JPH0733744B2 - 冷蔵庫のレールなし展示ドア - Google Patents
冷蔵庫のレールなし展示ドアInfo
- Publication number
- JPH0733744B2 JPH0733744B2 JP3268558A JP26855891A JPH0733744B2 JP H0733744 B2 JPH0733744 B2 JP H0733744B2 JP 3268558 A JP3268558 A JP 3268558A JP 26855891 A JP26855891 A JP 26855891A JP H0733744 B2 JPH0733744 B2 JP H0733744B2
- Authority
- JP
- Japan
- Prior art keywords
- door
- glass panel
- rail
- refrigerator according
- glass
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000011521 glass Substances 0.000 claims description 130
- 125000006850 spacer group Chemical group 0.000 claims description 40
- 230000002093 peripheral effect Effects 0.000 claims description 27
- 239000003566 sealing material Substances 0.000 claims description 20
- 229920001971 elastomer Polymers 0.000 claims description 11
- 239000002274 desiccant Substances 0.000 claims description 10
- 238000003466 welding Methods 0.000 claims description 4
- 239000000872 buffer Substances 0.000 claims description 3
- 239000000565 sealant Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 description 15
- 238000012856 packing Methods 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- 239000006096 absorbing agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 229920001084 poly(chloroprene) Polymers 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000008393 encapsulating agent Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000011152 fibreglass Substances 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 241000219000 Populus Species 0.000 description 1
- 241000219492 Quercus Species 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000013013 elastic material Substances 0.000 description 1
- 235000013611 frozen food Nutrition 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B3/00—Window sashes, door leaves, or like elements for closing wall or like openings; Layout of fixed or moving closures, e.g. windows in wall or like openings; Features of rigidly-mounted outer frames relating to the mounting of wing frames
- E06B3/66—Units comprising two or more parallel glass or like panes permanently secured together
- E06B3/663—Elements for spacing panes
- E06B3/66309—Section members positioned at the edges of the glazing unit
- E06B3/66342—Section members positioned at the edges of the glazing unit characterised by their sealed connection to the panes
- E06B3/66352—Section members positioned at the edges of the glazing unit characterised by their sealed connection to the panes with separate sealing strips between the panes and the spacer
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47F—SPECIAL FURNITURE, FITTINGS, OR ACCESSORIES FOR SHOPS, STOREHOUSES, BARS, RESTAURANTS OR THE LIKE; PAYING COUNTERS
- A47F3/00—Show cases or show cabinets
- A47F3/04—Show cases or show cabinets air-conditioned, refrigerated
- A47F3/0404—Cases or cabinets of the closed type
- A47F3/0426—Details
- A47F3/043—Doors, covers
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B3/00—Window sashes, door leaves, or like elements for closing wall or like openings; Layout of fixed or moving closures, e.g. windows in wall or like openings; Features of rigidly-mounted outer frames relating to the mounting of wing frames
- E06B3/54—Fixing of glass panes or like plates
- E06B3/5427—Fixing of glass panes or like plates the panes mounted flush with the surrounding frame or with the surrounding panes
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B3/00—Window sashes, door leaves, or like elements for closing wall or like openings; Layout of fixed or moving closures, e.g. windows in wall or like openings; Features of rigidly-mounted outer frames relating to the mounting of wing frames
- E06B3/66—Units comprising two or more parallel glass or like panes permanently secured together
- E06B3/6621—Units comprising two or more parallel glass or like panes permanently secured together with special provisions for fitting in window frames or to adjacent units; Separate edge protecting strips
-
- E—FIXED CONSTRUCTIONS
- E06—DOORS, WINDOWS, SHUTTERS, OR ROLLER BLINDS IN GENERAL; LADDERS
- E06B—FIXED OR MOVABLE CLOSURES FOR OPENINGS IN BUILDINGS, VEHICLES, FENCES OR LIKE ENCLOSURES IN GENERAL, e.g. DOORS, WINDOWS, BLINDS, GATES
- E06B3/00—Window sashes, door leaves, or like elements for closing wall or like openings; Layout of fixed or moving closures, e.g. windows in wall or like openings; Features of rigidly-mounted outer frames relating to the mounting of wing frames
- E06B3/66—Units comprising two or more parallel glass or like panes permanently secured together
- E06B3/663—Elements for spacing panes
- E06B3/66309—Section members positioned at the edges of the glazing unit
- E06B3/66366—Section members positioned at the edges of the glazing unit specially adapted for units comprising more than two panes or for attaching intermediate sheets
Landscapes
- Engineering & Computer Science (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- Thermal Sciences (AREA)
- Refrigerator Housings (AREA)
- Freezers Or Refrigerated Showcases (AREA)
- Securing Of Glass Panes Or The Like (AREA)
- Hinge Accessories (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US644072 | 1984-08-24 | ||
| US07/585,602 US5097642A (en) | 1990-09-20 | 1990-09-20 | Glass refrigerator door structure |
| US585602 | 1990-09-20 | ||
| US07/644,072 US5113628A (en) | 1990-09-20 | 1991-01-18 | Railless refrigerator display door |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH04254685A JPH04254685A (ja) | 1992-09-09 |
| JPH0733744B2 true JPH0733744B2 (ja) | 1995-04-12 |
Family
ID=27079444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3268558A Expired - Lifetime JPH0733744B2 (ja) | 1990-09-20 | 1991-09-20 | 冷蔵庫のレールなし展示ドア |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US5113628A (show.php) |
| JP (1) | JPH0733744B2 (show.php) |
| KR (1) | KR960005635B1 (show.php) |
| CA (1) | CA2049389C (show.php) |
| DE (1) | DE4129735A1 (show.php) |
| ES (1) | ES2041569B1 (show.php) |
| FR (1) | FR2667137A1 (show.php) |
| GB (1) | GB2248084B (show.php) |
| IT (1) | IT1250096B (show.php) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5255473A (en) * | 1989-12-11 | 1993-10-26 | Ardco, Inc. | Refrigerator door assembly with stylized substantially all glass front |
| US5363611A (en) * | 1990-09-20 | 1994-11-15 | Anthony's Manufacturing Company, Inc. | Foam rail door |
| US5097642A (en) | 1990-09-20 | 1992-03-24 | Anthony's Manufacturing Company, Inc. | Glass refrigerator door structure |
| US5910083A (en) * | 1990-09-20 | 1999-06-08 | New Anthony, Inc. | Integral spacer for door rail |
| DE4300481A1 (de) * | 1993-01-11 | 1994-07-14 | Kunert Heinz | Rahmenlose Isolierverglasung und Verfahren zu deren Herstellung |
| CA2128992A1 (en) * | 1993-09-20 | 1995-03-21 | Billy P. Gibson, Jr. | Flush appearance trim with allowance for door adjustability |
| DE29505223U1 (de) * | 1995-03-15 | 1995-06-01 | Lilge, Helmut, 94469 Deggendorf | Türflügel für Gebäudeaußentür |
| DK0745750T3 (da) * | 1995-06-02 | 2001-05-21 | Saint Gobain | Glaspanel |
| DE29723777U1 (de) * | 1996-07-11 | 1999-04-01 | Woschko, Donat, 74182 Obersulm | Rahmenlose Tür- oder Fensterflügelanordnung mit Isolierverglasung |
| DE19634695C1 (de) * | 1996-08-28 | 1997-11-20 | Dorma Gmbh & Co Kg | Rahmenlose Glastür mit rahmenlosem Seitenteil |
| US6318027B1 (en) * | 1998-03-03 | 2001-11-20 | New Anthony, Inc. | Display case door |
| US6637093B2 (en) | 1998-03-03 | 2003-10-28 | Anthony, Inc. | Method of assembling a display case door |
