HU193033B - Process for preparing new 6-substituted s-triazolo /3,4-a/ phthalazine derivatives - Google Patents
Process for preparing new 6-substituted s-triazolo /3,4-a/ phthalazine derivatives Download PDFInfo
- Publication number
- HU193033B HU193033B HU83141A HU14183A HU193033B HU 193033 B HU193033 B HU 193033B HU 83141 A HU83141 A HU 83141A HU 14183 A HU14183 A HU 14183A HU 193033 B HU193033 B HU 193033B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- phenyl
- triazolo
- group
- derivative
- Prior art date
Links
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical class C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 title claims description 32
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000000034 method Methods 0.000 claims abstract description 33
- 238000002360 preparation method Methods 0.000 claims abstract description 23
- JVJPJKLSGUJUJK-UHFFFAOYSA-N [1,2,4]triazolo[3,4-a]phthalazine Chemical class C1=CC=C2C=NN3C=NN=C3C2=C1 JVJPJKLSGUJUJK-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 9
- 150000001875 compounds Chemical class 0.000 claims description 109
- -1 (C1-C5) -alkyl Chemical group 0.000 claims description 83
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 67
- 239000000203 mixture Substances 0.000 claims description 40
- 239000001257 hydrogen Substances 0.000 claims description 38
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 23
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 229910052783 alkali metal Inorganic materials 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 14
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 10
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 150000007857 hydrazones Chemical class 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 238000007363 ring formation reaction Methods 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- 150000001340 alkali metals Chemical group 0.000 claims description 5
- 150000004703 alkoxides Chemical class 0.000 claims description 5
- 230000000049 anti-anxiety effect Effects 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 239000002249 anxiolytic agent Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 238000005660 chlorination reaction Methods 0.000 claims description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 150000002429 hydrazines Chemical class 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- UCOVESIAFFGEOR-UHFFFAOYSA-N 1-chlorophthalazine Chemical class C1=CC=C2C(Cl)=NN=CC2=C1 UCOVESIAFFGEOR-UHFFFAOYSA-N 0.000 claims 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims 2
- 206010029897 Obsessive thoughts Diseases 0.000 claims 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 2
- 230000001590 oxidative effect Effects 0.000 claims 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 claims 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 claims 1
- 238000005903 acid hydrolysis reaction Methods 0.000 claims 1
- 150000001335 aliphatic alkanes Chemical class 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 125000006323 alkenyl amino group Chemical group 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 125000004992 haloalkylamino group Chemical group 0.000 claims 1
