IE46502B1 - Imidazole derivatives having herbicidal activity - Google Patents
Imidazole derivatives having herbicidal activityInfo
- Publication number
- IE46502B1 IE46502B1 IE431/78A IE43178A IE46502B1 IE 46502 B1 IE46502 B1 IE 46502B1 IE 431/78 A IE431/78 A IE 431/78A IE 43178 A IE43178 A IE 43178A IE 46502 B1 IE46502 B1 IE 46502B1
- Authority
- IE
- Ireland
- Prior art keywords
- imidazole
- dicarboxamide
- dimethyl
- ethyl
- spp
- Prior art date
Links
- 150000002460 imidazoles Chemical class 0.000 title claims abstract description 49
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 title claims abstract description 21
- 230000002363 herbicidal effect Effects 0.000 title claims description 48
- 150000001875 compounds Chemical class 0.000 claims abstract description 88
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 48
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 22
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 8
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 239000004009 herbicide Substances 0.000 claims abstract description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 5
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 109
- 239000000203 mixture Substances 0.000 claims description 92
- 241000196324 Embryophyta Species 0.000 claims description 74
- 238000000034 method Methods 0.000 claims description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 38
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 230000012010 growth Effects 0.000 claims description 35
- 238000002360 preparation method Methods 0.000 claims description 32
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 28
- -1 trifluoromethoxy, methyl Chemical group 0.000 claims description 20
- 239000003085 diluting agent Substances 0.000 claims description 18
- 239000011149 active material Substances 0.000 claims description 16
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 239000000969 carrier Substances 0.000 claims description 11
- 239000008187 granular material Substances 0.000 claims description 11
- 239000003960 organic solvent Substances 0.000 claims description 11
- 240000008042 Zea mays Species 0.000 claims description 10
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 claims description 10
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 10
- 235000009973 maize Nutrition 0.000 claims description 10
- 239000002689 soil Substances 0.000 claims description 10
- 244000075850 Avena orientalis Species 0.000 claims description 9
- 229910052801 chlorine Chemical group 0.000 claims description 8
- 240000007594 Oryza sativa Species 0.000 claims description 7
- 235000007164 Oryza sativa Nutrition 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 235000009566 rice Nutrition 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 235000007319 Avena orientalis Nutrition 0.000 claims description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 claims description 6
- 240000005979 Hordeum vulgare Species 0.000 claims description 6
- 235000007238 Secale cereale Nutrition 0.000 claims description 6
- 240000003829 Sorghum propinquum Species 0.000 claims description 6
- 235000011684 Sorghum saccharatum Nutrition 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 244000291564 Allium cepa Species 0.000 claims description 5
- 235000002732 Allium cepa var. cepa Nutrition 0.000 claims description 5
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 claims description 5
- 235000010469 Glycine max Nutrition 0.000 claims description 5
- 244000068988 Glycine max Species 0.000 claims description 5
- 235000021536 Sugar beet Nutrition 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000004094 surface-active agent Substances 0.000 claims description 5
- 235000021537 Beetroot Nutrition 0.000 claims description 4
- 235000016068 Berberis vulgaris Nutrition 0.000 claims description 4
- 241000335053 Beta vulgaris Species 0.000 claims description 4
- 229920000742 Cotton Polymers 0.000 claims description 4
- 241000192043 Echinochloa Species 0.000 claims description 4
- 241000219146 Gossypium Species 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 241000205407 Polygonum Species 0.000 claims description 4
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 4
- 244000061456 Solanum tuberosum Species 0.000 claims description 4
- 235000021307 Triticum Nutrition 0.000 claims description 4
- 239000000428 dust Substances 0.000 claims description 4
- 235000012015 potatoes Nutrition 0.000 claims description 4
- 239000004563 wettable powder Substances 0.000 claims description 4
- 240000006995 Abutilon theophrasti Species 0.000 claims description 3
- 241000219318 Amaranthus Species 0.000 claims description 3
- 244000025254 Cannabis sativa Species 0.000 claims description 3
- 241001508646 Galeopsis tetrahit Species 0.000 claims description 3
- 244000067505 Xanthium strumarium Species 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000002420 orchard Substances 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 241000743339 Agrostis Species 0.000 claims description 2
- 244000105624 Arachis hypogaea Species 0.000 claims description 2
- 235000005781 Avena Nutrition 0.000 claims description 2
- 235000011305 Capsella bursa pastoris Nutrition 0.000 claims description 2
- 240000008867 Capsella bursa-pastoris Species 0.000 claims description 2
- 241000219312 Chenopodium Species 0.000 claims description 2
- 244000192528 Chrysanthemum parthenium Species 0.000 claims description 2
- 235000002767 Daucus carota Nutrition 0.000 claims description 2
- 244000000626 Daucus carota Species 0.000 claims description 2
- 235000007351 Eleusine Nutrition 0.000 claims description 2
- 241000209215 Eleusine Species 0.000 claims description 2
- 241000221079 Euphorbia <genus> Species 0.000 claims description 2
- 241000520028 Lamium Species 0.000 claims description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 claims description 2
