IE41792B1 - Process for the preparation of meta-substituted halogenophenols - Google Patents
Process for the preparation of meta-substituted halogenophenolsInfo
- Publication number
- IE41792B1 IE41792B1 IE1967/75A IE196775A IE41792B1 IE 41792 B1 IE41792 B1 IE 41792B1 IE 1967/75 A IE1967/75 A IE 1967/75A IE 196775 A IE196775 A IE 196775A IE 41792 B1 IE41792 B1 IE 41792B1
- Authority
- IE
- Ireland
- Prior art keywords
- process according
- reaction
- chlorine
- carried out
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 46
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- -1 aralkyl radical Chemical class 0.000 claims abstract description 40
- 239000000460 chlorine Substances 0.000 claims abstract description 29
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 28
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 27
- 239000001257 hydrogen Substances 0.000 claims abstract description 27
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 24
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000005864 Sulphur Substances 0.000 claims abstract description 17
- 150000002367 halogens Chemical group 0.000 claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 9
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000002253 acid Substances 0.000 claims abstract description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims abstract description 5
- 229920001021 polysulfide Polymers 0.000 claims abstract description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 239000003610 charcoal Substances 0.000 claims abstract description 3
- 159000000014 iron salts Chemical class 0.000 claims abstract description 3
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 3
- 150000003573 thiols Chemical class 0.000 claims abstract description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims abstract 6
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 claims abstract 2
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- 239000012433 hydrogen halide Substances 0.000 claims description 6
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical class OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 claims description 2
- 150000002505 iron Chemical class 0.000 claims description 2
- 125000004494 ethyl ester group Chemical group 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 150000002989 phenols Chemical class 0.000 abstract description 9
- 150000004763 sulfides Chemical class 0.000 abstract description 2
- 101710178035 Chorismate synthase 2 Proteins 0.000 abstract 1
- 101710152694 Cysteine synthase 2 Proteins 0.000 abstract 1
- 150000003254 radicals Chemical class 0.000 description 13
- 125000005843 halogen group Chemical group 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000005984 hydrogenation reaction Methods 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000370 acceptor Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- VPOMSPZBQMDLTM-UHFFFAOYSA-N 3,5-dichlorophenol Chemical compound OC1=CC(Cl)=CC(Cl)=C1 VPOMSPZBQMDLTM-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LAXBNTIAOJWAOP-UHFFFAOYSA-N 2-chlorobiphenyl Chemical group ClC1=CC=CC=C1C1=CC=CC=C1 LAXBNTIAOJWAOP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CETBSQOFQKLHHZ-UHFFFAOYSA-N Diethyl disulfide Chemical compound CCSSCC CETBSQOFQKLHHZ-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 229940031826 phenolate Drugs 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- RZFBEFUNINJXRQ-UHFFFAOYSA-M sodium ethyl xanthate Chemical compound [Na+].CCOC([S-])=S RZFBEFUNINJXRQ-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011949 solid catalyst Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BDIWZLUDTUAEAG-UHFFFAOYSA-N 2,3,4,6-tetrachloro-5-fluorophenol Chemical compound OC1=C(Cl)C(F)=C(Cl)C(Cl)=C1Cl BDIWZLUDTUAEAG-UHFFFAOYSA-N 0.000 description 1
- VGVRPFIJEJYOFN-UHFFFAOYSA-N 2,3,4,6-tetrachlorophenol Chemical class OC1=C(Cl)C=C(Cl)C(Cl)=C1Cl VGVRPFIJEJYOFN-UHFFFAOYSA-N 0.000 description 1
- VOCZPWMPYBPGMZ-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-phenylphenol Chemical compound ClC1=C(Cl)C(O)=C(Cl)C(Cl)=C1C1=CC=CC=C1 VOCZPWMPYBPGMZ-UHFFFAOYSA-N 0.000 description 1
- KEWNKZNZRIAIAK-UHFFFAOYSA-N 2,3,5,6-tetrachlorophenol Chemical compound OC1=C(Cl)C(Cl)=CC(Cl)=C1Cl KEWNKZNZRIAIAK-UHFFFAOYSA-N 0.000 description 1
- AJSVNRDXQWMCGA-UHFFFAOYSA-N 2,3,6-trichloro-4-phenylphenol Chemical compound ClC1=C(Cl)C(O)=C(Cl)C=C1C1=CC=CC=C1 AJSVNRDXQWMCGA-UHFFFAOYSA-N 0.000 description 1
- JMHHBGDBHZLOJM-UHFFFAOYSA-N 2,3,6-trichloro-5-fluorophenol Chemical compound OC1=C(Cl)C(F)=CC(Cl)=C1Cl JMHHBGDBHZLOJM-UHFFFAOYSA-N 0.000 description 1
- KLKPGFUKWNLFCZ-UHFFFAOYSA-N 2,4,6-trichloro-3,5-difluorophenol Chemical compound OC1=C(Cl)C(F)=C(Cl)C(F)=C1Cl KLKPGFUKWNLFCZ-UHFFFAOYSA-N 0.000 description 1
- LWMLZSHNKKTXEP-UHFFFAOYSA-N 2,4-dichloro-3,5-difluorophenol Chemical compound OC1=CC(F)=C(Cl)C(F)=C1Cl LWMLZSHNKKTXEP-UHFFFAOYSA-N 0.000 description 1
- XJVONDCVBSAKPU-UHFFFAOYSA-N 2,4-dichloro-3-fluorophenol Chemical compound OC1=CC=C(Cl)C(F)=C1Cl XJVONDCVBSAKPU-UHFFFAOYSA-N 0.000 description 1
- CKARHTOOOHCDMF-UHFFFAOYSA-N 2,4-dichloro-5-fluorophenol Chemical compound OC1=CC(F)=C(Cl)C=C1Cl CKARHTOOOHCDMF-UHFFFAOYSA-N 0.000 description 1
- FXFNXOBKTWAIKS-UHFFFAOYSA-N 2,5-dichloro-4-phenylphenol Chemical compound C1=C(Cl)C(O)=CC(Cl)=C1C1=CC=CC=C1 FXFNXOBKTWAIKS-UHFFFAOYSA-N 0.000 description 1
- TUUGYZALCDNGEO-UHFFFAOYSA-N 2,6-dichloro-3-fluorophenol Chemical compound OC1=C(Cl)C=CC(F)=C1Cl TUUGYZALCDNGEO-UHFFFAOYSA-N 0.000 description 1
- MXORDJXBRHNWBE-UHFFFAOYSA-N 2-Chloro-4-biphenylol Chemical compound ClC1=CC(O)=CC=C1C1=CC=CC=C1 MXORDJXBRHNWBE-UHFFFAOYSA-N 0.000 description 1
- BWBYPPWYJVICSZ-UHFFFAOYSA-N 2-benzyl-3,4,6-trichlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=CC=CC=C1 BWBYPPWYJVICSZ-UHFFFAOYSA-N 0.000 description 1
- PYORPTYZFIPIDJ-UHFFFAOYSA-N 2-benzyl-3,6-dichlorophenol Chemical compound OC1=C(Cl)C=CC(Cl)=C1CC1=CC=CC=C1 PYORPTYZFIPIDJ-UHFFFAOYSA-N 0.000 description 1
- ZAMOVMHWSVVCQD-UHFFFAOYSA-N 2-benzyl-3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1CC1=CC=CC=C1 ZAMOVMHWSVVCQD-UHFFFAOYSA-N 0.000 description 1
- SPEWNHZQFNTOGX-UHFFFAOYSA-N 2-benzyl-3-fluorophenol Chemical compound OC1=CC=CC(F)=C1CC1=CC=CC=C1 SPEWNHZQFNTOGX-UHFFFAOYSA-N 0.000 description 1
- IGKMOCOFYGZTKU-UHFFFAOYSA-N 2-benzyl-4,6-dichloro-3-fluorophenol Chemical compound OC1=C(Cl)C=C(Cl)C(F)=C1CC1=CC=CC=C1 IGKMOCOFYGZTKU-UHFFFAOYSA-N 0.000 description 1
- CDMGNVWZXRKJNS-UHFFFAOYSA-N 2-benzylphenol Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1 CDMGNVWZXRKJNS-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- ZQWULOHSTAQTKJ-UHFFFAOYSA-N 2-chloro-3,5-difluorophenol Chemical compound OC1=CC(F)=CC(F)=C1Cl ZQWULOHSTAQTKJ-UHFFFAOYSA-N 0.000 description 1
- YIENEZQWQPFHQN-UHFFFAOYSA-N 2-chloro-3-fluorophenol Chemical compound OC1=CC=CC(F)=C1Cl YIENEZQWQPFHQN-UHFFFAOYSA-N 0.000 description 1
- CMQOZIKIOASEIN-UHFFFAOYSA-N 2-chloro-5-fluorophenol Chemical compound OC1=CC(F)=CC=C1Cl CMQOZIKIOASEIN-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- KANQZAUYDTZEOV-UHFFFAOYSA-N 3,3-dichlorocyclohexa-1,5-dien-1-ol Chemical compound ClC1(CC=CC(=C1)O)Cl KANQZAUYDTZEOV-UHFFFAOYSA-N 0.000 description 1
- GBNHEBQXJVDXSW-UHFFFAOYSA-N 3,4,5-trichlorophenol Chemical compound OC1=CC(Cl)=C(Cl)C(Cl)=C1 GBNHEBQXJVDXSW-UHFFFAOYSA-N 0.000 description 1
- HUKVRTZYEYFLMR-UHFFFAOYSA-N 3,4,6-trichloro-2-phenylphenol Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1C1=CC=CC=C1 HUKVRTZYEYFLMR-UHFFFAOYSA-N 0.000 description 1
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 1
- GOTIANIYWBGACK-UHFFFAOYSA-N 3,5-dichloro-4-phenylphenol Chemical compound ClC1=CC(O)=CC(Cl)=C1C1=CC=CC=C1 GOTIANIYWBGACK-UHFFFAOYSA-N 0.000 description 1
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 1
- HJSSBIMVTMYKPD-UHFFFAOYSA-N 3,5-difluorophenol Chemical compound OC1=CC(F)=CC(F)=C1 HJSSBIMVTMYKPD-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- KPFPEXKMIDAQNO-UHFFFAOYSA-N 3-chloro-2-phenylphenol Chemical compound OC1=CC=CC(Cl)=C1C1=CC=CC=C1 KPFPEXKMIDAQNO-UHFFFAOYSA-N 0.000 description 1
- ZMFBYTAAMHWQHD-UHFFFAOYSA-N 3-chloro-5-fluorophenol Chemical compound OC1=CC(F)=CC(Cl)=C1 ZMFBYTAAMHWQHD-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- GXCDLJXPZVCHBX-UHFFFAOYSA-N 3-methylpent-1-yn-3-yl carbamate Chemical compound CCC(C)(C#C)OC(N)=O GXCDLJXPZVCHBX-UHFFFAOYSA-N 0.000 description 1
- QWMIBRLYNKJTRT-UHFFFAOYSA-N 4-benzyl-2,5-dichlorophenol Chemical compound C1=C(Cl)C(O)=CC(Cl)=C1CC1=CC=CC=C1 QWMIBRLYNKJTRT-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- OEBQPSQPCDHCKT-UHFFFAOYSA-N 4-chloro-3,5-difluorophenol Chemical compound OC1=CC(F)=C(Cl)C(F)=C1 OEBQPSQPCDHCKT-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- AGVJBLHVMNHENQ-UHFFFAOYSA-N Calcium sulfide Chemical compound [S-2].[Ca+2] AGVJBLHVMNHENQ-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- IJCVBMSXIPFVLH-UHFFFAOYSA-N [C].S=O Chemical compound [C].S=O IJCVBMSXIPFVLH-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229940102689 lustra Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- CMGLSTYFWSQNEC-UHFFFAOYSA-N o-ethyl n-ethylcarbamothioate Chemical compound CCNC(=S)OCC CMGLSTYFWSQNEC-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- XDDVRYDDMGRFAZ-UHFFFAOYSA-N thiobenzophenone Chemical compound C=1C=CC=CC=1C(=S)C1=CC=CC=C1 XDDVRYDDMGRFAZ-UHFFFAOYSA-N 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2443152A DE2443152C3 (de) | 1974-09-10 | 1974-09-10 | Verfahren zur Herstellung von durch Halogen meta-substituierten Phenolen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41792L IE41792L (en) | 1976-03-10 |
| IE41792B1 true IE41792B1 (en) | 1980-03-26 |
Family
ID=5925262
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1967/75A IE41792B1 (en) | 1974-09-10 | 1975-09-09 | Process for the preparation of meta-substituted halogenophenols |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4060562A (enExample) |
| JP (1) | JPS5154526A (enExample) |
| AT (1) | AT338239B (enExample) |
| BE (1) | BE833171A (enExample) |
| CA (1) | CA1059148A (enExample) |
| CH (1) | CH616133A5 (enExample) |
| DE (1) | DE2443152C3 (enExample) |
| DK (1) | DK402875A (enExample) |
| ES (1) | ES440815A1 (enExample) |
| FR (1) | FR2284583A1 (enExample) |
| GB (1) | GB1470929A (enExample) |
| IE (1) | IE41792B1 (enExample) |
| IL (1) | IL48062A (enExample) |
| LU (1) | LU73241A1 (enExample) |
| NL (1) | NL7510566A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2496641A1 (fr) * | 1980-12-24 | 1982-06-25 | Rhone Poulenc Ind | Procede de preparation de phenols metachlores |
| FR2496639A1 (fr) * | 1980-12-24 | 1982-06-25 | Rhone Poulenc Ind | Procede de preparation de phenols metachlores |
| FR2496640A1 (fr) * | 1980-12-24 | 1982-06-25 | Rhone Poulenc Ind | Procede de preparation de phenols metachlores |
| FR2541992B3 (fr) * | 1983-03-02 | 1985-11-29 | Rhone Poulenc Spec Chim | Procede de preparation de phenols metachlores |
| JPS60115543A (ja) * | 1983-11-26 | 1985-06-22 | Dai Ichi Kogyo Seiyaku Co Ltd | 臭素化−p−フエニルフエノ−ル |
| JPS60136529A (ja) * | 1983-12-26 | 1985-07-20 | Dai Ichi Kogyo Seiyaku Co Ltd | 臭素化−o−フエニルフエノ−ル |
| DE3632363A1 (de) * | 1986-09-24 | 1988-03-31 | Boelsing Friedrich | Verfahren zur dehalogenierung von halogenierten kohlenwasserstoffen |
| CN118702085B (zh) * | 2023-08-25 | 2025-10-03 | 三明学院 | 一种调控碳材料比表面积的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1419603A (en) * | 1972-12-05 | 1975-12-31 | Bayer Ag | Process for the producition of 3-halogen-and 3,5-dihalogen phenols |
| DE2259433A1 (de) * | 1972-12-05 | 1974-06-06 | Bayer Ag | Verfahren zur herstellung von 3-halogen- und 3,5-dihalogen-phenolen |
| DE2344926C3 (de) * | 1973-09-06 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 3-Halogen- bzw. 3,5-Dihalogen-phenolen |
| US3912783A (en) * | 1972-12-05 | 1975-10-14 | Bayer Ag | Process and catalyst for preparing of 3-halogen-and 3,5-dihalogen-phenols |
-
1974
- 1974-09-10 DE DE2443152A patent/DE2443152C3/de not_active Expired
-
1975
- 1975-08-22 LU LU73241A patent/LU73241A1/xx unknown
- 1975-08-25 CH CH1097375A patent/CH616133A5/de not_active IP Right Cessation
- 1975-08-29 US US05/609,140 patent/US4060562A/en not_active Expired - Lifetime
- 1975-09-05 IL IL48062A patent/IL48062A/xx unknown
- 1975-09-08 JP JP50108144A patent/JPS5154526A/ja active Pending
- 1975-09-08 CA CA234,963A patent/CA1059148A/en not_active Expired
- 1975-09-08 NL NL7510566A patent/NL7510566A/xx not_active Application Discontinuation
- 1975-09-08 BE BE159827A patent/BE833171A/xx not_active IP Right Cessation
- 1975-09-08 AT AT690475A patent/AT338239B/de not_active IP Right Cessation
- 1975-09-09 ES ES440815A patent/ES440815A1/es not_active Expired
- 1975-09-09 IE IE1967/75A patent/IE41792B1/en unknown
- 1975-09-09 DK DK402875A patent/DK402875A/da unknown
- 1975-09-09 GB GB3705275A patent/GB1470929A/en not_active Expired
- 1975-09-10 FR FR7527790A patent/FR2284583A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2284583B1 (enExample) | 1982-07-30 |
| DK402875A (da) | 1976-03-11 |
| FR2284583A1 (fr) | 1976-04-09 |
| JPS5154526A (enExample) | 1976-05-13 |
| GB1470929A (en) | 1977-04-21 |
| BE833171A (fr) | 1976-03-08 |
| ES440815A1 (es) | 1977-03-01 |
| CH616133A5 (enExample) | 1980-03-14 |
| NL7510566A (nl) | 1976-03-12 |
| DE2443152A1 (de) | 1976-03-25 |
| LU73241A1 (enExample) | 1976-05-31 |
| DE2443152C3 (de) | 1981-05-21 |
| IL48062A0 (en) | 1975-11-25 |
| ATA690475A (de) | 1976-12-15 |
| IL48062A (en) | 1978-12-17 |
| CA1059148A (en) | 1979-07-24 |
| DE2443152B2 (de) | 1980-08-21 |
| US4060562A (en) | 1977-11-29 |
| IE41792L (en) | 1976-03-10 |
| AT338239B (de) | 1977-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2516567C3 (de) | Verfahren zum Chlorieren von phenolischen Verbindungen | |
| Campbell | Synthesis of thioethers. Amide solvent-promoted nucleophilic displacement of halide by thiolate ion | |
| EP0000162B1 (de) | Verfahren zur Herstellung von Aralkyl- und Alkyl-phenol-äthern | |
| Williams et al. | Solvent-assisted Ullmann ether synthesis. Reactions of dihydric phenols | |
| DE2547309C3 (de) | Verfahren zur o-Alkylierung von Phenolen | |
| EP0297028B1 (de) | Verfahren zur Herstellung chlorierter Diphenylether | |
| PL88994B1 (en) | Process for oxidizing phenols to quinones[us3796732a] | |
| IE41792B1 (en) | Process for the preparation of meta-substituted halogenophenols | |
| US4108908A (en) | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of thio-acid compounds | |
| US2602822A (en) | Production of bis (hydroxyphenyl) compounds | |
| US3912783A (en) | Process and catalyst for preparing of 3-halogen-and 3,5-dihalogen-phenols | |
| US4101561A (en) | Oxidative coupling of alkylphenols catalyzed by metal complexes of imino acid compounds | |
| US4324920A (en) | Process for the preparation of ortho-(hydrocarbylthio)-phenols | |
| US3912782A (en) | Catalytic process for preparing 3-halogen- and 3,5-dihalogen-phenols | |
| IL43738A (en) | Process for the production of 3-halophenols and 3,5-dihalophenols | |
| US1801901A (en) | Method of making phenol ethyl ethers | |
| US4410736A (en) | Coupling of phenols with diphenoquinones | |
| Sprung et al. | Molecular Rearrangements Involving Optically Active Radicals. V. The Rearrangement of Optically Active Alkyl Phenyl Ethers1 | |
| US4193937A (en) | Process for preparing 3-chloro- and 3,5-dichloro-anilines | |
| EP0304725B1 (de) | Verfahren zur Herstellung von Nitro-diphenyl(thio)-ethern | |
| US2903484A (en) | Reaction of naphthols with hydrogen sulfide | |
| DE60111593T2 (de) | Verfahren zur Entfernung von tert-Butylgruppen von tert-Butylphenolverbindungen | |
| US4429156A (en) | Process for the preparation of m-halogen-substituted anilines | |
| USRE31771E (en) | Process for the preparation of ortho-(hydrocarbylthio)-phenols | |
| US3651151A (en) | Preparation of polyphenyl ether from dihydric phenols |