- 230000002140 halogenating effect Effects 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- BNPBZINPHDCVFQ-UHFFFAOYSA-N n,n-bis(2-methoxyethyl)-3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine Chemical compound N=1N=C2C3=CC=CC=C3C(N(CCOC)CCOC)=NN2C=1C1=CC=C(OC)C=C1 BNPBZINPHDCVFQ-UHFFFAOYSA-N 0.000 claims 1
- PBMSWVPMRUJMPE-UHFFFAOYSA-N phthalylsulfathiazole Chemical compound OC(=O)C1=CC=CC=C1C(=O)NC1=CC=C(S(=O)(=O)\N=C\2SC=CN/2)C=C1 PBMSWVPMRUJMPE-UHFFFAOYSA-N 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 215
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 74
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 239000000243 solution Substances 0.000 description 27
- 239000002904 solvent Substances 0.000 description 26
- 238000002844 melting Methods 0.000 description 25
- 230000008018 melting Effects 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 238000002425 crystallisation Methods 0.000 description 15
- 230000008025 crystallization Effects 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 208000023514 Barrett esophagus Diseases 0.000 description 11
- 238000001914 filtration Methods 0.000 description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 9
- 229960003529 diazepam Drugs 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 7
- 230000011514 reflex Effects 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 101100310222 Caenorhabditis briggsae she-1 gene Proteins 0.000 description 5
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- PTIIJXOOYMMFJB-UHFFFAOYSA-N (6-chloro-4-phenylphthalazin-1-yl)hydrazine Chemical compound C12=CC(Cl)=CC=C2C(NN)=NN=C1C1=CC=CC=C1 PTIIJXOOYMMFJB-UHFFFAOYSA-N 0.000 description 4
- 102000004300 GABA-A Receptors Human genes 0.000 description 4
- 108090000839 GABA-A Receptors Proteins 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- OZXCKWJNGZVAAJ-UHFFFAOYSA-N (4-phenylphthalazin-1-yl)hydrazine Chemical compound C12=CC=CC=C2C(NN)=NN=C1C1=CC=CC=C1 OZXCKWJNGZVAAJ-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- XNEQXUCGYMSSRQ-UHFFFAOYSA-N 3,8-dichloro-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(Cl)=NN=C2C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 XNEQXUCGYMSSRQ-UHFFFAOYSA-N 0.000 description 3
- IJIKKYUDVPQLGL-UHFFFAOYSA-N 3-(4-methoxyphenyl)-5h-[1,2,4]triazolo[3,4-a]phthalazin-6-one Chemical compound C1=CC(OC)=CC=C1C1=NN=C2N1NC(=O)C1=CC=CC=C12 IJIKKYUDVPQLGL-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- HMKCQESJPJSWDH-UHFFFAOYSA-N 6-(4-methoxyphenyl)-2h-[1,2,4]triazolo[3,4-a]phthalazine-3-thione Chemical compound C1=CC(OC)=CC=C1C1=NN2C(=S)NN=C2C2=CC=CC=C12 HMKCQESJPJSWDH-UHFFFAOYSA-N 0.000 description 3
- HQTKRFAZCJOEDF-UHFFFAOYSA-N 6-phenyl-2h-[1,2,4]triazolo[3,4-a]phthalazine-3-thione Chemical compound N=1N2C(=S)NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 HQTKRFAZCJOEDF-UHFFFAOYSA-N 0.000 description 3
- 229910000831 Steel Inorganic materials 0.000 description 3
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 150000001557 benzodiazepines Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229960005152 pentetrazol Drugs 0.000 description 3
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 3
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 235000010262 sodium metabisulphite Nutrition 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- UQTJGZYAFKMABR-UHFFFAOYSA-N (4-chlorophthalazin-1-yl)hydrazine Chemical compound C1=CC=C2C(NN)=NN=C(Cl)C2=C1 UQTJGZYAFKMABR-UHFFFAOYSA-N 0.000 description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 2
- WOFOKHAYIVGJOD-UHFFFAOYSA-N 1,6-dichloro-4-phenylphthalazine Chemical compound C12=CC(Cl)=CC=C2C(Cl)=NN=C1C1=CC=CC=C1 WOFOKHAYIVGJOD-UHFFFAOYSA-N 0.000 description 2
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 2
- SGTXILTYXULEQD-UHFFFAOYSA-N 2H-triazolo[4,5-f]phthalazine Chemical group N1=NC=C2C3=NNN=C3C=CC2=C1 SGTXILTYXULEQD-UHFFFAOYSA-N 0.000 description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 2
- HFXOYPGGMQHNHI-UHFFFAOYSA-N 3-chloro-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(Cl)=NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 HFXOYPGGMQHNHI-UHFFFAOYSA-N 0.000 description 2
- KYINPWAJIVTFBW-UHFFFAOYSA-N 3-methylpyrrolidine Chemical compound CC1CCNC1 KYINPWAJIVTFBW-UHFFFAOYSA-N 0.000 description 2
- ANYDHLGPGKEJLY-UHFFFAOYSA-N 3-methylsulfanyl-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(SC)=NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 ANYDHLGPGKEJLY-UHFFFAOYSA-N 0.000 description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 2
- PZFWLAZUUQXZCW-UHFFFAOYSA-N 6-(4-methoxyphenyl)-3-methylsulfanyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound C1=CC(OC)=CC=C1C(C1=CC=CC=C11)=NN2C1=NN=C2SC PZFWLAZUUQXZCW-UHFFFAOYSA-N 0.000 description 2
- ZHGVCXDOKBSJBV-UHFFFAOYSA-N 6-chloro-3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound C1=CC(OC)=CC=C1C1=NN=C2N1N=C(Cl)C1=CC=CC=C12 ZHGVCXDOKBSJBV-UHFFFAOYSA-N 0.000 description 2
- HNOGCUCCQQVHCI-UHFFFAOYSA-N 6-chloro-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N=C2C3=CC=CC=C3C(Cl)=NN2C=1C1=CC=CC=C1 HNOGCUCCQQVHCI-UHFFFAOYSA-N 0.000 description 2
- NQTKGRXVFWMBOK-UHFFFAOYSA-N 8-chloro-6-phenyl-2h-[1,2,4]triazolo[3,4-a]phthalazine-3-thione Chemical compound C12=CC(Cl)=CC=C2C2=NNC(=S)N2N=C1C1=CC=CC=C1 NQTKGRXVFWMBOK-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229960003965 antiepileptics Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000009194 climbing Effects 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 235000013681 dietary sucrose Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000007243 oxidative cyclization reaction Methods 0.000 description 2
- 229940124531 pharmaceutical excipient Drugs 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 238000001525 receptor binding assay Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000004296 sodium metabisulphite Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- HRJIEWRRYHJREA-UHFFFAOYSA-N 1,3-diethylbenzimidazol-3-ium triiodide Chemical compound I[I-]I.CCn1c[n+](CC)c2ccccc12 HRJIEWRRYHJREA-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- FTOOZRHZXGOWDL-UHFFFAOYSA-N 1-[(8-chloro-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-3-yl)-methylamino]propan-2-ol Chemical compound N=1N2C(N(C)CC(O)C)=NN=C2C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 FTOOZRHZXGOWDL-UHFFFAOYSA-N 0.000 description 1
- LNWWQYYLZVZXKS-UHFFFAOYSA-N 1-pyrrolidin-1-ylethanone Chemical compound CC(=O)N1CCCC1 LNWWQYYLZVZXKS-UHFFFAOYSA-N 0.000 description 1
- SJBXMBRSTWBJRN-UHFFFAOYSA-N 2-benzoyl-4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 SJBXMBRSTWBJRN-UHFFFAOYSA-N 0.000 description 1
- NZCKTGCKFJDGFD-UHFFFAOYSA-N 2-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Br NZCKTGCKFJDGFD-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- UYCUMNRCCJNSBR-UHFFFAOYSA-N 2-ethoxy-2-oxoacetic acid;hydrochloride Chemical compound Cl.CCOC(=O)C(O)=O UYCUMNRCCJNSBR-UHFFFAOYSA-N 0.000 description 1
