFLHRXHCS-UHFFFAOYSA-N 0.000 description 1
- STUHJGTWFIZQFN-UHFFFAOYSA-N 6-cyano-n-(3-methylphenyl)naphthalene-2-carboxamide Chemical compound CC1=CC=CC(NC(=O)C=2C=C3C=CC(=CC3=CC=2)C#N)=C1 STUHJGTWFIZQFN-UHFFFAOYSA-N 0.000 description 1
- ZRSXUPMUOGZANJ-UHFFFAOYSA-N 6-cyanonaphthalene-2-carbonyl azide Chemical compound C1=C(C#N)C=CC2=CC(C(=O)N=[N+]=[N-])=CC=C21 ZRSXUPMUOGZANJ-UHFFFAOYSA-N 0.000 description 1
- OZXBANYHKBTOIN-UHFFFAOYSA-N 6-cyanonaphthalene-2-carboxylic acid Chemical compound C1=C(C#N)C=CC2=CC(C(=O)O)=CC=C21 OZXBANYHKBTOIN-UHFFFAOYSA-N 0.000 description 1
- HVGCEGAHWDOESL-UHFFFAOYSA-N 6-ethynylnaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(C#C)=CC=C21 HVGCEGAHWDOESL-UHFFFAOYSA-N 0.000 description 1
- WKTNIBWKHNIPQR-UHFFFAOYSA-N 6-hydroxynaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(O)=CC=C21 WKTNIBWKHNIPQR-UHFFFAOYSA-N 0.000 description 1
- UAGZCPLHMCSCJE-UHFFFAOYSA-N 6-methanehydrazonoyl-N-(1,3-thiazol-2-yl)naphthalene-2-carboxamide Chemical compound NN=CC=1C=C2C=CC(=CC2=CC1)C(=O)NC=1SC=CN1 UAGZCPLHMCSCJE-UHFFFAOYSA-N 0.000 description 1
- FXTAGHRRKUXSFI-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(1h-pyrazol-5-yl)naphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC=NN1 FXTAGHRRKUXSFI-UHFFFAOYSA-N 0.000 description 1
- FRWKBBCJZSYTIP-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(2-methylquinolin-6-yl)naphthalene-2-carboxamide Chemical compound C1=C(C=NN)C=CC2=CC(C(=O)NC3=CC4=CC=C(N=C4C=C3)C)=CC=C21 FRWKBBCJZSYTIP-UHFFFAOYSA-N 0.000 description 1
- BCLZSDLQBOLAAH-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3,4,5-trimethoxyphenyl)naphthalene-2-carboxamide Chemical compound COC1=C(OC)C(OC)=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 BCLZSDLQBOLAAH-UHFFFAOYSA-N 0.000 description 1
- PNTTZGHZNVIKED-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-methylpyridin-2-yl)naphthalene-2-carboxamide Chemical compound CC1=CC=CN=C1NC(=O)C1=CC=C(C=C(C=NN)C=C2)C2=C1 PNTTZGHZNVIKED-UHFFFAOYSA-N 0.000 description 1
- OAEJGCAJUXCVRI-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-pentan-3-yloxyphenyl)naphthalene-2-carboxamide Chemical compound CCC(CC)OC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 OAEJGCAJUXCVRI-UHFFFAOYSA-N 0.000 description 1
- XFYZSBAQPFPFSV-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-phenoxyphenyl)naphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC(C=1)=CC=CC=1OC1=CC=CC=C1 XFYZSBAQPFPFSV-UHFFFAOYSA-N 0.000 description 1
- JVTHSXFOOGFNTH-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-phenylmethoxyphenyl)naphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC(C=1)=CC=CC=1OCC1=CC=CC=C1 JVTHSXFOOGFNTH-UHFFFAOYSA-N 0.000 description 1
- MKTHSQJKVFDHCI-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-propan-2-yloxyphenyl)naphthalene-2-carboxamide Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 MKTHSQJKVFDHCI-UHFFFAOYSA-N 0.000 description 1
- YGTHIGHUEMAYQE-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(3-propoxyphenyl)naphthalene-2-carboxamide Chemical compound CCCOC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 YGTHIGHUEMAYQE-UHFFFAOYSA-N 0.000 description 1
- KSRNJLNNDSPYLI-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(4-nitrophenyl)naphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC=C([N+]([O-])=O)C=C1 KSRNJLNNDSPYLI-UHFFFAOYSA-N 0.000 description 1
- FKFIUSGRDJBOBK-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(5-methyl-1,2-oxazol-3-yl)naphthalene-2-carboxamide Chemical compound O1C(C)=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=N1 FKFIUSGRDJBOBK-UHFFFAOYSA-N 0.000 description 1
- RVBZPTORUSFXKV-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(5-methylpyridin-2-yl)naphthalene-2-carboxamide Chemical compound N1=CC(C)=CC=C1NC(=O)C1=CC=C(C=C(C=NN)C=C2)C2=C1 RVBZPTORUSFXKV-UHFFFAOYSA-N 0.000 description 1
- VLKJVICERZVROC-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(6-methoxypyridin-3-yl)naphthalene-2-carboxamide Chemical compound C1=NC(OC)=CC=C1NC(=O)C1=CC=C(C=C(C=NN)C=C2)C2=C1 VLKJVICERZVROC-UHFFFAOYSA-N 0.000 description 1
- OQQWCYPRPHDXAC-UHFFFAOYSA-N 6-methanehydrazonoyl-n-(6-methylpyridin-2-yl)naphthalene-2-carboxamide Chemical compound CC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=N1 OQQWCYPRPHDXAC-UHFFFAOYSA-N 0.000 description 1
- RVOFEMBBXGJLBL-UHFFFAOYSA-N 6-methanehydrazonoyl-n-pyrazin-2-ylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CN=CC=N1 RVOFEMBBXGJLBL-UHFFFAOYSA-N 0.000 description 1
