HU228047B1 - A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides - Google Patents
A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides Download PDFInfo
- Publication number
- HU228047B1 HU228047B1 HU0302642A HUP0302642A HU228047B1 HU 228047 B1 HU228047 B1 HU 228047B1 HU 0302642 A HU0302642 A HU 0302642A HU P0302642 A HUP0302642 A HU P0302642A HU 228047 B1 HU228047 B1 HU 228047B1
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- straight
- branched
- amino
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- 238000002360 preparation method Methods 0.000 title claims description 13
- UXPIWHPHEGRYLB-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxamide Chemical class NC(=O)C1=CC(N)=CC(C(N)=O)=C1 UXPIWHPHEGRYLB-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 38
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 239000003054 catalyst Substances 0.000 claims description 18
- -1 1,3-dihydroxy-2-propyl Chemical group 0.000 claims description 15
- 239000003960 organic solvent Substances 0.000 claims description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 125000005907 alkyl ester group Chemical group 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 230000032050 esterification Effects 0.000 claims description 5
- 238000005886 esterification reaction Methods 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 229960001025 iohexol Drugs 0.000 claims description 4
- NTHXOOBQLCIOLC-UHFFFAOYSA-N iohexol Chemical compound OCC(O)CN(C(=O)C)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NTHXOOBQLCIOLC-UHFFFAOYSA-N 0.000 claims description 4
- 229960004647 iopamidol Drugs 0.000 claims description 4
- XQZXYNRDCRIARQ-LURJTMIESA-N iopamidol Chemical compound C[C@H](O)C(=O)NC1=C(I)C(C(=O)NC(CO)CO)=C(I)C(C(=O)NC(CO)CO)=C1I XQZXYNRDCRIARQ-LURJTMIESA-N 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- KBZFDRWPMZESDI-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=CC(C(O)=O)=CC(C(O)=O)=C1 KBZFDRWPMZESDI-UHFFFAOYSA-N 0.000 claims description 3
- 229960000780 iomeprol Drugs 0.000 claims description 3
- NJKDOADNQSYQEV-UHFFFAOYSA-N iomeprol Chemical compound OCC(=O)N(C)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I NJKDOADNQSYQEV-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 239000000155 melt Substances 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 229910052757 nitrogen Inorganic materials 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 12
- 238000007112 amidation reaction Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 7
- 239000008367 deionised water Substances 0.000 description 7
- 229910021641 deionized water Inorganic materials 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 230000009435 amidation Effects 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 239000002872 contrast media Substances 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000005215 alkyl ethers Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- DEKPYXUDJRABNK-UHFFFAOYSA-N dimethyl 5-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(N)=CC(C(=O)OC)=C1 DEKPYXUDJRABNK-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DOGCTUGYGZGSFX-UHFFFAOYSA-N 1-aminopropane-1,3-diol Chemical compound NC(O)CCO DOGCTUGYGZGSFX-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 description 1
- JDFDHBSESGTDAL-UHFFFAOYSA-N 3-methoxypropan-1-ol Chemical compound COCCCO JDFDHBSESGTDAL-UHFFFAOYSA-N 0.000 description 1
- JULQNWKGIJXZCB-UHFFFAOYSA-N 5-amino-3-n,3-n-bis(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide Chemical compound NC(=O)C1=CC(N)=CC(C(=O)N(CC(O)CO)CC(O)CO)=C1 JULQNWKGIJXZCB-UHFFFAOYSA-N 0.000 description 1
- NVKJOXRVEKMMHS-UHFFFAOYSA-N 5-nitro-1,2,4-triazol-3-one Chemical compound [O-][N+](=O)C1=NC(=O)N=N1 NVKJOXRVEKMMHS-UHFFFAOYSA-N 0.000 description 1
- SDQJTJLJXCWVQR-UHFFFAOYSA-N 5-nitrobenzene-1,3-dicarboxamide Chemical class NC(=O)C1=CC(C(N)=O)=CC([N+]([O-])=O)=C1 SDQJTJLJXCWVQR-UHFFFAOYSA-N 0.000 description 1