| DE60013336T8 (de) * | 1999-02-11 | 2005-06-02 | Cisaplast S.R.L., Suzzara | Abschlusstür für Kühlmöbel und Verfahren zu ihrer Herstellung |
| US6148563A (en) * | 1999-03-25 | 2000-11-21 | Hussmann Corporation | Reach-in door for refrigerated merchandiser |
| US20030062813A1 (en) * | 2001-07-19 | 2003-04-03 | Cording Christopher R. | Energy-free refrigeration door and method for making the same |
| FR2845750B1 (fr) * | 2002-10-09 | 2005-04-29 | Saint Gobain | Joint d'etancheite et vitrage isolant incorporant ce joint d'etancheite |
| US7043886B1 (en) * | 2003-01-07 | 2006-05-16 | Thermoseal Glass Corp. | Refrigerator door assembly |
| WO2005021886A1 (en) * | 2003-09-03 | 2005-03-10 | Mckinlay King, Julian | Improvements in insulated panels |
| DE10358731A1 (de) * | 2003-12-15 | 2005-07-14 | BSH Bosch und Siemens Hausgeräte GmbH | Gehäuse für ein Haushaltsgerät |
| DE202005000923U1 (de) * | 2004-11-29 | 2006-04-06 | Liebherr-Hausgeräte Lienz Gmbh | Kühl- und/oder Gefriergerät |
| DE202004019865U1 (de) * | 2004-11-29 | 2006-04-06 | Liebherr-Hausgeräte Lienz Gmbh | Kühl- und/oder Gefriergerät |
| DE102004062060B3 (de) * | 2004-12-23 | 2006-05-18 | Saint-Gobain Glass Deutschland Gmbh | Fensterscheibe mit einem Sicherungselement |
| WO2006118567A1 (en) * | 2005-04-28 | 2006-11-09 | Carrier Corporation | Frameless door suspension |
| GB2439328B (en) * | 2006-06-22 | 2012-07-04 | Panasonic Mfg Uk Ltd | Domestic appliance with concealed hinge |
| US20080036350A1 (en) * | 2006-08-09 | 2008-02-14 | Maytag Corp. | Trim piece cover for a refrigerator door |
| DE102007059222A1 (de) * | 2007-12-07 | 2009-07-30 | Raumplus Gmbh & Co. Kg | Wand-, Tür- oder Fensterelement |
| US8393130B2 (en) * | 2010-06-09 | 2013-03-12 | Hill Phoenix, Inc. | Door module for a refrigerated case |
| US8845045B2 (en) | 2010-06-09 | 2014-09-30 | Hill Phoenix, Inc. | Door closing control and electrical connectivity system for refrigerated case |
| US8776439B2 (en) | 2010-06-09 | 2014-07-15 | Hill Phoenix, Inc. | Modular door system for refrigerated case |
| US9157675B2 (en) | 2010-06-09 | 2015-10-13 | Hill Phoenix, Inc. | Insulated case construction |
| US20130319598A1 (en) | 2012-05-30 | 2013-12-05 | Cardinal Ig Company | Asymmetrical insulating glass unit and spacer system |
| DE102014015788B4 (de) * | 2014-10-24 | 2017-12-07 | Michatek, K.S. | Vakuumschublade zum Vakuumieren von Lebensmitteln mit betätigbarem Deckel |
| JP2017142051A (ja) * | 2016-02-09 | 2017-08-17 | 旭硝子株式会社 | 保冷ショーケース用ガラスドア、及び保冷ショーケース |
| US9687087B1 (en) | 2016-06-16 | 2017-06-27 | Anthony, Inc. | Display case door assembly with vacuum panel and lighting features |
| US10295248B2 (en) | 2017-01-09 | 2019-05-21 | Electrolux Home Products, Inc. | Refrigerator with glass door |
| US20230015006A1 (en) * | 2020-04-01 | 2023-01-19 | Leonid Oleksandrovych Lazebnikov | Translucent enclosing structure |
| US12538989B2 (en) * | 2020-11-12 | 2026-02-03 | Hussmann Corporation | Transparent door |
Family Cites Families (146)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1636593A (en) * | 1927-07-19 | John edwin dennis | ||
| US834968A (en) * | 1905-11-15 | 1906-11-06 | Lars Christenson | Hollow fireproof double-glazed window. |
| US1117340A (en) * | 1914-05-12 | 1914-11-17 | Crittall Mfg Co Ltd | Double glazing. |
| US1877336A (en) * | 1930-12-18 | 1932-09-13 | Lovell George | Panel for the walls and doors of refrigerators and cold storage rooms |
| US1975895A (en) * | 1933-06-19 | 1934-10-09 | Gen Motors Corp | Sealed double-pane glass and frame |
| US2173664A (en) * | 1936-03-23 | 1939-09-19 | Gen Motors Corp | Double windowpane construction |
| US2282831A (en) * | 1936-03-23 | 1942-05-12 | Gen Motors Corp | Method of making multiple windowpane units |
| US2173649A (en) * | 1937-08-26 | 1939-09-19 | Gen Motors Corp | Multiple windowpane construction |
| US2205522A (en) * | 1937-12-15 | 1940-06-25 | Pittsburgh Plate Glass Co | Double glazing unit |
| US2383691A (en) * | 1942-11-13 | 1945-08-28 | Maytag Co | Window construction |
| US2348307A (en) * | 1942-12-03 | 1944-05-09 | Gen Motors Corp | Double windowpane |
| US2589064A (en) * | 1946-02-26 | 1952-03-11 | Libbey Owens Ford Glass Co | Multiple sheet glazing units |
| US2489962A (en) * | 1946-11-29 | 1949-11-29 | Christopher L Hardwick | Oven door |
| US2607086A (en) * | 1947-07-17 | 1952-08-19 | Saunders Ralph | Refrigerator door construction |
| US2708774A (en) * | 1949-11-29 | 1955-05-24 | Rca Corp | Multiple glazed unit |
| US2679074A (en) * | 1952-07-22 | 1954-05-25 | Norman E Bryden | Door construction |
| US2904819A (en) * | 1953-02-10 | 1959-09-22 | David J Seaman | Closure structure |
| US2774117A (en) * | 1955-07-20 | 1956-12-18 | Oliver C Eckel | Resilient door with offset mount |
| US2872713A (en) * | 1956-07-19 | 1959-02-10 | Window Products Inc | Insulated metal-framed window sash |
| US2975492A (en) * | 1956-09-18 | 1961-03-21 | Persson Sven Eric | Windows with one or more metal section sashes for three window panes |
| US2909814A (en) * | 1956-12-05 | 1959-10-27 | James W Schwartz | Multiple panel glazing units |
| US2873486A (en) * | 1956-12-10 | 1959-02-17 | Pittsburgh Plate Glass Co | Multiple glazed unit |
| US2880475A (en) * | 1957-05-10 | 1959-04-07 | Mills Prod Inc | Window unit |
| US2877761A (en) * | 1957-06-14 | 1959-03-17 | Westinghouse Electric Corp | Oven door window |
| DE1082386B (de) * | 1957-08-22 | 1960-05-25 | Thermo Chemical Dev Company | Mehrscheibenisolierglas |
| US3030673A (en) * | 1957-12-26 | 1962-04-24 | Harry J London | Multiple glass sheet glazing unit |
| US2877516A (en) * | 1958-01-17 | 1959-03-17 | Pittsburgh Plate Glass Co | Multiple glazed unit |
| US2987782A (en) * | 1960-01-08 | 1961-06-13 | Aluminum Refrigerator Door Co | Refrigerator door |
| US3024880A (en) * | 1961-01-24 | 1962-03-13 | Seaporcel Metals Inc | Translucent building panels |
| US3077643A (en) * | 1961-04-10 | 1963-02-19 | Carl L Horner | Sun screens |
| US3170456A (en) * | 1963-09-09 | 1965-02-23 | Gordon E Moss | Oven double pane door units and method of making same |
| US3280523A (en) * | 1964-01-08 | 1966-10-25 | Pittsburgh Plate Glass Co | Multiple glazing unit |
| US3339225A (en) * | 1964-03-30 | 1967-09-05 | Booth John Summer | Torsion door hinge |
| US3300900A (en) * | 1964-12-21 | 1967-01-31 | Loup Engineering Company | Pivotal door construction and method |
| US3331159A (en) * | 1965-04-23 | 1967-07-18 | Clark Equipment Co | Swinging door construction |
| US3335785A (en) * | 1965-08-24 | 1967-08-15 | Nat Lock Co | Bifold door hardware |
| US3418779A (en) * | 1966-05-09 | 1968-12-31 | Shatterproof Glass Corp | Window units |
| US3396490A (en) * | 1966-08-01 | 1968-08-13 | Dukas John | Door and frame constructions |
| US3411247A (en) * | 1966-10-10 | 1968-11-19 | Amerace Corp | Refrigerator door frame |
| US3425163A (en) * | 1966-11-14 | 1969-02-04 | Ppg Industries Inc | Preglazed sliding panel |
| US3442059A (en) * | 1967-01-31 | 1969-05-06 | Gerald Kessler | Plastic edge channel for glass windows |
| GB1301651A (show.php) | 1968-10-08 | 1973-01-04 | ||
| US3629972A (en) * | 1970-02-09 | 1971-12-28 | Ardco Inc | Refrigerator door construction |
| US3577973A (en) * | 1970-02-25 | 1971-05-11 | Mills Prod Inc | Oven door window unit |
| US3667179A (en) * | 1970-05-01 | 1972-06-06 | Biltbest Corp | Wooden window units having protective coverings |
| US3662429A (en) * | 1970-09-23 | 1972-05-16 | Lawrence Brothers | Door pivot assembly |
| BE785765A (show.php) | 1971-07-08 | 1973-01-03 | Glaverbel | |
| US3855995A (en) * | 1971-08-16 | 1974-12-24 | Bentley Lab | Ventricle assembly for pulsatile-type pump |
| DE2237018C3 (de) * | 1972-07-27 | 1979-08-09 | Bostik Gmbh, 6370 Oberursel | Mehrscheiben-Isolierglas mit einem randseitig angeordneten Abstandhalter, der als innen mit Öffnungen versehenes Hohlprofil ausgebildet ist |
| US3919023A (en) * | 1973-09-24 | 1975-11-11 | Ppg Industries Inc | Multiple glazed unit |
| JPS5245092Y2 (show.php) * | 1973-12-03 | 1977-10-13 | ||
| FR2278896A1 (fr) | 1974-03-29 | 1976-02-13 | Saint Gobain | Dispositif pour le montage des vitrages simples ou multiples dans le batiment |
| NL7404741A (nl) | 1974-04-08 | 1975-10-10 | Lebon En Visser N V | Vloeistoftank, in het bijzonder tank voor een afleveringsinstallatie voor vloeibare brandstof. |
| US3889434A (en) * | 1974-04-12 | 1975-06-17 | Lyle N Shelver | Thermal glass structural device |
| US3965638A (en) * | 1974-07-02 | 1976-06-29 | Ira W. Fine | Insulated glass panel |
| JPS5134544A (show.php) * | 1974-07-19 | 1976-03-24 | Daburyu Buraun Jeemuzu | |
| US3949526A (en) * | 1974-07-31 | 1976-04-13 | H. A. Brown Limited | Door construction |
| FR2294314A1 (fr) * | 1974-12-11 | 1976-07-09 | Saint Gobain | Intercalaire pour vitrages multiples |
| DE2501096B2 (de) * | 1975-01-13 | 1976-10-28 | Vennemann, Horst, 7180 Crailsheim | Randleiste zur herstellung von isolierglasscheiben, mehrscheiben-isolierglas sowie verfahren zu seiner herstellung |
| US3975881A (en) * | 1975-03-13 | 1976-08-24 | Ninowski Jr James | Window assembly |
| GB1541682A (en) * | 1975-04-22 | 1979-03-07 | Yoshida Kogyo Kk | Gasket construction |
| US4295305A (en) * | 1975-06-09 | 1981-10-20 | Shelver Lyle N | Thermal glass structure and method for forming same |
| US4015394A (en) * | 1975-10-14 | 1977-04-05 | Gerald Kessler | Double-insulated glass window with insulating spacer |
| US4042736A (en) * | 1975-10-28 | 1977-08-16 | Flint Theodore R | Insulating glass units |
| US4030263A (en) * | 1975-11-11 | 1977-06-21 | D.C. Glass Ltd. | Protective capping channel for glass sealed unit |
| DK169476A (da) * | 1976-04-12 | 1977-10-13 | Scanglas As | Fremgangsmade til fremstilling af et termovindue med mindst to glasruder og samleorgan til udovelse af fremgangsmaden |
| DK177676A (da) | 1976-04-20 | 1977-10-21 | Johansen Joergen Skoubo | Indbygningsferdigt glaspanel |
| DK177576A (da) | 1976-04-20 | 1977-10-21 | Johansen Joergen Skoubo | Indbygningsferdigt glaspanel |
| US4043091A (en) * | 1976-06-04 | 1977-08-23 | Mills Products, Inc. | Flange mount oven door window |
| FR2355986A1 (fr) | 1976-06-24 | 1978-01-20 | Saint Gobain | Perfectionnement au montage des vantaux vitres |
| CH608071A5 (en) | 1976-10-07 | 1978-12-15 | Adolphe John Girardy | Metal framing component for doors and walls made of toughened glass plates |
| NL7702637A (nl) * | 1977-03-11 | 1978-09-13 | Philips Nv | Venster met twee op afstand van elkaar opgestel- de ruiten. |
| IT1081320B (it) * | 1977-03-15 | 1985-05-21 | Ip Ind Chimica Per L Arredamen | Struttura di affisso componibile costituita da profilati e da elementi di collegamento a squadra |
| US4149348A (en) * | 1977-07-15 | 1979-04-17 | Ppg Industries, Inc. | Multiple glazed unit having inner sheet mounted within a spacer |
| US4145844A (en) * | 1977-12-16 | 1979-03-27 | Ardco, Inc. | Refrigerator door construction |
| CA1105323A (en) * | 1977-12-16 | 1981-07-21 | Repla Limited | Window frame structure |
| US4223482A (en) * | 1978-01-16 | 1980-09-23 | Barroero Louis F | Refrigerator door structure |
| NL7802883A (nl) * | 1978-03-16 | 1979-09-18 | Stenman Holland Nv | Venster- of deurconstructie. |
| AT375728B (de) | 1978-03-17 | 1984-09-10 | Dornier System Gmbh | Fensterrahmen |
| GB2023209A (en) | 1978-04-05 | 1979-12-28 | Bostik Ltd | Spacer means |
| DE2840656A1 (de) | 1978-09-19 | 1980-03-27 | Weru Gmbh & Co Kg | Rahmen fuer fenster, tueren u.dgl. |
| DE2917095A1 (de) * | 1979-04-27 | 1980-11-13 | Licentia Gmbh | Kuehlschrank |
| EP0019020A1 (en) * | 1979-05-14 | 1980-11-26 | Perry Bros. (Hall Green) Ltd. | Door and method of construction thereof |
| US4348435A (en) * | 1980-03-19 | 1982-09-07 | Ppg Industries, Inc. | Primed multiple glazed units for curtainwall systems |
| DE3014207C2 (de) * | 1980-04-14 | 1983-12-29 | Bfg Glassgroup, Paris | Isolierglaseinheit mit Innenscheibe, Außenscheibe und Gasfüllung im Zwischenraum |
| JPS6047125B2 (ja) | 1980-04-17 | 1985-10-19 | 日産自動車株式会社 | 車両用開閉体における機能部品取付部構造 |
| DE3162499D1 (en) * | 1980-06-05 | 1984-04-12 | Rhee Jae Wha | Refrigerator |
| US4368226A (en) * | 1980-08-13 | 1983-01-11 | Gasper Mucaria | Glass units |
| US4382177A (en) * | 1980-09-15 | 1983-05-03 | Heaney James J | Substantially transparent insulating anti-condensation structure |
| US4429509A (en) * | 1981-03-10 | 1984-02-07 | Saint-Gobain Vitrage | Multiple glass pane with improved joints of plastic materials |
| US4393105A (en) * | 1981-04-20 | 1983-07-12 | Spire Corporation | Method of fabricating a thermal pane window and product |
| ES258870Y (es) * | 1981-05-15 | 1982-05-16 | Elemento aislante perfeccionado | |
| SE426873B (sv) | 1981-06-30 | 1983-02-14 | Electrolux Sarl | Kylskapsdorr med en ram av hopfogade delar |
| US4412708A (en) * | 1981-09-21 | 1983-11-01 | Pace Industries Inc. | Cabinet door hinge construction |
| US4454703A (en) * | 1981-11-12 | 1984-06-19 | Solar Structures Corp. | Solar panel |
| US4691486A (en) * | 1982-04-29 | 1987-09-08 | Frank Niekrasz | Glass assembly for refrigerator doors and method of manufacture |
| US4696078A (en) * | 1982-05-06 | 1987-09-29 | Anthony's Manufacturing Company, Inc. | Combined adjustable door hinge pin socket and adjustable torque rod anchor device |
| US4459789A (en) * | 1982-05-20 | 1984-07-17 | Ford Donald F | Window |
| US4514948A (en) * | 1982-06-01 | 1985-05-07 | Disco Aluminum Products Co., Inc. | Thermal break frame with load transfer member |
| US4496201A (en) * | 1982-07-23 | 1985-01-29 | Umc Industries, Inc. | Closure such as a glass door for a refrigeration or freezer |
| FR2535800B1 (fr) | 1982-11-05 | 1986-04-11 | Thomson Brandt | Dispositif de fixation et de reglage en position de panneaux d'habillage de portes et portes d'armoires frigorifiques integrables munies de panneaux fixes par ce dispositif |
| FR2543608B1 (fr) | 1983-03-28 | 1987-08-07 | Mondon Charles | Vitrage energetique " menuise " |
| DE3315346A1 (de) | 1983-04-28 | 1984-10-31 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Tuerlager fuer kuehl- oder gefriergeraete |
| US4552790A (en) * | 1983-06-30 | 1985-11-12 | Francis Geoffrey V | Structural spacer glazing with connecting spacer device |
| SE8304525L (sv) | 1983-08-19 | 1985-02-20 | Termofrost Sweden Ab | Dorr |
| DE3407639A1 (de) * | 1984-03-01 | 1985-09-12 | Gebrüder Kömmerling Kunststoffwerke GmbH, 6780 Pirmasens | Verbundstab, insbesondere fuer fensterrahmen, tuerrahmen und rollaeden |
| IT8434032U1 (it) | 1984-05-24 | 1985-11-24 | Zanussi Elettrodomestici | Porta per mobile frigorifero |
| EP0163166A3 (de) | 1984-05-29 | 1987-03-25 | Carl Schmitt | Abdeckplatte für oben offene Kühltruhen |
| DE3425991C1 (de) | 1984-07-14 | 1985-10-17 | Bauknecht Hausgeräte GmbH, 7000 Stuttgart | Einbaugeraet z.B. Kuehl- und Gefrierschrank fuer die Nischen von Kuechenmoebeln oder dergleichen |
| GB2162228B (en) * | 1984-07-25 | 1987-07-15 | Sanden Corp | Double-glazed window for a refrigerator |
| US4588235A (en) * | 1984-09-07 | 1986-05-13 | Barroero Louis F | Refrigerator door structure |
