IL29887A - N-substituted-2,4,5-trihalo imidazole derivatives,their preparation,and their use as acaricides - Google Patents
N-substituted-2,4,5-trihalo imidazole derivatives,their preparation,and their use as acaricidesInfo
- Publication number
- IL29887A IL29887A IL29887A IL2988768A IL29887A IL 29887 A IL29887 A IL 29887A IL 29887 A IL29887 A IL 29887A IL 2988768 A IL2988768 A IL 2988768A IL 29887 A IL29887 A IL 29887A
- Authority
- IL
- Israel
- Prior art keywords
- general formula
- imidazole
- parts
- hal
- derivatives
- Prior art date
Links
- 150000002460 imidazoles Chemical class 0.000 title claims description 15
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims description 11
- 230000000895 acaricidal effect Effects 0.000 title claims description 9
- 239000000642 acaricide Substances 0.000 title description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 14
- 239000013543 active substance Substances 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 8
- -1 sulphinyl Chemical group 0.000 claims description 8
- 241001533303 Acarinae Species 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 5
- 239000005864 Sulphur Substances 0.000 claims description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical class O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 230000004224 protection Effects 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 238000003801 milling Methods 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000003568 thioethers Chemical class 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- JCGGPCDDFXIVQB-UHFFFAOYSA-N 2,4,5-tribromo-1h-imidazole Chemical compound BrC1=NC(Br)=C(Br)N1 JCGGPCDDFXIVQB-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000839 emulsion Substances 0.000 description 7
- KCUCKJJLMMZKBV-UHFFFAOYSA-N 2,4,5-trichloro-1h-imidazole Chemical compound ClC1=NC(Cl)=C(Cl)N1 KCUCKJJLMMZKBV-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 6
- 235000008504 concentrate Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- SNODATUILHBXFF-UHFFFAOYSA-N 5-bromo-2-chloro-1h-imidazole Chemical compound ClC1=NC=C(Br)N1 SNODATUILHBXFF-UHFFFAOYSA-N 0.000 description 4
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 241000238876 Acari Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000006072 paste Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 241000239290 Araneae Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241001454295 Tetranychidae Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- UKXSKSHDVLQNKG-UHFFFAOYSA-N benzilic acid Chemical class C=1C=CC=CC=1C(O)(C(=O)O)C1=CC=CC=C1 UKXSKSHDVLQNKG-UHFFFAOYSA-N 0.000 description 2
- 235000021028 berry Nutrition 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- OPUAWDUYWRUIIL-UHFFFAOYSA-N methanedisulfonic acid Chemical compound OS(=O)(=O)CS(O)(=O)=O OPUAWDUYWRUIIL-UHFFFAOYSA-N 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 230000000885 phytotoxic effect Effects 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- KAMDVXMJRMNDCQ-UHFFFAOYSA-N 2,4,5-tribromo-1-methylimidazole Chemical compound CN1C(Br)=NC(Br)=C1Br KAMDVXMJRMNDCQ-UHFFFAOYSA-N 0.000 description 1
- KYPQLESZZWJYCR-UHFFFAOYSA-N 2,4,5-trichloro-1-(methylsulfanylmethyl)imidazole Chemical compound CSCN1C(=NC(=C1Cl)Cl)Cl KYPQLESZZWJYCR-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 241000489242 Amphitetranychus viennensis Species 0.000 description 1
- GQXDDONGIJJFOW-UHFFFAOYSA-N BrC=1N=C(NC1Br)Cl Chemical compound BrC=1N=C(NC1Br)Cl GQXDDONGIJJFOW-UHFFFAOYSA-N 0.000 description 1