- GBNKYJHZUILFEZ-UHFFFAOYSA-N 3-(2-bromophenyl)-6-chloro-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N=C2C3=CC=CC=C3C(Cl)=NN2C=1C1=CC=CC=C1Br GBNKYJHZUILFEZ-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- FWMFWQBGFCSIMK-UHFFFAOYSA-N 3-[[3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-yl]oxy]pyrrolidin-2-one Chemical compound C1=CC(OC)=CC=C1C1=NN=C2N1N=C(OC1C(NCC1)=O)C1=CC=CC=C12 FWMFWQBGFCSIMK-UHFFFAOYSA-N 0.000 description 1
- GVPDRYJFYUWXQK-UHFFFAOYSA-N 3-bromopyrrolidin-2-one Chemical compound BrC1CCNC1=O GVPDRYJFYUWXQK-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- QWLQHMCKQKUIAX-UHFFFAOYSA-N 3-methylsulfinyl-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(S(=O)C)=NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 QWLQHMCKQKUIAX-UHFFFAOYSA-N 0.000 description 1
- CTYNDEQALAAWPC-UHFFFAOYSA-N 3-phenyl-5h-[1,2,4]triazolo[3,4-a]phthalazine-6-thione Chemical compound N=1N=C2C3=CC=CC=C3C(=S)NN2C=1C1=CC=CC=C1 CTYNDEQALAAWPC-UHFFFAOYSA-N 0.000 description 1
- DBQIQJLLFPFTGZ-UHFFFAOYSA-N 3-sulfanyl-2H-phthalazine Chemical compound C=1NN(C=C2C=CC=CC=12)S DBQIQJLLFPFTGZ-UHFFFAOYSA-N 0.000 description 1
- OYLVBLUJRKGKIU-UHFFFAOYSA-N 3h-phthalazin-2-amine Chemical compound C1=CC=CC2=CN(N)NC=C21 OYLVBLUJRKGKIU-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- CSVRBZABWINVSH-UHFFFAOYSA-N 4-chloro-2-ethylbutanoic acid Chemical compound CCC(C(O)=O)CCCl CSVRBZABWINVSH-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- JRAUUVUQPGLRCF-UHFFFAOYSA-N 6-(2-methoxyethoxy)-3-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N=C2C3=CC=CC=C3C(OCCOC)=NN2C=1C1=CC=C(OC)C=C1 JRAUUVUQPGLRCF-UHFFFAOYSA-N 0.000 description 1
- NQMMLMPWHYBOQG-UHFFFAOYSA-N 6-(4-methoxyphenyl)-3-methylsulfinyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound C1=CC(OC)=CC=C1C(C1=CC=CC=C11)=NN2C1=NN=C2S(C)=O NQMMLMPWHYBOQG-UHFFFAOYSA-N 0.000 description 1
- RKINLIGTILCMDR-UHFFFAOYSA-N 6-(4-methoxyphenyl)-3-pyrrolidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound C1=CC(OC)=CC=C1C(C1=CC=CC=C11)=NN2C1=NN=C2N1CCCC1 RKINLIGTILCMDR-UHFFFAOYSA-N 0.000 description 1
- YCVCJAVLEBGWBT-UHFFFAOYSA-N 6-ethoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N=C2C3=CC=CC=C3C(OCC)=NN2C=1C1=CC=CC=C1 YCVCJAVLEBGWBT-UHFFFAOYSA-N 0.000 description 1
- RHROWHMFWYLYLZ-UHFFFAOYSA-N 6-ethylsulfanyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N=C2C3=CC=CC=C3C(SCC)=NN2C=1C1=CC=CC=C1 RHROWHMFWYLYLZ-UHFFFAOYSA-N 0.000 description 1
- PXRWSPIIXAXJKZ-UHFFFAOYSA-N 6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C=NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 PXRWSPIIXAXJKZ-UHFFFAOYSA-N 0.000 description 1
- USJXNVWBZBITPA-UHFFFAOYSA-N 6-phenyl-n-prop-2-enyl-[1,2,4]triazolo[3,4-a]phthalazin-3-amine Chemical compound N=1N2C(NCC=C)=NN=C2C2=CC=CC=C2C=1C1=CC=CC=C1 USJXNVWBZBITPA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEUOZDOMYGKJBP-UHFFFAOYSA-N 8-chloro-3-ethoxy-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(OCC)=NN=C2C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 VEUOZDOMYGKJBP-UHFFFAOYSA-N 0.000 description 1
- PJVWRMUQRMLWBF-UHFFFAOYSA-N 8-chloro-3-methyl-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N=1N2C(C)=NN=C2C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 PJVWRMUQRMLWBF-UHFFFAOYSA-N 0.000 description 1
