JP2600644B2 - チアゾリルベンゾフラン誘導体 - Google Patents
チアゾリルベンゾフラン誘導体Info
- Publication number
- JP2600644B2 JP2600644B2 JP4210308A JP21030892A JP2600644B2 JP 2600644 B2 JP2600644 B2 JP 2600644B2 JP 4210308 A JP4210308 A JP 4210308A JP 21030892 A JP21030892 A JP 21030892A JP 2600644 B2 JP2600644 B2 JP 2600644B2
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- substituted
- compound
- acyl
- salt
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- IQDNFLQNJPENQU-UHFFFAOYSA-N 2-(1-benzofuran-2-yl)-1,3-thiazole Chemical class C1=CSC(C=2OC3=CC=CC=C3C=2)=N1 IQDNFLQNJPENQU-UHFFFAOYSA-N 0.000 title claims description 10
- 150000001875 compounds Chemical class 0.000 claims abstract description 242
- 150000003839 salts Chemical class 0.000 claims abstract description 186
- -1 cyano, hydroxy Chemical group 0.000 claims abstract description 141
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 135
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 83
- 125000002252 acyl group Chemical group 0.000 claims abstract description 55
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 47
- 125000003118 aryl group Chemical group 0.000 claims abstract description 33
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 31
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 25
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 25
- 150000002367 halogens Chemical group 0.000 claims abstract description 25
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 125000005843 halogen group Chemical group 0.000 claims abstract description 13
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 11
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 10
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 claims abstract description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 7
- 125000004429 atom Chemical group 0.000 claims abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 6
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims abstract description 6
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 6
- 229910052727 yttrium Inorganic materials 0.000 claims abstract description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract 4
- 238000004519 manufacturing process Methods 0.000 claims description 115
- 239000002253 acid Substances 0.000 claims description 44
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 229940124597 therapeutic agent Drugs 0.000 claims description 5
- 206010020751 Hypersensitivity Diseases 0.000 claims description 4
- 206010061218 Inflammation Diseases 0.000 claims description 4
- 208000026935 allergic disease Diseases 0.000 claims description 4
- 230000007815 allergy Effects 0.000 claims description 4
- 208000006673 asthma Diseases 0.000 claims description 4
- 230000004054 inflammatory process Effects 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- PSILZZNMGXTOOP-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC(O)=O)C=C3C=2)=N1 PSILZZNMGXTOOP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims 2
- 230000000069 prophylactic effect Effects 0.000 claims 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000004970 halomethyl group Chemical group 0.000 claims 1
- 239000003199 leukotriene receptor blocking agent Substances 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 abstract description 10
- 238000000034 method Methods 0.000 abstract description 8
- 238000002360 preparation method Methods 0.000 abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 179
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- 239000000203 mixture Substances 0.000 description 79
- 239000002585 base Substances 0.000 description 68
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 64
- 239000002904 solvent Substances 0.000 description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 51
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 46
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 238000001816 cooling Methods 0.000 description 41
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 36
- 239000000243 solution Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 238000010438 heat treatment Methods 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- 230000002411 adverse Effects 0.000 description 24
- 238000001914 filtration Methods 0.000 description 24
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 23
- 235000019341 magnesium sulphate Nutrition 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- 239000012267 brine Substances 0.000 description 22
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 238000003756 stirring Methods 0.000 description 21
- 229910052783 alkali metal Inorganic materials 0.000 description 19
- 239000012046 mixed solvent Substances 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000012044 organic layer Substances 0.000 description 18
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 18
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- 239000003054 catalyst Substances 0.000 description 17
- 238000010898 silica gel chromatography Methods 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 15
- 229910052751 metal Inorganic materials 0.000 description 15
- 239000002184 metal Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- 239000006188 syrup Substances 0.000 description 15
- 235000020357 syrup Nutrition 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 14
- 239000005457 ice water Substances 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 14
- 239000003921 oil Substances 0.000 description 12
- 239000003960 organic solvent Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 11
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 235000011121 sodium hydroxide Nutrition 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 9
- 150000001342 alkaline earth metals Chemical class 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- 201000004624 Dermatitis Diseases 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 229910017052 cobalt Inorganic materials 0.000 description 6
- 239000010941 cobalt Substances 0.000 description 6
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 150000002148 esters Chemical group 0.000 description 6
- 239000011777 magnesium Substances 0.000 description 6