- GJKVMEHRUCPFFZ-UHFFFAOYSA-N C(C)(C)S(=O)CN1C(=NC(=C1Br)Br)Br Chemical compound C(C)(C)S(=O)CN1C(=NC(=C1Br)Br)Br GJKVMEHRUCPFFZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001481698 Mesostigmata Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000488583 Panonychus ulmi Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 241001645405 Sarcoptiformes Species 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241001645411 Trombidiformes Species 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229940115440 aluminum sodium silicate Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 231100000194 ovacidal Toxicity 0.000 description 1
- 230000003151 ovacidal effect Effects 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N s-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/68—Halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH596067A CH485733A (de) | 1967-04-26 | 1967-04-26 | Verfahren zur Herstellung halogensubstituierter Imidazol-Derivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL29887A0 IL29887A0 (en) | 1968-06-20 |
| IL29887A true IL29887A (en) | 1971-12-29 |
Family
ID=4302145
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29887A IL29887A (en) | 1967-04-26 | 1968-04-25 | N-substituted-2,4,5-trihalo imidazole derivatives,their preparation,and their use as acaricides |
| IL29888A IL29888A (en) | 1967-04-26 | 1968-04-25 | Insecticidal and acaricidal compositions containing n-substituted 2,4,5-trihalo-imidazole derivatives |
| IL29886A IL29886A (en) | 1967-04-26 | 1968-04-25 | N-substituted derivatives of 2,4,5-trihaloimidazole and their preparation |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL29888A IL29888A (en) | 1967-04-26 | 1968-04-25 | Insecticidal and acaricidal compositions containing n-substituted 2,4,5-trihalo-imidazole derivatives |
| IL29886A IL29886A (en) | 1967-04-26 | 1968-04-25 | N-substituted derivatives of 2,4,5-trihaloimidazole and their preparation |
Country Status (14)
| Country | Link |
|---|---|
| US (5) | US3625953A (e) |
| AT (4) | AT280280B (e) |
| BE (3) | BE714239A (e) |
| BR (1) | BR6898630D0 (e) |
| CA (1) | CA928306A (e) |
| CH (3) | CH485412A (e) |
| DE (2) | DE1770270A1 (e) |
| DK (2) | DK125565B (e) |
| ES (6) | ES353179A1 (e) |
| FR (3) | FR1567372A (e) |
| GB (3) | GB1197103A (e) |
| IL (3) | IL29887A (e) |
| NL (3) | NL139313B (e) |
| SE (3) | SE352804B (e) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH485412A (de) * | 1967-04-26 | 1970-02-15 | Agripat Sa | Mittel zur Bekämpfung tierischer und pflanzlicher Schädlinge |
| CH510394A (de) * | 1969-07-04 | 1971-07-31 | Ciba Geigy Ag | Akarizides Mittel |
| FR2104652A2 (en) * | 1970-04-29 | 1972-04-21 | Agripat Sa | 1-alkoxymethyl-2, 4, 5-trichloroimidazoles - insecticides and acaricides |
| US3934019A (en) * | 1970-12-18 | 1976-01-20 | Bayer Aktiengesellschaft | Pesticidal 4,5-bis-(trifluoromethylimino)-diazoles |
| US4089672A (en) * | 1972-12-20 | 1978-05-16 | The Upjohn Company | 1-(Substituted-hydrocarbyl)-di- and trihalopyrazoles |
| DE2314985A1 (de) * | 1973-03-26 | 1974-10-17 | Hoechst Ag | 1-(imidazol-1-yl)-isochinoline und verfahren zu ihrer herstellung |
| NZ178996A (en) * | 1974-11-15 | 1978-06-02 | Kornis G | Pyrfazole amides and thioamides;herbicidal compositions |
| AU2241677A (en) * | 1976-03-12 | 1978-08-24 | Bayer Ag | 4,5-dichloroimidazole-2-carboxylic acid derivatives |
| DE2646144A1 (de) * | 1976-10-13 | 1978-04-20 | Bayer Ag | 4,5-dichlor-imidazol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| US4185991A (en) * | 1976-10-13 | 1980-01-29 | Bayer Aktiengesellschaft | 4,5-Dichloro-imidazole derivatives and their use as herbicides |
| US4187100A (en) * | 1976-10-13 | 1980-02-05 | Bayer Aktiengesellschaft | 4,5-Dichloro-imidazole-1-carboxylic acid aryl esters and their use as herbicides |
| DE2646143A1 (de) * | 1976-10-13 | 1978-04-20 | Bayer Ag | 4,5-dichlor-imidazol-1-carbonsaeure- arylester, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| DE2646142A1 (de) * | 1976-10-13 | 1978-04-20 | Bayer Ag | 1-acyloxymethyl-4,5-dichlor- imidazol-2-carbonsaeure-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| EG17668A (en) * | 1984-11-22 | 1990-08-30 | Sumitomo Chemical Co | Process for preparing of a bromodichlorimidazole insecticide |
| JPS6239577A (ja) * | 1985-08-15 | 1987-02-20 | Sumitomo Chem Co Ltd | トリハロイミダゾ−ル誘導体、その製造法およびそれを有効成分とする殺虫剤 |
| DE3828208A1 (de) * | 1988-08-19 | 1990-02-22 | Basf Ag | Substituierte 2-chlorimidazolderivate, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide mittel |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1567084A1 (de) * | 1963-07-01 | 1970-10-15 | Shell Int Research | Mittel zur Bekaempfung unerwuenschten Pflanzenwuchses |
| US3501286A (en) * | 1964-06-29 | 1970-03-17 | Shell Oil Co | Plant growth control |
| DE1294086B (de) * | 1964-08-07 | 1969-04-30 | Shell Int Research | Herbizide Mittel |
| GB1154722A (en) * | 1965-07-08 | 1969-06-11 | Boots Pure Drug Co Ltd | 2,4,5-Tribromoimidazole Derivatives and Compositions thereof |
| US3409606A (en) * | 1965-12-30 | 1968-11-05 | American Cyanamid Co | Halogenated chloroimidazole compounds |
| US3435050A (en) * | 1966-04-08 | 1969-03-25 | Dow Chemical Co | 2,4,5-trichloroimidazole and method of preparation |
| FR1494338A (fr) * | 1966-07-29 | 1967-09-08 | Chimetron Sarl | Sulfénylimidazoles |
| CH485412A (de) * | 1967-04-26 | 1970-02-15 | Agripat Sa | Mittel zur Bekämpfung tierischer und pflanzlicher Schädlinge |
-
1967
- 1967-04-26 CH CH25470A patent/CH485412A/de not_active IP Right Cessation
- 1967-04-26 CH CH596067A patent/CH485733A/de not_active IP Right Cessation
- 1967-04-26 CH CH25370A patent/CH485736A/de not_active IP Right Cessation
-
1968
- 1968-04-24 US US723903A patent/US3625953A/en not_active Expired - Lifetime
- 1968-04-24 US US723904A patent/US3625955A/en not_active Expired - Lifetime
- 1968-04-25 IL IL29887A patent/IL29887A/en unknown
- 1968-04-25 CA CA018359A patent/CA928306A/en not_active Expired
- 1968-04-25 GB GB19571/68A patent/GB1197103A/en not_active Expired
- 1968-04-25 BE BE714239D patent/BE714239A/xx unknown
- 1968-04-25 ES ES353179A patent/ES353179A1/es not_active Expired
- 1968-04-25 ES ES353177A patent/ES353177A1/es not_active Expired
- 1968-04-25 IL IL29888A patent/IL29888A/xx unknown
- 1968-04-25 ES ES353182A patent/ES353182A1/es not_active Expired
- 1968-04-25 GB GB19569/68A patent/GB1197101A/en not_active Expired
- 1968-04-25 DE DE19681770270 patent/DE1770270A1/de active Pending
- 1968-04-25 GB GB19570/68A patent/GB1197102A/en not_active Expired
- 1968-04-25 AT AT404068A patent/AT280280B/de active
- 1968-04-25 BE BE714241D patent/BE714241A/xx unknown
- 1968-04-25 ES ES353178A patent/ES353178A1/es not_active Expired
- 1968-04-25 AT AT492969A patent/AT291667B/de not_active IP Right Cessation
- 1968-04-25 NL NL686805901A patent/NL139313B/xx unknown
- 1968-04-25 IL IL29886A patent/IL29886A/xx unknown
- 1968-04-25 FR FR1567372D patent/FR1567372A/fr not_active Expired
- 1968-04-25 SE SE05586/68A patent/SE352804B/xx unknown
- 1968-04-25 BR BR198630/68A patent/BR6898630D0/pt unknown
- 1968-04-25 SE SE05585/68A patent/SE354072B/xx unknown
- 1968-04-25 AT AT403968A patent/AT280279B/de not_active IP Right Cessation
- 1968-04-25 ES ES353180A patent/ES353180A1/es not_active Expired
- 1968-04-25 BE BE714240D patent/BE714240A/xx unknown
- 1968-04-25 DK DK189168AA patent/DK125565B/da unknown
- 1968-04-25 AT AT404168A patent/AT280692B/de not_active IP Right Cessation
- 1968-04-25 NL NL6805899A patent/NL6805899A/xx unknown
- 1968-04-25 SE SE05584/68A patent/SE354176B/xx unknown
- 1968-04-25 FR FR1567373D patent/FR1567373A/fr not_active Expired
- 1968-04-25 ES ES353181A patent/ES353181A1/es not_active Expired
- 1968-04-25 FR FR1567374D patent/FR1567374A/fr not_active Expired
- 1968-04-25 DK DK189368AA patent/DK125284B/da unknown
- 1968-04-25 NL NL6805900A patent/NL6805900A/xx unknown
- 1968-04-25 DE DE1770269A patent/DE1770269C3/de not_active Expired
-
1970
- 1970-06-08 US US44558A patent/US3674874A/en not_active Expired - Lifetime
-
1971
- 1971-04-05 US US00131447A patent/US3773960A/en not_active Expired - Lifetime
- 1971-06-28 US US00157698A patent/US3759945A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3773960A (en) | Acaracidal compositions and methods comprising aliphatically substituted thiosulfinyl-and sulfonyl-alkyl-2,4,5-trihalogeno imidazoles | |
| EP1101760B1 (en) | Difluoromethanesulfonyl anilide derivatives, process for the preparation of them and herbicides containing them as the active ingredient | |
| CS268519B2 (en) | Insecticide and acaricide and method of its efficient component production | |
| PL117396B1 (en) | Process for preparing novel derivatives of benzimidazole | |
| AU595229B2 (en) | Substituted semicarbazones, thiosemicarbazones and isothiosemicarbazones | |
| IL24464A (en) | Benzimidazole compounds,their preparation,and physiologically active compositions containing them | |
| GB819689A (en) | Thiophosphoric acid esters | |
| SU791199A3 (ru) | Акарицидное средство | |
| IL28545A (en) | Fungicidal 1-acyl-benzimidazoline derivatives | |
| US3784696A (en) | Control of insects and acarinae with 4,4'-dibromo-and 4- chloro-4'-bromobenzilic acid esters | |
| KR940011460B1 (ko) | 벤조티아지논 화합물의 제조방법 | |
| EP0004129A2 (en) | Thiazolidinone derivatives, their preparation, their pesticidal compositions and processes for treating plants | |
| EP0258182A1 (en) | Semicarbazones and thiosemicarbazones | |
| US4276302A (en) | Miticidal 2-(phenoxy-alpha-alkyl)-imidazolines | |
| US2971884A (en) | Method for the control of fungal organisms | |
| DK158153B (da) | Fremgangsmaade til fremstilling af 3,4,6-trisubstituerede 3-alkylthio-1,2,4-triazin-5-oner | |
| EP0286006A1 (en) | Thiadiazole derivative, and insecticidal and miticidal composition containing the derivative as the effective ingredient | |
| US3562292A (en) | N-substituted phthalimides | |
| CS258139B2 (en) | Fungicide and method of its efficient substance production | |
| US4551458A (en) | Quinazolines and fungicidal compositions thereof | |
| CA1169076A (en) | Benzotriazoles, the preparation thereof and their use as fungicides | |
| US3772320A (en) | N1-sulfonyl-2-phenylhydrazino-2-imidazolines | |
| US4033960A (en) | 2-Mercaptoquinoxaline-di-N-oxide products and a method for their preparation | |
| US4034104A (en) | Carbamic acid esters of gallic acid, their esters, and heavy metal salts | |
| EP0091148B1 (en) | Fungicidal heterocyclic compounds |