IE46588B1 - Isocyanurate compounds and method for preparation thereof - Google Patents
Isocyanurate compounds and method for preparation thereofInfo
- Publication number
- IE46588B1 IE46588B1 IE562/78A IE56278A IE46588B1 IE 46588 B1 IE46588 B1 IE 46588B1 IE 562/78 A IE562/78 A IE 562/78A IE 56278 A IE56278 A IE 56278A IE 46588 B1 IE46588 B1 IE 46588B1
- Authority
- IE
- Ireland
- Prior art keywords
- isocyanurate
- weight
- blocked
- stage
- caprolactam
- Prior art date
Links
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical class OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 title claims abstract description 31
- 238000000034 method Methods 0.000 title claims abstract description 25
- 238000002360 preparation method Methods 0.000 title abstract description 14
- 239000000203 mixture Substances 0.000 claims abstract description 42
- 239000005056 polyisocyanate Substances 0.000 claims abstract description 34
- 229920001228 polyisocyanate Polymers 0.000 claims abstract description 34
- 239000002981 blocking agent Substances 0.000 claims abstract description 19
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims abstract description 19
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 10
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical group O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 31
- 239000012948 isocyanate Substances 0.000 claims description 30
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical group CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 claims description 15
- -1 isocyanurate compound Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 2
- 239000013067 intermediate product Substances 0.000 abstract description 2
- VYGUBTIWNBFFMQ-UHFFFAOYSA-N [N+](#[C-])N1C(=O)NC=2NC(=O)NC2C1=O Chemical group [N+](#[C-])N1C(=O)NC=2NC(=O)NC2C1=O VYGUBTIWNBFFMQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 33
- 239000000047 product Substances 0.000 description 31
- 150000002513 isocyanates Chemical class 0.000 description 24
- 239000003054 catalyst Substances 0.000 description 19
- 230000000903 blocking effect Effects 0.000 description 16
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000005058 Isophorone diisocyanate Substances 0.000 description 9
- 239000011521 glass Substances 0.000 description 6
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 5
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 5
- WJIOHMVWGVGWJW-UHFFFAOYSA-N 3-methyl-n-[4-[(3-methylpyrazole-1-carbonyl)amino]butyl]pyrazole-1-carboxamide Chemical compound N1=C(C)C=CN1C(=O)NCCCCNC(=O)N1N=C(C)C=C1 WJIOHMVWGVGWJW-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- DFTMMVSDKIXUIX-KQQUZDAGSA-N (NE)-N-[(4E)-4-hydroxyiminohexan-3-ylidene]hydroxylamine Chemical compound CC\C(=N/O)\C(\CC)=N\O DFTMMVSDKIXUIX-KQQUZDAGSA-N 0.000 description 1
- JHNRZXQVBKRYKN-VQHVLOKHSA-N (ne)-n-(1-phenylethylidene)hydroxylamine Chemical compound O\N=C(/C)C1=CC=CC=C1 JHNRZXQVBKRYKN-VQHVLOKHSA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- ZTNJGMFHJYGMDR-UHFFFAOYSA-N 1,2-diisocyanatoethane Chemical compound O=C=NCCN=C=O ZTNJGMFHJYGMDR-UHFFFAOYSA-N 0.000 description 1
- 229940008841 1,6-hexamethylene diisocyanate Drugs 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- URTHTVUJNWVGAB-UHFFFAOYSA-N 3-isocyanato-1,1,5-trimethylcyclohexane Chemical compound CC1CC(N=C=O)CC(C)(C)C1 URTHTVUJNWVGAB-UHFFFAOYSA-N 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- RRUDCFGSUDOHDG-UHFFFAOYSA-N acetohydroxamic acid Chemical compound CC(O)=NO RRUDCFGSUDOHDG-UHFFFAOYSA-N 0.000 description 1
- 229960001171 acetohydroxamic acid Drugs 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- VDEUYMSGMPQMIK-UHFFFAOYSA-N benzhydroxamic acid Chemical compound ONC(=O)C1=CC=CC=C1 VDEUYMSGMPQMIK-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- MHWWXNJJLIETEQ-UHFFFAOYSA-N n-(2,2,3-trimethylcyclohexylidene)hydroxylamine Chemical compound CC1CCCC(=NO)C1(C)C MHWWXNJJLIETEQ-UHFFFAOYSA-N 0.000 description 1
- DNYZBFWKVMKMRM-UHFFFAOYSA-N n-benzhydrylidenehydroxylamine Chemical compound C=1C=CC=CC=1C(=NO)C1=CC=CC=C1 DNYZBFWKVMKMRM-UHFFFAOYSA-N 0.000 description 1
- WHIVNJATOVLWBW-UHFFFAOYSA-N n-butan-2-ylidenehydroxylamine Chemical compound CCC(C)=NO WHIVNJATOVLWBW-UHFFFAOYSA-N 0.000 description 1
- SQDFHQJTAWCFIB-UHFFFAOYSA-N n-methylidenehydroxylamine Chemical compound ON=C SQDFHQJTAWCFIB-UHFFFAOYSA-N 0.000 description 1
- 125000005609 naphthenate group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
- C07D251/34—Cyanuric or isocyanuric esters
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/79—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates
- C08G18/791—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates containing isocyanurate groups
- C08G18/792—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates containing isocyanurate groups formed by oligomerisation of aliphatic and/or cycloaliphatic isocyanates or isothiocyanates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/80—Masked polyisocyanates
- C08G18/8061—Masked polyisocyanates masked with compounds having only one group containing active hydrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
- C08G69/14—Lactams
- C08G69/16—Preparatory processes
- C08G69/18—Anionic polymerisation
- C08G69/20—Anionic polymerisation characterised by the catalysts used
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772712931 DE2712931A1 (de) | 1977-03-24 | 1977-03-24 | Isocyanuratgruppen - und endstaendig- blockierte isocyanatgruppen - enthaltende verbindungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE780562L IE780562L (en) | 1978-09-24 |
| IE46588B1 true IE46588B1 (en) | 1983-07-27 |
Family
ID=6004525
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE562/78A IE46588B1 (en) | 1977-03-24 | 1978-03-21 | Isocyanurate compounds and method for preparation thereof |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4302351A (enExample) |
| JP (1) | JPS53121773A (enExample) |
| BE (1) | BE865301A (enExample) |
| CH (1) | CH639651A5 (enExample) |
| DE (1) | DE2712931A1 (enExample) |
| DK (1) | DK153548C (enExample) |
| FR (1) | FR2384746A1 (enExample) |
| GB (1) | GB1600042A (enExample) |
| IE (1) | IE46588B1 (enExample) |
| IT (1) | IT1113118B (enExample) |
| NL (1) | NL188999C (enExample) |
| ZA (1) | ZA781717B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2842641A1 (de) * | 1978-09-29 | 1980-04-10 | Bayer Ag | Lackpolyisocyanat auf basis von modifiziertem 1-isocyanato-3,3,5-trimethyl-5-isocyanatomethyl-cyclohexan, ein verfahren zu seiner herstellung und seine verwendung in zweikomponenten-polyurethan-pulverlacken |
| DE2938855A1 (de) * | 1979-09-26 | 1981-04-09 | Chemische Werke Hüls AG, 4370 Marl | Einkomponenten-einbrennlacke |
| DE3001060A1 (de) * | 1980-01-12 | 1981-07-16 | Chemische Werke Hüls AG, 4370 Marl | Blockierte polyisocyanato-isocyanurate und ihre herstellung und verwendung |
| US4359541A (en) * | 1981-01-19 | 1982-11-16 | Basf Wyandotte Corporation | Process for the preparation of polyisocyanurate dispersions and compositions prepared therefrom |
| US4491663A (en) * | 1982-04-14 | 1985-01-01 | Ford Motor Company | Trifunctional blocked isocyanate containing an isocyanurate ring |
| DE3328131C2 (de) * | 1983-08-04 | 1994-02-03 | Huels Chemische Werke Ag | Pulverlacke auf der Basis teilblockierter IPDI-Isocyanurate und hydroxylgruppenhaltiger Polyester sowie ein Verfahren zur Herstellung matter Überzüge |
| NL8303152A (nl) * | 1983-09-13 | 1985-04-01 | Dsm Resins Bv | Werkwijze voor het bereiden van een isocyanaat groepen bevattende isocyanuraatverbinding. |
| DE4015155A1 (de) * | 1990-05-11 | 1991-11-14 | Bayer Ag | Verfahren zur herstellung von isocyanuratpolyisocyanaten, die nach diesem verfahren enthaltenen verbindungen und ihre verwendung |
| DE4115402A1 (de) * | 1991-05-10 | 1992-11-12 | Huels Chemische Werke Ag | Verfahren zur herstellung eines blockierten lackpolyisocyanats und dessen verwendung fuer pur-lacke |
| DE4311609C2 (de) * | 1993-04-08 | 1995-11-23 | Huels Chemische Werke Ag | Mit Acetessigsäure-t-butylester ganz oder teilweise blockierte (cyclo)-aliphatische Polyisocyanate |
| US5554692A (en) * | 1994-01-06 | 1996-09-10 | Ferro Corporation | Blocked isocyanate crosslinkers based on pentaerythritol for use in thermosetting coatings |
| DE4419216C1 (de) * | 1994-06-01 | 1995-08-31 | Bollig & Kemper | Wäßrige Überzugsmittel und deren Verwendung |
| GB9513713D0 (en) * | 1995-07-05 | 1995-09-06 | Exxon Chemical Patents Inc | Curable elastomeric compositions and a process to produce curable elastomeric compositions |
| DE19603389A1 (de) | 1996-01-31 | 1997-08-07 | Huels Chemische Werke Ag | Blockierte aliphatische Diisocyanate oder Diisocyanat-Addukte |
| JP3712295B2 (ja) * | 1996-04-12 | 2005-11-02 | 旭化成ケミカルズ株式会社 | ブロックポリイソシアネート組成物及びそれを用いた一液性熱硬化組成物 |
| US5912302A (en) * | 1996-06-11 | 1999-06-15 | Gadkari; Avinash Chandrakant | Elastomeric compositions and a process to produce elastomeric compositions |
| NL1010175C2 (nl) * | 1998-09-24 | 2000-03-27 | Dsm Nv | Werkwijze voor de bereiding van N-alkylcarbamoylderivaat. |
| US6448394B1 (en) | 1998-09-24 | 2002-09-10 | Dsm N.V. | Process for the preparation of an N-alkyl or N-aryl carbamoyl derivative |
| DE10106630A1 (de) * | 2001-02-12 | 2002-08-22 | Jowat Lobers U Frank Gmbh & Co | Selbsttragendes reaktives Schmelzklebeelement und seine Verwendung |
| DE10163826A1 (de) | 2001-12-22 | 2003-07-03 | Degussa | Strahlen härtbare Pulverlackzusammensetzungen und deren Verwendung |
| DE10320266A1 (de) | 2003-05-03 | 2004-11-18 | Degussa Ag | Feste Uretdiongruppenhaltige Polyurethan-Pulverlackzusammensetzungen bei niedriger Temperatur härtbar |
| DE10346957A1 (de) | 2003-10-09 | 2005-05-04 | Degussa | Hochreaktive, flüssige uretdiongruppenhaltige Polyurenthansysteme, die bei niedriger Temperatur härtbar sind |
| DE10347902A1 (de) * | 2003-10-15 | 2005-05-19 | Degussa Ag | Feste uretdiongruppenhaltige Polyadditionsverbindungen |
| DE10348965A1 (de) * | 2003-10-22 | 2005-05-25 | Degussa Ag | Epoxidgruppenhaltige Pulverlackzusammensetzungen, die bei niedrigen Temperaturen aushärten |
| DE102004020451A1 (de) * | 2004-04-27 | 2005-12-01 | Degussa Ag | Uretdiongruppenhaltige Polyurethanzusammensetzungen, welche bei niedriger Temperatur härtbar sind und (teil-)kristalline Harze enthalten |
| DE102004020429A1 (de) * | 2004-04-27 | 2005-11-24 | Degussa Ag | Uretdiongruppenhaltige Polyurethanzusammensetzungen, welche bei niedriger Temperatur härtbar sind und (teil-)kristalline Harze enthalten |
| DE102007022789A1 (de) | 2007-04-26 | 2008-10-30 | Evonik Degussa Gmbh | Bei niedriger Temperatur härtbare, Uretdiongruppen aufweisende Polyurethanzusammensetzungen enthaltend Polymere auf der Basis von sekundären OH-Gruppen tragenden Polyolen |
| DE102007062316A1 (de) | 2007-12-21 | 2009-06-25 | Evonik Degussa Gmbh | Reaktive Isocyanatzusammensetzungen |
| DE102008007386A1 (de) | 2008-02-01 | 2009-08-06 | Evonik Degussa Gmbh | Verfahren zur Herstellung hochreaktiver uretdiongruppenhaltiger Polyurethanzusammensetzungen im Dryblend |
| DE102008002703A1 (de) | 2008-06-27 | 2009-12-31 | Evonik Degussa Gmbh | Hochreaktive, Uretdiongruppen haltige Polyurethanzusammensetzungen, die metallfreie Acetylacetonate enthalten |
| CN104159942B (zh) | 2011-12-28 | 2016-10-12 | 亨茨曼国际有限公司 | 包含多异氰酸酯组合物的可固化组合物 |
| EP2644270A1 (en) | 2012-03-29 | 2013-10-02 | Huntsman International Llc | Polyisocyanate trimerization catalyst composition |
| EP2687551A1 (en) | 2012-07-17 | 2014-01-22 | Huntsman International Llc | Intermediate polyisocyanurate comprising materials |
| DE102014214130A1 (de) | 2014-07-21 | 2016-01-21 | Evonik Degussa Gmbh | Hochreaktive, Uretdiongruppen haltige Polyurethanzusammensetzungen, die Carbonatsalze enthalten |
| EP3929233A1 (de) | 2020-06-25 | 2021-12-29 | Evonik Operations GmbH | Reaktive polyurethan-zusammensetzungen |
| EP4163314B1 (de) | 2021-10-05 | 2023-12-06 | Evonik Operations GmbH | Verfahren zur herstellung fester polyurethanhärter |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3577391A (en) * | 1968-10-08 | 1971-05-04 | Marathon Oil Co | Alcohol-blocker isocyanate compositions and derivatives |
| DE2105777C3 (de) * | 1971-02-08 | 1976-02-05 | Veba Chemie Ag | Pulverförmige Überzugsmasse |
| DE2166423A1 (de) * | 1971-02-08 | 1974-01-03 | Veba Chemie Ag | Epsilon-caprolactam blockierte isocyanate |
| GB1391066A (en) * | 1971-07-16 | 1975-04-16 | Ici Ltd | Urethane oils |
| JPS4830453A (enExample) * | 1971-08-23 | 1973-04-21 | ||
| DE2225958C3 (de) * | 1972-05-27 | 1980-08-21 | Bayer Ag, 5090 Leverkusen | Bindemittel für das elektrostatische Pulverspriihverfahren |
| DE2325826C3 (de) * | 1973-05-22 | 1981-01-29 | Chemische Werke Huels Ag, 4370 Marl | Isocyanato-isocyanurate und Herstellung lagerstabiler Lösungen hiervon |
| FI62677C (fi) * | 1974-06-21 | 1983-02-10 | Grow Group Inc | Belaeggningskomposition omfattande ett polymeriserat harts medisocyanatreaktiva grupper och ett tvaerbindningsmedel med bockerade isocyanatgrupper |
| DE2456469C2 (de) * | 1974-11-29 | 1983-01-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von in Wasser löslichen bzw. dispergierbaren blockierten Polyisocyanaten und ihre Verwendung als Beschichtungsmittel |
| DE2502934A1 (de) * | 1975-01-24 | 1976-07-29 | Bayer Ag | Uretdiongruppen und endstaendige blockierte isocyanatgruppen aufweisende organische verbindungen |
| DE2542706C3 (de) * | 1975-09-25 | 1981-04-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Imidgruppen enthaltenden Polykondensaten |
| DE2644684C2 (de) * | 1976-10-02 | 1983-01-13 | Chemische Werke Huels Ag, 4370 Marl | Verfahren zur Herstellung von 2,4,6-Triketohexahydrotriazinen |
| US4055551A (en) * | 1976-12-08 | 1977-10-25 | Cargill, Incorporated | Continuous process for the production of blocked isocyanates |
| DE2707656C2 (de) * | 1977-02-23 | 1986-04-17 | Bayer Ag, 5090 Leverkusen | Pulverförmige Überzugsmittel |
-
1977
- 1977-03-24 DE DE19772712931 patent/DE2712931A1/de active Granted
-
1978
- 1978-03-21 IE IE562/78A patent/IE46588B1/en unknown
- 1978-03-21 FR FR7808160A patent/FR2384746A1/fr active Granted
- 1978-03-21 CH CH307678A patent/CH639651A5/de not_active IP Right Cessation
- 1978-03-22 DK DK131578A patent/DK153548C/da not_active IP Right Cessation
- 1978-03-22 IT IT21487/78A patent/IT1113118B/it active
- 1978-03-23 ZA ZA00781717A patent/ZA781717B/xx unknown
- 1978-03-23 JP JP3247878A patent/JPS53121773A/ja active Pending
- 1978-03-23 NL NLAANVRAGE7803146,A patent/NL188999C/xx not_active IP Right Cessation
- 1978-03-23 GB GB11681/78A patent/GB1600042A/en not_active Expired
- 1978-03-24 BE BE186257A patent/BE865301A/xx not_active IP Right Cessation
-
1980
- 1980-04-11 US US06/139,399 patent/US4302351A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK153548C (da) | 1988-12-12 |
| GB1600042A (en) | 1981-10-14 |
| NL188999B (nl) | 1992-07-01 |
| NL7803146A (nl) | 1978-09-26 |
| BE865301A (fr) | 1978-07-17 |
| ZA781717B (en) | 1979-03-28 |
| DK153548B (da) | 1988-07-25 |
| IT1113118B (it) | 1986-01-20 |
| CH639651A5 (de) | 1983-11-30 |
| DE2712931A1 (de) | 1978-09-28 |
| IT7821487A0 (it) | 1978-03-22 |
| IE780562L (en) | 1978-09-24 |
| US4302351A (en) | 1981-11-24 |
| DK131578A (da) | 1978-09-25 |
| FR2384746A1 (fr) | 1978-10-20 |
| DE2712931C2 (enExample) | 1987-12-17 |
| NL188999C (nl) | 1992-12-01 |
| JPS53121773A (en) | 1978-10-24 |
| FR2384746B1 (enExample) | 1984-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE46588B1 (en) | Isocyanurate compounds and method for preparation thereof | |
| US5143994A (en) | Polyisocyanate mixture, a process for its preparation and its use in polyurethane coating compositions | |
| US4994541A (en) | Process for the preparation of polyisocyanates containing uretdione and isocyanurate groups, the polyisocyanates obtained by this process and their use in two-component polyurethane coatings | |
| US4419513A (en) | Isocyanato-isocyanurates, and process for the production thereof | |
| US5621063A (en) | Blocked polyisocyanates and a process for their preparation | |
| US4306051A (en) | Isocyanurate group-and terminally blocked isocyanate group-containing compounds | |
| KR100355259B1 (ko) | 우레티디온그룹과알로파네이트그룹을포함하는폴리이소시아네이트 | |
| CA1335991C (en) | Process for the production of isocyanurate polyisocyanates, the compounds obtained by this process and their use | |
| JP3103630B2 (ja) | ウレットジオン基及び/又はイソシアヌレート基を含有するポリイソシアネート並びにそれらの製造方法 | |
| US5750629A (en) | Uretdione diisocyanates and a process for their production | |
| US5115072A (en) | Reactive resins with terminal and/or pendant vinyl groups | |
| CA2184239A1 (en) | Polycyclic iminooxadiazinediones, their preparation and use | |
| US5606001A (en) | Polyisocyanates containing allophanate groups and optionally isocyanurate groups | |
| EP0224165A2 (de) | Verfahren zur Herstellung von Isocyanuratgruppen aufweisenden Polyisocyanaten und ihre Verwendung als Isocyanatkomponente in Polyurethanlacken | |
| US4373080A (en) | Polyisocyanates, preparation and use thereof | |
| KR100924485B1 (ko) | 높은 관능도를 가진 저점도 폴리이소시아네이트 조성물 및그 제조방법 | |
| US4656223A (en) | Process for the production of modified polyisocyanates, the compounds obtainable by this process and their use in polyurethane lacquers | |
| US4639502A (en) | Substantially colorless organic polyisocyanates, processes for their production and their use in the production of polyurethane plastics | |
| US6204351B1 (en) | Blocked polyisocyanates with built-in hals stabilizer | |
| US4500698A (en) | One-component baking enamels | |
| EP0727453A1 (de) | Isocyanurat-Polyisocyanate auf Basis von 1,3-Diisocyanatocycloalkanen |