- 229910052749 magnesium Inorganic materials 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- YXRUWYWSPZHKLD-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-carbaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(C=O)C=C3C=2)=N1 YXRUWYWSPZHKLD-UHFFFAOYSA-N 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 125000001589 carboacyl group Chemical group 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 4
- FZHSPPYCNDYIKD-UHFFFAOYSA-N 5-methoxysalicylaldehyde Chemical compound COC1=CC=C(O)C(C=O)=C1 FZHSPPYCNDYIKD-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 208000003455 anaphylaxis Diseases 0.000 description 4
- 230000027455 binding Effects 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- 239000012024 dehydrating agents Substances 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- FWSXVUZYZVPTIF-UHFFFAOYSA-N 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 FWSXVUZYZVPTIF-UHFFFAOYSA-N 0.000 description 3
- BNALANGFESRXOP-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 BNALANGFESRXOP-UHFFFAOYSA-N 0.000 description 3
- YCMLQMDWSXFTIF-UHFFFAOYSA-N 2-methylbenzenesulfonimidic acid Chemical compound CC1=CC=CC=C1S(N)(=O)=O YCMLQMDWSXFTIF-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- ZRCORLXUHDZQNV-UHFFFAOYSA-N 4-tert-butyl-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 ZRCORLXUHDZQNV-UHFFFAOYSA-N 0.000 description 3
- XBJDWSFHEMVWIV-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 XBJDWSFHEMVWIV-UHFFFAOYSA-N 0.000 description 3
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 206010002199 Anaphylactic shock Diseases 0.000 description 3
- 206010003210 Arteriosclerosis Diseases 0.000 description 3
- 208000014644 Brain disease Diseases 0.000 description 3
- 206010048962 Brain oedema Diseases 0.000 description 3
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 3
- 206010010741 Conjunctivitis Diseases 0.000 description 3
- 208000011231 Crohn disease Diseases 0.000 description 3
- 208000007882 Gastritis Diseases 0.000 description 3
- 201000005569 Gout Diseases 0.000 description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 206010030216 Oesophagitis Diseases 0.000 description 3
- 206010033645 Pancreatitis Diseases 0.000 description 3
- 208000008469 Peptic Ulcer Diseases 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 3
- 206010040070 Septic Shock Diseases 0.000 description 3
- 208000007107 Stomach Ulcer Diseases 0.000 description 3
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 3
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 3
- 150000008046 alkali metal hydrides Chemical class 0.000 description 3
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 3
- 150000001356 alkyl thiols Chemical class 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 208000011775 arteriosclerosis disease Diseases 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 208000010668 atopic eczema Diseases 0.000 description 3
- 208000006752 brain edema Diseases 0.000 description 3
- 206010006451 bronchitis Diseases 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000003379 elimination reaction Methods 0.000 description 3
- 208000006881 esophagitis Diseases 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 201000005917 gastric ulcer Diseases 0.000 description 3
- 208000006454 hepatitis Diseases 0.000 description 3
- 231100000283 hepatitis Toxicity 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 208000001286 intracranial vasospasm Diseases 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 230000000302 ischemic effect Effects 0.000 description 3
- 150000002617 leukotrienes Chemical class 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 208000010125 myocardial infarction Diseases 0.000 description 3
- 201000008383 nephritis Diseases 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 208000011906 peptic ulcer disease Diseases 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 230000002265 prevention Effects 0.000 description 3
- 208000002815 pulmonary hypertension Diseases 0.000 description 3
- 206010039083 rhinitis Diseases 0.000 description 3
- 230000036303 septic shock Effects 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 description 3
- 125000005270 trialkylamine group Chemical group 0.000 description 3
- IISOIQHTJLMMLZ-UHFFFAOYSA-M (2-ethoxycarbonylphenyl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].CCOC(=O)C1=CC=CC=C1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 IISOIQHTJLMMLZ-UHFFFAOYSA-M 0.000 description 2
- DZOXPAYEAYNYMA-UHFFFAOYSA-N 1-(5-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2OC(C(C)=O)=CC2=C1 DZOXPAYEAYNYMA-UHFFFAOYSA-N 0.000 description 2
- VEGPSYLREWWGAU-UHFFFAOYSA-N 1-[2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CC1=NN=NN1 VEGPSYLREWWGAU-UHFFFAOYSA-N 0.000 description 2
- IZFOPMSVNDORMZ-UHFFFAOYSA-N 1-benzofuran-5-ol Chemical compound OC1=CC=C2OC=CC2=C1 IZFOPMSVNDORMZ-UHFFFAOYSA-N 0.000 description 2
- SCEIUGQQBYRBPP-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-azepine Chemical compound C1CCC=CNC1 SCEIUGQQBYRBPP-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- ALXDZWOFWIALGS-UHFFFAOYSA-N 2-(2-formyl-4-methoxyphenoxy)acetonitrile Chemical compound COC1=CC=C(OCC#N)C(C=O)=C1 ALXDZWOFWIALGS-UHFFFAOYSA-N 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- TVKWECKQHNTPMG-UHFFFAOYSA-N 2-(bromomethyl)-4-tert-butyl-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(CBr)=N1 TVKWECKQHNTPMG-UHFFFAOYSA-N 0.000 description 2
- ZRHOACSSGGJLRP-UHFFFAOYSA-N 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C1=NC(CCl)=CS1 ZRHOACSSGGJLRP-UHFFFAOYSA-N 0.000 description 2
- MXVGTYBWKONZRD-UHFFFAOYSA-N 2-[4-[(tert-butylamino)methyl]-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound CC(C)(C)NCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 MXVGTYBWKONZRD-UHFFFAOYSA-N 0.000 description 2
- FBFBAXVUXDBYAR-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-hexyl-1,3-thiazole Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 FBFBAXVUXDBYAR-UHFFFAOYSA-N 0.000 description 2
- HYEMCPMRYDUHSN-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)C=O)C=C3C=2)=N1 HYEMCPMRYDUHSN-UHFFFAOYSA-N 0.000 description 2
- CDNSWXWETQLGKR-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 CDNSWXWETQLGKR-UHFFFAOYSA-N 0.000 description 2
- UKFXZVDPWRYNQM-UHFFFAOYSA-N 2-[[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]methyl]propanedioic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC(C(O)=O)C(O)=O)C=C3C=2)=N1 UKFXZVDPWRYNQM-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NAASIWUJCOIUMX-UHFFFAOYSA-N 4-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]benzene-1,3-dicarbaldehyde Chemical compound CC(C)(C)C1=CSC(COC=2C(=CC(C=O)=CC=2)C=O)=N1 NAASIWUJCOIUMX-UHFFFAOYSA-N 0.000 description 2
- FEUATHOQKVGPEK-UHFFFAOYSA-N 4-hydroxybenzene-1,3-dicarbaldehyde Chemical compound OC1=CC=C(C=O)C=C1C=O FEUATHOQKVGPEK-UHFFFAOYSA-N 0.000 description 2
- PNZYQVLBRDFJLB-UHFFFAOYSA-N 4-tert-butyl-2-[5-(chloromethyl)-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCl)C=C3C=2)=N1 PNZYQVLBRDFJLB-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- UJKGHPHSZMHGPH-UHFFFAOYSA-N 5-hydroxy-1-benzofuran-2-carbothioamide Chemical compound OC1=CC=C2OC(C(=S)N)=CC2=C1 UJKGHPHSZMHGPH-UHFFFAOYSA-N 0.000 description 2
- FBZOVBYQQNIYBV-UHFFFAOYSA-N 5-methoxy-1-benzofuran-2-carbothioamide Chemical compound COC1=CC=C2OC(C(N)=S)=CC2=C1 FBZOVBYQQNIYBV-UHFFFAOYSA-N 0.000 description 2
- AOCUYPLJQNFUBI-UHFFFAOYSA-N 5-methoxy-n-(2-oxoazepan-3-yl)-1-benzofuran-2-carboxamide Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(=O)NC1CCCCNC1=O AOCUYPLJQNFUBI-UHFFFAOYSA-N 0.000 description 2
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- BJJGPJNFIWHDQT-UHFFFAOYSA-N [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methanol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CO)C=C3C=2)=N1 BJJGPJNFIWHDQT-UHFFFAOYSA-N 0.000 description 2
- STYBRPVXARSAAK-UHFFFAOYSA-N [2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]phenyl]methanol Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CO)C=C3C=2)=N1 STYBRPVXARSAAK-UHFFFAOYSA-N 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000003435 aroyl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Inorganic materials [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 150000001925 cycloalkenes Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- KGTWUQFETIEFKI-UHFFFAOYSA-N diethyl 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methyl]propanedioate Chemical compound C=1C2=CC(CC(C(=O)OCC)C(=O)OCC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 KGTWUQFETIEFKI-UHFFFAOYSA-N 0.000 description 2
- 239000006196 drop Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- JZRYZNCFHHWXLT-UHFFFAOYSA-N ethyl 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethenyl]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1C=CC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 JZRYZNCFHHWXLT-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- RIFFHFIDKGXZAS-UHFFFAOYSA-N methyl 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 RIFFHFIDKGXZAS-UHFFFAOYSA-N 0.000 description 2
- NHGZEJHJHUHZDI-UHFFFAOYSA-N methyl 2-sulfanylbutanoate Chemical compound CCC(S)C(=O)OC NHGZEJHJHUHZDI-UHFFFAOYSA-N 0.000 description 2
- JIXPEHBNFXLJEI-UHFFFAOYSA-N methyl 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-2,2-dimethylpropanoate Chemical compound C=1C2=CC(CC(C)(C)C(=O)OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 JIXPEHBNFXLJEI-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- XWRNVVHLXBWGDT-UHFFFAOYSA-N n,n-dimethyl-2-sulfanylpropanamide Chemical compound CC(S)C(=O)N(C)C XWRNVVHLXBWGDT-UHFFFAOYSA-N 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 2
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical compound [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 229910003445 palladium oxide Inorganic materials 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 230000003449 preventive effect Effects 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 2
- 229940103494 thiosalicylic acid Drugs 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- FMGGHNGKHRCJLL-UHFFFAOYSA-N 1,2-bis(chloromethyl)benzene Chemical group ClCC1=CC=CC=C1CCl FMGGHNGKHRCJLL-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- QFBZMBRHUZAPTL-UHFFFAOYSA-N 1-[2-(5-hydroxy-1-benzofuran-2-yl)-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound CC(=O)C1CCCNC2=C1N=C(C=1OC3=CC=C(O)C=C3C=1)S2 QFBZMBRHUZAPTL-UHFFFAOYSA-N 0.000 description 1
- XDIMOQRDIWMRMA-UHFFFAOYSA-N 1-[2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-8-yl]ethanone Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CCl XDIMOQRDIWMRMA-UHFFFAOYSA-N 0.000 description 1
- SAIRZMWXVJEBMO-UHFFFAOYSA-N 1-bromo-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CBr SAIRZMWXVJEBMO-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- OALRKTRDVLNQAZ-UHFFFAOYSA-N 1-methylsulfinyl-1-(1-methylsulfinylethylsulfanyl)ethane Chemical compound CS(=O)C(C)SC(C)S(C)=O OALRKTRDVLNQAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- BEWVAZNECYSPMT-UHFFFAOYSA-N 2,3-dihydro-1h-azepine Chemical compound C1CC=CC=CN1 BEWVAZNECYSPMT-UHFFFAOYSA-N 0.000 description 1
- JUWKMCGQHYTQFD-UHFFFAOYSA-N 2-(2-tert-butyl-1,3-thiazol-4-yl)-1-benzofuran-5-ol;hydrobromide Chemical compound Br.S1C(C(C)(C)C)=NC(C=2OC3=CC=C(O)C=C3C=2)=C1 JUWKMCGQHYTQFD-UHFFFAOYSA-N 0.000 description 1
- MPTPXOLRFZGVTJ-UHFFFAOYSA-N 2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1-benzofuran-5-ol Chemical compound C1CCCC(S2)=C1N=C2C1=CC2=CC(O)=CC=C2O1 MPTPXOLRFZGVTJ-UHFFFAOYSA-N 0.000 description 1
- LEOOZBXZXBAGPV-UHFFFAOYSA-N 2-(4-cyclobutyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1CCC1 LEOOZBXZXBAGPV-UHFFFAOYSA-N 0.000 description 1
- SURHWKHAMWEMFC-UHFFFAOYSA-N 2-(4-hexyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 SURHWKHAMWEMFC-UHFFFAOYSA-N 0.000 description 1
- NYCMSJGLAGXYMI-UHFFFAOYSA-N 2-(4-methyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 NYCMSJGLAGXYMI-UHFFFAOYSA-N 0.000 description 1
- CYHZWHGCYXJNBY-UHFFFAOYSA-N 2-(4-pentyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 CYHZWHGCYXJNBY-UHFFFAOYSA-N 0.000 description 1
- PNMZNPODRHJKAM-UHFFFAOYSA-N 2-(4-phenyl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=C1 PNMZNPODRHJKAM-UHFFFAOYSA-N 0.000 description 1
- DKUMTQAFQWGIOS-UHFFFAOYSA-N 2-(4-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 DKUMTQAFQWGIOS-UHFFFAOYSA-N 0.000 description 1
- MHUONAQKQYQPRK-UHFFFAOYSA-N 2-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=N1 MHUONAQKQYQPRK-UHFFFAOYSA-N 0.000 description 1
- YIEGKCBHMGMNOJ-UHFFFAOYSA-N 2-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CS1 YIEGKCBHMGMNOJ-UHFFFAOYSA-N 0.000 description 1
- DLRJHYZDVVCTJO-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound C1CCCC(S2)=C1N=C2C1=CC2=CC(OC)=CC=C2O1 DLRJHYZDVVCTJO-UHFFFAOYSA-N 0.000 description 1
- APSMNLZTBGAVBJ-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-(trifluoromethyl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C(F)(F)F)=CS1 APSMNLZTBGAVBJ-UHFFFAOYSA-N 0.000 description 1
- BUTGBZVYCCYLJH-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-methyl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC(C)=CS1 BUTGBZVYCCYLJH-UHFFFAOYSA-N 0.000 description 1
- XHGVFWKEBVRDJW-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-phenyl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=C1 XHGVFWKEBVRDJW-UHFFFAOYSA-N 0.000 description 1
- JNOZIOSZZAJZHB-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-pyridin-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CC=N1 JNOZIOSZZAJZHB-UHFFFAOYSA-N 0.000 description 1
- LBNYDHGKJUFPFJ-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-4-thiophen-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1=CC=CS1 LBNYDHGKJUFPFJ-UHFFFAOYSA-N 0.000 description 1
- NXRUNZNHIWGIOU-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepine Chemical compound C1CCCNC(S2)=C1N=C2C1=CC2=CC(OC)=CC=C2O1 NXRUNZNHIWGIOU-UHFFFAOYSA-N 0.000 description 1
- YYYKDMKXQUNELW-UHFFFAOYSA-N 2-(5-methoxy-1-benzofuran-2-yl)-5-propan-2-yl-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=NC=C(C(C)C)S1 YYYKDMKXQUNELW-UHFFFAOYSA-N 0.000 description 1
- LFPWYVUYVPRGBQ-UHFFFAOYSA-N 2-(5-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-ol Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(O)=CC=C2O1 LFPWYVUYVPRGBQ-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LPDVAZUHYLUBSO-UHFFFAOYSA-N 2-[(4-tert-butyl-1,3-thiazol-2-yl)methoxy]-5-methoxybenzaldehyde Chemical compound O=CC1=CC(OC)=CC=C1OCC1=NC(C(C)(C)C)=CS1 LPDVAZUHYLUBSO-UHFFFAOYSA-N 0.000 description 1
- XXHQURQANNZXDO-UHFFFAOYSA-N 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 XXHQURQANNZXDO-UHFFFAOYSA-N 0.000 description 1
- LEEVCCMHYCGJFV-UHFFFAOYSA-N 2-[2-[[2-(4-cyclopropyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CC3)C2=C1 LEEVCCMHYCGJFV-UHFFFAOYSA-N 0.000 description 1
- NFNQYXPFZIPDRZ-UHFFFAOYSA-N 2-[2-[[2-(4-hexyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 NFNQYXPFZIPDRZ-UHFFFAOYSA-N 0.000 description 1
- QAHKMMKEIZUPHD-UHFFFAOYSA-N 2-[2-[[2-(4-methyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 QAHKMMKEIZUPHD-UHFFFAOYSA-N 0.000 description 1
- ZSDIPSKDSOEGME-UHFFFAOYSA-N 2-[2-[[2-(4-pentyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 ZSDIPSKDSOEGME-UHFFFAOYSA-N 0.000 description 1
- XITNFTYFRHDTLZ-UHFFFAOYSA-N 2-[2-[[2-(4-phenyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3C=CC=CC=3)C2=C1 XITNFTYFRHDTLZ-UHFFFAOYSA-N 0.000 description 1
- HVPOEHISSYCOEH-UHFFFAOYSA-N 2-[2-[[2-(4-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 HVPOEHISSYCOEH-UHFFFAOYSA-N 0.000 description 1
- UTHUKQQIZOXCFR-UHFFFAOYSA-N 2-[2-[[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3N=CC=CC=3)C2=C1 UTHUKQQIZOXCFR-UHFFFAOYSA-N 0.000 description 1
- YTDHBKDNLJZAMY-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 YTDHBKDNLJZAMY-UHFFFAOYSA-N 0.000 description 1
- WYXJIHDNODKHJB-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 WYXJIHDNODKHJB-UHFFFAOYSA-N 0.000 description 1
- UXBRVGLLTFHRME-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetic acid;hydrochloride Chemical compound Cl.CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC(O)=O)C=C3C=2)=N1 UXBRVGLLTFHRME-UHFFFAOYSA-N 0.000 description 1
- AGKCMFIHQFHQPK-UHFFFAOYSA-N 2-[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzothiophen-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 AGKCMFIHQFHQPK-UHFFFAOYSA-N 0.000 description 1
- BDIOZPCAVUHWHS-UHFFFAOYSA-N 2-[2-[[2-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3SC=CC=3)C2=C1 BDIOZPCAVUHWHS-UHFFFAOYSA-N 0.000 description 1
- XOENEGMPYVTFJX-UHFFFAOYSA-N 2-[2-[[2-(5-propan-2-yl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CC#N)=CC=C2O1 XOENEGMPYVTFJX-UHFFFAOYSA-N 0.000 description 1
- NEWJHVFYVNWCQD-UHFFFAOYSA-N 2-[2-[[2-(8-acetyl-5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepin-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N=1C=2C(C(=O)C)CCCNC=2SC=1C(OC1=CC=2)=CC1=CC=2OCC1=CC=CC=C1CC#N NEWJHVFYVNWCQD-UHFFFAOYSA-N 0.000 description 1
- ROZUZHKAGVUYBL-UHFFFAOYSA-N 2-[2-[[2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C34CC5CC(CC(C5)C3)C4)C2=C1 ROZUZHKAGVUYBL-UHFFFAOYSA-N 0.000 description 1
- PHKMPHODSDUBSZ-UHFFFAOYSA-N 2-[2-[[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-yl]oxymethyl]phenyl]acetonitrile Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 PHKMPHODSDUBSZ-UHFFFAOYSA-N 0.000 description 1
- SFRLBXJPVQADEU-UHFFFAOYSA-N 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C1C(C2)CC(C3)CC2CC13C1=CSC(C=2OC3=CC=C(C=C3C=2)O)=N1 SFRLBXJPVQADEU-UHFFFAOYSA-N 0.000 description 1
- MUSNGRVILXZYGS-UHFFFAOYSA-N 2-[4-(2,2-dimethylpropyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(O)C=C3C=2)=N1 MUSNGRVILXZYGS-UHFFFAOYSA-N 0.000 description 1
- AUYLWBDILMAZNW-UHFFFAOYSA-N 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol Chemical compound C=1C2=CC(O)=CC=C2OC=1C1=NC(C(F)(F)F)=CS1 AUYLWBDILMAZNW-UHFFFAOYSA-N 0.000 description 1
- MFENBUASWIXCPU-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole Chemical compound C=1C=C2OC(C=3SC=4CCCCC=4N=3)=CC2=CC=1OCC1=CC=CC=C1CC=1N=NNN=1 MFENBUASWIXCPU-UHFFFAOYSA-N 0.000 description 1
- XMJBFDFESYAMIZ-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(trifluoromethyl)-1,3-thiazole Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 XMJBFDFESYAMIZ-UHFFFAOYSA-N 0.000 description 1
- RPPNUMDRYCDHRE-UHFFFAOYSA-N 2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-thiophen-2-yl-1,3-thiazole Chemical compound C=1C=CC=C(CC2=NNN=N2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1=CC=CS1 RPPNUMDRYCDHRE-UHFFFAOYSA-N 0.000 description 1
- YLEBKDUVODBXHW-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(2,2-dimethylpropyl)-1,3-thiazole Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 YLEBKDUVODBXHW-UHFFFAOYSA-N 0.000 description 1
- ZJEKELSVWBZQRE-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-(trifluoromethyl)-1,3-thiazole Chemical compound FC(F)(F)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 ZJEKELSVWBZQRE-UHFFFAOYSA-N 0.000 description 1
- ALRKMCTWXSDYFA-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-cyclopropyl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C3CC3)C2=C1 ALRKMCTWXSDYFA-UHFFFAOYSA-N 0.000 description 1
- FDRMJBMVWFYVFY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-methyl-1,3-thiazole Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 FDRMJBMVWFYVFY-UHFFFAOYSA-N 0.000 description 1
- VAGYUNPKHPHURY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pentyl-1,3-thiazole Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 VAGYUNPKHPHURY-UHFFFAOYSA-N 0.000 description 1
- IUIWHLWMTFSOIL-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-phenyl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3C=CC=CC=3)C2=C1 IUIWHLWMTFSOIL-UHFFFAOYSA-N 0.000 description 1
- LLLTXEQOJOSUOU-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-propan-2-yl-1,3-thiazole Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 LLLTXEQOJOSUOU-UHFFFAOYSA-N 0.000 description 1
- PHJAOOYXXZDHRX-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-pyridin-2-yl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3N=CC=CC=3)C2=C1 PHJAOOYXXZDHRX-UHFFFAOYSA-N 0.000 description 1
- VGWTXHSYHFEFMY-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-4-thiophen-2-yl-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C=3SC=CC=3)C2=C1 VGWTXHSYHFEFMY-UHFFFAOYSA-N 0.000 description 1
- CFAUDFRGAMRUCE-UHFFFAOYSA-N 2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-5-propan-2-yl-1,3-thiazole Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CCl)=CC=C2O1 CFAUDFRGAMRUCE-UHFFFAOYSA-N 0.000 description 1
- DIQUWLCXEKOMIN-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methoxy]benzaldehyde Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)C=O)C=C3C=2)=N1 DIQUWLCXEKOMIN-UHFFFAOYSA-N 0.000 description 1
- FUJZAGIXVDMRPZ-UHFFFAOYSA-N 2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]methylsulfanyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)C(O)=O)C=C3C=2)=N1 FUJZAGIXVDMRPZ-UHFFFAOYSA-N 0.000 description 1
- BOWUOGIPSRVRSJ-UHFFFAOYSA-N 2-aminohexano-6-lactam Chemical compound NC1CCCCNC1=O BOWUOGIPSRVRSJ-UHFFFAOYSA-N 0.000 description 1
- JSCFKVXPOWVVGS-UHFFFAOYSA-N 2-bromo-1-(5-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2OC(C(=O)CBr)=CC2=C1 JSCFKVXPOWVVGS-UHFFFAOYSA-N 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- NMBWXBWFDHVLGS-UHFFFAOYSA-N 2-ethylbenzenesulfonamide Chemical compound CCC1=CC=CC=C1S(N)(=O)=O NMBWXBWFDHVLGS-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- GYXHHICIFZSKKZ-UHFFFAOYSA-N 2-sulfanylacetamide Chemical compound NC(=O)CS GYXHHICIFZSKKZ-UHFFFAOYSA-N 0.000 description 1
- CFPHMAVQAJGVPV-UHFFFAOYSA-N 2-sulfanylbutanoic acid Chemical compound CCC(S)C(O)=O CFPHMAVQAJGVPV-UHFFFAOYSA-N 0.000 description 1
- IMGGANUNCHXAQF-UHFFFAOYSA-N 2-sulfanylpentanoic acid Chemical compound CCCC(S)C(O)=O IMGGANUNCHXAQF-UHFFFAOYSA-N 0.000 description 1
- YDBVCFUMMUNSRW-UHFFFAOYSA-N 2-sulfanylpropanamide Chemical compound CC(S)C(N)=O YDBVCFUMMUNSRW-UHFFFAOYSA-N 0.000 description 1
- DQQJQXPICVLDKK-UHFFFAOYSA-N 2-tert-butyl-4-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=CSC(C(C)(C)C)=N1 DQQJQXPICVLDKK-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CVKOOKPNCVYHNY-UHFFFAOYSA-N 3-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC(C#N)=C1 CVKOOKPNCVYHNY-UHFFFAOYSA-N 0.000 description 1
- GAQFEBOLCZZIFK-UHFFFAOYSA-N 3-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]propanoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CCC(O)=O)C=C3C=2)=N1 GAQFEBOLCZZIFK-UHFFFAOYSA-N 0.000 description 1
- QEMAXXDNCFWUMS-UHFFFAOYSA-N 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoic acid Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C=C(C=CC=4)C(O)=O)C=C3C=2)=N1 QEMAXXDNCFWUMS-UHFFFAOYSA-N 0.000 description 1
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 1
- JNJXNTYEINIXPS-UHFFFAOYSA-N 4-(1-adamantyl)-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C1C(C2)CC(C3)CC2CC13C1=CSC(C=2OC3=CC=C(C=C3C=2)OC)=N1 JNJXNTYEINIXPS-UHFFFAOYSA-N 0.000 description 1
- KNFVGADUTWXZLL-UHFFFAOYSA-N 4-(1-adamantyl)-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound ClCC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C34CC5CC(CC(C5)C3)C4)C2=C1 KNFVGADUTWXZLL-UHFFFAOYSA-N 0.000 description 1
- NNKPGIWIUSVXIT-UHFFFAOYSA-N 4-(2,2-dimethylpropyl)-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 NNKPGIWIUSVXIT-UHFFFAOYSA-N 0.000 description 1
- JHKIUPOLQADFGQ-UHFFFAOYSA-N 4-cyclobutyl-2-(5-methoxy-1-benzofuran-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2OC=1C(SC=1)=NC=1C1CCC1 JHKIUPOLQADFGQ-UHFFFAOYSA-N 0.000 description 1
- FVVUOJUWJCSVED-UHFFFAOYSA-N 4-cyclobutyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound C=1C=CC=C(CC=2NN=NN=2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1CCC1 FVVUOJUWJCSVED-UHFFFAOYSA-N 0.000 description 1
- SANAIMQSTRMYGD-UHFFFAOYSA-N 4-hexyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CCCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 SANAIMQSTRMYGD-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- HSYSADQZVDOHMN-UHFFFAOYSA-N 4-methyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 HSYSADQZVDOHMN-UHFFFAOYSA-N 0.000 description 1
- DDODANZBNHLARU-UHFFFAOYSA-N 4-pentyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CCCCCC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 DDODANZBNHLARU-UHFFFAOYSA-N 0.000 description 1
- XBZYDWCIBOPVHJ-UHFFFAOYSA-N 4-propan-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 XBZYDWCIBOPVHJ-UHFFFAOYSA-N 0.000 description 1
- DNFXYJIENXCYEU-UHFFFAOYSA-N 4-pyridin-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole;hydrochloride Chemical compound Cl.C=1C=CC=C(CC=2NN=NN=2)C=1COC(C=C1C=2)=CC=C1OC=2C(SC=1)=NC=1C1=CC=CC=N1 DNFXYJIENXCYEU-UHFFFAOYSA-N 0.000 description 1
- ZJIQUYZWMIXTRM-UHFFFAOYSA-N 4-tert-butyl-2-(5-methoxy-1-benzothiophen-2-yl)-1,3-thiazole Chemical compound C=1C2=CC(OC)=CC=C2SC=1C1=NC(C(C)(C)C)=CS1 ZJIQUYZWMIXTRM-UHFFFAOYSA-N 0.000 description 1
- QVFBRRBYYIDZOG-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2-methylsulfanyl-2-methylsulfinylethenyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CSC(S(C)=O)=CC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 QVFBRRBYYIDZOG-UHFFFAOYSA-N 0.000 description 1
- QALVWRPQKALRFR-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC=4NN=NN=4)C=C3C=2)=N1 QALVWRPQKALRFR-UHFFFAOYSA-N 0.000 description 1
- SZUFOPUHQJEOMC-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenoxy]methyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(COC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 SZUFOPUHQJEOMC-UHFFFAOYSA-N 0.000 description 1
- JPBYSHRCPHZBBS-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzothiophen-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2SC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 JPBYSHRCPHZBBS-UHFFFAOYSA-N 0.000 description 1
- XVLHZWGKLQAOCX-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[2-(chloromethyl)phenyl]sulfanylmethyl]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(CSC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 XVLHZWGKLQAOCX-UHFFFAOYSA-N 0.000 description 1
- QGJRBLUNOCMWJT-UHFFFAOYSA-N 4-tert-butyl-2-[5-[[3-(2h-tetrazol-5-yl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound CC(C)(C)C1=CSC(C=2OC3=CC=C(OCC=4C=C(C=CC=4)C4=NNN=N4)C=C3C=2)=N1 QGJRBLUNOCMWJT-UHFFFAOYSA-N 0.000 description 1
- VJCQMWMITJQMGI-UHFFFAOYSA-N 5,6,7,8-tetrahydro-4h-[1,3]thiazolo[5,4-b]azepine Chemical compound N1CCCCC2=C1SC=N2 VJCQMWMITJQMGI-UHFFFAOYSA-N 0.000 description 1
- BMRGTCJDJUHASV-UHFFFAOYSA-N 5-Hydroxybenzofuran Natural products OC1=CC=C2CC=CC2=C1 BMRGTCJDJUHASV-UHFFFAOYSA-N 0.000 description 1
- GKOBIPBVHLFDES-UHFFFAOYSA-N 5-methoxy-2-[(4-phenyl-1,3-thiazol-2-yl)methoxy]benzaldehyde Chemical compound O=CC1=CC(OC)=CC=C1OCC1=NC(C=2C=CC=CC=2)=CS1 GKOBIPBVHLFDES-UHFFFAOYSA-N 0.000 description 1
- ZMKJSTWSUYKRHU-UHFFFAOYSA-N 5-propan-2-yl-2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazole Chemical compound S1C(C(C)C)=CN=C1C1=CC2=CC(OCC=3C(=CC=CC=3)CC=3NN=NN=3)=CC=C2O1 ZMKJSTWSUYKRHU-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OQHIOKDKKJFXHR-UHFFFAOYSA-N C1=CC(OC)=CC=C1P1(=S)SP(=S)S1 Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)S1 OQHIOKDKKJFXHR-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 229910021555 Chromium Chloride Inorganic materials 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- YDPLDMLRERBXAV-UHFFFAOYSA-N aluminum;triazide Chemical compound [Al+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-] YDPLDMLRERBXAV-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229950003476 aminothiazole Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004321 azepin-2-yl group Chemical group [H]N1C([H])=C([H])C([H])=C([H])C([H])=C1* 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-N bromoacetic acid Chemical compound OC(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UETLMBWMVIQIGU-UHFFFAOYSA-N calcium azide Chemical compound [Ca+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UETLMBWMVIQIGU-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000005026 carboxyaryl group Chemical group 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- BXCVCLILGBBCBR-UHFFFAOYSA-N diethyl 2-[[2-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]phenyl]methyl]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CC1=CC=CC=C1COC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 BXCVCLILGBBCBR-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- RDEWTAHSEKSPPT-UHFFFAOYSA-N ethyl 2-(bromomethyl)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CBr RDEWTAHSEKSPPT-UHFFFAOYSA-N 0.000 description 1
- GUWLSZDZWACRBS-UHFFFAOYSA-N ethyl 2-[2-[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]ethyl]benzoate Chemical compound CCOC(=O)C1=CC=CC=C1CCC1=CC=C(OC(=C2)C=3SC=C(N=3)C(C)(C)C)C2=C1 GUWLSZDZWACRBS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 230000016507 interphase Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- IDIOJRGTRFRIJL-UHFFFAOYSA-N iodosilane Chemical compound I[SiH3] IDIOJRGTRFRIJL-UHFFFAOYSA-N 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- YEESKJGWJFYOOK-IJHYULJSSA-N leukotriene D4 Chemical compound CCCCC\C=C/C\C=C/C=C/C=C/[C@H]([C@@H](O)CCCC(O)=O)SC[C@H](N)C(=O)NCC(O)=O YEESKJGWJFYOOK-IJHYULJSSA-N 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- OESMCLIZLYTGJJ-UHFFFAOYSA-N methyl 3-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]oxymethyl]benzoate Chemical compound COC(=O)C1=CC=CC(COC=2C=C3C=C(OC3=CC=2)C=2SC=C(N=2)C(C)(C)C)=C1 OESMCLIZLYTGJJ-UHFFFAOYSA-N 0.000 description 1
- LDTLDBDUBGAEDT-UHFFFAOYSA-N methyl 3-sulfanylpropanoate Chemical compound COC(=O)CCS LDTLDBDUBGAEDT-UHFFFAOYSA-N 0.000 description 1
- KFBDRZJNGWQOMM-UHFFFAOYSA-N methyl 4-[[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-benzofuran-5-yl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylbutanoate Chemical compound C=1C2=CC(C(SCCC(=O)N(C)C)SCCCC(=O)OC)=CC=C2OC=1C1=NC(C(C)(C)C)=CS1 KFBDRZJNGWQOMM-UHFFFAOYSA-N 0.000 description 1
- YRIAPEVGKLRGHX-UHFFFAOYSA-N methyl 4-sulfanylbutanoate Chemical compound COC(=O)CCCS YRIAPEVGKLRGHX-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- BXGTVNLGPMZLAZ-UHFFFAOYSA-N n'-ethylmethanediimine;hydrochloride Chemical compound Cl.CCN=C=N BXGTVNLGPMZLAZ-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- UXBJXJHRVOEYPA-UHFFFAOYSA-N n,n-dimethyl-3-sulfanylpropanamide Chemical compound CN(C)C(=O)CCS UXBJXJHRVOEYPA-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 description 1
- IEFQBVPRWKDJJV-UHFFFAOYSA-N n-tert-butyl-n-[[2-[5-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC4=NNN=N4)C=C3C=2)=N1 IEFQBVPRWKDJJV-UHFFFAOYSA-N 0.000 description 1
- WYLAJBGOOAKMAP-UHFFFAOYSA-N n-tert-butyl-n-[[2-[5-[[2-(chloromethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CCl)C=C3C=2)=N1 WYLAJBGOOAKMAP-UHFFFAOYSA-N 0.000 description 1
- YWORNCVWQMGRQA-UHFFFAOYSA-N n-tert-butyl-n-[[2-[5-[[2-(cyanomethyl)phenyl]methoxy]-1-benzofuran-2-yl]-1,3-thiazol-4-yl]methyl]acetamide Chemical compound CC(=O)N(C(C)(C)C)CC1=CSC(C=2OC3=CC=C(OCC=4C(=CC=CC=4)CC#N)C=C3C=2)=N1 YWORNCVWQMGRQA-UHFFFAOYSA-N 0.000 description 1