- 240000006240 Linum usitatissimum Species 0.000 claims description 2
- 235000017945 Matricaria Nutrition 0.000 claims description 2
- 235000007232 Matricaria chamomilla Nutrition 0.000 claims description 2
- 244000046052 Phaseolus vulgaris Species 0.000 claims description 2
- 235000010582 Pisum sativum Nutrition 0.000 claims description 2
- 240000004713 Pisum sativum Species 0.000 claims description 2
- 241000209048 Poa Species 0.000 claims description 2
- 241000219295 Portulaca Species 0.000 claims description 2
- 244000155504 Rotala indica Species 0.000 claims description 2
- 241000219053 Rumex Species 0.000 claims description 2
- 241000220261 Sinapis Species 0.000 claims description 2
- 235000002594 Solanum nigrum Nutrition 0.000 claims description 2
- 244000061457 Solanum nigrum Species 0.000 claims description 2
- 235000009108 Urtica dioica Nutrition 0.000 claims description 2
- 240000001261 Urtica urens Species 0.000 claims description 2
- 241000394440 Viola arvensis Species 0.000 claims description 2
- 244000047670 Viola x wittrockiana Species 0.000 claims description 2
- 235000004031 Viola x wittrockiana Nutrition 0.000 claims description 2
- 239000002152 aqueous-organic solution Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000000839 emulsion Substances 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 239000002917 insecticide Substances 0.000 claims description 2
- 238000003973 irrigation Methods 0.000 claims description 2
- 230000002262 irrigation Effects 0.000 claims description 2
- 235000020232 peanut Nutrition 0.000 claims description 2
- 239000005648 plant growth regulator Substances 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims description 2
- 241000209056 Secale Species 0.000 claims 3
- 244000098338 Triticum aestivum Species 0.000 claims 3
- 241000132536 Cirsium Species 0.000 claims 1
- 244000075634 Cyperus rotundus Species 0.000 claims 1
- 235000016854 Cyperus rotundus Nutrition 0.000 claims 1
- 244000294661 Emex spinosa Species 0.000 claims 1
- 235000006369 Emex spinosa Nutrition 0.000 claims 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 241001101998 Galium Species 0.000 claims 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000006285 dibromobenzyl group Chemical group 0.000 claims 1
- 125000006178 methyl benzyl group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 abstract description 4
- 150000002367 halogens Chemical class 0.000 abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 98
- 238000002425 crystallisation Methods 0.000 description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 57
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 38
- 238000000354 decomposition reaction Methods 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- ZEVWQFWTGHFIDH-UHFFFAOYSA-N 1h-imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C=1N=CNC=1C(O)=O ZEVWQFWTGHFIDH-UHFFFAOYSA-N 0.000 description 23
- 239000007787 solid Substances 0.000 description 20
- 239000012141 concentrate Substances 0.000 description 16
- 235000008504 concentrate Nutrition 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 239000012530 fluid Substances 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000007921 spray Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 240000006122 Chenopodium album Species 0.000 description 8
- 235000009344 Chenopodium album Nutrition 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- 235000019502 Orange oil Nutrition 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000004495 emulsifiable concentrate Substances 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 6
- 239000010502 orange oil Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 240000006694 Stellaria media Species 0.000 description 5
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 5
- 230000006978 adaptation Effects 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 239000007900 aqueous suspension Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 238000000227 grinding Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- HWQGXBCAMFVSPB-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1CN1C(C#N)=C(C#N)N=C1 HWQGXBCAMFVSPB-UHFFFAOYSA-N 0.000 description 4
- QFMDFTQOJHFVNR-UHFFFAOYSA-N 1-[2,2-dichloro-1-(4-ethylphenyl)ethyl]-4-ethylbenzene Chemical compound C1=CC(CC)=CC=C1C(C(Cl)Cl)C1=CC=C(CC)C=C1 QFMDFTQOJHFVNR-UHFFFAOYSA-N 0.000 description 4
- BHAAQCPWCCKULK-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarbonitrile Chemical class N1C(C#N)=C(C#N)N=C1CC1=CC=CC=C1 BHAAQCPWCCKULK-UHFFFAOYSA-N 0.000 description 4
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 4
- 235000008427 Brassica arvensis Nutrition 0.000 description 4
- 244000024671 Brassica kaber Species 0.000 description 4
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- 241001289540 Fallopia convolvulus Species 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 241001148683 Zostera marina Species 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- LEBUFKMXQTTWDK-UHFFFAOYSA-N (3,4-dibromophenyl)methanol Chemical compound OCC1=CC=C(Br)C(Br)=C1 LEBUFKMXQTTWDK-UHFFFAOYSA-N 0.000 description 3
- UZGUMBYWNGRUSI-KHPPLWFESA-N (z)-2-amino-3-[(3,4-dichlorophenyl)methylamino]but-2-enedinitrile Chemical compound N#CC(/N)=C(C#N)/NCC1=CC=C(Cl)C(Cl)=C1 UZGUMBYWNGRUSI-KHPPLWFESA-N 0.000 description 3
- KYPOHTVBFVELTG-UPHRSURJSA-N (z)-but-2-enedinitrile Chemical compound N#C\C=C/C#N KYPOHTVBFVELTG-UPHRSURJSA-N 0.000 description 3
- ABAUGTVEDXFARS-UHFFFAOYSA-N 1,2-dibromo-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Br)C(Br)=C1 ABAUGTVEDXFARS-UHFFFAOYSA-N 0.000 description 3
- AJBWDFPJLDDEPQ-UHFFFAOYSA-N 1-(1-bromoethyl)-3-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=CC(C(F)(F)F)=C1 AJBWDFPJLDDEPQ-UHFFFAOYSA-N 0.000 description 3
- IHSYKQWWDAFVSB-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)butan-1-ol Chemical compound CCCC(O)C1=CC=C(Cl)C(Cl)=C1 IHSYKQWWDAFVSB-UHFFFAOYSA-N 0.000 description 3