- RINAIRPUCWWKBM-UHFFFAOYSA-N 6-methanehydrazonoyl-n-pyridazin-3-ylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC=CN=N1 RINAIRPUCWWKBM-UHFFFAOYSA-N 0.000 description 1
- AZFNEJRKNBLNNQ-UHFFFAOYSA-N 6-methanehydrazonoyl-n-pyrimidin-5-ylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CN=CN=C1 AZFNEJRKNBLNNQ-UHFFFAOYSA-N 0.000 description 1
- IQDVJUUREAAWAO-UHFFFAOYSA-N 6-methanehydrazonoyl-n-quinolin-6-ylnaphthalene-2-carboxamide Chemical compound N1=CC=CC2=CC(NC(=O)C3=CC4=CC=C(C=C4C=C3)C=NN)=CC=C21 IQDVJUUREAAWAO-UHFFFAOYSA-N 0.000 description 1
- XZLPGJXWJHJJTQ-UHFFFAOYSA-N 6-methoxy-1-oxo-8-phenylmethoxy-3,4-dihydro-2h-naphthalene-2-carbonitrile Chemical compound C=1C(OC)=CC=2CCC(C#N)C(=O)C=2C=1OCC1=CC=CC=C1 XZLPGJXWJHJJTQ-UHFFFAOYSA-N 0.000 description 1
- QRZVUDQHZUPESX-UHFFFAOYSA-N 6-methoxy-8-phenylmethoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound C=1C(OC)=CC=2CCCC(=O)C=2C=1OCC1=CC=CC=C1 QRZVUDQHZUPESX-UHFFFAOYSA-N 0.000 description 1
- QPDUURBYZUJSJQ-UHFFFAOYSA-N 6-methoxy-8-phenylmethoxy-3,4-dihydronaphthalene-2-carbonitrile Chemical compound C=1C(OC)=CC=2CCC(C#N)=CC=2C=1OCC1=CC=CC=C1 QPDUURBYZUJSJQ-UHFFFAOYSA-N 0.000 description 1
- NIMOCQAMAZQKIC-UHFFFAOYSA-N 6-methoxy-8-phenylmethoxynaphthalene-2-carbonitrile Chemical compound C=12C=C(C#N)C=CC2=CC(OC)=CC=1OCC1=CC=CC=C1 NIMOCQAMAZQKIC-UHFFFAOYSA-N 0.000 description 1
- SKTKMAWOMQFTNS-UHFFFAOYSA-N 6-methoxycarbonylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)OC)=CC=C21 SKTKMAWOMQFTNS-UHFFFAOYSA-N 0.000 description 1
- CLZPNGOBBYNHAL-UHFFFAOYSA-N 7,8-dimethoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(OC)C(OC)=CC=C21 CLZPNGOBBYNHAL-UHFFFAOYSA-N 0.000 description 1
- OYJYKOBKDWQWDV-UHFFFAOYSA-N 7-(2-hydroxyethoxy)-8-iodonaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(I)C(OCCO)=CC=C21 OYJYKOBKDWQWDV-UHFFFAOYSA-N 0.000 description 1
- YMEXVCJENUUZIU-UHFFFAOYSA-N 7-(2-hydroxyethoxy)naphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=CC(OCCO)=CC=C21 YMEXVCJENUUZIU-UHFFFAOYSA-N 0.000 description 1
- AVRFPUMKJBGVHH-UHFFFAOYSA-N 7-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-8-iodonaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(I)C(OCCO[Si](C)(C)C(C)(C)C)=CC=C21 AVRFPUMKJBGVHH-UHFFFAOYSA-N 0.000 description 1
- VRUNAUBTOHUDJX-UHFFFAOYSA-N 7-hydroxy-8-iodonaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(I)C(O)=CC=C21 VRUNAUBTOHUDJX-UHFFFAOYSA-N 0.000 description 1
- JATLJHOGYANERT-UHFFFAOYSA-N 7-methoxy-8-(1-methylsulfonylpyrazol-4-yl)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C=1C=NN(S(C)(=O)=O)C=1 JATLJHOGYANERT-UHFFFAOYSA-N 0.000 description 1
- KIPSOXJPRUFBKM-UHFFFAOYSA-N 7-methoxy-8-(1h-pyrazol-4-yl)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C=1C=NNC=1 KIPSOXJPRUFBKM-UHFFFAOYSA-N 0.000 description 1
- OSDQVFQGDRBEIV-UHFFFAOYSA-N 7-methoxy-8-(3-phenylpropoxy)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1OCCCC1=CC=CC=C1 OSDQVFQGDRBEIV-UHFFFAOYSA-N 0.000 description 1
- IRNWXGDARWUPMD-UHFFFAOYSA-N 7-methoxy-8-(4-nitrophenoxy)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1OC1=CC=C([N+]([O-])=O)C=C1 IRNWXGDARWUPMD-UHFFFAOYSA-N 0.000 description 1
- DHVKHUAJPOPGKG-UHFFFAOYSA-N 7-methoxy-8-(5-oxooxolan-3-yl)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C1COC(=O)C1 DHVKHUAJPOPGKG-UHFFFAOYSA-N 0.000 description 1
- USCVTOSUCRRWQO-UHFFFAOYSA-N 7-methoxy-8-(oxolan-3-yl)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C1CCOC1 USCVTOSUCRRWQO-UHFFFAOYSA-N 0.000 description 1
- JWBGTHPLHPONNL-UHFFFAOYSA-N 7-methoxy-8-(pyrimidin-2-ylamino)naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1NC1=NC=CC=N1 JWBGTHPLHPONNL-UHFFFAOYSA-N 0.000 description 1
- AMTASAHFLYOJBN-UHFFFAOYSA-N 7-methoxy-8-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]naphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C=1C=NN(COCC[Si](C)(C)C)C=1 AMTASAHFLYOJBN-UHFFFAOYSA-N 0.000 description 1
- ZKVLIKCIKXCCDN-UHFFFAOYSA-N 7-methoxy-8-nitronaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C([N+]([O-])=O)C(OC)=CC=C21 ZKVLIKCIKXCCDN-UHFFFAOYSA-N 0.000 description 1
- QHNHCHNOSGETMU-UHFFFAOYSA-N 7-methoxy-8-prop-2-enoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(OCC=C)C(OC)=CC=C21 QHNHCHNOSGETMU-UHFFFAOYSA-N 0.000 description 1