- BHBLFMAUUKZTOH-UHFFFAOYSA-N 8-chloro-6-phenyl-3-pyrrolidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound N12N=C(C=3C=CC=CC=3)C3=CC(Cl)=CC=C3C2=NN=C1N1CCCC1 BHBLFMAUUKZTOH-UHFFFAOYSA-N 0.000 description 1
- XUWBANWJZJOEBI-UHFFFAOYSA-N 8-chloro-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine Chemical compound C12=CC(Cl)=CC=C2C2=NN=CN2N=C1C1=CC=CC=C1 XUWBANWJZJOEBI-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- JCSFBTFUCJFIBS-UHFFFAOYSA-N [4-(4-methoxyphenyl)phthalazin-1-yl]hydrazine Chemical compound C1=CC(OC)=CC=C1C1=NN=C(NN)C2=CC=CC=C12 JCSFBTFUCJFIBS-UHFFFAOYSA-N 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- DQGFCLJXYFXXIJ-LFIBNONCSA-N budralazine Chemical class C1=CC=C2C(N/N=C(C)/C=C(C)C)=NN=CC2=C1 DQGFCLJXYFXXIJ-LFIBNONCSA-N 0.000 description 1
- PIJXRNNCIJAUOX-UHFFFAOYSA-N butanoic acid;hydrochloride Chemical compound Cl.CCCC(O)=O PIJXRNNCIJAUOX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 1
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- RPTYOHBNZMHGIH-UHFFFAOYSA-N ethyl 8-chloro-6-phenyl-[1,2,4]triazolo[3,4-a]phthalazine-3-carboxylate Chemical compound N=1N2C(C(=O)OCC)=NN=C2C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 RPTYOHBNZMHGIH-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004973 motor coordination Effects 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- ADIMAYPTOBDMTL-UHFFFAOYSA-N oxazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1 ADIMAYPTOBDMTL-UHFFFAOYSA-N 0.000 description 1
- 229960004535 oxazepam Drugs 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- IHRYNXNMVQFNPK-UHFFFAOYSA-N phthalazin-6-amine Chemical compound C1=NN=CC2=CC(N)=CC=C21 IHRYNXNMVQFNPK-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
- C07D237/30—Phthalazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
- C07D237/30—Phthalazines
- C07D237/34—Phthalazines with nitrogen atoms directly attached to carbon atoms of the nitrogen-containing ring, e.g. hydrazine radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Anesthesiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8201273 | 1982-01-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU193033B true HU193033B (en) | 1987-08-28 |
Family
ID=10527683
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU83141A HU193033B (en) | 1982-01-18 | 1983-01-17 | Process for preparing new 6-substituted s-triazolo /3,4-a/ phthalazine derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4788186A (enExample) |
| EP (1) | EP0085840B1 (enExample) |
| JP (1) | JPS58124786A (enExample) |
| KR (1) | KR890000184B1 (enExample) |
| AT (1) | ATE22562T1 (enExample) |
| AU (1) | AU564026B2 (enExample) |
| CA (1) | CA1214168A (enExample) |
| DE (1) | DE3366494D1 (enExample) |
| DK (1) | DK163145C (enExample) |
| ES (1) | ES531458A0 (enExample) |
| FI (1) | FI81350C (enExample) |
| GR (1) | GR78442B (enExample) |
| HU (1) | HU193033B (enExample) |
| IE (1) | IE55032B1 (enExample) |
| IL (1) | IL67697A (enExample) |
| NO (1) | NO161674C (enExample) |
| NZ (1) | NZ203021A (enExample) |
| PH (1) | PH21834A (enExample) |
| PT (1) | PT76107A (enExample) |
| ZA (1) | ZA83224B (enExample) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1194310B (it) * | 1983-07-12 | 1988-09-14 | Lepetit Spa | Derivati triazolo (3,4-a) ftalazinici 3,6-disostituiti |
| US6465462B1 (en) | 1996-07-25 | 2002-10-15 | Merck Sharp & Dohme Ltd. | Substituted triazolo pyridazine derivatives as inverse agonists of the GABAAα5 receptor subtype |
| YU2899A (sh) | 1996-07-25 | 2000-03-21 | Merck Sharp & Dohme Limited | Supstituisani triazolo-piridazin derivati kao ligandi za gaba receptore |
| DE69807074T2 (de) * | 1997-05-08 | 2003-04-03 | Merck Sharp & Dohme Ltd., Hoddesdon | Substituierte 1,2,4-triazolo[3,4,-a]phthalazin-derivate als gaba-alpha 5-liganden |
| ES2137113B1 (es) * | 1997-07-29 | 2000-09-16 | Almirall Prodesfarma Sa | Nuevos derivados de triazolo-piridazinas heterociclicos. |
| GB9715977D0 (en) | 1997-07-29 | 1997-10-01 | Merck Sharp & Dohme | Therapeutic agents |
| AU1041599A (en) * | 1997-11-13 | 1999-06-07 | Jose Luis Castro Pineiro | Therapeutic uses of triazolo-pyridazine derivatives |
| GB9726702D0 (en) * | 1997-12-18 | 1998-02-18 | Merck Sharp & Dohme | Therapeutic use |
| GB9723999D0 (en) | 1997-11-13 | 1998-01-14 | Merck Sharp & Dohme | Therapeutic use |
| GB9726701D0 (en) * | 1997-12-18 | 1998-02-18 | Merck Sharp & Dohme | Therapeutic use |
| GB9726699D0 (en) * | 1997-12-18 | 1998-02-18 | Merck Sharp & Dohme | Therapeutic use |
| US6110915A (en) * | 1997-12-18 | 2000-08-29 | Merck & Co., Inc. | Antiemetic use of triazolo-pyridazine derivatives |
| US6303597B1 (en) | 1998-01-14 | 2001-10-16 | Merck Sharp & Dohme Limited | Triazolo-pyridazine derivatives as ligands for GABA receptors |
| GB9801202D0 (en) | 1998-01-21 | 1998-03-18 | Merck Sharp & Dohme | Therapeutic agents |
| KR20010034257A (ko) * | 1998-01-21 | 2001-04-25 | 더블유. 지. 콜 | Gaba 수용체에 대한 리간드로서 트리아졸로-피리다진유도체 |
| GB9801208D0 (en) | 1998-01-21 | 1998-03-18 | Merck Sharp & Dohme | Therapeutic agents |
| GB9801234D0 (en) * | 1998-01-21 | 1998-03-18 | Merck Sharp & Dohme | Therapeutic agents |
| GB9801210D0 (en) * | 1998-01-21 | 1998-03-18 | Merck Sharp & Dohme | Therapeutic agents |
| GB9801397D0 (en) | 1998-01-22 | 1998-03-18 | Merck Sharp & Dohme | Therapeutic agents |
| GB9801538D0 (en) | 1998-01-23 | 1998-03-25 | Merck Sharp & Dohme | Pharmaceutical product |
| BR9908155A (pt) | 1998-02-25 | 2000-10-31 | Merck Sharp & Dohme | Composto, composição farmacêutica, uso do composto, e, processo para intensificar cognição em um sujeito sofrendo de cognição diminuìda |
| CA2317416A1 (en) * | 1998-02-25 | 1999-09-02 | Merck Sharp & Dohme Limited | Substituted 1,2,4-triazolo[3,4-a]pyridazine |
| WO2000027849A2 (en) | 1998-11-12 | 2000-05-18 | Merck & Co., Inc. | Therapeutic polymorphs of a gaba-a alpha-5 inverse agonist and pamoate formulations of the same |
| GB9824897D0 (en) | 1998-11-12 | 1999-01-06 | Merck Sharp & Dohme | Therapeutic compounds |
| GB9929569D0 (en) * | 1999-12-14 | 2000-02-09 | Merck Sharp & Dohme | Therapeutic agents |
| GB0028583D0 (en) | 2000-11-23 | 2001-01-10 | Merck Sharp & Dohme | Therapeutic compounds |
| AU2002307163B2 (en) * | 2001-04-10 | 2006-06-29 | Merck & Co., Inc. | A method of treating cancer |
| WO2002083140A1 (en) * | 2001-04-10 | 2002-10-24 | Merck & Co., Inc. | Inhibitors of akt activity |
| WO2003084473A2 (en) * | 2002-04-08 | 2003-10-16 | Merck & Co., Inc. | Method of treating cancer |
| US20050054647A1 (en) * | 2002-12-27 | 2005-03-10 | Detlev Schuppan | New pharmaceutical combination |
| WO2006024640A2 (en) | 2004-09-02 | 2006-03-09 | Altana Pharma Ag | Triazolophthalazines |