- UEIJPSVZLULBMX-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UEIJPSVZLULBMX-UHFFFAOYSA-N 0.000 description 3
- XGDRLCRGKUCBQL-UHFFFAOYSA-N 1h-imidazole-4,5-dicarbonitrile Chemical compound N#CC=1N=CNC=1C#N XGDRLCRGKUCBQL-UHFFFAOYSA-N 0.000 description 3
- ZTVIKZXZYLEVOL-DGKWVBSXSA-N 2-hydroxy-2-phenylacetic acid [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] ester Chemical group C([C@H]1CC[C@@H](C2)N1C)C2OC(=O)C(O)C1=CC=CC=C1 ZTVIKZXZYLEVOL-DGKWVBSXSA-N 0.000 description 3
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 235000017896 Digitaria Nutrition 0.000 description 3
- 241001303487 Digitaria <clam> Species 0.000 description 3
- 235000014820 Galium aparine Nutrition 0.000 description 3
- 240000005702 Galium aparine Species 0.000 description 3
- 206010061217 Infestation Diseases 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 244000082988 Secale cereale Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 240000000359 Triticum dicoccon Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 239000004491 dispersible concentrate Substances 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000001117 sulphuric acid Substances 0.000 description 3
- 235000011149 sulphuric acid Nutrition 0.000 description 3
- 239000004546 suspension concentrate Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- ZRBDUKUJADUIEO-UHFFFAOYSA-N (3-bromo-4-methylphenyl)methanol Chemical compound CC1=CC=C(CO)C=C1Br ZRBDUKUJADUIEO-UHFFFAOYSA-N 0.000 description 2
- DPZSNGJNFHWQDC-ARJAWSKDSA-N (z)-2,3-diaminobut-2-enedinitrile Chemical compound N#CC(/N)=C(/N)C#N DPZSNGJNFHWQDC-ARJAWSKDSA-N 0.000 description 2
- PXQTZCYVTTZYFY-UHFFFAOYSA-N 1,2-dibromo-4-(1-chloroethyl)benzene Chemical compound CC(Cl)C1=CC=C(Br)C(Br)=C1 PXQTZCYVTTZYFY-UHFFFAOYSA-N 0.000 description 2
- DXBPDAOUIWQAGE-UHFFFAOYSA-N 1,2-dichloro-4-(1-chlorobutyl)benzene Chemical compound CCCC(Cl)C1=CC=C(Cl)C(Cl)=C1 DXBPDAOUIWQAGE-UHFFFAOYSA-N 0.000 description 2
- ROEYQOPGMISNEU-UHFFFAOYSA-N 1,2-dichloro-4-(1-chloropropyl)benzene Chemical compound CCC(Cl)C1=CC=C(Cl)C(Cl)=C1 ROEYQOPGMISNEU-UHFFFAOYSA-N 0.000 description 2
- RNXABUQTPSAAJW-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethoxy)benzene Chemical compound CC(Br)C1=CC=C(OC(F)(F)F)C=C1 RNXABUQTPSAAJW-UHFFFAOYSA-N 0.000 description 2
- LBMKFQMJURUPKC-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCl)C=C1 LBMKFQMJURUPKC-UHFFFAOYSA-N 0.000 description 2
- XIIJSHMQJXORBW-UHFFFAOYSA-N 1-[(3,4-dibromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Br)C(Br)=CC=C1CN1C(C#N)=C(C#N)N=C1 XIIJSHMQJXORBW-UHFFFAOYSA-N 0.000 description 2
- FZTQXHGGBGVTGO-UHFFFAOYSA-N 1-[(3,4-dibromophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Br)C(Br)=C1 FZTQXHGGBGVTGO-UHFFFAOYSA-N 0.000 description 2
- OAEZHYFDCHQVEG-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(C)C(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 OAEZHYFDCHQVEG-UHFFFAOYSA-N 0.000 description 2
- WWUJIGWQPQFRGS-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound ClC1=CC(Cl)=CC(CN2C(=C(C#N)N=C2)C#N)=C1 WWUJIGWQPQFRGS-UHFFFAOYSA-N 0.000 description 2
- RQLHDIWUIMTHRZ-UHFFFAOYSA-N 1-[(3,5-dichlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC(Cl)=CC(Cl)=C1 RQLHDIWUIMTHRZ-UHFFFAOYSA-N 0.000 description 2
- VMAWTAARMCGBOW-UHFFFAOYSA-N 1-[(3-bromo-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Br)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VMAWTAARMCGBOW-UHFFFAOYSA-N 0.000 description 2
- DISBIUPTUVSAAX-UHFFFAOYSA-N 1-[(3-bromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound BrC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 DISBIUPTUVSAAX-UHFFFAOYSA-N 0.000 description 2
- NKKZAXBEEMWFTP-UHFFFAOYSA-N 1-[(3-chloro-4-methoxyphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(OC)=CC=C1CN1C(C#N)=C(C#N)N=C1 NKKZAXBEEMWFTP-UHFFFAOYSA-N 0.000 description 2
- STBBEWFYPQAJFP-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound ClC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 STBBEWFYPQAJFP-UHFFFAOYSA-N 0.000 description 2
- MTXKJAQTJWQAAH-UHFFFAOYSA-N 1-[(3-iodophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound IC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 MTXKJAQTJWQAAH-UHFFFAOYSA-N 0.000 description 2
- ZWYQKKKJTIPGMO-UHFFFAOYSA-N 1-[(4-bromophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(Br)=CC=C1CN1C(C#N)=C(C#N)N=C1 ZWYQKKKJTIPGMO-UHFFFAOYSA-N 0.000 description 2
- HTBFMVXYLRUDEP-UHFFFAOYSA-N 1-[(4-chloro-3-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(C)=CC(CN2C(=C(C#N)N=C2)C#N)=C1 HTBFMVXYLRUDEP-UHFFFAOYSA-N 0.000 description 2
- NFJGFKYUTHTGAJ-UHFFFAOYSA-N 1-[(4-chloro-3-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC(CN2C(=C(C(O)=O)N=C2)C(O)=O)=C1 NFJGFKYUTHTGAJ-UHFFFAOYSA-N 0.000 description 2
- AVSZPRGTJSEOLP-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(Cl)=CC=C1CN1C(C#N)=C(C#N)N=C1 AVSZPRGTJSEOLP-UHFFFAOYSA-N 0.000 description 2
- KLTKNOWTXOBRKU-UHFFFAOYSA-N 1-[(4-ethylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(CC)=CC=C1CN1C(C#N)=C(C#N)N=C1 KLTKNOWTXOBRKU-UHFFFAOYSA-N 0.000 description 2
- WFOMPSUTFQXJIY-UHFFFAOYSA-N 1-[(4-ethylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=CC(CC)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 WFOMPSUTFQXJIY-UHFFFAOYSA-N 0.000 description 2
- JFKFTPHLKKEDPS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(F)C=C1 JFKFTPHLKKEDPS-UHFFFAOYSA-N 0.000 description 2
- AYPWALVHPDEFFW-UHFFFAOYSA-N 1-[(4-propan-2-ylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C(C)C)=CC=C1CN1C(C#N)=C(C#N)N=C1 AYPWALVHPDEFFW-UHFFFAOYSA-N 0.000 description 2
- YNVXCOKNHXMBQC-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=CC(C(F)(F)F)=C1 YNVXCOKNHXMBQC-UHFFFAOYSA-N 0.000 description 2
- RFESEZYNEIOJHS-UHFFFAOYSA-N 1-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound CC(O)C1=CC=C(OC(F)(F)F)C=C1 RFESEZYNEIOJHS-UHFFFAOYSA-N 0.000 description 2
- VFZGUIRCBMCSKT-UHFFFAOYSA-N 1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(C(F)(F)F)=C1 VFZGUIRCBMCSKT-UHFFFAOYSA-N 0.000 description 2
- FGQPPLHMCZAREX-UHFFFAOYSA-N 1-[[4-(trifluoromethoxy)phenyl]methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(OC(F)(F)F)=CC=C1CN1C(C#N)=C(C#N)N=C1 FGQPPLHMCZAREX-UHFFFAOYSA-N 0.000 description 2
- ZDTBFCFVANNUPR-UHFFFAOYSA-N 1-[[4-(trifluoromethoxy)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(OC(F)(F)F)C=C1 ZDTBFCFVANNUPR-UHFFFAOYSA-N 0.000 description 2
- ZAOHROFKPPVHIV-UHFFFAOYSA-N 1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C(F)(F)F)=CC=C1CN1C(C#N)=C(C#N)N=C1 ZAOHROFKPPVHIV-UHFFFAOYSA-N 0.000 description 2
- NDVMXJKODFZPSW-UHFFFAOYSA-N 1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(C(F)(F)F)C=C1 NDVMXJKODFZPSW-UHFFFAOYSA-N 0.000 description 2
- SDTULEXOSNNGAW-UHFFFAOYSA-N 1-bromo-2-chloro-4-methylbenzene Chemical compound CC1=CC=C(Br)C(Cl)=C1 SDTULEXOSNNGAW-UHFFFAOYSA-N 0.000 description 2
- 239000002794 2,4-DB Substances 0.000 description 2
- YIVXMZJTEQBPQO-UHFFFAOYSA-N 2,4-DB Chemical compound OC(=O)CCCOC1=CC=C(Cl)C=C1Cl YIVXMZJTEQBPQO-UHFFFAOYSA-N 0.000 description 2
- JNPGXYPTTMKNJS-UHFFFAOYSA-N 2-benzyl-1h-imidazole-4,5-dicarboxylic acid Chemical class N1C(C(O)=O)=C(C(=O)O)N=C1CC1=CC=CC=C1 JNPGXYPTTMKNJS-UHFFFAOYSA-N 0.000 description 2
- LLWADFLAOKUBDR-UHFFFAOYSA-N 2-methyl-4-chlorophenoxybutyric acid Chemical compound CC1=CC(Cl)=CC=C1OCCCC(O)=O LLWADFLAOKUBDR-UHFFFAOYSA-N 0.000 description 2
- DHMPDNLGFIBQCK-UHFFFAOYSA-N 3,4-dibromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(Br)=C1 DHMPDNLGFIBQCK-UHFFFAOYSA-N 0.000 description 2
- BDAHJRSPLTZINY-UHFFFAOYSA-N 3,4-dichloro-1-phenylbutan-1-one Chemical compound ClCC(Cl)CC(=O)C1=CC=CC=C1 BDAHJRSPLTZINY-UHFFFAOYSA-N 0.000 description 2
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 2
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 2
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 2
- RIZRQBKYAVIFCA-UHFFFAOYSA-N 4-(1-bromopentyl)-1,2-dichlorobenzene Chemical compound CCCCC(Br)C1=CC=C(Cl)C(Cl)=C1 RIZRQBKYAVIFCA-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- YJKIALIXRCSISK-UHFFFAOYSA-N Chlorfenprop-methyl Chemical group COC(=O)C(Cl)CC1=CC=C(Cl)C=C1 YJKIALIXRCSISK-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 240000008853 Datura stramonium Species 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- 244000025670 Eleusine indica Species 0.000 description 2
- 235000014716 Eleusine indica Nutrition 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 235000009193 Lamium purpureum Nutrition 0.000 description 2
- 240000006503 Lamium purpureum Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- 235000001855 Portulaca oleracea Nutrition 0.000 description 2
- 244000234609 Portulaca oleracea Species 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 235000007201 Saccharum officinarum Nutrition 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RCTGMCJBQGBLKT-UHFFFAOYSA-N Sudan IV Chemical compound CC1=CC=CC=C1N=NC(C=C1C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 RCTGMCJBQGBLKT-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 2
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 2
- 240000005592 Veronica officinalis Species 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000012874 anionic emulsifier Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 2
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 2
- 150000003938 benzyl alcohols Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 2
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 2
- UOUIDNHNSLAJDQ-UHFFFAOYSA-N diethyl 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C1=C(C(=O)OCC)N=CN1CC1=CC=C(Cl)C(Cl)=C1 UOUIDNHNSLAJDQ-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 235000005489 dwarf bean Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 235000014483 powder concentrate Nutrition 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- UDPGUMQDCGORJQ-UHFFFAOYSA-N (2-chloroethyl)phosphonic acid Chemical compound OP(O)(=O)CCCl UDPGUMQDCGORJQ-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-RXMQYKEDSA-N (R)-dichlorprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-RXMQYKEDSA-N 0.000 description 1
- WNTGYJSOUMFZEP-SSDOTTSWSA-N (R)-mecoprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-SSDOTTSWSA-N 0.000 description 1
- YHOCKSQBVLBNJP-QXMHVHEDSA-N (z)-2-amino-3-[1-(4-chlorophenyl)ethylamino]but-2-enedinitrile Chemical compound N#CC(/N)=C(C#N)/NC(C)C1=CC=C(Cl)C=C1 YHOCKSQBVLBNJP-QXMHVHEDSA-N 0.000 description 1
- YBBLOADPFWKNGS-UHFFFAOYSA-N 1,1-dimethylurea Chemical compound CN(C)C(N)=O YBBLOADPFWKNGS-UHFFFAOYSA-N 0.000 description 1
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- ZZBPVECKHPGPAQ-UHFFFAOYSA-N 1,2,3-trichloro-5-(chloromethyl)benzene Chemical compound ClCC1=CC(Cl)=C(Cl)C(Cl)=C1 ZZBPVECKHPGPAQ-UHFFFAOYSA-N 0.000 description 1
- AIPJZPPOFWCJRC-UHFFFAOYSA-N 1,2-dichloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1Cl AIPJZPPOFWCJRC-UHFFFAOYSA-N 0.000 description 1
- FMLVOCILLTZUSX-UHFFFAOYSA-N 1,2-diiodo-4-methylbenzene Chemical compound CC1=CC=C(I)C(I)=C1 FMLVOCILLTZUSX-UHFFFAOYSA-N 0.000 description 1
- JSJHYPQTIIFNIO-UHFFFAOYSA-N 1-(1-bromoethyl)-3,5-bis(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 JSJHYPQTIIFNIO-UHFFFAOYSA-N 0.000 description 1
- VWPMBVBOSDEYQU-UHFFFAOYSA-N 1-(1-bromoethyl)-4-(trifluoromethyl)benzene Chemical compound CC(Br)C1=CC=C(C(F)(F)F)C=C1 VWPMBVBOSDEYQU-UHFFFAOYSA-N 0.000 description 1
- NIIYSMKAEQGJHD-UHFFFAOYSA-N 1-(3,4-dibromophenyl)ethanol Chemical compound CC(O)C1=CC=C(Br)C(Br)=C1 NIIYSMKAEQGJHD-UHFFFAOYSA-N 0.000 description 1
- DAQIQOIKLVJWKH-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)pentan-1-one Chemical compound CCCCC(=O)C1=CC=C(Cl)C(Cl)=C1 DAQIQOIKLVJWKH-UHFFFAOYSA-N 0.000 description 1
- PJYGECCAJOYJMK-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)propan-1-ol Chemical compound CCC(O)C1=CC=C(Cl)C(Cl)=C1 PJYGECCAJOYJMK-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- JZJWCDQGIPQBAO-UHFFFAOYSA-N 1-(4-iodophenyl)ethanone Chemical compound CC(=O)C1=CC=C(I)C=C1 JZJWCDQGIPQBAO-UHFFFAOYSA-N 0.000 description 1
- ATLQGZVLWOURFU-UHFFFAOYSA-N 1-(bromomethyl)-3,5-bis(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(CBr)=CC(C(F)(F)F)=C1 ATLQGZVLWOURFU-UHFFFAOYSA-N 0.000 description 1
- BACZSVQZBSCWIG-UHFFFAOYSA-N 1-(bromomethyl)-3-iodobenzene Chemical compound BrCC1=CC=CC(I)=C1 BACZSVQZBSCWIG-UHFFFAOYSA-N 0.000 description 1
- BQTRMYJYYNQQGK-UHFFFAOYSA-N 1-(bromomethyl)-4-iodobenzene Chemical compound BrCC1=CC=C(I)C=C1 BQTRMYJYYNQQGK-UHFFFAOYSA-N 0.000 description 1
- XGASTRVQNVVYIZ-UHFFFAOYSA-N 1-(chloromethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CCl)=C1 XGASTRVQNVVYIZ-UHFFFAOYSA-N 0.000 description 1
- XBDXMDVEZLOGMC-UHFFFAOYSA-N 1-(chloromethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CCl)=C1 XBDXMDVEZLOGMC-UHFFFAOYSA-N 0.000 description 1
- LZBOHNCMCCSTJX-UHFFFAOYSA-N 1-(chloromethyl)-3-methylbenzene Chemical compound CC1=CC=CC(CCl)=C1 LZBOHNCMCCSTJX-UHFFFAOYSA-N 0.000 description 1
- MCHDHQVROPEJJT-UHFFFAOYSA-N 1-(chloromethyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCl)C=C1 MCHDHQVROPEJJT-UHFFFAOYSA-N 0.000 description 1
- DUBCVXSYZVTCOC-UHFFFAOYSA-N 1-(chloromethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(CCl)C=C1 DUBCVXSYZVTCOC-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- AYZFQKPOALRPNQ-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole Chemical compound C1=C(Cl)C(Cl)=CC=C1CN1C=NC=C1 AYZFQKPOALRPNQ-UHFFFAOYSA-N 0.000 description 1
- BZCONTRYCQCAJT-UHFFFAOYSA-N 1-[(3,4-dichlorophenyl)methyl]imidazole-4,5-dicarbonyl chloride Chemical compound ClC(=O)C1=C(C(=O)Cl)N=CN1CC1=CC=C(Cl)C(Cl)=C1 BZCONTRYCQCAJT-UHFFFAOYSA-N 0.000 description 1
- LFNWHYXBFKUGOQ-UHFFFAOYSA-N 1-[(3,4-dimethylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(C)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 LFNWHYXBFKUGOQ-UHFFFAOYSA-N 0.000 description 1
- VPDODNZBDFMTQW-UHFFFAOYSA-N 1-[(3-chloro-4-methoxyphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(OC)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VPDODNZBDFMTQW-UHFFFAOYSA-N 0.000 description 1
- MKRDSPFEMSOAGL-UHFFFAOYSA-N 1-[(3-chloro-4-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Cl)C(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 MKRDSPFEMSOAGL-UHFFFAOYSA-N 0.000 description 1
- IGOXWALFLCBKOO-UHFFFAOYSA-N 1-[(3-chloro-4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=C(Cl)C(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 IGOXWALFLCBKOO-UHFFFAOYSA-N 0.000 description 1
- DDJICXDMKPEKIR-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(Cl)=C1 DDJICXDMKPEKIR-UHFFFAOYSA-N 0.000 description 1
- TVKRDBQEICMHMX-UHFFFAOYSA-N 1-[(3-fluorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound FC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 TVKRDBQEICMHMX-UHFFFAOYSA-N 0.000 description 1
- RBIAKJQZUGGWLM-UHFFFAOYSA-N 1-[(3-fluorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(F)=C1 RBIAKJQZUGGWLM-UHFFFAOYSA-N 0.000 description 1
- LYWFJCSZLZJQFX-UHFFFAOYSA-N 1-[(3-iodophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=CC(I)=C1 LYWFJCSZLZJQFX-UHFFFAOYSA-N 0.000 description 1
- XJQTWIQFBGQRBN-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound CC1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 XJQTWIQFBGQRBN-UHFFFAOYSA-N 0.000 description 1
- GYHILZITVAFLFU-UHFFFAOYSA-N 1-[(3-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound CC1=CC=CC(CN2C(=C(C(O)=O)N=C2)C(O)=O)=C1 GYHILZITVAFLFU-UHFFFAOYSA-N 0.000 description 1
- ISEGRZXSIYYIAH-UHFFFAOYSA-N 1-[(4-bromo-3-chlorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=C(Br)C(Cl)=CC(CN2C(=C(C#N)N=C2)C#N)=C1 ISEGRZXSIYYIAH-UHFFFAOYSA-N 0.000 description 1
- CUSOITOQLPMJNP-UHFFFAOYSA-N 1-[(4-bromophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Br)C=C1 CUSOITOQLPMJNP-UHFFFAOYSA-N 0.000 description 1
- LRMGCOXBSJJZGZ-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(Cl)C=C1 LRMGCOXBSJJZGZ-UHFFFAOYSA-N 0.000 description 1
- HXOHEWNWQNLYGJ-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(F)=CC=C1CN1C(C#N)=C(C#N)N=C1 HXOHEWNWQNLYGJ-UHFFFAOYSA-N 0.000 description 1
- GMSACMDXYKHDSZ-UHFFFAOYSA-N 1-[(4-iodophenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound OC(=O)C1=C(C(=O)O)N=CN1CC1=CC=C(I)C=C1 GMSACMDXYKHDSZ-UHFFFAOYSA-N 0.000 description 1
- OHWCIWFXHZLWBK-UHFFFAOYSA-N 1-[(4-methylphenyl)methyl]imidazole-4,5-dicarbonitrile Chemical compound C1=CC(C)=CC=C1CN1C(C#N)=C(C#N)N=C1 OHWCIWFXHZLWBK-UHFFFAOYSA-N 0.000 description 1
- UPELJEPLNJCEFY-UHFFFAOYSA-N 1-[(4-methylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=CC(C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 UPELJEPLNJCEFY-UHFFFAOYSA-N 0.000 description 1
- VFXFJYMBGGFVAS-UHFFFAOYSA-N 1-[(4-propan-2-ylphenyl)methyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=CC(C(C)C)=CC=C1CN1C(C(O)=O)=C(C(O)=O)N=C1 VFXFJYMBGGFVAS-UHFFFAOYSA-N 0.000 description 1
- IOBGWZLVDRJKRX-UHFFFAOYSA-N 1-[1-(3,4-dibromophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(Br)C(Br)=C1 IOBGWZLVDRJKRX-UHFFFAOYSA-N 0.000 description 1
- VNLDYWMXBMNPQQ-UHFFFAOYSA-N 1-[1-(3,4-dibromophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Br)C(Br)=C1 VNLDYWMXBMNPQQ-UHFFFAOYSA-N 0.000 description 1
- SSAVPNWIWXWSJF-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)butyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(CCC)C1=CC=C(Cl)C(Cl)=C1 SSAVPNWIWXWSJF-UHFFFAOYSA-N 0.000 description 1
- ZXHWLEHAXIWKHW-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)butyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(CCC)C1=CC=C(Cl)C(Cl)=C1 ZXHWLEHAXIWKHW-UHFFFAOYSA-N 0.000 description 1
- UPEYWGJBRLRKGU-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(Cl)C(Cl)=C1 UPEYWGJBRLRKGU-UHFFFAOYSA-N 0.000 description 1
- FROZNGWBPQFKEK-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Cl)C(Cl)=C1 FROZNGWBPQFKEK-UHFFFAOYSA-N 0.000 description 1
- OHEAWXLIEYOAMS-UHFFFAOYSA-N 1-[1-(3-chlorophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=CC(Cl)=C1 OHEAWXLIEYOAMS-UHFFFAOYSA-N 0.000 description 1
- AKGNGFLBABPBFU-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(Cl)C=C1 AKGNGFLBABPBFU-UHFFFAOYSA-N 0.000 description 1
- GOMIRPGYSAWMNF-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(Cl)C=C1 GOMIRPGYSAWMNF-UHFFFAOYSA-N 0.000 description 1
- WUZOAAGVQISERA-UHFFFAOYSA-N 1-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=CC(C(F)(F)F)=C1 WUZOAAGVQISERA-UHFFFAOYSA-N 0.000 description 1
- CVAKKNUFZQUCBW-UHFFFAOYSA-N 1-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=CC(C(F)(F)F)=C1 CVAKKNUFZQUCBW-UHFFFAOYSA-N 0.000 description 1
- PJPSOTLRLORLGJ-UHFFFAOYSA-N 1-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarbonitrile Chemical compound C1=NC(C#N)=C(C#N)N1C(C)C1=CC=C(C(F)(F)F)C=C1 PJPSOTLRLORLGJ-UHFFFAOYSA-N 0.000 description 1
- QWXPMUHNVUUDOE-UHFFFAOYSA-N 1-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazole-4,5-dicarboxylic acid Chemical compound C1=NC(C(O)=O)=C(C(O)=O)N1C(C)C1=CC=C(C(F)(F)F)C=C1 QWXPMUHNVUUDOE-UHFFFAOYSA-N 0.000 description 1
- YMXIDIAEXNLCFT-UHFFFAOYSA-N 1-[4-(trifluoromethyl)phenyl]ethanol Chemical compound CC(O)C1=CC=C(C(F)(F)F)C=C1 YMXIDIAEXNLCFT-UHFFFAOYSA-N 0.000 description 1
- MSSYHCXUGVOREX-UHFFFAOYSA-N 1-[[3-(trifluoromethyl)phenyl]methyl]imidazole-4,5-dicarbonitrile Chemical compound FC(F)(F)C1=CC=CC(CN2C(=C(C#N)N=C2)C#N)=C1 MSSYHCXUGVOREX-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical class C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- UDKGXKYEWBGQCG-UHFFFAOYSA-N 1-bromo-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Br)=C1 UDKGXKYEWBGQCG-UHFFFAOYSA-N 0.000 description 1
- XCJXYTFYKPVYMK-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC(CBr)=CC=C1Br XCJXYTFYKPVYMK-UHFFFAOYSA-N 0.000 description 1
- UEDWCYBNUKGVRI-UHFFFAOYSA-N 1-chloro-3-(1-chloroethyl)benzene Chemical compound CC(Cl)C1=CC=CC(Cl)=C1 UEDWCYBNUKGVRI-UHFFFAOYSA-N 0.000 description 1
- DDGRAFHHXYIQQR-UHFFFAOYSA-N 1-chloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1 DDGRAFHHXYIQQR-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- QMQZIXCNLUPEIN-UHFFFAOYSA-N 1h-imidazole-2-carbonitrile Chemical compound N#CC1=NC=CN1 QMQZIXCNLUPEIN-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- IGIMRHMZHOJBKZ-UHFFFAOYSA-N 2-bromo-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Br IGIMRHMZHOJBKZ-UHFFFAOYSA-N 0.000 description 1
- JAXSPAXDDROBLQ-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1Cl JAXSPAXDDROBLQ-UHFFFAOYSA-N 0.000 description 1
- JTMYLQKKQFLIGV-UHFFFAOYSA-N 2-chloro-4-(chloromethyl)-1-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1Cl JTMYLQKKQFLIGV-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- DYBIGIADVHIODH-UHFFFAOYSA-N 2-nonylphenol;oxirane Chemical compound C1CO1.CCCCCCCCCC1=CC=CC=C1O DYBIGIADVHIODH-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical class CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- XRZPMHVRPUGCAY-UHFFFAOYSA-N 3,4-dichloro-1-phenylpentan-1-one Chemical compound CC(Cl)C(Cl)CC(=O)C1=CC=CC=C1 XRZPMHVRPUGCAY-UHFFFAOYSA-N 0.000 description 1
- AWGBKZRMLNVLAF-UHFFFAOYSA-N 3,5-dibromo-n,2-dihydroxybenzamide Chemical compound ONC(=O)C1=CC(Br)=CC(Br)=C1O AWGBKZRMLNVLAF-UHFFFAOYSA-N 0.000 description 1
- ZFJOMUKPDWNRFI-UHFFFAOYSA-N 3-bromo-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Br ZFJOMUKPDWNRFI-UHFFFAOYSA-N 0.000 description 1
- 125000006482 3-iodobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(I)=C1[H])C([H])([H])* 0.000 description 1
- DXBQEHHOGRVYFF-UHFFFAOYSA-N 3-pyridin-4-ylpentane-2,4-dione Chemical group CC(=O)C(C(C)=O)C1=CC=NC=C1 DXBQEHHOGRVYFF-UHFFFAOYSA-N 0.000 description 1
- UZGBMCVSBCAVMY-UHFFFAOYSA-N 4-(bromomethyl)-1,2-diiodobenzene Chemical compound BrCC1=CC=C(I)C(I)=C1 UZGBMCVSBCAVMY-UHFFFAOYSA-N 0.000 description 1
- UBQRAAXAHIKWRI-UHFFFAOYSA-N 4-(chloromethyl)-1,2-dimethylbenzene Chemical compound CC1=CC=C(CCl)C=C1C UBQRAAXAHIKWRI-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- RATSANVPHHXDCT-UHFFFAOYSA-N 4-(trifluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(OC(F)(F)F)C=C1 RATSANVPHHXDCT-UHFFFAOYSA-N 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 240000007241 Agrostis stolonifera Species 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000004135 Amaranthus viridis Nutrition 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 241000602336 Anthemis arvensis Species 0.000 description 1
- 235000007639 Anthemis cotula Nutrition 0.000 description 1
- 244000186140 Asperula odorata Species 0.000 description 1
- 235000010960 Atriplex hastata Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 241001041979 Brachiaria plantaginea Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- GIPPFGHAWCAECA-UHFFFAOYSA-N C1=C(C=CC2=CC=CC=C12)O.C1(=C(C=CC=C1)C=1C=C(C(NN=NNC=2C(=CC=CC2)C)=CC1)C)C Chemical compound C1=C(C=CC2=CC=CC=C12)O.C1(=C(C=CC=C1)C=1C=C(C(NN=NNC=2C(=CC=CC2)C)=CC1)C)C GIPPFGHAWCAECA-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000005490 Carbetamide Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000722731 Carex Species 0.000 description 1
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 1
- 235000008645 Chenopodium bonus henricus Nutrition 0.000 description 1
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 1
- 239000005493 Chloridazon (aka pyrazone) Substances 0.000 description 1
- 239000005647 Chlorpropham Substances 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 235000005918 Cirsium arvense Nutrition 0.000 description 1
- 240000001579 Cirsium arvense Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-N Dalapon Chemical compound CC(Cl)(Cl)C(O)=O NDUPDOJHUQKPAG-UHFFFAOYSA-N 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- 235000005476 Digitaria cruciata Nutrition 0.000 description 1
- 235000006830 Digitaria didactyla Nutrition 0.000 description 1
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- DHWRNDJOGMTCPB-UHFFFAOYSA-N Dimefuron Chemical compound ClC1=CC(NC(=O)N(C)C)=CC=C1N1C(=O)OC(C(C)(C)C)=N1 DHWRNDJOGMTCPB-UHFFFAOYSA-N 0.000 description 1
- OFDYMSKSGFSLLM-UHFFFAOYSA-N Dinitramine Chemical compound CCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C(N)=C1[N+]([O-])=O OFDYMSKSGFSLLM-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241000309579 Erysimum cheiranthoides Species 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 235000008526 Galium odoratum Nutrition 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- 239000005575 MCPB Substances 0.000 description 1
- 101150039283 MCPB gene Proteins 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000005983 Maleic hydrazide Substances 0.000 description 1
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 239000005579 Metamitron Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101150101537 Olah gene Proteins 0.000 description 1
- 239000005588 Oxadiazon Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- 235000007846 Papaver rhoeas Nutrition 0.000 description 1
- 240000004674 Papaver rhoeas Species 0.000 description 1
- SGEJQUSYQTVSIU-UHFFFAOYSA-N Pebulate Chemical compound CCCCN(CC)C(=O)SCCC SGEJQUSYQTVSIU-UHFFFAOYSA-N 0.000 description 1
- 240000006928 Persicaria lapathifolia Species 0.000 description 1
- 244000037751 Persicaria maculosa Species 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- 244000064622 Physalis edulis Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000006386 Polygonum aviculare Nutrition 0.000 description 1
- 244000292697 Polygonum aviculare Species 0.000 description 1
- 235000004442 Polygonum persicaria Nutrition 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 1
- 235000016911 Ribes sativum Nutrition 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 235000016897 Ribes triste Nutrition 0.000 description 1
- 244000281209 Ribes triste Species 0.000 description 1
- 241001373037 Rumex hypogaeus Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 1
- 241000282485 Vulpes vulpes Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- AMRQXHFXNZFDCH-SECBINFHSA-N [(2r)-1-(ethylamino)-1-oxopropan-2-yl] n-phenylcarbamate Chemical compound CCNC(=O)[C@@H](C)OC(=O)NC1=CC=CC=C1 AMRQXHFXNZFDCH-SECBINFHSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- VGPYEHKOIGNJKV-UHFFFAOYSA-N asulam Chemical compound COC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VGPYEHKOIGNJKV-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229920005551 calcium lignosulfonate Polymers 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- HBHZKFOUIUMKHV-UHFFFAOYSA-N chembl1982121 Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HBHZKFOUIUMKHV-UHFFFAOYSA-N 0.000 description 1
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 108010041382 compound 20 Proteins 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- NQKKUSLBNWTXQI-UHFFFAOYSA-N diethyl 1h-imidazole-4,5-dicarboxylate Chemical compound CCOC(=O)C=1N=CNC=1C(=O)OCC NQKKUSLBNWTXQI-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 229940018564 m-phenylenediamine Drugs 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 1
- RBNIGDFIUWJJEV-UHFFFAOYSA-N methyl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-UHFFFAOYSA-N 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000000063 preceeding effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- IKVXBIIHQGXQRQ-UHFFFAOYSA-N propan-2-yl 2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N(C(C)C(=O)OC(C)C)C(=O)C1=CC=CC=C1 IKVXBIIHQGXQRQ-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- JDVPQXZIJDEHAN-UHFFFAOYSA-N succinamic acid Chemical compound NC(=O)CCC(O)=O JDVPQXZIJDEHAN-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical class OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 150000005199 trimethylbenzenes Chemical class 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/50—1,3-Diazoles; Hydrogenated 1,3-diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/147—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/807—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen all halogen atoms bound to the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Dentistry (AREA)
- Agronomy & Crop Science (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9277/77A GB1599032A (en) | 1977-03-04 | 1977-03-04 | Imidazole derivatives having herbicidal activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE780431L IE780431L (en) | 1978-09-04 |
| IE46502B1 true IE46502B1 (en) | 1983-06-29 |
Family
ID=9868874
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE431/78A IE46502B1 (en) | 1977-03-04 | 1978-03-02 | Imidazole derivatives having herbicidal activity |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4185992A (Direct) |
| JP (1) | JPS53111068A (Direct) |
| AR (1) | AR223314A1 (Direct) |
| AU (1) | AU513393B2 (Direct) |
| BE (1) | BE864614A (Direct) |
| BR (1) | BR7801257A (Direct) |
| CA (1) | CA1092131A (Direct) |
| CH (1) | CH630615A5 (Direct) |
| CS (1) | CS207657B2 (Direct) |
| DD (1) | DD135346A5 (Direct) |
| DE (1) | DE2809022A1 (Direct) |
| DK (1) | DK95478A (Direct) |
| ES (2) | ES467496A1 (Direct) |
| GB (1) | GB1599032A (Direct) |
| IE (1) | IE46502B1 (Direct) |
| IT (1) | IT1095472B (Direct) |
| LU (1) | LU79162A1 (Direct) |
| NL (1) | NL7802316A (Direct) |
| NZ (1) | NZ186608A (Direct) |
| PH (1) | PH14020A (Direct) |
| PL (3) | PL116646B1 (Direct) |
| PT (1) | PT67731A (Direct) |
| SE (1) | SE7802394L (Direct) |
| SU (2) | SU805946A3 (Direct) |
| ZA (1) | ZA781229B (Direct) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT377514B (de) * | 1978-08-08 | 1985-03-25 | Wellcome Found | Verfahren zur herstellung von neuen imidazolderivaten und deren salzen |
| IT1207229B (it) * | 1978-08-25 | 1989-05-17 | May & Baker Ltd | Derivati immidazolici particolarmente utili quali erbicidi |
| PT72437B (en) * | 1980-02-05 | 1982-01-29 | May & Baker Ltd | Herbicidal compositions comprising 1-(3,4-dichlorobenzyl)imida-zole-n,n'-dimetyl-4,5-dicarboxamide |
| DE3217094A1 (de) * | 1982-05-07 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | 1-substituierte imidazol-5-carbonsaeurederivate, ihre herstellung sowie ihre verwendung als biozide |
| MY100938A (en) * | 1986-06-06 | 1991-05-31 | Ciba Geigy Ag | Arylkylimidazole derivatives. |
| DE3723621A1 (de) * | 1987-07-17 | 1989-02-02 | Bayer Ag | Schaedlingsbekaempfungsmittel auf basis von derivaten des 2,3-diaminomaleinsaeurenitrils |
| DE19814092A1 (de) * | 1997-04-15 | 1998-10-22 | Stefes Agro Gmbh | Pflanzenschutzmittel |
| WO2002064538A1 (en) * | 2001-02-16 | 2002-08-22 | Ube Industries, Ltd. | Process for producing 4-trifluoromethoxybenzyl halide compound |
| DE102009043862A1 (de) * | 2009-08-26 | 2011-08-04 | Karlsruher Institut für Technologie, 76131 | Acylierte Phthalocyanine |
| WO2013160273A1 (en) | 2012-04-25 | 2013-10-31 | F. Hoffmann-La Roche Ag | (3,4-dichloro-phenyl)-((s)-3-propyl-pyrrolidin-3-yl)-methanone hydrochloride and manufacturing processes |
| SG11201503770VA (en) * | 2012-11-14 | 2015-06-29 | Teijin Pharma Ltd | Pyridine derivative |
| CN104326939B (zh) * | 2014-09-30 | 2016-06-22 | 广东工业大学 | 一种二氨基马来腈衍生物及其制备方法和应用 |
| WO2023235376A1 (en) | 2022-06-01 | 2023-12-07 | Zoetis Services Llc | Process for preparing 1-(4-chlorobenzyl)-1h-imidazole-4,5-dicarboxamide |
| CN119707818A (zh) * | 2024-12-11 | 2025-03-28 | 河北农业大学 | 一类新型甲基吡唑丙酰胺衍生物及其制备方法和用途 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2897205A (en) * | 1958-06-27 | 1959-07-28 | Merck & Co Inc | 1-etherified oxyalkyl imidazole-4,5-dicarboxamides, intermediates and process |
| US3914246A (en) * | 1972-05-05 | 1975-10-21 | Merck & Co Inc | Tri-substituted imidazoles |
| JPS5320990B2 (Direct) * | 1973-02-26 | 1978-06-29 |
-
1977
- 1977-03-04 GB GB9277/77A patent/GB1599032A/en not_active Expired
-
1978
- 1978-03-01 IT IT7820800A patent/IT1095472B/it active
- 1978-03-02 JP JP2403778A patent/JPS53111068A/ja active Granted
- 1978-03-02 IE IE431/78A patent/IE46502B1/en unknown
- 1978-03-02 NZ NZ186608A patent/NZ186608A/xx unknown
- 1978-03-02 PL PL1978205025A patent/PL116646B1/pl unknown
- 1978-03-02 ES ES467496A patent/ES467496A1/es not_active Expired
- 1978-03-02 AU AU33747/78A patent/AU513393B2/en not_active Expired
- 1978-03-02 DK DK95478A patent/DK95478A/da not_active Application Discontinuation
- 1978-03-02 DD DD78203943A patent/DD135346A5/xx unknown
- 1978-03-02 ZA ZA00781229A patent/ZA781229B/xx unknown
- 1978-03-02 DE DE19782809022 patent/DE2809022A1/de not_active Withdrawn
- 1978-03-02 CA CA298,042A patent/CA1092131A/en not_active Expired
- 1978-03-02 PT PT67731A patent/PT67731A/pt unknown
- 1978-03-02 BR BR7801257A patent/BR7801257A/pt unknown
- 1978-03-02 AR AR271292A patent/AR223314A1/es active
- 1978-03-02 NL NL7802316A patent/NL7802316A/xx not_active Application Discontinuation
- 1978-03-02 US US05/882,857 patent/US4185992A/en not_active Expired - Lifetime
- 1978-03-02 CS CS781338A patent/CS207657B2/cs unknown
- 1978-03-02 PL PL1978211646A patent/PL115964B1/pl unknown
- 1978-03-02 SE SE7802394A patent/SE7802394L/xx unknown
- 1978-03-02 PL PL1978211647A patent/PL115974B1/pl unknown
- 1978-03-03 CH CH234478A patent/CH630615A5/fr not_active IP Right Cessation
- 1978-03-03 PH PH20844A patent/PH14020A/en unknown
- 1978-03-03 LU LU79162A patent/LU79162A1/xx unknown
- 1978-03-06 BE BE185709A patent/BE864614A/xx not_active IP Right Cessation
- 1978-10-12 SU SU782672299A patent/SU805946A3/ru active
- 1978-12-01 ES ES475635A patent/ES475635A1/es not_active Expired
-
1980
- 1980-01-04 SU SU802864114A patent/SU908249A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU805946A3 (ru) | 1981-02-15 |
| NZ186608A (en) | 1980-05-08 |
| JPS53111068A (en) | 1978-09-28 |
| IE780431L (en) | 1978-09-04 |
| GB1599032A (en) | 1981-09-30 |
| PT67731A (en) | 1978-04-01 |
| ZA781229B (en) | 1979-02-28 |
| CH630615A5 (fr) | 1982-06-30 |
| PL211647A1 (pl) | 1979-10-22 |
| US4185992A (en) | 1980-01-29 |
| PL116646B1 (en) | 1981-06-30 |
| NL7802316A (nl) | 1978-09-06 |
| DE2809022A1 (de) | 1978-09-07 |
| PL205025A1 (pl) | 1979-04-09 |
| IT7820800A0 (it) | 1978-03-01 |
| DK95478A (da) | 1978-09-05 |
| IT1095472B (it) | 1985-08-10 |
| PH14020A (en) | 1980-12-08 |
| PL115974B1 (en) | 1981-05-30 |
| AU3374778A (en) | 1979-09-06 |
| AR223314A1 (es) | 1981-08-14 |
| BR7801257A (pt) | 1979-01-02 |
| ES475635A1 (es) | 1979-04-16 |
| DD135346A5 (de) | 1979-05-02 |
| PL115964B1 (en) | 1981-05-30 |
| SU908249A3 (ru) | 1982-02-23 |
| CA1092131A (en) | 1980-12-23 |
| CS207657B2 (en) | 1981-08-31 |
| SE7802394L (sv) | 1978-09-05 |
| ES467496A1 (es) | 1979-08-01 |
| LU79162A1 (fr) | 1979-10-29 |
| BE864614A (fr) | 1978-09-06 |
| AU513393B2 (en) | 1980-11-27 |
| JPS6129344B2 (Direct) | 1986-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4618366A (en) | Certain N-(2,4-difluorophenyl)-2-(3-trifluoromethylphenoxy)-nicotinamides having herbicidal activity | |
| US4459150A (en) | 5-Acylamino-4-cyano-1-phenylpyrazole derivatives and use as herbicides | |
| US5114461A (en) | Cyclic diones | |
| EP0034945B1 (en) | N-phenylpyrazole derivatives | |
| CZ285582B6 (cs) | Deriváty 4-benzoylisoxazolu, způsob a meziprodukty jejich výroby, herbicidní prostředek, který je obsahuje, a způsob potlačování růstu plevelů za jejich použití | |
| US4185992A (en) | Imidazole derivatives | |
| GB2136427A (en) | Herbicidal N-pyridylpyrazole Derivatives | |
| US4496390A (en) | N-Phenylpyrazole derivatives | |
| US4629495A (en) | Herbicidal 5-amino-4-cyano-1-phenylpyrazoles | |
| EP0084033B1 (en) | N-phenylpyrazole derivatives | |
| JPH11509202A (ja) | 除草性スルホンアミド | |
| US4192669A (en) | Herbicidal ethers | |
| KR810000678B1 (ko) | 이미다졸 유도체의 제조방법 | |
| US4246021A (en) | Imidazole derivatives | |
| GB2028821A (en) | New imidazole derivatives | |
| CS237333B2 (en) | Herbicide agent | |
| CS207658B2 (cs) | Způsob výroby derivátů imidazolu | |
| HK33088A (en) | New herbicidal nicotinamide derivatives |