HU189596B - Herbicide compositions containing new substituted phenoxy-propionates as active agents and process for producing the active agents - Google Patents
Herbicide compositions containing new substituted phenoxy-propionates as active agents and process for producing the active agents Download PDFInfo
- Publication number
- HU189596B HU189596B HU822065A HU206582A HU189596B HU 189596 B HU189596 B HU 189596B HU 822065 A HU822065 A HU 822065A HU 206582 A HU206582 A HU 206582A HU 189596 B HU189596 B HU 189596B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- defined above
- alkyl
- halogen
- optionally
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 29
- 238000000034 method Methods 0.000 title claims description 29
- 239000000203 mixture Substances 0.000 title claims description 23
- SXERGJJQSKIUIC-UHFFFAOYSA-N 2-Phenoxypropionic acid Chemical class OC(=O)C(C)OC1=CC=CC=C1 SXERGJJQSKIUIC-UHFFFAOYSA-N 0.000 title claims description 4
- 239000004009 herbicide Substances 0.000 title description 2
- 239000013543 active substance Substances 0.000 title 2
- -1 Nitro- Chemical class 0.000 claims abstract description 101
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 27
- 150000002367 halogens Chemical class 0.000 claims abstract description 20
- 125000005843 halogen group Chemical group 0.000 claims abstract description 15
- 150000001875 compounds Chemical class 0.000 claims description 84
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 66
- 239000001257 hydrogen Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 17
- 239000003085 diluting agent Substances 0.000 claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- 239000000843 powder Substances 0.000 claims description 13
- 239000004480 active ingredient Substances 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 11
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 6
- 239000000969 carrier Substances 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 239000002516 radical scavenger Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 4
- 238000009472 formulation Methods 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 3
- 229920000151 polyglycol Polymers 0.000 claims description 3
- 239000010695 polyglycol Substances 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 239000003513 alkali Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 239000002480 mineral oil Substances 0.000 claims description 2
- 239000004575 stone Substances 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- HKROQOWBHZLRCU-UHFFFAOYSA-N 2,2-diphenoxypropanoic acid Chemical class C=1C=CC=CC=1OC(C(O)=O)(C)OC1=CC=CC=C1 HKROQOWBHZLRCU-UHFFFAOYSA-N 0.000 claims 1
- WYYFNMXLUUHRAU-UHFFFAOYSA-N 2-phenoxy-2-pyridin-2-yloxypropanoic acid Chemical class C=1C=CC=NC=1OC(C(O)=O)(C)OC1=CC=CC=C1 WYYFNMXLUUHRAU-UHFFFAOYSA-N 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- 150000003871 sulfonates Chemical class 0.000 claims 1
- WROZTZHKRRNHBS-UHFFFAOYSA-N phenyl propaneperoxoate Chemical compound CCC(=O)OOC1=CC=CC=C1 WROZTZHKRRNHBS-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 36
- 125000001309 chloro group Chemical group Cl* 0.000 description 20
- 239000000243 solution Substances 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- FJFSSESWAFPCSU-UHFFFAOYSA-N 4-[4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 FJFSSESWAFPCSU-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 231100000674 Phytotoxicity Toxicity 0.000 description 8
- 239000008187 granular material Substances 0.000 description 8
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 8
- 125000005059 halophenyl group Chemical group 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000002689 soil Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- CUZKCNWZBXLAJX-UHFFFAOYSA-N 2-phenylmethoxyethanol Chemical compound OCCOCC1=CC=CC=C1 CUZKCNWZBXLAJX-UHFFFAOYSA-N 0.000 description 5
- UTALIXJUDXOJIW-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-bromopropanoate Chemical compound CC(Br)C(=O)OCCOCC1=CC=CC=C1 UTALIXJUDXOJIW-UHFFFAOYSA-N 0.000 description 5
- 241000621105 Elymus tsukushiensis Species 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 239000004471 Glycine Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- KJBPYIUAQLPHJG-UHFFFAOYSA-N 1-phenylmethoxypropan-2-ol Chemical compound CC(O)COCC1=CC=CC=C1 KJBPYIUAQLPHJG-UHFFFAOYSA-N 0.000 description 4
- NWFAJOGQUGZVOS-UHFFFAOYSA-N 4-(3,5-dichloropyridin-2-yl)oxyphenol Chemical compound C1=CC(O)=CC=C1OC1=NC=C(Cl)C=C1Cl NWFAJOGQUGZVOS-UHFFFAOYSA-N 0.000 description 4
- UVYGCWPVJVUBJK-UHFFFAOYSA-N CC(Cl)C(=O)OCCOCC1=CC=CC=C1 Chemical compound CC(Cl)C(=O)OCCOCC1=CC=CC=C1 UVYGCWPVJVUBJK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 206010029897 Obsessive thoughts Diseases 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 244000038559 crop plants Species 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000012467 final product Substances 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- MCVIDUDFKDIJMZ-UHFFFAOYSA-N 2-[(2,6-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=C(Cl)C=CC=C1Cl MCVIDUDFKDIJMZ-UHFFFAOYSA-N 0.000 description 3
- QWKQPDIBDYVUIZ-UHFFFAOYSA-N 2-[(4-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C=C1 QWKQPDIBDYVUIZ-UHFFFAOYSA-N 0.000 description 3
- ILLHORFDXDLILE-UHFFFAOYSA-N 2-bromopropanoyl bromide Chemical compound CC(Br)C(Br)=O ILLHORFDXDLILE-UHFFFAOYSA-N 0.000 description 3
- LCLUFLRXLOHWHN-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-(4-hydroxyphenoxy)propanoate Chemical compound C=1C=CC=CC=1COCCOC(=O)C(C)OC1=CC=C(O)C=C1 LCLUFLRXLOHWHN-UHFFFAOYSA-N 0.000 description 3
- 241000209136 Agropyron Species 0.000 description 3
- 235000003911 Arachis Nutrition 0.000 description 3
- 244000105624 Arachis hypogaea Species 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 3
- 244000052363 Cynodon dactylon Species 0.000 description 3
- 235000017896 Digitaria Nutrition 0.000 description 3
- 241001303487 Digitaria <clam> Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- 235000009438 Gossypium Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000219843 Pisum Species 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- 235000008515 Setaria glauca Nutrition 0.000 description 3
- 244000010062 Setaria pumila Species 0.000 description 3
- 240000003461 Setaria viridis Species 0.000 description 3
- 235000002248 Setaria viridis Nutrition 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000006501 nitrophenyl group Chemical group 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 2
- WCMHEWRMRSJVHY-UHFFFAOYSA-N 2-[(2,4-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C=C1Cl WCMHEWRMRSJVHY-UHFFFAOYSA-N 0.000 description 2
- WGPCGEJBQSXQRF-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1F WGPCGEJBQSXQRF-UHFFFAOYSA-N 0.000 description 2
- IFPCMFBCDKXOSS-UHFFFAOYSA-N 2-[(3,4-dichlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(Cl)C(Cl)=C1 IFPCMFBCDKXOSS-UHFFFAOYSA-N 0.000 description 2
- NADUNELKTNMTOZ-UHFFFAOYSA-N 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=NC=C(Cl)C=C1Cl NADUNELKTNMTOZ-UHFFFAOYSA-N 0.000 description 2
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical compound CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 description 2
- CEGDBSAPVKSQJI-UHFFFAOYSA-N 2-phenylmethoxyethyl 2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical compound C=1C=CC=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 CEGDBSAPVKSQJI-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- FUCYABRIJPUVAT-UHFFFAOYSA-N 3-phenylmethoxypropan-1-ol Chemical compound OCCCOCC1=CC=CC=C1 FUCYABRIJPUVAT-UHFFFAOYSA-N 0.000 description 2
- AJIHBUNFLVGSRK-UHFFFAOYSA-N 4-(4-bromo-2-chlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Br)C=C1Cl AJIHBUNFLVGSRK-UHFFFAOYSA-N 0.000 description 2
- XKBVEHVQDYRJCW-UHFFFAOYSA-N 4-[2-chloro-4-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1Cl XKBVEHVQDYRJCW-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 241000189415 Alopecurus aequalis Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 241000209761 Avena Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000132536 Cirsium Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 229920001732 Lignosulfonate Polymers 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 241000209117 Panicum Species 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 2
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000207763 Solanum Species 0.000 description 2
- 235000002634 Solanum Nutrition 0.000 description 2
- 241000209072 Sorghum Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000004088 foaming agent Substances 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000000466 oxiranyl group Chemical group 0.000 description 2
- QULYNCCPRWKEMF-UHFFFAOYSA-N parachlorobenzotrifluoride Chemical compound FC(F)(F)C1=CC=C(Cl)C=C1 QULYNCCPRWKEMF-UHFFFAOYSA-N 0.000 description 2
- 230000000291 postprandial effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- JEQDSBVHLKBEIZ-REOHCLBHSA-N (2s)-2-chloropropanoyl chloride Chemical compound C[C@H](Cl)C(Cl)=O JEQDSBVHLKBEIZ-REOHCLBHSA-N 0.000 description 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- VPGSXIKVUASQIY-UHFFFAOYSA-N 1,2-dibutylnaphthalene Chemical compound C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 VPGSXIKVUASQIY-UHFFFAOYSA-N 0.000 description 1
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DYBYUWVMLBBEMA-UHFFFAOYSA-N 1,4-dichloro-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(Cl)=CC=C1Cl DYBYUWVMLBBEMA-UHFFFAOYSA-N 0.000 description 1
- PNCZKUWEKXLJAF-UHFFFAOYSA-N 1-[(2-methylphenyl)methoxy]ethanol Chemical compound CC(O)OCC1=CC=CC=C1C PNCZKUWEKXLJAF-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- DGRVQOKCSKDWIH-UHFFFAOYSA-N 1-chloro-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1Cl DGRVQOKCSKDWIH-UHFFFAOYSA-N 0.000 description 1
- RJCGZNCCVKIBHO-UHFFFAOYSA-N 1-chloro-4-fluorobenzene Chemical compound FC1=CC=C(Cl)C=C1 RJCGZNCCVKIBHO-UHFFFAOYSA-N 0.000 description 1
- RECMXJOGNNTEBG-UHFFFAOYSA-N 1-phenylmethoxyethanol Chemical compound CC(O)OCC1=CC=CC=C1 RECMXJOGNNTEBG-UHFFFAOYSA-N 0.000 description 1
- SKIYXKPTNHRGRG-UHFFFAOYSA-N 2-[(2,6-dichlorophenyl)methoxy]ethyl 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoate Chemical compound ClC=1C=CC=C(Cl)C=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 SKIYXKPTNHRGRG-UHFFFAOYSA-N 0.000 description 1
- PJWBNHPIMROMAC-UHFFFAOYSA-N 2-[(2-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1Cl PJWBNHPIMROMAC-UHFFFAOYSA-N 0.000 description 1
- SIFAJKGTJJTJCJ-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]ethyl 2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical compound C=1C=CC=C(F)C=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 SIFAJKGTJJTJCJ-UHFFFAOYSA-N 0.000 description 1
- TUACQCVHBZGPSE-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methoxy]ethanol Chemical compound COC1=CC=CC=C1COCCO TUACQCVHBZGPSE-UHFFFAOYSA-N 0.000 description 1
- NNAYEKVPAWDFCP-UHFFFAOYSA-N 2-[(3-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC(Cl)=C1 NNAYEKVPAWDFCP-UHFFFAOYSA-N 0.000 description 1
- FLIXRDQRQILWKE-UHFFFAOYSA-N 2-[(4-chlorophenyl)methoxy]ethyl 2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical compound C=1C=C(Cl)C=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 FLIXRDQRQILWKE-UHFFFAOYSA-N 0.000 description 1
- NFVKGIBDPOVUBA-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=C(F)C=C1 NFVKGIBDPOVUBA-UHFFFAOYSA-N 0.000 description 1
- NLHZEVIHCLBCDK-UHFFFAOYSA-N 2-[(4-fluorophenyl)methoxy]ethyl 2-[4-(3,5-dichloropyridin-2-yl)oxyphenoxy]propanoate Chemical compound C=1C=C(F)C=CC=1COCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=NC=C(Cl)C=C1Cl NLHZEVIHCLBCDK-UHFFFAOYSA-N 0.000 description 1
- PHXZOQVBYCJBHO-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methoxy]ethanol Chemical compound COC1=CC=C(COCCO)C=C1 PHXZOQVBYCJBHO-UHFFFAOYSA-N 0.000 description 1
- VOTIBUBWWVMJIZ-UHFFFAOYSA-N 2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride Chemical compound C1=CC(OC(C)C(Cl)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=C1 VOTIBUBWWVMJIZ-UHFFFAOYSA-N 0.000 description 1
- BWCRDMRLKBPUTD-UHFFFAOYSA-N 2-phenylmethoxypropan-1-ol Chemical compound OCC(C)OCC1=CC=CC=C1 BWCRDMRLKBPUTD-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- WEMZLVCDMCFMJO-UHFFFAOYSA-N 3-[4-(2,4-dichlorophenoxy)phenoxy]propanoyl chloride Chemical compound C1=CC(OCCC(=O)Cl)=CC=C1OC1=CC=C(Cl)C=C1Cl WEMZLVCDMCFMJO-UHFFFAOYSA-N 0.000 description 1
- YOVZBRJIUFHSEM-UHFFFAOYSA-N 3-phenylmethoxypropyl 2-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate Chemical compound C=1C=CC=CC=1COCCCOC(=O)C(C)OC(C=C1)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 YOVZBRJIUFHSEM-UHFFFAOYSA-N 0.000 description 1
- DPRSKCAGYLXDCY-UHFFFAOYSA-N 4-(2,4-dichlorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1Cl DPRSKCAGYLXDCY-UHFFFAOYSA-N 0.000 description 1
- VPNNDIAAGGTJQN-UHFFFAOYSA-N 4-(2-chloro-4-nitrophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1Cl VPNNDIAAGGTJQN-UHFFFAOYSA-N 0.000 description 1
- KIVFDFJTCRMULF-UHFFFAOYSA-N 4-(4-fluorophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(F)C=C1 KIVFDFJTCRMULF-UHFFFAOYSA-N 0.000 description 1
- DCCDSAOUQRQDEL-UHFFFAOYSA-N 4-(4-nitrophenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 DCCDSAOUQRQDEL-UHFFFAOYSA-N 0.000 description 1
- PAVKZCYKRPHZIQ-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1C(F)(F)F PAVKZCYKRPHZIQ-UHFFFAOYSA-N 0.000 description 1
- ODMMFEGUNKFXLV-UHFFFAOYSA-N 4-[4-chloro-2-(trifluoromethyl)phenoxy]phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(Cl)C=C1C(F)(F)F ODMMFEGUNKFXLV-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 241000234282 Allium Species 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000005340 Asparagus officinalis Nutrition 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 244000024469 Cucumis prophetarum Species 0.000 description 1
- 235000010071 Cucumis prophetarum Nutrition 0.000 description 1
- 241000219122 Cucurbita Species 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000320605 Dactyloctenium Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 241000208175 Daucus Species 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 235000001950 Elaeis guineensis Nutrition 0.000 description 1
- 244000127993 Elaeis melanococca Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 244000294661 Emex spinosa Species 0.000 description 1
- 235000006369 Emex spinosa Nutrition 0.000 description 1
- 244000165918 Eucalyptus papuana Species 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241001290564 Fimbristylis Species 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 241001327265 Ischaemum Species 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 241000064140 Lindernia Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- 235000002262 Lycopersicon Nutrition 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 241000208125 Nicotiana Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241001268782 Paspalum dilatatum Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241000209051 Saccharum Species 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 244000275012 Sesbania cannabina Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 240000002439 Sorghum halepense Species 0.000 description 1
- 244000273618 Sphenoclea zeylanica Species 0.000 description 1
- 235000017967 Sphenoclea zeylanica Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 206010042496 Sunburn Diseases 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241001506766 Xanthium Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 244000193174 agave Species 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 125000005108 alkenylthio group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- KMHJKRGRIJONSV-UHFFFAOYSA-N dioxygen(.1+) Chemical compound [O+]=O KMHJKRGRIJONSV-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- ILYSHPJWNMPBPE-UHFFFAOYSA-N ethyl 2-(4-hydroxyphenoxy)propanoate Chemical compound CCOC(=O)C(C)OC1=CC=C(O)C=C1 ILYSHPJWNMPBPE-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- QPPQHRDVPBTVEV-UHFFFAOYSA-N isopropyl dihydrogen phosphate Chemical compound CC(C)OP(O)(O)=O QPPQHRDVPBTVEV-UHFFFAOYSA-N 0.000 description 1
- 230000002015 leaf growth Effects 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9748681A JPS57212144A (en) | 1981-06-25 | 1981-06-25 | Substituted phenoxypropionic ester, its preparation, and herbicide |
| JP56144778A JPS5849364A (ja) | 1981-09-16 | 1981-09-16 | 置換フエノキシプロピオン酸エステル、その製法及び除草剤 |
| JP19560481A JPS5899438A (ja) | 1981-12-07 | 1981-12-07 | 2−ハロゲノプロピオン酸エステルおよびその製法 |
| JP56195605A JPS5899440A (ja) | 1981-12-07 | 1981-12-07 | 置換フエノキシプロピオン酸エステルの製法、並びにその製造中間体及び該中間体の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189596B true HU189596B (en) | 1986-07-28 |
Family
ID=27468546
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU822065A HU189596B (en) | 1981-06-25 | 1982-06-25 | Herbicide compositions containing new substituted phenoxy-propionates as active agents and process for producing the active agents |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US4441913A (Direct) |
| EP (1) | EP0068260B1 (Direct) |
| AU (1) | AU556522B2 (Direct) |
| BR (1) | BR8203706A (Direct) |
| CA (1) | CA1175839A (Direct) |
| DD (1) | DD202087A5 (Direct) |
| DE (1) | DE3269600D1 (Direct) |
| DK (1) | DK285782A (Direct) |
| ES (4) | ES513476A0 (Direct) |
| GR (1) | GR76837B (Direct) |
| HU (1) | HU189596B (Direct) |
| IL (1) | IL66096A (Direct) |
| PH (1) | PH18417A (Direct) |
| PT (1) | PT75053B (Direct) |
| TR (1) | TR21452A (Direct) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4561882A (en) * | 1981-06-05 | 1985-12-31 | Zoecon Corporation | 3-Alkoxy-4-substituted-phenoxy-2,3-unsaturated acid esters and derivatives thereof and the use thereof for the control of weeds |
| JPS58183666A (ja) * | 1982-04-20 | 1983-10-26 | Nippon Tokushu Noyaku Seizo Kk | 置換フエノキシプロピオン酸エステル、その製造中間体、該エステル及び該中間体の製法、並びに除草剤 |
| DE3247929A1 (de) * | 1982-12-24 | 1984-07-12 | Bayer Ag, 5090 Leverkusen | Phenoxypropionsaeure-derivate |
| DE3247930A1 (de) * | 1982-12-24 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Optisch aktive phenoxypropionsaeure-derivate |
| JPS59172440A (ja) * | 1983-03-23 | 1984-09-29 | Nippon Tokushu Noyaku Seizo Kk | 置換フエノキシプロピオン酸エステル及びその中間体、それらの製法並びに除草剤 |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| US4661617A (en) * | 1985-04-19 | 1987-04-28 | Sandoz Ltd. | Novel compositions |
| DE3875546T2 (de) * | 1987-08-05 | 1993-03-11 | Dowelanco | Herbizide fluorphenoxy-phenoxyalkancarbonsaeure und ihre derivate. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3282991A (en) * | 1963-10-29 | 1966-11-01 | Tenneco Chem | Alkyldichlorobenzoic acids |
| DE2611695A1 (de) * | 1976-03-19 | 1977-09-29 | Hoechst Ag | Herbizide mittel |
| DE2909816A1 (de) * | 1978-03-16 | 1979-09-27 | Ciba Geigy Ag | Bis-pyridyloxy-phenoxy-propionsaeureester |
-
1982
- 1982-05-31 PH PH27376A patent/PH18417A/en unknown
- 1982-06-14 DE DE8282105172T patent/DE3269600D1/de not_active Expired
- 1982-06-14 EP EP82105172A patent/EP0068260B1/de not_active Expired
- 1982-06-15 PT PT75053A patent/PT75053B/pt unknown
- 1982-06-17 US US06/389,525 patent/US4441913A/en not_active Expired - Fee Related
- 1982-06-22 IL IL66096A patent/IL66096A/xx unknown
- 1982-06-22 AU AU85091/82A patent/AU556522B2/en not_active Ceased
- 1982-06-22 DD DD82240964A patent/DD202087A5/de unknown
- 1982-06-23 GR GR68546A patent/GR76837B/el unknown
- 1982-06-23 TR TR21452A patent/TR21452A/xx unknown
- 1982-06-23 CA CA000405784A patent/CA1175839A/en not_active Expired
- 1982-06-24 BR BR8203706A patent/BR8203706A/pt unknown
- 1982-06-24 DK DK285782A patent/DK285782A/da not_active Application Discontinuation
- 1982-06-25 ES ES513476A patent/ES513476A0/es active Granted
- 1982-06-25 HU HU822065A patent/HU189596B/hu unknown
-
1983
- 1983-05-12 ES ES522323A patent/ES8406999A1/es not_active Expired
- 1983-05-12 ES ES83522322A patent/ES522322A0/es active Granted
- 1983-05-12 ES ES522324A patent/ES522324A0/es active Granted
- 1983-12-12 US US06/546,216 patent/US4584396A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES8406998A1 (es) | 1984-08-16 |
| ES522323A0 (es) | 1984-08-16 |
| EP0068260A2 (de) | 1983-01-05 |
| ES8406999A1 (es) | 1984-08-16 |
| ES522322A0 (es) | 1984-08-16 |
| DD202087A5 (de) | 1983-08-31 |
| TR21452A (tr) | 1984-06-05 |
| DK285782A (da) | 1982-12-26 |
| US4441913A (en) | 1984-04-10 |
| PT75053B (en) | 1983-12-28 |
| ES8407001A1 (es) | 1984-08-16 |
| IL66096A (en) | 1985-04-30 |
| AU8509182A (en) | 1983-01-06 |
| ES8307708A1 (es) | 1983-08-16 |
| CA1175839A (en) | 1984-10-09 |
| ES522324A0 (es) | 1984-08-16 |
| PH18417A (en) | 1985-06-24 |
| IL66096A0 (en) | 1982-09-30 |
| EP0068260A3 (en) | 1983-05-25 |
| GR76837B (Direct) | 1984-09-04 |
| EP0068260B1 (de) | 1986-03-05 |
| AU556522B2 (en) | 1986-11-06 |
| ES513476A0 (es) | 1983-08-16 |
| PT75053A (en) | 1982-07-01 |
| US4584396A (en) | 1986-04-22 |
| DE3269600D1 (en) | 1986-04-10 |
| BR8203706A (pt) | 1983-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3157234B2 (ja) | 除草性カルボキシアミド誘導体 | |
| CA1101867A (en) | Phenoxy-alkanecarboxylic acid derivatives, their production, and their use | |
| JPH08501100A (ja) | 除草性ベンゼン化合物 | |
| BG61516B2 (bg) | Пропинилов естер на 2-/4-(5-хлоро-3-флуоропиридин-2-илокси) фенокси/-пропионовата киселина и приложението й | |
| HU181666B (en) | Herbicide compositions and process for preparing the unsaturated esters of alpha-/4-/3',5'-dihalo-pyridyl-2'-oxy/-phenoxy/-propionic acids and -propionic-thiolacids applied as active substances | |
| US6251829B1 (en) | Herbicidal benzoyloxy carboxylates and carboxamides | |
| EP0288275A2 (en) | Phenoxypropionic acid derivatives for use as herbicides | |
| HU189596B (en) | Herbicide compositions containing new substituted phenoxy-propionates as active agents and process for producing the active agents | |
| US4477276A (en) | Heterocyclic phenyl ethers and their herbicidal use | |
| JPH0421672B2 (Direct) | ||
| US4384881A (en) | Herbicidally active novel benzazol-2-yloxyacetanilides | |
| HU182939B (en) | Herbicide compositions containing o-bracket-pyridyl-oxy-phenyl-bracket closed-lactic acid esters and process for producing the active agents | |
| US4402731A (en) | Herbicidally active novel substituted tetrahydropyrimidinones | |
| HU190748B (en) | Herbicide compositions containing opically active phenoxy - propionic acid derivatives as active agents and process for producing the active agents | |
| US4391629A (en) | 2-Pyridyloxyacetanilides and their use as herbicides | |
| CS236791B2 (en) | Herbicide agent and processing method of active component | |
| EP0052473B1 (en) | N-substituted phenyl-1-methylcyclopropanecarboxamides, their production and use | |
| KR880002413B1 (ko) | 페녹시프로피오네이트 제조방법 | |
| JPS6314711B2 (Direct) | ||
| EP0037527A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| US5346880A (en) | Herbicidally active pyrimidinylthioalkane derivatives | |
| US4431441A (en) | Pyrazolyl acrylates and herbicidal use | |
| JPH05132473A (ja) | シアノチアゾール誘導体 | |
| HU188427B (en) | Herbicide compositions and process for producing methyl-tetrahydro-2-pyrimidinone derivatives as active agents | |
| KR840002302B1 (ko) | 알칸카르복실산 유도체의 제조방법 |