- NBDAHKQJXVLAID-UHFFFAOYSA-N 5-nitroisophthalic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 NBDAHKQJXVLAID-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- AMDBBAQNWSUWGN-UHFFFAOYSA-N Ioversol Chemical compound OCCN(C(=O)CO)C1=C(I)C(C(=O)NCC(O)CO)=C(I)C(C(=O)NCC(O)CO)=C1I AMDBBAQNWSUWGN-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- ALHZEIINTQJLOT-VKHMYHEASA-N [(2s)-1-chloro-1-oxopropan-2-yl] acetate Chemical compound ClC(=O)[C@H](C)OC(C)=O ALHZEIINTQJLOT-VKHMYHEASA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- GGTSJKFPGKFLCZ-UHFFFAOYSA-N dimethyl 5-nitrobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC)=CC([N+]([O-])=O)=C1 GGTSJKFPGKFLCZ-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229960004537 ioversol Drugs 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- CIBMHJPPKCXONB-UHFFFAOYSA-N propane-2,2-diol Chemical compound CC(C)(O)O CIBMHJPPKCXONB-UHFFFAOYSA-N 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/38—Separation; Purification; Stabilisation; Use of additives
- C07C227/40—Separation; Purification
- C07C227/42—Crystallisation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/14—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof
- C07C227/18—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof by reactions involving amino or carboxyl groups, e.g. hydrolysis of esters or amides, by formation of halides, salts or esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2000MI002608A IT1319674B1 (it) | 2000-12-01 | 2000-12-01 | Processo per la preparazione dell'acido1-(aminometil)cicloesanacetico. |
| PCT/EP2001/013879 WO2002044125A1 (en) | 2000-12-01 | 2001-11-28 | A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HUP0302642A2 HUP0302642A2 (hu) | 2003-11-28 |
| HUP0302642A3 HUP0302642A3 (en) | 2010-01-28 |
| HU228047B1 true HU228047B1 (en) | 2012-09-28 |
Family
ID=11446165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU0302642A HU228047B1 (en) | 2000-12-01 | 2001-11-28 | A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US7393974B2 (enExample) |
| EP (1) | EP1347951B1 (enExample) |
| JP (1) | JP2004521875A (enExample) |
| AT (1) | ATE339400T1 (enExample) |
| AU (2) | AU2957502A (enExample) |
| BR (1) | BR0115755A (enExample) |
| CA (1) | CA2436908A1 (enExample) |
| DE (1) | DE60123125T2 (enExample) |
| ES (1) | ES2271102T3 (enExample) |
| HR (1) | HRP20030438A2 (enExample) |
| HU (1) | HU228047B1 (enExample) |
| IL (2) | IL156185A0 (enExample) |
| IT (1) | IT1319674B1 (enExample) |
| MX (1) | MXPA03004775A (enExample) |
| NZ (1) | NZ526370A (enExample) |
| PL (1) | PL361886A1 (enExample) |
| RU (1) | RU2289572C2 (enExample) |
| WO (1) | WO2002044123A1 (enExample) |
| ZA (1) | ZA200304484B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE418535T1 (de) | 2002-11-18 | 2009-01-15 | Nicholas Piramal India Ltd | Verbessertes verfahren zur herstellung von gabapentin |
| ATE455089T1 (de) | 2002-11-20 | 2010-01-15 | Hikal Ltd | Verfahren zur herstellung von aminomethylcycloalkan-essigsäuren |
| US7439387B2 (en) | 2003-04-21 | 2008-10-21 | Matrix Laboratories Ltd. | Process for the preparation of Gabapentin form-II |
| WO2004101489A1 (en) * | 2003-05-19 | 2004-11-25 | Shasun Chemicals And Drugs Limited | Process for the preparation of gabapentin |
| ITMI20042418A1 (it) * | 2004-12-17 | 2005-03-17 | Zambon Spa | Processo per la purificazione della gabapentina |
| US7071356B1 (en) | 2005-12-01 | 2006-07-04 | Isp Investments Inc. | Process for the preparation of 1-(aminomethyl) cyclohexaneacetic acid |
| EP2183211A1 (en) | 2007-07-27 | 2010-05-12 | Medichem, S.A. | Method for preparing polymorph form ii of gabapentin |
| EP2368872A1 (en) | 2010-03-25 | 2011-09-28 | Serichim S.r.l. | Process for the preparation of Gabapentin |
| ITMI20131757A1 (it) | 2013-10-22 | 2015-04-23 | Zach System Spa | Processo di preparazione di gabapentina |
| EP3018131A1 (en) * | 2014-11-07 | 2016-05-11 | Bayer Pharma Aktiengesellschaft | Synthesis of copanlisib and its dihydrochloride salt |
| EP3018127A1 (en) * | 2014-11-07 | 2016-05-11 | Bayer Pharma Aktiengesellschaft | Synthesis of copanlisib and its dihydrochloride salt |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2460891C2 (de) | 1974-12-21 | 1982-09-23 | Gödecke AG, 1000 Berlin | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4960931A (en) | 1988-05-02 | 1990-10-02 | Warner-Lambert Company | Gabapentin mohohydrate and a process for producing the same |
| DE3928184A1 (de) | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von cyclischen aminosaeurederivaten sowie zwischenprodukte |