- ANCSFNZKDDRCRA-UHFFFAOYSA-N 7-methoxy-8-pyrimidin-2-yloxynaphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1OC1=NC=CC=N1 ANCSFNZKDDRCRA-UHFFFAOYSA-N 0.000 description 1
- YTTUURFHFUMFNK-UHFFFAOYSA-N 7-methoxy-9-phenylmethoxy-4,5-dihydrobenzo[g][1,2]benzoxazole Chemical compound C=1C(OC)=CC=2CCC=3C=NOC=3C=2C=1OCC1=CC=CC=C1 YTTUURFHFUMFNK-UHFFFAOYSA-N 0.000 description 1
- UNFNRIIETORURP-UHFFFAOYSA-N 7-methoxynaphthalen-2-ol Chemical compound C1=CC(O)=CC2=CC(OC)=CC=C21 UNFNRIIETORURP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XWVWPNCHKIMHAC-UHFFFAOYSA-N 8-(1,4-dihydroxybut-2-en-2-yl)-7-methoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(C(CO)=CCO)C(OC)=CC=C21 XWVWPNCHKIMHAC-UHFFFAOYSA-N 0.000 description 1
- UFFYDGAETUFVTD-UHFFFAOYSA-N 8-(1-acetylpyrazol-3-yl)-7-methoxynaphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C=1C=CN(C(C)=O)N=1 UFFYDGAETUFVTD-UHFFFAOYSA-N 0.000 description 1
- KFXFGDJBYVIOQF-UHFFFAOYSA-N 8-(1-benzofuran-2-yl)-7-methoxynaphthalene-2-carbonitrile Chemical compound C1=CC=C2OC(C3=C4C=C(C=CC4=CC=C3OC)C#N)=CC2=C1 KFXFGDJBYVIOQF-UHFFFAOYSA-N 0.000 description 1
- GPDDUVRWJNZEHS-UHFFFAOYSA-N 8-(3-bromopropoxy)-7-methoxynaphthalene-2-carbonitrile;hydrochloride Chemical compound Cl.C1=CC(C#N)=CC2=C(OCCCBr)C(OC)=CC=C21 GPDDUVRWJNZEHS-UHFFFAOYSA-N 0.000 description 1
- CKMUISSAWUIZCW-UHFFFAOYSA-N 8-(furan-2-yl)-7-methoxynaphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C1=CC=CO1 CKMUISSAWUIZCW-UHFFFAOYSA-N 0.000 description 1
- ZBCXNEGUPXELLY-UHFFFAOYSA-N 8-(furan-3-yl)-7-methoxynaphthalene-2-carbonitrile Chemical compound COC1=CC=C2C=CC(C#N)=CC2=C1C=1C=COC=1 ZBCXNEGUPXELLY-UHFFFAOYSA-N 0.000 description 1
- JCERHNXCSHAWFM-QPJJXVBHSA-N 8-[(e)-2-(1,3-benzodioxol-5-yl)ethenyl]naphthalene-2-carbonitrile Chemical compound C1=C2OCOC2=CC(/C=C/C2=CC=CC3=CC=C(C=C32)C#N)=C1 JCERHNXCSHAWFM-QPJJXVBHSA-N 0.000 description 1
- KVHHMYZBFBSVDI-UHFFFAOYSA-N 8-aminonaphthalen-2-ol Chemical compound C1=C(O)C=C2C(N)=CC=CC2=C1 KVHHMYZBFBSVDI-UHFFFAOYSA-N 0.000 description 1
- FURQCHFPXBIWNL-UHFFFAOYSA-N 8-hydroxy-6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC(O)=C21 FURQCHFPXBIWNL-UHFFFAOYSA-N 0.000 description 1
- BXSVTTNFMAFXGH-UHFFFAOYSA-N 8-hydroxy-6-methoxynaphthalene-2-carbonitrile Chemical compound C1=C(C#N)C=CC2=CC(OC)=CC(O)=C21 BXSVTTNFMAFXGH-UHFFFAOYSA-N 0.000 description 1
- SIQMXXMYFAQXII-UHFFFAOYSA-N 8-hydroxy-7-methoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(O)C(OC)=CC=C21 SIQMXXMYFAQXII-UHFFFAOYSA-N 0.000 description 1
- BPGWDLFPUFIFQZ-UHFFFAOYSA-N 8-iodo-7-methoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(I)C(OC)=CC=C21 BPGWDLFPUFIFQZ-UHFFFAOYSA-N 0.000 description 1
- WXAOSFNXUXQSBF-UHFFFAOYSA-N 8-iodo-7-phenylmethoxynaphthalene-2-carbonitrile Chemical compound C1=CC2=CC=C(C#N)C=C2C(I)=C1OCC1=CC=CC=C1 WXAOSFNXUXQSBF-UHFFFAOYSA-N 0.000 description 1
- RZUNPOHCUZSPON-UHFFFAOYSA-N 8-iodo-7-propoxynaphthalene-2-carbonitrile Chemical compound C1=CC(C#N)=CC2=C(I)C(OCCC)=CC=C21 RZUNPOHCUZSPON-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- 241000197192 Bulla gouldiana Species 0.000 description 1
- VHIBOFWCGOAFJE-UHFFFAOYSA-N C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.Cl.Cl.[Fe+2] Chemical compound C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C[C-]1P(C1=CC=CC=C1)C1=CC=CC=C1.Cl.Cl.[Fe+2] VHIBOFWCGOAFJE-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- DKMROQRQHGEIOW-UHFFFAOYSA-N Diethyl succinate Chemical compound CCOC(=O)CCC(=O)OCC DKMROQRQHGEIOW-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Polymers OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- 150000008575 L-amino acids Chemical class 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- QXKHYNVANLEOEG-UHFFFAOYSA-N Methoxsalen Chemical group C1=CC(=O)OC2=C1C=C1C=COC1=C2OC QXKHYNVANLEOEG-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- CMBGMZSEOJDFLA-UHFFFAOYSA-N N-(2,4-dioxo-1H-pyrimidin-5-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound NN=CC=1C=C2C=CC(=CC2=CC1)C(=O)NC=1C(NC(NC1)=O)=O CMBGMZSEOJDFLA-UHFFFAOYSA-N 0.000 description 1
- YFGVMXSVNFRMTL-UHFFFAOYSA-N N-(5-bromo-1,3-thiazol-2-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=C(C=CC(=C2)C(=O)NC3=NC=C(S3)Br)C=C1C=NN YFGVMXSVNFRMTL-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 1
