IL57714A - Benzoyl(pyridylcarbonyl)urea and thiourea derivatives,their preparation and insecticidal compositions containing them - Google Patents
Benzoyl(pyridylcarbonyl)urea and thiourea derivatives,their preparation and insecticidal compositions containing themInfo
- Publication number
- IL57714A IL57714A IL57714A IL5771479A IL57714A IL 57714 A IL57714 A IL 57714A IL 57714 A IL57714 A IL 57714A IL 5771479 A IL5771479 A IL 5771479A IL 57714 A IL57714 A IL 57714A
- Authority
- IL
- Israel
- Prior art keywords
- pyridylcarbonyl
- benzoyl
- urea
- preparation
- compositions containing
- Prior art date
Links
- 230000000749 insecticidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- BIAGZTBMJMQKIH-UHFFFAOYSA-N n-benzoyl-n-carbamoylpyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)N(C(=O)N)C(=O)C1=CC=CC=C1 BIAGZTBMJMQKIH-UHFFFAOYSA-N 0.000 title 1
- 150000003585 thioureas Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/34—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the groups, e.g. biuret; Thio analogues thereof; Urea-aldehyde condensation products
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/42—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/18—Radicals substituted by singly bound hetero atoms other than halogen by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7807316 | 1978-07-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL57714A0 IL57714A0 (en) | 1979-11-30 |
| IL57714A true IL57714A (en) | 1983-07-31 |
Family
ID=19831203
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL57714A IL57714A (en) | 1978-07-06 | 1979-07-03 | Benzoyl(pyridylcarbonyl)urea and thiourea derivatives,their preparation and insecticidal compositions containing them |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4350706A (cs) |
| JP (1) | JPS5540667A (cs) |
| AR (1) | AR227761A1 (cs) |
| AT (1) | AT367604B (cs) |
| AU (1) | AU529840B2 (cs) |
| BE (1) | BE877486A (cs) |
| BR (1) | BR7904225A (cs) |
| CA (1) | CA1124240A (cs) |
| CH (1) | CH642061A5 (cs) |
| CS (1) | CS216201B2 (cs) |
| DD (1) | DD144709A5 (cs) |
| DE (1) | DE2926480A1 (cs) |
| DK (1) | DK155597C (cs) |
| EG (1) | EG13906A (cs) |
| ES (1) | ES482183A1 (cs) |
| FR (1) | FR2430415A1 (cs) |
| GB (1) | GB2028803B (cs) |
| HU (1) | HU182947B (cs) |
| IE (1) | IE48771B1 (cs) |
| IL (1) | IL57714A (cs) |
| IT (1) | IT1122009B (cs) |
| NZ (1) | NZ190892A (cs) |
| PL (1) | PL115792B1 (cs) |
| SE (1) | SE7905822L (cs) |
| YU (1) | YU164379A (cs) |
| ZA (1) | ZA793186B (cs) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US4405552A (en) | 1981-03-03 | 1983-09-20 | Eli Lilly And Company | 1-Benzoyl-3-(arylphyridyl)urea compounds |
| DE3132020A1 (de) * | 1981-08-13 | 1983-03-03 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von insekten und spinnentieren |
| US5416102A (en) * | 1981-11-10 | 1995-05-16 | Ciba-Geigy Corporation | Method of preventing the reinfestation of dogs and cats by fleas |
| US4880838A (en) * | 1982-06-30 | 1989-11-14 | Rhone-Poulenc | Pesticidal 1-(4-Phenoxyphenyl)-5-Benzoyl urea compounds and process for preparation |
| US4783485A (en) * | 1983-01-24 | 1988-11-08 | Duphar International Research B.V. | Benzoylurea compounds, and insecticidal and acaricidal compositions comprising same |
| DE3378207D1 (en) * | 1983-01-24 | 1988-11-17 | Duphar Int Res | Benzoylurea compounds and pesticidal compositions comprisingsame |
| DE3371508D1 (en) * | 1983-01-24 | 1987-06-19 | Duphar Int Res | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same |
| EP0116728B1 (en) * | 1983-01-24 | 1987-08-12 | Duphar International Research B.V | Composition active against mites, whitefly and thrips, pharmaceutical composition, and new benzoylureau compounds |
| US4665097A (en) * | 1983-03-31 | 1987-05-12 | Union Carbide Corporation | Novel bicyclooxyaryl thioureas and process for preparation |
| US4873264A (en) * | 1983-05-20 | 1989-10-10 | Rhone-Poulenc Nederlands B.V. | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation |
| DE3433152A1 (de) * | 1984-09-10 | 1985-04-11 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Insektizid wirksame kombinationen von benzoylharnstoff-derivaten mit 1,2-methylendioxybenzol-derivaten und gegebenenfalls pyrethrinen bzw. pyrethroiden |
| US4638088A (en) * | 1984-11-15 | 1987-01-20 | Union Carbide Corporation | Pesticidal biphenylyloxy and biphenylylalkoxy aryl acyl urea compounds |
| JPS61126151A (ja) * | 1984-11-21 | 1986-06-13 | Nippon Zeon Co Ltd | 耐油性ゴム組成物 |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| ZA861446B (en) * | 1985-03-01 | 1986-10-29 | Duphar Int Res | Benzoyl urea derivatives having anti-tumor activity |
| IT1208512B (it) * | 1985-03-14 | 1989-07-10 | Donegani Guido Ist | Benzoil-uree ad attivita'insetticida. |
| US4578402A (en) * | 1985-03-15 | 1986-03-25 | Union Carbide Corporation | Pesticidal alpha-cyanobenzyl phenyl benzoyl urea compounds |
| US4870089A (en) * | 1985-11-25 | 1989-09-26 | Fmc Corporation | N-[(alpha-perhaloalkylbenzyloxy)pyridyl]-N'-benzoylurea insecticides |
| US4609732A (en) * | 1986-01-03 | 1986-09-02 | Fmc Corporation | 2-(alpha-perhaloalkylbenzyloxy)pyridyl insecticide intermediates |
| NZ221262A (en) * | 1986-08-06 | 1990-08-28 | Ciba Geigy Ag | Preventing the reinfestation of dogs and cats by fleas by administering to the host a flea growth inhibiting substance orally, parenterally or by implant |
| US4737509A (en) * | 1986-12-04 | 1988-04-12 | Fmc Corporation | N-(4-(2-aryltetrafluoroethoxy)-3-methoxyphenyl)-N'-benzoylurea insect growth regulators |
| US5008277A (en) * | 1987-12-21 | 1991-04-16 | Fmc Corporation | N-[(alpha-perhaloalkylbenzyloxy)pyridyl]N'-benzoylurea insecticides |
| JPH01180115U (cs) * | 1988-06-03 | 1989-12-25 | ||
| US5439924A (en) * | 1991-12-23 | 1995-08-08 | Virbac, Inc. | Systemic control of parasites |
| CA2312720A1 (en) * | 1997-12-11 | 1999-06-17 | Janssen-Cilag S.A. | Retinoic acid mimetic anilides |
| ATE265424T1 (de) * | 2000-06-09 | 2004-05-15 | Aventis Pharma Gmbh | Acylphenylharnstoffderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| PE20021091A1 (es) * | 2001-05-25 | 2003-02-04 | Aventis Pharma Gmbh | Derivados de fenilurea sustituidos con carbonamida y procedimiento para su preparacion |
| EP1562895A1 (en) | 2002-11-19 | 2005-08-17 | Achillion Pharmaceuticals, Inc. | Substituted aryl acylthioureas and related compounds; inhibitors of viral replication |
| DE10346245A1 (de) * | 2003-10-06 | 2005-04-28 | Bayer Cropscience Gmbh | Verfahren zur Herstellung von Acylharnstoffderivaten, Salze dieser Acylharnstoffderivate und deren Verwendung als Schädlingsbekämpfungsmittel |
| TW200600492A (en) * | 2004-05-18 | 2006-01-01 | Achillion Pharmaceuticals Inc | Substituted aryl acylthioureas and related compounds; inhibitors of viral replication |
| US8912184B1 (en) | 2010-03-01 | 2014-12-16 | Alzheimer's Institute Of America, Inc. | Therapeutic and diagnostic methods |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB969022A (en) * | 1961-04-27 | 1964-09-09 | Olin Mathieson | Substituted ureas |
| US3933908A (en) * | 1970-05-15 | 1976-01-20 | U.S. Philips Corporation | Substituted benzoyl ureas |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| NL177823C (nl) * | 1971-04-21 | 1989-12-18 | Duphar Int Res | Werkwijze ter bereiding van ureum- en thioureumverbindingen met insecticide werking alsmede van insecticide preparaten. |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
| US4123449A (en) * | 1975-02-06 | 1978-10-31 | Bayer Aktiengesellschaft | 4-Nitro-4-isocyanato- or amino-diphenyl ethers |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531202C2 (de) * | 1975-07-12 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531743C2 (de) * | 1975-07-16 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | 2',3,6'-Trichlor-4-cyano-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwenung als Insektizide |
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| NZ183570A (en) * | 1976-03-19 | 1979-06-08 | Mcneilab Inc | Heterocyclic guanidine derivatives, having anti-secretory and hypogliycaemic activity |
| TR19459A (tr) * | 1976-08-25 | 1979-05-01 | Bayer Ag | Suebstitueye benzoliuereidodifenil eterleri,bunlarin hazirlanisi icin usuller ve bunlarin ensektisidler olarak kullanilmalari |
| JPS5344544A (en) * | 1976-09-30 | 1978-04-21 | Sumitomo Chem Co Ltd | Substituted phenylurea derivatives, their preparation, and selective herbicide comprising the corresponding compounds |
| JPS6029382B2 (ja) * | 1977-06-24 | 1985-07-10 | 住友化学工業株式会社 | N−〔p−(置換ベンジルオキシ)フエニル〕n′−ベンゾイル尿素誘導体、その製造法およびそれらを有効成分とする殺虫、殺ダニ剤 |
| BE868406A (fr) * | 1977-06-28 | 1978-12-27 | Sumitomo Chemical Co | N'-phenyl-n-methyl-urees, leur preparation et leur emploi |
| JPS54122252A (en) * | 1978-03-13 | 1979-09-21 | Sumitomo Chem Co Ltd | Substitued phenylurea derivative, its preparation, and herbicide containing the same |
-
1979
- 1979-06-26 ZA ZA793186A patent/ZA793186B/xx unknown
- 1979-06-27 US US06/052,371 patent/US4350706A/en not_active Expired - Lifetime
- 1979-06-30 DE DE19792926480 patent/DE2926480A1/de not_active Withdrawn
- 1979-07-02 AU AU48581/79A patent/AU529840B2/en not_active Ceased
- 1979-07-03 CA CA330,989A patent/CA1124240A/en not_active Expired
- 1979-07-03 DK DK280879A patent/DK155597C/da not_active IP Right Cessation
- 1979-07-03 SE SE7905822A patent/SE7905822L/xx not_active Application Discontinuation
- 1979-07-03 NZ NZ190892A patent/NZ190892A/xx unknown
- 1979-07-03 IL IL57714A patent/IL57714A/xx unknown
- 1979-07-03 CH CH621779A patent/CH642061A5/de not_active IP Right Cessation
- 1979-07-03 HU HU79DU310A patent/HU182947B/hu not_active IP Right Cessation
- 1979-07-03 CS CS794674A patent/CS216201B2/cs unknown
- 1979-07-03 GB GB7923053A patent/GB2028803B/en not_active Expired
- 1979-07-03 IT IT24075/79A patent/IT1122009B/it active
- 1979-07-03 AT AT0464579A patent/AT367604B/de not_active IP Right Cessation
- 1979-07-04 ES ES482183A patent/ES482183A1/es not_active Expired
- 1979-07-04 BE BE0/196137A patent/BE877486A/fr not_active IP Right Cessation
- 1979-07-04 FR FR7917383A patent/FR2430415A1/fr active Granted
- 1979-07-04 BR BR7904225A patent/BR7904225A/pt unknown
- 1979-07-05 YU YU01643/79A patent/YU164379A/xx unknown
- 1979-07-05 DD DD79214146A patent/DD144709A5/de unknown
- 1979-07-06 JP JP8581179A patent/JPS5540667A/ja active Granted
- 1979-07-06 AR AR277231A patent/AR227761A1/es active
- 1979-07-06 PL PL1979216907A patent/PL115792B1/pl unknown
- 1979-07-07 EG EG412/79A patent/EG13906A/xx active
- 1979-08-08 IE IE1242/79A patent/IE48771B1/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL57714A (en) | Benzoyl(pyridylcarbonyl)urea and thiourea derivatives,their preparation and insecticidal compositions containing them | |
| EP0013480A3 (en) | Herbicidal pyridinesulfonamides, preparation and use thereof and compositions containing them | |
| IL51463A (en) | Insecticidal compositions containing n-benzyl-n-methyl-2-propynylamine derivatives,several novel n-benzyl-n-methyl-2-propynylamine derivatives and their preparation | |
| DE2961508D1 (en) | Insecticidal compositions, and preparation and use thereof | |
| IL55114A (en) | 5-alkylthio-pyrimidine derivatives,their preparation and herbicidal compositions containing them | |
| IL56857A (en) | N-phenyl-n-fluorobenzoyl urea derivatives,their preparation and pesticidal compositions containing them | |
| IL60458A (en) | N-phenoxyphenyl-thiourea and isothiourea derivatives,their preparation and pesticidal compositions containing them | |
| DE2862404D1 (en) | Hydantoin derivatives, their preparation and pharmaceutical compositions containing them | |
| IL57297A (en) | 4-amino-2-piperidinoquinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56816A0 (en) | N-phenylaniline derivatives,their preparation and pharmaceutical compositions containing them | |
| DE3165868D1 (en) | Carbamoyloxyisooxazole derivatives, their preparation and insecticidal compositions containing them | |
| DE2965026D1 (en) | Substituted benzoylimidates, their preparation and compositions comprising them for insecticidal use | |
| IL57862A (en) | 1-benzoyl-3-pyridinyl ureas,their preparation and insecticidal compositions comprising them | |
| IL54011A (en) | 1,3-bis(2-oxoazacycloalkyl-alkyl)urea and thiourea derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56913A (en) | Sprio-steroid-oxazolidinone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56890A0 (en) | 2-amino-carbazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56075A (en) | Tautomeric 1-cycloalkenoyl-2-anilino-imidazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL57184A (en) | Diphenylamine derivatives,their preparation and herbicidal compositions containing them | |
| IL56512A0 (en) | Anilide derivatives, their preparation and plant-microbicidal compositions containing them | |
| HK50485A (en) | Carbostyrile derivatives,their preparation and pharmaceutical compositions containing them | |
| IL57989A (en) | (5-(o-halophenyl)-2-oxo-1,4-benzodiazepin-7-yl)urea derivatives,their manufacture and pharmaceutical compositions containing them | |
| DE2961647D1 (en) | Insecticidal compositions, and preparation and use thereof | |
| IL56349A0 (en) | 3-aminopropoxyaryl derivatives, their preparation and pharmaceutical compositions containing them | |
| IL57300A0 (en) | Arylalkyl-and aryloxyalkylphosphonates,their preparation and antiviral compositions containing them | |
| DE2960313D1 (en) | N-(o-ethyl-s-n-propyl-(di)thiophosphoryloxy)-naphtalimides, process for their preparation, pesticidal compositions containing them, their preparation and use |