| FI905584A7 (fi) * | 1989-11-16 | 1991-05-17 | Lonza Ag | Menetelmä 1-(aminometyyli)sykloheksaanietikkahapon valmistamiseksi |
| US6255526B1 (en) * | 1996-12-24 | 2001-07-03 | Teva Pharmaceutical Industries Ltd. | Preparation of gabapentin |
| IL119890A (en) * | 1996-12-24 | 2002-03-10 | Teva Pharma | Gabapentin form iii and preparation of gabapentin form ii |
-
2000
- 2000-12-01 IT IT2000MI002608A patent/IT1319674B1/it active
-
2001
- 2001-11-28 HU HU0302642A patent/HU228047B1/hu unknown
- 2001-11-29 EP EP01990454A patent/EP1347951B1/en not_active Expired - Lifetime
- 2001-11-29 NZ NZ526370A patent/NZ526370A/en unknown
- 2001-11-29 CA CA002436908A patent/CA2436908A1/en not_active Abandoned
- 2001-11-29 AU AU2957502A patent/AU2957502A/xx active Pending
- 2001-11-29 RU RU2003119451/04A patent/RU2289572C2/ru not_active IP Right Cessation
- 2001-11-29 HR HR20030438A patent/HRP20030438A2/hr not_active Application Discontinuation
- 2001-11-29 WO PCT/EP2001/013953 patent/WO2002044123A1/en not_active Ceased
- 2001-11-29 AU AU2002229575A patent/AU2002229575B2/en not_active Ceased
- 2001-11-29 US US10/433,241 patent/US7393974B2/en not_active Expired - Fee Related
- 2001-11-29 PL PL36188601A patent/PL361886A1/xx not_active Application Discontinuation
- 2001-11-29 JP JP2002546493A patent/JP2004521875A/ja active Pending
- 2001-11-29 MX MXPA03004775A patent/MXPA03004775A/es active IP Right Grant
- 2001-11-29 IL IL15618501A patent/IL156185A0/xx active IP Right Grant
- 2001-11-29 ES ES01990454T patent/ES2271102T3/es not_active Expired - Lifetime
- 2001-11-29 DE DE60123125T patent/DE60123125T2/de not_active Expired - Fee Related
- 2001-11-29 AT AT01990454T patent/ATE339400T1/de not_active IP Right Cessation
- 2001-11-29 BR BR0115755-8A patent/BR0115755A/pt not_active IP Right Cessation
-
2003
- 2003-05-28 IL IL156185A patent/IL156185A/en not_active IP Right Cessation
- 2003-06-09 ZA ZA200304484A patent/ZA200304484B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MXPA03004775A (es) | 2004-12-03 |
| AU2957502A (en) | 2002-06-11 |
| HUP0302642A3 (en) | 2010-01-28 |
| EP1347951A1 (en) | 2003-10-01 |
| DE60123125D1 (de) | 2006-10-26 |
| US7393974B2 (en) | 2008-07-01 |
| NZ526370A (en) | 2003-08-29 |
| IL156185A (en) | 2008-08-07 |
| HRP20030438A2 (en) | 2004-08-31 |
| DE60123125T2 (de) | 2007-03-01 |
| EP1347951B1 (en) | 2006-09-13 |
| PL361886A1 (en) | 2004-10-04 |
| IT1319674B1 (it) | 2003-10-23 |
| BR0115755A (pt) | 2003-12-30 |
| ATE339400T1 (de) | 2006-10-15 |
| HUP0302642A2 (hu) | 2003-11-28 |
| WO2002044123A1 (en) | 2002-06-06 |
| US20050049432A1 (en) | 2005-03-03 |
| ITMI20002608A1 (it) | 2002-06-01 |
| CA2436908A1 (en) | 2002-06-06 |
| ZA200304484B (en) | 2004-09-09 |
| JP2004521875A (ja) | 2004-07-22 |
| IL156185A0 (en) | 2003-12-23 |
| ES2271102T3 (es) | 2007-04-16 |
| AU2002229575B2 (en) | 2006-12-07 |
| RU2289572C2 (ru) | 2006-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2002226359B2 (en) | A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides | |
| KR101668042B1 (ko) | 요오드화된 조영제의 제조방법 | |
| JP6307087B2 (ja) | ベンズアミド化合物の合成に有用な化合物 | |
| HU228047B1 (en) | A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides | |
| AU2002226359A1 (en) | A process for the preparation of N,N'-substituted 5-amino-1,3-benzenedicarboxamides | |
| EP1960349B1 (en) | Purification of iodixanol | |
| EP1353899B1 (en) | A process for the preparation of iopamidol | |
| US5616799A (en) | Process for the preparation of glycoloylanilides | |
| AU723184B2 (en) | Process for iohexol manufacture | |
| NO322067B1 (no) | Fremgangsmate ved fremstilling av 5-amino-2,4,6-trijod-1,3-benzendikarboksylsyre-derivater | |
| JP4439123B2 (ja) | N,n′−ビス〔2,3−ジヒドロキシプロピル〕−5−〔(ヒドロキシアセチル)メチルアミノ〕−2,4,6−トリヨード−1,3−ベンゼンジカルボキシアミドの調製方法 | |
| JP5899204B2 (ja) | キラルなβ−アミノカルボキサミド誘導体の製造方法 | |
| CA2755650C (en) | Process for the preparation of triiodinated carboxylic aromatic derivatives | |
| EP4172139B1 (en) | Process for the preparation of iopamidol | |
| JP4721518B2 (ja) | 5−アミノ−イソフタルアミドの製造方法 | |
| HK1058514B (en) | A process for the preparation of n,n'-substituted 5-amino-1,3-benzenedicarboxamides | |
| JP4634168B2 (ja) | テアニンの製造法 | |
| JPH072809A (ja) | アミノチアゾール酢酸誘導体の新規製造法 |