- SZBIWXUSZLRXQJ-UHFFFAOYSA-N NN=CC=1C=C2C=CC(=CC2=CC1)C(=O)NC=1SC=C(N1)C Chemical compound NN=CC=1C=C2C=CC(=CC2=CC1)C(=O)NC=1SC=C(N1)C SZBIWXUSZLRXQJ-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010029113 Neovascularisation Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ROPRPORTRGAPAQ-UHFFFAOYSA-N O=C=C1C(C(NOCC(C=CC=C2)=C2OS(C(F)(F)F)(=O)=O)=CC=C2)=C2C=CC1 Chemical compound O=C=C1C(C(NOCC(C=CC=C2)=C2OS(C(F)(F)F)(=O)=O)=CC=C2)=C2C=CC1 ROPRPORTRGAPAQ-UHFFFAOYSA-N 0.000 description 1
- RSIQJRFJXGSLOE-UHFFFAOYSA-N OBO.C=CC1=CC=CC=C1 Chemical class OBO.C=CC1=CC=CC=C1 RSIQJRFJXGSLOE-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- GMPDOIGGGXSAPL-UHFFFAOYSA-N Phenyl vinyl sulfide Natural products C=CSC1=CC=CC=C1 GMPDOIGGGXSAPL-UHFFFAOYSA-N 0.000 description 1
- RZKYEQDPDZUERB-UHFFFAOYSA-N Pindone Chemical compound C1=CC=C2C(=O)C(C(=O)C(C)(C)C)C(=O)C2=C1 RZKYEQDPDZUERB-UHFFFAOYSA-N 0.000 description 1
- 102000013566 Plasminogen Human genes 0.000 description 1
- 108010051456 Plasminogen Proteins 0.000 description 1
- 102000001938 Plasminogen Activators Human genes 0.000 description 1
- 108010001014 Plasminogen Activators Proteins 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 241001337451 Polyblastus cancer Species 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical group [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- 101000924984 Salmonella typhimurium (strain LT2 / SGSC1412 / ATCC 700720) 3-dehydroquinate dehydratase Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- SSZBUIDZHHWXNJ-UHFFFAOYSA-N Stearinsaeure-hexadecylester Natural products CCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCCCC SSZBUIDZHHWXNJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 206010064390 Tumour invasion Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- MOOFQFGJFBDLFR-UHFFFAOYSA-N [1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid Chemical compound C[Si](C)(C)CCOCN1C=C(B(O)O)C=N1 MOOFQFGJFBDLFR-UHFFFAOYSA-N 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- WXIONIWNXBAHRU-UHFFFAOYSA-N [dimethylamino(triazolo[4,5-b]pyridin-3-yloxy)methylidene]-dimethylazanium Chemical compound C1=CN=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 WXIONIWNXBAHRU-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005076 adamantyloxycarbonyl group Chemical group C12(CC3CC(CC(C1)C3)C2)OC(=O)* 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- CECABOMBVQNBEC-UHFFFAOYSA-K aluminium iodide Chemical compound I[Al](I)I CECABOMBVQNBEC-UHFFFAOYSA-K 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000002491 angiogenic effect Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- MKUWVMRNQOOSAT-UHFFFAOYSA-N but-3-en-2-ol Chemical compound CC(O)C=C MKUWVMRNQOOSAT-UHFFFAOYSA-N 0.000 description 1
- QDEOKXOYHYUKMS-UHFFFAOYSA-N but-3-ynylbenzene Chemical compound C#CCCC1=CC=CC=C1 QDEOKXOYHYUKMS-UHFFFAOYSA-N 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 230000009400 cancer invasion Effects 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000004709 cell invasion Effects 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001916 cyano esters Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- KFGVRWGDTLZAAO-UHFFFAOYSA-N cyclopenta-1,3-diene dicyclohexyl(cyclopenta-1,3-dien-1-yl)phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.C1CCC(CC1)P(C1CCCCC1)c1ccc[cH-]1 KFGVRWGDTLZAAO-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- LJOQGZACKSYWCH-UHFFFAOYSA-N dihydro quinine Natural products C1=C(OC)C=C2C(C(O)C3CC4CCN3CC4CC)=CC=NC2=C1 LJOQGZACKSYWCH-UHFFFAOYSA-N 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- UGMCXQCYOVCMTB-UHFFFAOYSA-K dihydroxy(stearato)aluminium Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[Al](O)O UGMCXQCYOVCMTB-UHFFFAOYSA-K 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- JMRYOSQOYJBDOI-UHFFFAOYSA-N dilithium;di(propan-2-yl)azanide Chemical compound [Li+].CC(C)[N-]C(C)C.CC(C)N([Li])C(C)C JMRYOSQOYJBDOI-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- SBTVCCZEDARAEG-UHFFFAOYSA-N dipotassium;trimethylsilylazanide Chemical compound [K+].[K+].C[Si](C)(C)[NH-].C[Si](C)(C)[NH-] SBTVCCZEDARAEG-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 125000005303 dithiazolyl group Chemical group S1SNC(=C1)* 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000004761 fibrosis Effects 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- PZJSZBJLOWMDRG-UHFFFAOYSA-N furan-2-ylboronic acid Chemical compound OB(O)C1=CC=CO1 PZJSZBJLOWMDRG-UHFFFAOYSA-N 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 1
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 229960003136 leucine Drugs 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- NLWBJPPMPLPZIE-UHFFFAOYSA-N methyl 4-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CBr)C=C1 NLWBJPPMPLPZIE-UHFFFAOYSA-N 0.000 description 1
- FRSDNJDYURVPCW-UHFFFAOYSA-N methyl 6-carbamoylnaphthalene-2-carboxylate Chemical compound C1=C(C(N)=O)C=CC2=CC(C(=O)OC)=CC=C21 FRSDNJDYURVPCW-UHFFFAOYSA-N 0.000 description 1
- YACGNGQPYPCGOL-UHFFFAOYSA-N methyl 6-cyanonaphthalene-2-carboxylate Chemical compound C1=C(C#N)C=CC2=CC(C(=O)OC)=CC=C21 YACGNGQPYPCGOL-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- UPLPZGYIEWRZBJ-UHFFFAOYSA-N n-(1,3-benzodioxol-5-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=C2OCOC2=CC(NC(=O)C2=CC3=CC=C(C=C3C=C2)C=NN)=C1 UPLPZGYIEWRZBJ-UHFFFAOYSA-N 0.000 description 1
- SPNNOTRWLYVRSU-UHFFFAOYSA-N n-(1h-indazol-5-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=C2NN=CC2=CC(NC(=O)C2=CC3=CC=C(C=C3C=C2)C=NN)=C1 SPNNOTRWLYVRSU-UHFFFAOYSA-N 0.000 description 1
- FQQBZIGZTSFYOA-UHFFFAOYSA-N n-(1h-indazol-6-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=C2C=NNC2=CC(NC(=O)C2=CC3=CC=C(C=C3C=C2)C=NN)=C1 FQQBZIGZTSFYOA-UHFFFAOYSA-N 0.000 description 1
- WCGOMMQKRMSMIC-UHFFFAOYSA-N n-(1h-indol-5-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=C2NC=CC2=CC(NC(=O)C2=CC3=CC=C(C=C3C=C2)C=NN)=C1 WCGOMMQKRMSMIC-UHFFFAOYSA-N 0.000 description 1
- MEJSHMWEAOZXMS-UHFFFAOYSA-N n-(3,5-difluorophenyl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC(F)=CC(F)=C1 MEJSHMWEAOZXMS-UHFFFAOYSA-N 0.000 description 1
- ACPKRLYDVSPROC-UHFFFAOYSA-N n-(3-cyclopentyloxyphenyl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC(C=1)=CC=CC=1OC1CCCC1 ACPKRLYDVSPROC-UHFFFAOYSA-N 0.000 description 1
- UYPZMWPPUGGPFA-UHFFFAOYSA-N n-(3-ethoxyphenyl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound CCOC1=CC=CC(NC(=O)C=2C=C3C=CC(C=NN)=CC3=CC=2)=C1 UYPZMWPPUGGPFA-UHFFFAOYSA-N 0.000 description 1
- AONLFLSIZBSVST-UHFFFAOYSA-N n-(4-aminophenyl)-6-cyanonaphthalene-2-carboxamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=C(C=C(C=C2)C#N)C2=C1 AONLFLSIZBSVST-UHFFFAOYSA-N 0.000 description 1
- VFZXFEZOUFINIV-UHFFFAOYSA-N n-(4-carbamoylphenyl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC=C(C(N)=O)C=C1 VFZXFEZOUFINIV-UHFFFAOYSA-N 0.000 description 1
- BSJACQUUQAZAEM-UHFFFAOYSA-N n-(5-bromopyridin-2-yl)-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC1=CC=C(Br)C=N1 BSJACQUUQAZAEM-UHFFFAOYSA-N 0.000 description 1
- FDARCGVEEUMMKK-UHFFFAOYSA-N n-(6-methanehydrazonoylnaphthalen-2-yl)benzamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1NC(=O)C1=CC=CC=C1 FDARCGVEEUMMKK-UHFFFAOYSA-N 0.000 description 1
- GGHQCQSNCKBHNL-UHFFFAOYSA-N n-[3-(cyclobutylmethoxy)phenyl]-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NC(C=1)=CC=CC=1OCC1CCC1 GGHQCQSNCKBHNL-UHFFFAOYSA-N 0.000 description 1
- MFPDJUVDJQOCQT-UHFFFAOYSA-N n-[4-(aminomethyl)phenyl]-6-cyanonaphthalene-2-carboxamide Chemical compound C1=CC(CN)=CC=C1NC(=O)C1=CC=C(C=C(C=C2)C#N)C2=C1 MFPDJUVDJQOCQT-UHFFFAOYSA-N 0.000 description 1
- BHDLBDWACSCPFM-UHFFFAOYSA-N n-imidazol-1-yl-6-methanehydrazonoylnaphthalene-2-carboxamide Chemical compound C1=CC2=CC(C=NN)=CC=C2C=C1C(=O)NN1C=CN=C1 BHDLBDWACSCPFM-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 150000005209 naphthoic acids Chemical class 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- PSACHCMMPFMFAJ-UHFFFAOYSA-N nmm n-methylmorpholine Chemical compound CN1CCOCC1.CN1CCOCC1 PSACHCMMPFMFAJ-UHFFFAOYSA-N 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- XYEOALKITRFCJJ-UHFFFAOYSA-N o-benzylhydroxylamine Chemical compound NOCC1=CC=CC=C1 XYEOALKITRFCJJ-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000000668 oral spray Substances 0.000 description 1
- 229940041678 oral spray Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 230000016087 ovulation Effects 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- YWWARDMVSMPOLR-UHFFFAOYSA-M oxolane;tetrabutylazanium;fluoride Chemical compound [F-].C1CCOC1.CCCC[N+](CCCC)(CCCC)CCCC YWWARDMVSMPOLR-UHFFFAOYSA-M 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- CVXGFPPAIUELDV-UHFFFAOYSA-N phenacylazanium;chloride Chemical compound [Cl-].[NH3+]CC(=O)C1=CC=CC=C1 CVXGFPPAIUELDV-UHFFFAOYSA-N 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 229960005190 phenylalanine Drugs 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 230000033885 plasminogen activation Effects 0.000 description 1
- 229940127126 plasminogen activator Drugs 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001993 poloxamer 188 Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- ZMJJCODMIXQWCQ-UHFFFAOYSA-N potassium;di(propan-2-yl)azanide Chemical compound [K+].CC(C)[N-]C(C)C ZMJJCODMIXQWCQ-UHFFFAOYSA-N 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- NGKSKVYWPINGLI-UHFFFAOYSA-N prop-2-ynylbenzene Chemical compound C#CCC1=CC=CC=C1 NGKSKVYWPINGLI-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- RJSRSRITMWVIQT-UHFFFAOYSA-N quinolin-6-amine Chemical compound N1=CC=CC2=CC(N)=CC=C21 RJSRSRITMWVIQT-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- XFTALRAZSCGSKN-UHFFFAOYSA-M sodium;4-ethenylbenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(C=C)C=C1 XFTALRAZSCGSKN-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- PQEXLIRUMIRSAL-UHFFFAOYSA-N tert-butyl 4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate Chemical compound CCOC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 PQEXLIRUMIRSAL-UHFFFAOYSA-N 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
- WIVYTYZCVWHWSH-UHFFFAOYSA-N tert-butyl n-(4-aminophenyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=C(N)C=C1 WIVYTYZCVWHWSH-UHFFFAOYSA-N 0.000 description 1
- OVHQHAKJDSKUMG-UHFFFAOYSA-N tert-butyl n-[4-(aminomethyl)anilino]carbamate Chemical compound CC(C)(C)OC(=O)NNC1=CC=C(CN)C=C1 OVHQHAKJDSKUMG-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000006169 tetracyclic group Chemical group 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- 230000007838 tissue remodeling Effects 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000006168 tricyclic group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000005760 tumorsuppression Effects 0.000 description 1
- 238000000825 ultraviolet detection Methods 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000003260 vortexing Methods 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/18—Feminine contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/10—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines
- C07C257/18—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines having carbon atoms of amidino groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/12—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines
- C07C259/18—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines having carbon atoms of hydroxamidine groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/26—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring
- C07C271/30—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atom of at least one of the carbamate groups bound to a carbon atom of a six-membered aromatic ring to a carbon atom of a six-membered aromatic ring being part of a condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/62—Compounds containing any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylcarbamates
- C07C271/66—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/40—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/56—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/58—Amidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
- C07D239/54—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals
- C07D239/545—Two oxygen atoms as doubly bound oxygen atoms or as unsubstituted hydroxy radicals with other hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/18—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/34—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/42—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/38—Compounds containing oxirane rings with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D303/46—Compounds containing oxirane rings with hydrocarbon radicals, substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals by amide or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/16—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/64—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/10—Systems containing only non-condensed rings with a five-membered ring the ring being unsaturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Reproductive Health (AREA)
- Endocrinology (AREA)
- Rheumatology (AREA)
- Gynecology & Obstetrics (AREA)
- Immunology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Ophthalmology & Optometry (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US90104097A | 1997-07-25 | 1997-07-25 | |
US08/901,040 | 1997-07-25 |
Publications (1)
Publication Number | Publication Date |
---|---|
KR20010014369A true KR20010014369A (ko) | 2001-02-26 |
Family
ID=25413502
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
KR1019997012528A KR20010014369A (ko) | 1997-07-25 | 1998-07-24 | 유로키나제 억제제 |
Country Status (16)
Country | Link |
---|---|
EP (1) | EP1000018A2 (xx) |
JP (1) | JP2002512636A (xx) |
KR (1) | KR20010014369A (xx) |
CN (1) | CN1265645A (xx) |
AR (1) | AR013372A1 (xx) |
AU (1) | AU8587498A (xx) |
BG (1) | BG103981A (xx) |
BR (1) | BR9811099A (xx) |
CA (1) | CA2294300A1 (xx) |
HU (1) | HUP0100353A3 (xx) |
IL (1) | IL133368A0 (xx) |
NO (1) | NO996578L (xx) |
PL (1) | PL339429A1 (xx) |
SK (1) | SK174899A3 (xx) |
WO (1) | WO1999005096A2 (xx) |
ZA (1) | ZA986594B (xx) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR101228385B1 (ko) * | 2004-09-21 | 2013-02-04 | 빌렉스 아게 | 페닐알라닌 유도체의 안정한 제형 |
Families Citing this family (29)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2000005214A2 (en) * | 1998-07-24 | 2000-02-03 | Pfizer Inc. | Isoquinolines as urokinase inhibitors |
US6504031B1 (en) | 1998-08-06 | 2003-01-07 | Milan Bruncko | Naphthamidine urokinase inhibitors |
GB9914486D0 (en) | 1999-06-21 | 1999-08-18 | Smithkline Beecham Plc | Medicaments |
AU780009B2 (en) * | 1999-08-31 | 2005-02-24 | Merck Sharp & Dohme Corp. | Heterocyclic compounds and methods of use thereof |
EP1242366A1 (en) * | 1999-12-15 | 2002-09-25 | Axys Pharmaceuticals, Inc. | Salicylamides as serine protease and factor xa inhibitors |
US6495562B1 (en) | 2000-04-25 | 2002-12-17 | Abbott Laboratories | Naphthamidine urokinase inhibitors |
WO2001081314A1 (en) * | 2000-04-25 | 2001-11-01 | Abbott Laboratories | Naphthamidine urokinase inhibitors |
DE10029014A1 (de) | 2000-06-15 | 2001-12-20 | Univ Schiller Jena | Urokinase-Hemmstoffe |
US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
WO2002070467A1 (en) * | 2001-02-26 | 2002-09-12 | 4Sc Ag | Derivatives of diphenylurea, diphenyloxalic acid diamide and diphenylsulfuric acid diamide and their use as medicaments |
JP4898091B2 (ja) | 2002-03-11 | 2012-03-14 | ザ メディシンズ カンパニー (ライプツィヒ) ゲーエムベーハー | ウロキナーゼの阻害剤、それらの製造および使用 |
US7053112B2 (en) * | 2002-09-24 | 2006-05-30 | Schering Aktiengesellschaft | Imidazolidinedione analogs useful as anticoagulants and antithrombotics |
DE10301300B4 (de) | 2003-01-15 | 2009-07-16 | Curacyte Chemistry Gmbh | Verwendung von acylierten 4-Amidino- und 4-Guanidinobenzylaminen zur Inhibierung von Plasmakallikrein |
DE10342108A1 (de) | 2003-09-11 | 2005-04-14 | Curacyte Chemistry Gmbh | Basisch-substituierte Benzylaminanaloga als Inhibitoren des Gerinnungsfaktors Xa, ihre Herstellung und Verwendung |
US7545495B2 (en) | 2004-04-27 | 2009-06-09 | Abbott Laboratories | Methods for visualizing crystals and distinguishing crystals from other matter within a biological sample |
DK1773816T3 (en) | 2004-06-24 | 2015-01-26 | Vertex Pharma | Modulators of ATP-binding cassette transporters |
US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
AU2006261099A1 (en) | 2005-06-24 | 2006-12-28 | Wilex Ag | Use of Urokinase inhibitors for the treatment and/or prevention of neuropathological diseases |
US8686002B2 (en) | 2005-08-21 | 2014-04-01 | AbbVie Deutschland GmbH & Co. KG | Heterocyclic compounds and their use as binding partners for 5-HT5 receptors |
JP5409010B2 (ja) | 2005-12-28 | 2014-02-05 | バーテックス ファーマシューティカルズ インコーポレイテッド | N−[2,4−ビス(1,1−ジメチルエチル)−5−ヒドロキシフェニル]−1,4−ジヒドロ−4−オキソキノリン−3−カルボキサミドの固体形態 |
DE102006050672A1 (de) | 2006-10-24 | 2008-04-30 | Curacyte Discovery Gmbh | Hemmstoffe des Plasmins und des Plasmakallikreins |
NZ624460A (en) | 2009-03-20 | 2015-12-24 | Vertex Pharma | Process for making modulators of cystic fibrosis transmembrane conductance regulator |
JP2011057661A (ja) * | 2009-08-14 | 2011-03-24 | Bayer Cropscience Ag | 殺虫性カルボキサミド類 |
US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
CN104470518A (zh) | 2012-02-27 | 2015-03-25 | 沃泰克斯药物股份有限公司 | 药物组合物及其施用 |
CA2963945C (en) | 2014-10-07 | 2023-01-10 | Vertex Pharmaceuticals Incorporated | Co-crystals of modulators of cystic fibrosis transmembrane conductance regulator |
GB201617758D0 (en) | 2016-10-20 | 2016-12-07 | Almac Discovery Limited | Pharmaceutical compounds |
KR20220087497A (ko) | 2019-10-18 | 2022-06-24 | 더 리전츠 오브 더 유니버시티 오브 캘리포니아 | 병원성 혈관을 표적화하기 위한 화합물 및 방법 |
AR128577A1 (es) * | 2022-03-01 | 2024-05-22 | Syngenta Crop Protection Ag | Compuestos herbicidas |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
ZA928276B (en) * | 1991-10-31 | 1993-05-06 | Daiichi Seiyaku Co | Aromatic amidine derivates and salts thereof. |
US5340833A (en) * | 1992-05-01 | 1994-08-23 | Eisai Co., Ltd. | Urokinase inhibitors |
JP3457694B2 (ja) * | 1993-02-04 | 2003-10-20 | 第一製薬株式会社 | インフルエンザ感染予防・治療薬 |
MX9704059A (es) * | 1994-12-02 | 1997-08-30 | Yamanouchi Pharma Co Ltd | Derivado de amidinonaftilo novedoso o sal del mismo. |
AU735144B2 (en) * | 1997-07-23 | 2001-07-05 | Yamanouchi Pharmaceutical Co., Ltd. | Novel hexahydro-1,4-diazepine derivatives or their salts |
-
1998
- 1998-07-23 ZA ZA986594A patent/ZA986594B/xx unknown
- 1998-07-24 IL IL13336898A patent/IL133368A0/xx unknown
- 1998-07-24 SK SK1748-99A patent/SK174899A3/sk unknown
- 1998-07-24 KR KR1019997012528A patent/KR20010014369A/ko not_active Application Discontinuation
- 1998-07-24 PL PL98339429A patent/PL339429A1/xx unknown
- 1998-07-24 JP JP51012199A patent/JP2002512636A/ja active Pending
- 1998-07-24 EP EP98937082A patent/EP1000018A2/en not_active Withdrawn
- 1998-07-24 CN CN98806826A patent/CN1265645A/zh active Pending
- 1998-07-24 BR BR9811099-3A patent/BR9811099A/pt not_active Application Discontinuation
- 1998-07-24 WO PCT/US1998/015386 patent/WO1999005096A2/en not_active Application Discontinuation
- 1998-07-24 AU AU85874/98A patent/AU8587498A/en not_active Abandoned
- 1998-07-24 CA CA002294300A patent/CA2294300A1/en not_active Abandoned
- 1998-07-24 HU HU0100353A patent/HUP0100353A3/hu unknown
- 1998-07-27 AR ARP980103690A patent/AR013372A1/es unknown
-
1999
- 1999-12-10 BG BG103981A patent/BG103981A/bg unknown
- 1999-12-30 NO NO996578A patent/NO996578L/no not_active Application Discontinuation
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR101228385B1 (ko) * | 2004-09-21 | 2013-02-04 | 빌렉스 아게 | 페닐알라닌 유도체의 안정한 제형 |
Also Published As
Publication number | Publication date |
---|---|
AU8587498A (en) | 1999-02-16 |
NO996578L (no) | 2000-01-25 |
CA2294300A1 (en) | 1999-02-04 |
EP1000018A2 (en) | 2000-05-17 |
BG103981A (bg) | 2000-11-30 |
HUP0100353A2 (hu) | 2001-05-28 |
BR9811099A (pt) | 2002-05-14 |
WO1999005096A3 (en) | 1999-06-03 |
AR013372A1 (es) | 2000-12-27 |
NO996578D0 (no) | 1999-12-30 |
WO1999005096A2 (en) | 1999-02-04 |
SK174899A3 (en) | 2000-06-12 |
PL339429A1 (en) | 2000-12-18 |
ZA986594B (en) | 1999-01-27 |
HUP0100353A3 (en) | 2001-11-28 |
JP2002512636A (ja) | 2002-04-23 |
CN1265645A (zh) | 2000-09-06 |
IL133368A0 (en) | 2001-04-30 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR20010014369A (ko) | 유로키나제 억제제 | |
US6258822B1 (en) | Urokinase inhibitors | |
KR100359397B1 (ko) | 엔도텔린의 활성을 조절하는 비페닐설폰아미드 및 이의 유도체 | |
EP0570594B1 (en) | Hydroxamic acid derivative based on aromatic sulfonamide | |
US8598168B2 (en) | Inhibitors of histone deacetylase | |
KR100527620B1 (ko) | 소수성 유리 설폰아미드의 알칼리 금속 염의 제조방법 | |
JP2005500312A (ja) | グルコキナーゼ(glk)モジュレーターとしてのアミノニコチネート誘導体 | |
KR20130131459A (ko) | 항균제로서 유용한 플루오로-피리디논 유도체 | |
KR20050071472A (ko) | 퀴놀린 항생 물질 중간체의 제조 방법 | |
EP1140849A1 (en) | Aminoalcohol derivatives and their use as beta 3 adrenergic agonists | |
JP2003176288A (ja) | エンドテリン介在障害治療用のスルホンアミド類 | |
KR19990071666A (ko) | 술파미드 유도체 | |
AU652433B2 (en) | Indoles useful as platelet activating factor antagonists | |
US20020143034A1 (en) | Aminoalcohol derivatives and their use as beta 3 adrenergic agonists | |
US6284796B1 (en) | Ukokinase inhibitors | |
KR20030060968A (ko) | 파르네실트랜스퍼라제 억제제 | |
US6812237B2 (en) | N-substituted peptidyl nitriles as cysteine cathepsin inhibitors | |
US20030087940A1 (en) | Farnesyltransferase inhibitors | |
KR20200091424A (ko) | 벤젠 축합 헤테로환 화합물 및 그 용도 | |
ZA200104979B (en) | Reverse hydroxamate inhibitors of matrix mettaloproteinases. | |
CZ467099A3 (cs) | Inhibitory urokinasy | |
EP1283825A1 (en) | N-substituted peptidyl nitriles as cysteine cathepsin inhibitors | |
JP2006509035A (ja) | 抗菌剤としてのn−(4−(ピペラジン−1−イル)−フェニル−2−オキサゾリジノン−5−カルボキサミド誘導体および関連化合物 | |
WO2000044712A1 (en) | N-hydroxyformamide derivatives as inhibitors of matrix metalloproteinases | |
JP2001509151A (ja) | マトリックス金属プロテイナーゼおよびTNFα分泌の大環状阻害剤 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
WITN | Application deemed withdrawn, e.g. because no request for examination was filed or no examination fee was paid |