| WO2006072612A2 (en) * | 2005-01-05 | 2006-07-13 | Nycomed Gmbh | Triazolophthalazines as pde2- inhibitors |
| CN101103033B (zh) | 2005-01-05 | 2010-08-04 | 尼科梅德有限责任公司 | 作为pde2抑制剂的三唑并酞嗪 |
| PH12012501361A1 (en) | 2009-12-31 | 2012-10-22 | Centro Nac De Investigaciones Oncologicas Cnio | Tricyclic compounds for use as kinase inhibitors |
| CN103694244B (zh) * | 2014-01-09 | 2016-03-30 | 郑州大学 | 3,6位取代-1,2,4-三氮唑并[3,4-a]酞嗪类化合物及其制备和用途 |
| CN104016986B (zh) * | 2014-03-13 | 2016-02-03 | 郑州大学 | 3-取代-6-(1-取代哌嗪基)-1,2,4-三氮唑并[3,4-a]酞嗪类化合物、其制备方法和用途 |
| EP4279074A1 (en) * | 2022-05-19 | 2023-11-22 | Georg-August-Universität Göttingen Stiftung Öffentlichen Rechts, Universitätsmedizin | Azolo compounds for treatment of fibrotic diseases |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2484029A (en) * | 1945-12-21 | 1949-10-11 | Ciba Pharm Prod Inc | Hydrazine derivatives of pyridazine compounds |
| GB629177A (en) * | 1945-12-21 | 1949-09-14 | Ciba Ltd | Manufacture of new hydrazine compounds and derivatives thereof |
| JPS5132598A (en) * | 1974-09-13 | 1976-03-19 | Eisai Co Ltd | Toriazoro * 3 44 ee * futarajinjudotai no goseiho |
| JPS603080B2 (ja) * | 1976-08-10 | 1985-01-25 | 三菱化学株式会社 | S―トリアゾロ〔3,4 ―α〕〔5,6,7,8〕テトラヒドロ フタラジン類 |
| GR70309B (enExample) * | 1979-10-29 | 1982-09-08 | Dow Chemical Co |
-
1983
- 1983-01-12 PH PH28380A patent/PH21834A/en unknown
- 1983-01-12 FI FI830100A patent/FI81350C/fi not_active IP Right Cessation
- 1983-01-13 DE DE8383100232T patent/DE3366494D1/de not_active Expired
- 1983-01-13 NZ NZ203021A patent/NZ203021A/en unknown
- 1983-01-13 EP EP83100232A patent/EP0085840B1/en not_active Expired
- 1983-01-13 GR GR70257A patent/GR78442B/el unknown
- 1983-01-13 AT AT83100232T patent/ATE22562T1/de not_active IP Right Cessation
- 1983-01-13 CA CA000419398A patent/CA1214168A/en not_active Expired
- 1983-01-13 ZA ZA83224A patent/ZA83224B/xx unknown
- 1983-01-14 NO NO830110A patent/NO161674C/no unknown
- 1983-01-17 HU HU83141A patent/HU193033B/hu not_active IP Right Cessation
- 1983-01-17 IL IL67697A patent/IL67697A/xx unknown
- 1983-01-17 IE IE82/83A patent/IE55032B1/en not_active IP Right Cessation
- 1983-01-18 JP JP58005413A patent/JPS58124786A/ja active Granted
- 1983-01-18 DK DK017983A patent/DK163145C/da not_active IP Right Cessation
- 1983-01-18 AU AU10550/83A patent/AU564026B2/en not_active Ceased
- 1983-01-18 PT PT76107A patent/PT76107A/pt unknown
- 1983-01-18 KR KR1019830000174A patent/KR890000184B1/ko not_active Expired
-
1984
- 1984-04-10 ES ES531458A patent/ES531458A0/es active Granted
-
1987
- 1987-10-20 US US07/112,015 patent/US4788186A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NO161674C (no) | 1989-09-13 |
| US4788186A (en) | 1988-11-29 |
| FI830100L (fi) | 1983-07-19 |
| IL67697A (en) | 1990-02-09 |
| NZ203021A (en) | 1986-05-09 |
| GR78442B (enExample) | 1984-09-27 |
| EP0085840A1 (en) | 1983-08-17 |
| DK163145C (da) | 1992-06-22 |
| KR890000184B1 (ko) | 1989-03-09 |
| NO830110L (no) | 1983-07-19 |
| KR840003254A (ko) | 1984-08-20 |
| FI81350B (fi) | 1990-06-29 |
| DK17983D0 (da) | 1983-01-18 |
| DK17983A (da) | 1983-07-19 |
| JPS58124786A (ja) | 1983-07-25 |
| JPH048428B2 (enExample) | 1992-02-17 |
| FI81350C (fi) | 1990-10-10 |
| ZA83224B (en) | 1983-10-26 |
| DE3366494D1 (de) | 1986-11-06 |
| DK163145B (da) | 1992-01-27 |
| IE830082L (en) | 1983-07-18 |
| EP0085840B1 (en) | 1986-10-01 |
| IE55032B1 (en) | 1990-05-09 |
| FI830100A0 (fi) | 1983-01-12 |
| ATE22562T1 (de) | 1986-10-15 |
| CA1214168A (en) | 1986-11-18 |
| ES8601995A1 (es) | 1985-11-01 |
| NO161674B (no) | 1989-06-05 |
| PH21834A (en) | 1988-03-17 |
| ES531458A0 (es) | 1985-11-01 |
| IL67697A0 (en) | 1983-05-15 |
| AU1055083A (en) | 1983-07-28 |
| PT76107A (en) | 1983-02-01 |
| AU564026B2 (en) | 1987-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU193033B (en) | Process for preparing new 6-substituted s-triazolo /3,4-a/ phthalazine derivatives | |
| US5977118A (en) | 6-substituted pyrazolo[3,4-d]pyrimidin-4-ones and compositions and methods of use thereof | |
| EP2497470B1 (en) | Imidazotriazines and imidazopyrimidines as kinase inhibitors | |
| HK1225978A1 (en) | Imidazotriazines and imidazopyrimidines as kinase inhibitors | |
| JP2015529192A (ja) | 2,3−ベンゾジアゼピン類 | |
| HUP0500332A2 (hu) | Helyettesített 2-pirimidinil-6,7,8,9-tetrahidropirimido[1,2-a]-pirimidin-4-on és 7-piridinil-2,3-dihidroimidazo[1,2-a]-pirimidin-5 (1H)-on-származékok, alkalmazásuk és az ezeket tartalmazó gyógyszerkészítmények | |
| EA002755B1 (ru) | Производные триазолопиридазина в качестве лигандов для гамк рецепторов | |
| EA004373B1 (ru) | 1-АМИНОТРИАЗОЛО[4,3-a]ХИНАЗОЛИН-5-ОНЫ И/ИЛИ -5-ТИОНЫ, ИНГИБИРУЮЩИЕ ФОСФОДИЭСТЕРАЗУ IV | |
| TWI472530B (zh) | 蛋白質激酶抑制劑 | |
| EP0693072A4 (en) | PROCESS FOR THE SYNTHESIS OF 2-AMINOIMIDAZOLES (BI) SUBSTITUTED IN POSITION 4 and / or 5 FROM 2-AMINOIMIDAZOLES AND ALDEHYDES | |
| US4616014A (en) | Triazine derivatives, and pharmaceutical compositions comprising the same | |
| SK1662001A3 (en) | Substituted imidazo[1,2a]azines as selective inhibotors of cox-2 | |
| FI89359C (fi) | Foerfarande foer framstaellning av antikonvulsivt verkande 3h-1,2,3-triazolo/4,5-d/pyrimidiner | |
| CN114478537B (zh) | 环酰胺并环化合物及其医药用途 | |
| SU1287752A3 (ru) | Способ получени имидазо /1,2- @ / пиримидинов или их аддитивных солей с кислотами | |
| HU192653B (en) | Process for the production of imidazo /1,2-c/pyrimidines, as well as of therapeutic preparations containing these compounds as agent | |
| CA2826757C (en) | Substituted [(5h-pyrrolo[2,1-c][1,4]benzodiazepin-11-yl)piperazin-1-yl]-2,2-dimethylpropanoic acid compounds as dual activity h1 inverse agonists/5-ht2a antagonists | |
| WO2000047582A1 (en) | Triazolo-pyridazine derivatives as ligands for gaba receptors | |
| IL96373A (en) | 4,5-Dihydro -3-isoxazolyl-4-oxoimidazo [1,5-a] quinoxaline compounds, their preparation and pharmaceutical compositions containing them | |
| Bhuyan et al. | Studies on uracils: A facile one‐pot synthesis of pyrazolo [3, 4‐d] pyrimidines | |
| US4075202A (en) | S-triazolo-1,5-benzodiazpine-4-ones | |
| Birnberg et al. | The synthesis of 5‐arylpyrrolo [3, 2‐b] pyridines and 7‐arylpyrrolo [3, 2‐b] pyridines: Addition of 3‐aminopyrroles to aryl enaminones | |
| Palusa et al. | Synthesis and evaluation of a series of pyrimidine substituted 1, 3, 4-oxadiazole derivatives as antimicrobial and anti-inflammatory agents | |
| Mekuskiene et al. | Department of Organic Chemistry, Faculty of Chemistry, Vilnius University, Naugarduko 24, Vilnius LT-03225, Lithuania e-mail: giedrute. mekuskiene@ chf. vu. lt | |
| IE47839B1 (en) | Condensed pyrimidine derivatives,their preparation and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |