JPS593492B2 - 新規な含クロム錯体の製造方法 - Google Patents
新規な含クロム錯体の製造方法Info
- Publication number
- JPS593492B2 JPS593492B2 JP48138200A JP13820073A JPS593492B2 JP S593492 B2 JPS593492 B2 JP S593492B2 JP 48138200 A JP48138200 A JP 48138200A JP 13820073 A JP13820073 A JP 13820073A JP S593492 B2 JPS593492 B2 JP S593492B2
- Authority
- JP
- Japan
- Prior art keywords
- chromium
- formula
- parts
- dye
- complex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 21
- 229910052804 chromium Inorganic materials 0.000 title claims description 20
- 239000011651 chromium Substances 0.000 title claims description 17
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- -1 azo compound Chemical class 0.000 claims description 14
- 239000002738 chelating agent Substances 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 125000002091 cationic group Chemical group 0.000 claims description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 claims description 4
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 claims description 3
- 150000007530 organic bases Chemical class 0.000 claims description 3
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 claims 2
- YXAOOTNFFAQIPZ-UHFFFAOYSA-N 1-nitrosonaphthalen-2-ol Chemical compound C1=CC=CC2=C(N=O)C(O)=CC=C21 YXAOOTNFFAQIPZ-UHFFFAOYSA-N 0.000 claims 1
- XFYKHXQQNRESHU-UHFFFAOYSA-N 2,4-dichloro-6-hydroxybenzaldehyde Chemical compound OC1=CC(Cl)=CC(Cl)=C1C=O XFYKHXQQNRESHU-UHFFFAOYSA-N 0.000 claims 1
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 claims 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims 1
- 229960003540 oxyquinoline Drugs 0.000 claims 1
- GUEIZVNYDFNHJU-UHFFFAOYSA-N quinizarin Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2O GUEIZVNYDFNHJU-UHFFFAOYSA-N 0.000 claims 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000000975 dye Substances 0.000 description 28
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000004952 Polyamide Substances 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229920002647 polyamide Polymers 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- RZVXOCDCIIFGGH-UHFFFAOYSA-N chromium gold Chemical class [Cr].[Au] RZVXOCDCIIFGGH-UHFFFAOYSA-N 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 229920002284 Cellulose triacetate Polymers 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229960000359 chromic chloride Drugs 0.000 description 2
- 150000001844 chromium Chemical class 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- ZMESHQOXZMOOQQ-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ZMESHQOXZMOOQQ-UHFFFAOYSA-N 0.000 description 1
- FHMMQQXRSYSWCM-UHFFFAOYSA-N 1-aminonaphthalen-2-ol Chemical compound C1=CC=C2C(N)=C(O)C=CC2=C1 FHMMQQXRSYSWCM-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- KTHTXLUIEAIGCD-UHFFFAOYSA-N 2-amino-3,5-dichlorobenzoic acid Chemical compound NC1=C(Cl)C=C(Cl)C=C1C(O)=O KTHTXLUIEAIGCD-UHFFFAOYSA-N 0.000 description 1
- LWUAMROXVQLJKA-UHFFFAOYSA-N 2-amino-3-chlorobenzoic acid Chemical compound NC1=C(Cl)C=CC=C1C(O)=O LWUAMROXVQLJKA-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 1
- APVFQUYJXZZQRW-UHFFFAOYSA-N 2-amino-4-methylnaphthalen-1-ol Chemical compound C1=CC=C2C(C)=CC(N)=C(O)C2=C1 APVFQUYJXZZQRW-UHFFFAOYSA-N 0.000 description 1
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 1
- SZCPTRGBOVXVCA-UHFFFAOYSA-N 2-amino-6-chlorobenzoic acid Chemical compound NC1=CC=CC(Cl)=C1C(O)=O SZCPTRGBOVXVCA-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- SEEZWGFVHCMHJF-UHFFFAOYSA-N 2-nitrosophenol Chemical group OC1=CC=CC=C1N=O SEEZWGFVHCMHJF-UHFFFAOYSA-N 0.000 description 1
- ZRYCRPNCXLQHPN-UHFFFAOYSA-N 3-hydroxy-2-methylbenzaldehyde Chemical compound CC1=C(O)C=CC=C1C=O ZRYCRPNCXLQHPN-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- RUCHWTKMOWXHLU-UHFFFAOYSA-N 5-nitroanthranilic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(O)=O RUCHWTKMOWXHLU-UHFFFAOYSA-N 0.000 description 1
- AIBOXZCUYYHFTM-UHFFFAOYSA-N 6-methylquinolin-8-ol Chemical compound N1=CC=CC2=CC(C)=CC(O)=C21 AIBOXZCUYYHFTM-UHFFFAOYSA-N 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- RMXTYBQNQCQHEU-UHFFFAOYSA-N ac1lawpn Chemical class [Cr]#[Cr] RMXTYBQNQCQHEU-UHFFFAOYSA-N 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- FGCPAXRNQIOISG-UHFFFAOYSA-N ethyl 5-oxo-1,2-dihydropyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(O)NN=1 FGCPAXRNQIOISG-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 235000019960 monoglycerides of fatty acid Nutrition 0.000 description 1
- DSEQJUPGRWESKP-UHFFFAOYSA-N n-(2-hydroxy-5-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC(C)=CC=C1O DSEQJUPGRWESKP-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229950006098 orthocaine Drugs 0.000 description 1
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/04—Azo compounds in general
- C09B45/06—Chromium compounds
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B55/00—Azomethine dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7246599A FR2212398B1 (forum.php) | 1972-12-28 | 1972-12-28 | |
| FR7246599 | 1972-12-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5012117A JPS5012117A (forum.php) | 1975-02-07 |
| JPS593492B2 true JPS593492B2 (ja) | 1984-01-24 |
Family
ID=9109418
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP48138200A Expired JPS593492B2 (ja) | 1972-12-28 | 1973-12-13 | 新規な含クロム錯体の製造方法 |
| JP56215912A Pending JPS57133280A (en) | 1972-12-28 | 1981-12-24 | Dyeing of synthetic material using new chromium containing complex |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56215912A Pending JPS57133280A (en) | 1972-12-28 | 1981-12-24 | Dyeing of synthetic material using new chromium containing complex |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4123429A (forum.php) |
| JP (2) | JPS593492B2 (forum.php) |
| AR (1) | AR197927A1 (forum.php) |
| BE (1) | BE809185A (forum.php) |
| BR (1) | BR7310166D0 (forum.php) |
| CA (1) | CA1012966A (forum.php) |
| CH (3) | CH555674A4 (forum.php) |
| CS (1) | CS220752B2 (forum.php) |
| DD (2) | DD115168A5 (forum.php) |
| DE (1) | DE2361837C2 (forum.php) |
| ES (1) | ES420946A1 (forum.php) |
| FR (1) | FR2212398B1 (forum.php) |
| GB (1) | GB1458827A (forum.php) |
| IT (1) | IT1000659B (forum.php) |
| NL (1) | NL7316636A (forum.php) |
| PL (1) | PL91126B1 (forum.php) |
| SU (1) | SU795498A3 (forum.php) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2219964B1 (forum.php) * | 1973-03-02 | 1978-03-03 | Ugine Kuhlmann | |
| CH599308A5 (forum.php) * | 1974-07-05 | 1978-05-31 | Ciba Geigy Ag | |
| EP0000331B1 (de) * | 1977-06-23 | 1983-12-28 | Ciba-Geigy Ag | Verfahren zum Färben linearer Polyamide in der Masse mit Salzen von 1:2 Chromkomplex-monoazofarbstoffen; die damit erzeugten Fasern |
| US4265811A (en) * | 1979-01-08 | 1981-05-05 | Polaroid Corporation | Novel azo dyes |
| US4231950A (en) * | 1979-03-23 | 1980-11-04 | Polaroid Corporation | Yellow azomethine dye developers |
| EP0135272B1 (en) * | 1983-07-26 | 1988-08-24 | I.C.I. Francolor S.A. | Metal complex compounds, their preparation and use |
| CH656140A5 (de) * | 1983-11-04 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
| CH656141A5 (de) * | 1983-11-07 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
| CH656142A5 (de) * | 1983-11-10 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
| US5314998A (en) * | 1992-09-08 | 1994-05-24 | Minnesota Mining And Manufacturing Company | Organic solvent-soluble metal-azo and metal-azomethine dyes |
| FR2790914B1 (fr) | 1999-03-19 | 2003-10-31 | Rhodia Chimie Sa | Utilisation de matrices polymeres reticulees en tant qu'agents anti-lessivage dans des formulations phytosanitaires |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2708193A (en) * | 1950-06-29 | 1955-05-10 | Basf Ag | Water-soluble chromium-containing azo dyestuffs |
| NL131003C (forum.php) * | 1964-10-20 | |||
| GB1136905A (en) * | 1965-02-02 | 1968-12-18 | Ici Ltd | 1:1 cobalt azo dyestuff complexes |
| US3356671A (en) * | 1965-03-17 | 1967-12-05 | Ici Ltd | Process of preparing unsymmetrical 1:2-cobalt complexed azo compounds |
| US3563739A (en) * | 1965-09-13 | 1971-02-16 | Polaroid Corp | Novel products,processes and compositions comprising metal-complexed dye developers |
| US3453107A (en) * | 1965-09-13 | 1969-07-01 | Polaroid Corp | Novel photographic products,processes and compositions |
| DE1572029B1 (de) * | 1967-03-29 | 1970-11-19 | Polaroid Corp | Lichtempfindliches Aufzeichnungsmaterial fuer das Entwicklerfarbstoff-Diffusionsverfahren und hierfuer geeigneter Entwickler |
| GB1312975A (en) * | 1969-06-04 | 1973-04-11 | Polaroid Corp | Photographic products and processes |
| FR2219964B1 (forum.php) * | 1973-03-02 | 1978-03-03 | Ugine Kuhlmann |
-
1972
- 1972-12-28 FR FR7246599A patent/FR2212398B1/fr not_active Expired
-
1973
- 1973-11-28 ES ES420946A patent/ES420946A1/es not_active Expired
- 1973-12-05 NL NL7316636A patent/NL7316636A/xx not_active Application Discontinuation
- 1973-12-12 DE DE2361837A patent/DE2361837C2/de not_active Expired
- 1973-12-13 CH CH555674D patent/CH555674A4/xx unknown
- 1973-12-13 JP JP48138200A patent/JPS593492B2/ja not_active Expired
- 1973-12-13 CH CH1748373A patent/CH572514A5/xx not_active IP Right Cessation
- 1973-12-13 CH CH555674A patent/CH603889B5/xx not_active IP Right Cessation
- 1973-12-19 GB GB5874373A patent/GB1458827A/en not_active Expired
- 1973-12-21 AR AR251663A patent/AR197927A1/es active
- 1973-12-21 DD DD181803*A patent/DD115168A5/xx unknown
- 1973-12-21 DD DD175623A patent/DD110047A5/xx unknown
- 1973-12-27 SU SU731983801A patent/SU795498A3/ru active
- 1973-12-27 BE BE139346A patent/BE809185A/xx not_active IP Right Cessation
- 1973-12-27 CA CA189,034A patent/CA1012966A/fr not_active Expired
- 1973-12-27 BR BR10166/73A patent/BR7310166D0/pt unknown
- 1973-12-27 CS CS739035A patent/CS220752B2/cs unknown
- 1973-12-28 PL PL1973167678A patent/PL91126B1/pl unknown
- 1973-12-28 IT IT70889/73A patent/IT1000659B/it active
-
1976
- 1976-10-27 US US05/736,027 patent/US4123429A/en not_active Expired - Lifetime
-
1981
- 1981-12-24 JP JP56215912A patent/JPS57133280A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2361837C2 (de) | 1983-11-03 |
| CA1012966A (fr) | 1977-06-28 |
| CH603889B5 (forum.php) | 1978-08-31 |
| CH572514A5 (forum.php) | 1976-02-13 |
| DD115168A5 (forum.php) | 1975-09-12 |
| DE2361837A1 (de) | 1974-07-11 |
| SU795498A3 (ru) | 1981-01-07 |
| CH555674A4 (forum.php) | 1975-12-15 |
| GB1458827A (en) | 1976-12-15 |
| BE809185A (fr) | 1974-06-27 |
| AR197927A1 (es) | 1974-05-15 |
| FR2212398A1 (forum.php) | 1974-07-26 |
| DD110047A5 (forum.php) | 1974-12-05 |
| AU6401373A (en) | 1975-07-03 |
| JPS57133280A (en) | 1982-08-17 |
| PL91126B1 (forum.php) | 1977-02-28 |
| FR2212398B1 (forum.php) | 1976-06-04 |
| BR7310166D0 (pt) | 1974-08-15 |
| ES420946A1 (es) | 1976-09-01 |
| NL7316636A (forum.php) | 1974-07-02 |
| CS220752B2 (en) | 1983-04-29 |
| JPS5012117A (forum.php) | 1975-02-07 |
| IT1000659B (it) | 1976-04-10 |
| US4123429A (en) | 1978-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2673199A (en) | Metalliferous azo dyestuffs | |
| US2985646A (en) | Chromium-containing dyestuffs | |
| JPS593492B2 (ja) | 新規な含クロム錯体の製造方法 | |
| US4045423A (en) | Chromium complexes of phenylazopyrazolyl or phenylazonaphthol dyestuffs and acetylacetone | |
| US4052374A (en) | Unsymmetrical 1:2-chromium complexes containing an azo compound and an azomethine compound | |
| JPS5839185B2 (ja) | シンキクロムサクタイセンリヨウノセイホウ | |
| US4234479A (en) | Chromium mixed complex dyestuffs of phenyl-azo-pyrazole components | |
| US3389132A (en) | Metalliferous azomethine containing azo dyestuffs containing an 8-aminoquinoline group | |
| US3221003A (en) | Chrgmium cqmplex mixed azo dyestuffs | |
| JPS5921904B2 (ja) | 新規金属アゾ染料の製法 | |
| US4264326A (en) | New disperse dyestuffs; their preparation and their applications to the coloration of synthetic materials | |
| US2891938A (en) | Chromium-containing monoazo dyestuffs | |
| US3661898A (en) | Metalliferous dyes | |
| US4396544A (en) | Asymmetric 1:2 chromium complexes of monoazo compounds | |
| US4019857A (en) | Process for the coloration of hydrophobic chemical fibers by metalliferous dyestuffs of cationic character | |
| US1943170A (en) | Azo-dyestuffs and process of making same | |
| US3102110A (en) | Chromium-containing azo dyestuffs | |
| JPS582351A (ja) | ポリエステル繊維用モノアゾ染料 | |
| JP3006618B2 (ja) | モノアゾ染料 | |
| US2538741A (en) | Monoazo-dyestuffs and process of making same | |
| US3701769A (en) | N-(p-aminophenyl) pyrrolidine containing monoazo dyes | |
| US2829139A (en) | Metalliferous azo dyestuff | |
| JPS62225563A (ja) | 1:2−金属錯塩アゾ染料の製造方法 | |
| US2714102A (en) | O-hydroxy-o'-carboxy azo dyestuffs | |
| US2829140A (en) | Azo dyestuffs containing heavy metal in complex union |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 19820608 |