| DE3435379A1 (de) | 1984-09-27 | 1986-04-03 | August Bilstein GmbH & Co KG, 5828 Ennepetal | Vorrichtung und verfahren zum herstellen von loechern in kunststoff-hohlprofilstaeben |
| US4622249A (en) * | 1985-04-15 | 1986-11-11 | Ppg Industries, Inc. | Multiple pane unit having a flexible spacing and sealing assembly |
| EP0213970A3 (en) | 1985-05-21 | 1987-06-16 | Fernand Belanger | Adjustable door having an increased rigidity and method of adjusting the dimensions of a door |
| US4671582A (en) * | 1985-11-08 | 1987-06-09 | Anthony's Manufacturing Company, Inc. | Combined, plug-in hinge pin and double-ended electrical connector for a hinged appliance door, with mating receptacle and connectors |
| FR2590783B1 (fr) | 1985-11-29 | 1988-08-05 | Bonnet Refrigeration | Vitrine refrigeree a glace horizontalement pivotante et verticalement relevable |
| DE3543524A1 (de) | 1985-12-10 | 1987-06-25 | Eltreva Ag | Fenster- oder tuerfluegel |
| EP0228641A3 (en) * | 1985-12-20 | 1988-04-06 | Marco Fratti | Casing with fixed and/or movable frames for doors, windows and the like |
| DE3775430D1 (de) * | 1986-02-20 | 1992-02-06 | Saint Gobain Vitrage | Mehrfachverglasung, sowie herstellungsverfahren und vorrichtung hierfuer. |
| GB2190877B (en) | 1986-05-22 | 1990-02-14 | Glaverbel | Glazing panels |
| IT1189559B (it) | 1986-06-13 | 1988-02-04 | Eurodomestici Ind Riunite | Metodo ed apparecchiatura per produrre porte coibentate di apparecchi frigoriferi,in particolare domestici,e porta ottenuta |
| IT208901Z2 (it) | 1986-10-10 | 1988-05-28 | Mecfor Srl | Banco a vetrina refrigerata per l esposizione e la conservazione di gelato con piano trasparente sollevabile a ribalta di chiusura del vano di conservazione del gelato |
| DE3634793A1 (de) | 1986-10-11 | 1988-04-14 | Urban Maschinenbau | Verfahren zum verschweissen von kunststoffprofilen |
| FR2605551B1 (fr) | 1986-10-24 | 1989-06-02 | Peugeot | Cadre a structure composite et son procede de fabrication |
| US4753043A (en) * | 1986-12-11 | 1988-06-28 | Ardco Inc. | Pivotally mounted insulated glass door assembly with self-contained structural support frame |
| US4817335A (en) * | 1987-07-22 | 1989-04-04 | Robert Adell | Decorative clear plastic edge guard |
| US4807419A (en) * | 1987-03-25 | 1989-02-28 | Ppg Industries, Inc. | Multiple pane unit having a flexible spacing and sealing assembly |
| DE3713500A1 (de) | 1987-04-22 | 1988-11-10 | Hoermann Kg | Torblatt |
| US4818043A (en) * | 1987-05-13 | 1989-04-04 | Margaret P. Borgen | Product display and marketing device |
| NL8701895A (nl) | 1987-08-12 | 1989-03-01 | Tapper Beheer En Management B | Gevelelement uitgevoerd als structurele beglazing. |
| FR2619587B1 (fr) * | 1987-08-17 | 1992-02-21 | Felix Const Sa | Panneau de revetement ou de fenetre pour la surface exterieure d'une facade, et facade equipee d'un tel panneau |
| DE8714435U1 (de) | 1987-10-30 | 1989-02-23 | Licentia Patent-Verwaltungs-Gmbh, 6000 Frankfurt | Kühl- oder Gefriergerät mit Kühlraumbelüftung |
| DE3740059C3 (de) * | 1987-11-26 | 1998-03-26 | Schueco Int Gmbh & Co | Fassadenverkleidung |
| EP0319695B1 (de) | 1987-12-09 | 1992-05-06 | Metallbau Koller GmbH i.K. | Plattenkonstruktionen für die Bildung einer Fassade oder dergleichen bei einem Bauwerk |
| US4941289A (en) | 1987-12-10 | 1990-07-17 | Ardco, Inc. | Refrigerator door frame with insulated mullion |
| US4994309A (en) * | 1987-12-14 | 1991-02-19 | Lauren Manufacturing Company | Insulating multiple layer sealed units and insulating |
| IT1216012B (it) | 1988-03-07 | 1990-02-22 | Eurodomestici Ind Riunite | Frigorifero componibile. |
| IT1225115B (it) | 1988-07-14 | 1990-11-02 | Zanussi A Spa Industrie | Dispositivo di supporto di porte per scomparti refrigerati di apparecchiature refrigeranti. |
| US4890438A (en) * | 1988-09-30 | 1990-01-02 | Odl, Incorporated | Insulated glass construction and method of making same |
| US4961975A (en) * | 1988-11-14 | 1990-10-09 | Walter Bejnar | Sealed glass unit |
| US4950344A (en) * | 1988-12-05 | 1990-08-21 | Lauren Manufacturing Company | Method of manufacturing multiple-pane sealed glazing units |
| SE469800B (sv) * | 1989-01-20 | 1993-09-13 | Termofrost Sweden Ab | Dörrbladsprofil |
| IT1229130B (it) | 1989-03-09 | 1991-07-22 | Metra Trafilati Alluminio S P | Sistema di profilati, per la realizzazione di serramenti in genere. |
| IT217412Z2 (it) | 1989-07-26 | 1991-12-10 | Costan Spa | Mobile espositore con superfici vetrate. |
| US5024023A (en) * | 1989-12-11 | 1991-06-18 | Ardco, Inc. | Insulated refrigerator door assembly with substantially all glass front doors |
| US4998382A (en) * | 1989-12-11 | 1991-03-12 | Ardco, Inc. | Insulated refrigerator door assembly with substantially all glass front doors |
-
1991
- 1991-01-18 US US07/644,072 patent/US5113628A/en not_active Ceased
- 1991-08-16 CA CA002049389A patent/CA2049389C/en not_active Expired - Fee Related
- 1991-09-04 ES ES09101980A patent/ES2041569B1/es not_active Expired - Lifetime
- 1991-09-05 GB GB9118956A patent/GB2248084B/en not_active Expired - Fee Related
- 1991-09-06 DE DE4129735A patent/DE4129735A1/de not_active Withdrawn
- 1991-09-16 IT ITRM910688A patent/IT1250096B/it active IP Right Grant
- 1991-09-19 KR KR1019910016332A patent/KR960005635B1/ko not_active Expired - Fee Related
- 1991-09-20 FR FR9111664A patent/FR2667137A1/fr not_active Withdrawn
- 1991-09-20 JP JP3268558A patent/JPH0733744B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB9118956D0 (en) | 1991-10-23 |
| GB2248084A (en) | 1992-03-25 |
| ITRM910688A1 (it) | 1993-03-16 |
| US5113628A (en) | 1992-05-19 |
| KR960005635B1 (ko) | 1996-04-30 |
| ES2041569R (show.php) | 1995-05-01 |
| ES2041569A2 (es) | 1993-11-16 |
| CA2049389C (en) | 1996-06-18 |
| ES2041569B1 (es) | 1995-12-16 |
| IT1250096B (it) | 1995-03-30 |
| FR2667137A1 (fr) | 1992-03-27 |
| CA2049389A1 (en) | 1992-03-21 |
| GB2248084B (en) | 1994-08-31 |
| DE4129735A1 (de) | 1992-03-26 |
| JPH04254685A (ja) | 1992-09-09 |
| ITRM910688A0 (it) | 1991-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0733744B2 (ja) | 冷蔵庫のレールなし展示ドア | |
| US5097642A (en) | Glass refrigerator door structure | |
| US5363611A (en) | Foam rail door | |
| US6318027B1 (en) | Display case door | |
| US6637093B2 (en) | Method of assembling a display case door | |
| AU658861B2 (en) | Refrigerator door assembly with stylized substantially all glass front | |
| CA1321227C (en) | Product display and marketing device | |
| US4753043A (en) | Pivotally mounted insulated glass door assembly with self-contained structural support frame | |
| JP4992056B2 (ja) | 冷蔵保存陳列ケースドアおよび製造方法 | |
| US5024023A (en) | Insulated refrigerator door assembly with substantially all glass front doors | |
| US5910083A (en) | Integral spacer for door rail | |
| US20020073645A1 (en) | Apparatus and methods of forming a display case door and frame | |
| USRE35149E (en) | Railless refrigerator display door | |
| US9554660B2 (en) | Reach-in door for refrigerated cabinets | |
| KR20070086450A (ko) | 냉장고 및/또는 냉동기 | |
| MX2015000221A (es) | Refrigerador. | |
| US4660903A (en) | Temperature controlled display case | |
| JP2017515082A5 (show.php) | ||
| US20200352355A1 (en) | Swing door system and a freezer device | |
| GB2220694A (en) | Lattice assembly and profiled clip for use therein | |
| US12082716B2 (en) | Swing door system and a freezer device | |
| AU626337B2 (en) | A window or door screen to prevent insect entry | |
| US4010585A (en) | Structural frame - window pane assembly | |
| JP2597813B2 (ja) | ド ア | |
| JPH03233282A (ja) | 貯蔵庫 |