- ZFIFHAKCBWOSRN-UHFFFAOYSA-N naphthalene-1-sulfonamide Chemical compound C1=CC=C2C(S(=O)(=O)N)=CC=CC2=C1 ZFIFHAKCBWOSRN-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- KPADFPAILITQBG-UHFFFAOYSA-N non-4-ene Chemical compound CCCCC=CCCC KPADFPAILITQBG-UHFFFAOYSA-N 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940100684 pentylamine Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PAYGMRRPBHYIMA-UHFFFAOYSA-N sodium;trihydrate Chemical compound O.O.O.[Na] PAYGMRRPBHYIMA-UHFFFAOYSA-N 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000013076 target substance Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Pulmonology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919117733A GB9117733D0 (en) | 1991-08-16 | 1991-08-16 | New thiazolylbenzofuran derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same |
| GB9201057-8 | 1992-01-17 | ||
| GB9117733-7 | 1992-01-17 | ||
| GB929201057A GB9201057D0 (en) | 1992-01-17 | 1992-01-17 | New thiazolylbenzofuran derivatives,processes for the preparation thereof and pharmaceutical composition comprising the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH05202040A JPH05202040A (ja) | 1993-08-10 |
| JP2600644B2 true JP2600644B2 (ja) | 1997-04-16 |
Family
ID=26299417
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP4210308A Expired - Fee Related JP2600644B2 (ja) | 1991-08-16 | 1992-08-06 | チアゾリルベンゾフラン誘導体 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5296495A (enFirst) |
| EP (1) | EP0528337B1 (enFirst) |
| JP (1) | JP2600644B2 (enFirst) |
| KR (1) | KR930004304A (enFirst) |
| CN (1) | CN1033088C (enFirst) |
| AT (1) | ATE185807T1 (enFirst) |
| AU (1) | AU665007B2 (enFirst) |
| CA (1) | CA2076192A1 (enFirst) |
| DE (1) | DE69230163T2 (enFirst) |
| DK (1) | DK0528337T3 (enFirst) |
| ES (1) | ES2137169T3 (enFirst) |
| GR (1) | GR3032425T3 (enFirst) |
| HU (2) | HUT64336A (enFirst) |
| MX (1) | MX9204746A (enFirst) |
| SG (1) | SG45259A1 (enFirst) |
| TW (1) | TW224464B (enFirst) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2102078A1 (en) * | 1992-11-02 | 1994-05-03 | Akira Takase | A process for producing (e)-alkoxyimino or hydroxyiminoacetamide compounds and intermediates therefor |
| KR100329887B1 (ko) * | 1992-11-02 | 2002-11-02 | 시오노기세이야쿠가부시키가이샤 | (e)-알콕시이미노-및하이드록시이미노-아세트아미드화합물의제조방법 및 그의 제조용중간체 |
| DE4425609A1 (de) * | 1994-07-20 | 1996-01-25 | Bayer Ag | Benzofuranyl- und Benzothienyloxazolidinone |
| KR19990076788A (ko) * | 1996-01-22 | 1999-10-15 | 후지야마 아키라 | 티아졸릴벤조푸란 유도체 및 그를 함유하는 약제학적 조성물 |
| ATE257703T1 (de) * | 1997-10-27 | 2004-01-15 | Takeda Chemical Industries Ltd | 1,3-thiazole als adenosine a3 rezeptor antagonisten zur behandlung von asthma, allergien und diabetes |
| US6262066B1 (en) | 1998-07-27 | 2001-07-17 | Schering Corporation | High affinity ligands for nociceptin receptor ORL-1 |
| AU2002349705A1 (en) | 2001-12-03 | 2003-06-17 | Japan Tobacco Inc. | Azole compound and medicinal use thereof |
| US7148248B2 (en) | 2002-11-29 | 2006-12-12 | Masako Nozaki | Method of treating or inhibiting the development of brain inflammation and sepsis |
| EP1424101A3 (en) * | 2002-11-29 | 2004-08-18 | NOZAKI, Masako | Use of a leukotriene C4 and D4 receptor antagonist for the preparation of a medicament for treating or preventing brain inflammation and sepsis |
| WO2004089918A1 (ja) * | 2003-04-09 | 2004-10-21 | Japan Tobacco Inc. | 複素芳香5員環化合物及びその医薬用途 |
| JP2005008631A (ja) * | 2003-05-29 | 2005-01-13 | New Industry Research Organization | ベンゾフラン化合物、およびそれを含有してなる医薬組成物 |
| EP1627873A4 (en) | 2003-05-29 | 2007-12-05 | New Ind Res Organization | BENZOFURAN-BASED COMPOUND AND MEDICINAL COMPOSITION CONTAINING THE SAME |
| ITTO20040125A1 (it) * | 2004-03-01 | 2004-06-01 | Rotta Research Lab | Nuove amidine eterocicliche inibitrici la produzione di ossido d'azoto (no) ad attivita' antinfiammatoria ed analgesica |
| CN101022796B (zh) | 2004-07-14 | 2013-02-27 | 炎症研究中心有限公司 | 抑制肿瘤转移的方法 |
| MX2007001561A (es) * | 2004-08-04 | 2007-04-16 | Schering Corp | Formulacion farmaceutica que comprende pleconaril para tratamiento de enfermedades de vias aereas. |
| WO2006046683A1 (en) * | 2004-10-25 | 2006-05-04 | Astellas Pharma Inc. | Thiazolylbenzofuran derivatives as leukotriene and prostaglandin d2 receptor antagonists |
| US20060110449A1 (en) | 2004-10-25 | 2006-05-25 | Lorber Richard R | Pharmaceutical composition |
| JPWO2006054793A1 (ja) * | 2004-11-19 | 2008-06-05 | 財団法人新産業創造研究機構 | ベンゾフラン化合物、およびそれを含有してなる医薬組成物 |
| KR20090026217A (ko) * | 2006-07-11 | 2009-03-11 | 쉐링 코포레이션 | 치환된 5-옥사졸-2-일-퀴놀린 화합물의 크시나포에이트 염 |
| CA2669704A1 (en) * | 2006-11-16 | 2008-05-22 | Allergan, Inc. | Sulfoximines as kinase inhibitors |
| CA2764830A1 (en) | 2009-06-16 | 2010-12-23 | Schering Corporation | Novel [3,2-c] heteroaryl steroids as glucocorticoid receptor agonists, compositions and uses thereof |
| EP2723717A2 (en) | 2011-06-24 | 2014-04-30 | Amgen Inc. | Trpm8 antagonists and their use in treatments |
| AU2012272898A1 (en) | 2011-06-24 | 2013-04-11 | Amgen Inc. | TRPM8 antagonists and their use in treatments |
| ES2790358T3 (es) | 2011-12-28 | 2020-10-27 | Global Blood Therapeutics Inc | Compuestos de heteroaril aldehído sustituido y métodos para su uso en el aumento de la oxigenación tisular |
| CA3142817A1 (en) * | 2011-12-28 | 2013-07-04 | Global Blood Therapeutics, Inc. | Substituted benzaldehyde compounds and methods for their use in increasing tissue oxygenation |
| US8952009B2 (en) | 2012-08-06 | 2015-02-10 | Amgen Inc. | Chroman derivatives as TRPM8 inhibitors |
| CN112500338A (zh) | 2013-03-15 | 2021-03-16 | 全球血液疗法股份有限公司 | 化合物及其用于调节血红蛋白的用途 |
| US9802900B2 (en) | 2013-03-15 | 2017-10-31 | Global Blood Therapeutics, Inc. | Bicyclic heteroaryl compounds and uses thereof for the modulation of hemoglobin |
| US10266551B2 (en) | 2013-03-15 | 2019-04-23 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US8952171B2 (en) | 2013-03-15 | 2015-02-10 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| EP3919056B1 (en) | 2013-03-15 | 2024-08-28 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US9422279B2 (en) | 2013-03-15 | 2016-08-23 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| EP2968299B1 (en) | 2013-03-15 | 2021-01-20 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US9604999B2 (en) | 2013-03-15 | 2017-03-28 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US9458139B2 (en) | 2013-03-15 | 2016-10-04 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| US10100043B2 (en) | 2013-03-15 | 2018-10-16 | Global Blood Therapeutics, Inc. | Substituted aldehyde compounds and methods for their use in increasing tissue oxygenation |
| US20140274961A1 (en) | 2013-03-15 | 2014-09-18 | Global Blood Therapeutics, Inc. | Compounds and uses thereof for the modulation of hemoglobin |
| EA202092627A1 (ru) | 2013-11-18 | 2021-09-30 | Глобал Блад Терапьютикс, Инк. | Соединения и их применения для модуляции гемоглобина |
| SG10201911662YA (en) | 2014-02-07 | 2020-02-27 | Global Blood Therapeutics Inc | Crystalline polymorphs of the free base of 2-hydroxy-6-((2-(1-isopropyl-1h-pyrazol-5-yl)pyridin-3-yl)methoxy)benzaldehyde |
| DK3186233T3 (da) | 2014-08-29 | 2021-11-22 | Chdi Foundation Inc | Prober til billeddannelse af huntingtin-protein |
| MA41841A (fr) | 2015-03-30 | 2018-02-06 | Global Blood Therapeutics Inc | Composés aldéhyde pour le traitement de la fibrose pulmonaire, de l'hypoxie, et de maladies auto-immunes et des tissus conjonctifs |
| HUE072191T2 (hu) | 2015-12-04 | 2025-10-28 | Global Blood Therapeutics Inc | A 2-hidoxi-6-((2-(1-izopropil-1H-pirazol-5-il)piridin-3-il)metoxi)benzaldehid adagolási rendje |
| TWI825524B (zh) | 2016-05-12 | 2023-12-11 | 美商全球血液治療公司 | 用於合成2-羥基-6-((2-(1-異丙基-1h-吡唑-5-基)-吡啶-3-基)甲氧基)苯甲醛之方法 |
| TWI778983B (zh) | 2016-10-12 | 2022-10-01 | 美商全球血液治療公司 | 包含2-羥基-6-((2-(1-異丙基-1h-吡唑-5-基)吡啶-3-基)甲氧基)-苯甲醛之片劑 |
| WO2018115984A1 (en) | 2016-12-19 | 2018-06-28 | Cellix Bio Private Limited | Compositions and methods for the treatment of inflammation |
| US11014884B2 (en) | 2018-10-01 | 2021-05-25 | Global Blood Therapeutics, Inc. | Modulators of hemoglobin |
| TW202500134A (zh) * | 2023-05-18 | 2025-01-01 | 美商恩維達醫療公司 | G-蛋白偶聯受體之拮抗劑 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62142168A (ja) * | 1985-10-16 | 1987-06-25 | Mitsubishi Chem Ind Ltd | チアゾ−ル誘導体及びそれを有効成分とするロイコトリエンきつ抗剤 |
| US4742057A (en) * | 1985-12-05 | 1988-05-03 | Fujisawa Pharmaceutical Co., Ltd. | Antiallergic thiazole compounds |
| US4908357A (en) * | 1986-04-30 | 1990-03-13 | Fmc Corporation | Photoactive azole pesticides |
| US5001140A (en) * | 1989-04-17 | 1991-03-19 | Hoffmann-La Roche Inc. | Cycloalkylthiazoles |
| JPH02169584A (ja) * | 1988-12-22 | 1990-06-29 | Mitsubishi Kasei Corp | ビニルチアゾール誘導体およびそれを有効成分とする薬剤 |
| US5032588A (en) * | 1989-12-08 | 1991-07-16 | Abbott Laboratories | Thiazole lipoxygenase-inhibiting compounds derived from non-steroidal antiinflammatory carboxylic acids |
| DE3941438A1 (de) * | 1989-12-15 | 1991-06-20 | Hoechst Ag | Neue 2-substituierte 4-(3-alkyl-5-tert.-butyl-4-hydroxy-phenyl)-thiazole, verfahren zu ihrer herstellung, die sie enthaltenden arzneimittel und ihre verwendung |
-
1992
- 1992-08-06 JP JP4210308A patent/JP2600644B2/ja not_active Expired - Fee Related
- 1992-08-12 AT AT92113705T patent/ATE185807T1/de not_active IP Right Cessation
- 1992-08-12 SG SG1996002173A patent/SG45259A1/en unknown
- 1992-08-12 DK DK92113705T patent/DK0528337T3/da active
- 1992-08-12 EP EP92113705A patent/EP0528337B1/en not_active Expired - Lifetime
- 1992-08-12 US US07/929,751 patent/US5296495A/en not_active Expired - Fee Related
- 1992-08-12 ES ES92113705T patent/ES2137169T3/es not_active Expired - Lifetime
- 1992-08-12 DE DE69230163T patent/DE69230163T2/de not_active Expired - Fee Related
- 1992-08-13 AU AU21029/92A patent/AU665007B2/en not_active Ceased
- 1992-08-14 HU HU9202656A patent/HUT64336A/hu unknown
- 1992-08-14 KR KR1019920014712A patent/KR930004304A/ko not_active Ceased
- 1992-08-14 CA CA002076192A patent/CA2076192A1/en not_active Abandoned
- 1992-08-14 TW TW081106455A patent/TW224464B/zh active
- 1992-08-15 CN CN92110877A patent/CN1033088C/zh not_active Expired - Fee Related
- 1992-08-17 MX MX9204746A patent/MX9204746A/es not_active IP Right Cessation
-
1995
- 1995-06-22 HU HU95P/P00346P patent/HU211630A9/hu unknown
-
2000
- 2000-01-19 GR GR20000400122T patent/GR3032425T3/el not_active IP Right Cessation
Non-Patent Citations (2)
| Title |
|---|
| Chemical Abstracts、第70巻、第1号、(1969)、要約番号11630&Z.Chem.、8(9)、(1968)、P.339−40、Kempter、Gerhard et al.、"Heterocycles from 2−bromoacetylheterocycles" |
| Chemical Abstracts、第74巻、第7号、(1971)、要約番号111955&Z.Chem.、19(12)、(1970)、P.460−2、Kempter、Gerhard et al.、"Thiazoles with heterocycles substituents" |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0528337B1 (en) | 1999-10-20 |
| ES2137169T3 (es) | 1999-12-16 |
| HU211630A9 (en) | 1995-12-28 |
| SG45259A1 (en) | 1998-01-16 |
| CN1033088C (zh) | 1996-10-23 |
| KR930004304A (ko) | 1993-03-22 |
| HU9202656D0 (en) | 1992-10-28 |
| GR3032425T3 (en) | 2000-05-31 |
| MX9204746A (es) | 1994-04-29 |
| TW224464B (enFirst) | 1994-06-01 |
| DE69230163D1 (de) | 1999-11-25 |
| CA2076192A1 (en) | 1993-02-17 |
| AU665007B2 (en) | 1995-12-14 |
| JPH05202040A (ja) | 1993-08-10 |
| CN1070910A (zh) | 1993-04-14 |
| ATE185807T1 (de) | 1999-11-15 |
| DE69230163T2 (de) | 2000-03-23 |
| AU2102992A (en) | 1993-02-18 |
| US5296495A (en) | 1994-03-22 |
| DK0528337T3 (da) | 2000-03-27 |
| EP0528337A1 (en) | 1993-02-24 |
| HUT64336A (en) | 1993-12-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2600644B2 (ja) | チアゾリルベンゾフラン誘導体 | |
| EP0626956B1 (en) | Quinolylbenzofuran derivatives as leukotriene antagonists | |
| US5994378A (en) | Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them | |
| US7176242B2 (en) | N,N′-substituted-1,3-diamino-2-hydroxypropane derivatives | |
| CA2176247A1 (en) | Platelet activating factor antagonists: imidazopyridine indoles | |
| US20050153966A1 (en) | Kinase inhibitors | |
| JP2011507894A (ja) | プロリルヒドロキシラーゼ阻害剤 | |
| AU2002359376A1 (en) | N, N'-substituted-1,3-diamino-2-hydroxypropane derivatives | |
| WO2009077728A1 (en) | Indoles and their therapeutic use | |
| EP1131321B1 (en) | Indole derivatives and their use as serotonin receptor ligands | |
| WO2000039097A1 (en) | Imidazole compounds and medicinal use thereof | |
| HU203238B (en) | Process for producing antiinflammatory tricyclic oxindole derivatives | |
| JPH0770114A (ja) | エーテル誘導体、その製造方法およびロイコトリエンが介在する疾患または症状に使用するためのそれを含有する調剤学的組成物 | |
| AU5878001A (en) | Novel benzothiophene derivatives | |
| JPH08325265A (ja) | チアゾリルベンゾフラン誘導体の製造方法、および該製造方法に用いられる化合物 | |
| KR880002272B1 (ko) | 1-치환된 옥신돌-3-카복사마이드의 제조방법 | |
| AU1399197A (en) | Thiazolylbenzofuran derivatives and pharmaceutical compositions containing them | |
| JPH07215954A (ja) | 新規ベンゾチアジアジン化合物 | |
| JPWO2001087878A1 (ja) | 新規ベンゾチオフェン誘導体 | |
| AU2008202190A1 (en) | Novel heterocyclic amide derivatives and their use as dopamine D3 receptor ligands |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |