HU189545B - Process for producing 2-oxo-azetidine derivatives - Google Patents
Process for producing 2-oxo-azetidine derivatives Download PDFInfo
- Publication number
- HU189545B HU189545B HU813576A HU357681A HU189545B HU 189545 B HU189545 B HU 189545B HU 813576 A HU813576 A HU 813576A HU 357681 A HU357681 A HU 357681A HU 189545 B HU189545 B HU 189545B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- group
- oxoazetidine
- alkyl
- added
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 43
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 title claims description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 103
- 150000003839 salts Chemical class 0.000 claims abstract description 40
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 39
- 125000003277 amino group Chemical group 0.000 claims abstract description 20
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 9
- 108090000204 Dipeptidase 1 Proteins 0.000 claims abstract description 8
- 230000000845 anti-microbial effect Effects 0.000 claims abstract description 8
- 102000006635 beta-lactamase Human genes 0.000 claims abstract description 8
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 8
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 4
- 238000004519 manufacturing process Methods 0.000 claims abstract 4
- -1 p-nitrobenzyloxycarbonyl Chemical group 0.000 claims description 505
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 81
- 125000000217 alkyl group Chemical group 0.000 claims description 61
- 125000004432 carbon atom Chemical group C* 0.000 claims description 46
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 239000007858 starting material Substances 0.000 claims description 16
- 125000002252 acyl group Chemical group 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 239000008194 pharmaceutical composition Substances 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000005518 carboxamido group Chemical group 0.000 claims description 7
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000005596 alkyl carboxamido group Chemical group 0.000 claims description 3
- 125000005103 alkyl silyl group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims 5
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 4
- 239000004599 antimicrobial Substances 0.000 claims 3
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims 2
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 claims 1
- WDXDODPFZOCRCW-UHFFFAOYSA-N 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[(2-methylsulfanyl-4-oxo-1-sulfoazetidin-3-yl)amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid Chemical compound O=C1N(S(O)(=O)=O)C(SC)C1NC(=O)C(=NOC(C)(C)C(O)=O)C1=CSC(N)=N1 WDXDODPFZOCRCW-UHFFFAOYSA-N 0.000 claims 1
- BJBGFQIOZMZVFB-UHFFFAOYSA-N 3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid Chemical compound C=1SC(N)=NC=1C(=NOC)C(=O)NC1C(SC)N(S(O)(=O)=O)C1=O BJBGFQIOZMZVFB-UHFFFAOYSA-N 0.000 claims 1
- GOFQXMKTAKIGQV-UHFFFAOYSA-N [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-(2-carboxypropan-2-yloxyimino)acetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]-diazonioazanide Chemical compound C=1SC(N)=NC=1C(=NOC(C)(C)C(O)=O)C(=O)NC1C(N=[N+]=[N-])N(S(O)(=O)=O)C1=O GOFQXMKTAKIGQV-UHFFFAOYSA-N 0.000 claims 1
- 239000002671 adjuvant Substances 0.000 claims 1
- 125000005431 alkyl carboxamide group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 125000001188 haloalkyl group Chemical group 0.000 claims 1
- 150000002148 esters Chemical class 0.000 abstract description 8
- CDFGMYLBUSYTKQ-UHFFFAOYSA-N 2-oxoazetidine-1-sulfonic acid Chemical class OS(=O)(=O)N1CCC1=O CDFGMYLBUSYTKQ-UHFFFAOYSA-N 0.000 abstract description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 534
- 239000000243 solution Substances 0.000 description 283
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 255
- 239000011541 reaction mixture Substances 0.000 description 213
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 206
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 183
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 181
- 239000000203 mixture Substances 0.000 description 180
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 174
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 151
- 125000003118 aryl group Chemical group 0.000 description 115
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 108
- 238000002329 infrared spectrum Methods 0.000 description 106
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- 238000001816 cooling Methods 0.000 description 74
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 73
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 73
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 72
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 63
- AFDQGRURHDVABZ-UHFFFAOYSA-N n,n-dimethylformamide;sulfur trioxide Chemical compound O=S(=O)=O.CN(C)C=O AFDQGRURHDVABZ-UHFFFAOYSA-N 0.000 description 62
- 238000005481 NMR spectroscopy Methods 0.000 description 59
- 159000000000 sodium salts Chemical class 0.000 description 59
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 58
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- 239000000706 filtrate Substances 0.000 description 42
- 239000002904 solvent Substances 0.000 description 38
- 238000003756 stirring Methods 0.000 description 34
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- 239000003480 eluent Substances 0.000 description 32
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 30
- AFCCDDWKHLHPDF-UHFFFAOYSA-M metam-sodium Chemical compound [Na+].CNC([S-])=S AFCCDDWKHLHPDF-UHFFFAOYSA-M 0.000 description 30
- 238000010898 silica gel chromatography Methods 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 24
- 239000011347 resin Substances 0.000 description 24
- 229920005989 resin Polymers 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 23
- 239000000741 silica gel Substances 0.000 description 23
- 229910002027 silica gel Inorganic materials 0.000 description 23
- 229940126062 Compound A Drugs 0.000 description 22
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 238000004587 chromatography analysis Methods 0.000 description 20
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 19
- 239000000725 suspension Substances 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 17
- 239000002253 acid Substances 0.000 description 17
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 17
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 17
- 239000002198 insoluble material Substances 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 16
- 239000013078 crystal Substances 0.000 description 16
- 125000006239 protecting group Chemical group 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 235000017557 sodium bicarbonate Nutrition 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- 238000001228 spectrum Methods 0.000 description 13
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- IJACXBZIXLEOPK-GGAORHGYSA-N [(2s,3s)-4-oxo-3-(tritylamino)azetidin-2-yl] acetate Chemical compound CC(=O)O[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 IJACXBZIXLEOPK-GGAORHGYSA-N 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 11
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 11
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 10
- 235000011054 acetic acid Nutrition 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 9
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 9
- JVFVSVLCXCDOPD-UHFFFAOYSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(=O)CCl)=N1 JVFVSVLCXCDOPD-UHFFFAOYSA-N 0.000 description 8
- 238000005917 acylation reaction Methods 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000005051 trimethylchlorosilane Substances 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 238000000746 purification Methods 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- PNWJHMNWFRMQKF-UHFFFAOYSA-N 4-ethyl-2,3-dioxopiperazine-1-carboxamide Chemical compound CCN1CCN(C(N)=O)C(=O)C1=O PNWJHMNWFRMQKF-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 6
- 230000010933 acylation Effects 0.000 description 6
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 6
- 238000010511 deprotection reaction Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 6
- VONQTDZQDYVTEV-UHFFFAOYSA-M sodium 2-oxoazetidine-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)N1CCC1=O VONQTDZQDYVTEV-UHFFFAOYSA-M 0.000 description 6
- JQEHQELQPPKXRR-LLVKDONJSA-N (2r)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetic acid Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 JQEHQELQPPKXRR-LLVKDONJSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- HTWSUTFJYFUSDS-SKDRFNHKSA-N [(2s,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@H](OC(C)=O)NC1=O HTWSUTFJYFUSDS-SKDRFNHKSA-N 0.000 description 5
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 125000001841 imino group Chemical group [H]N=* 0.000 description 5
- 150000007530 organic bases Chemical class 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- QSMGUTWCBAOBCD-UHFFFAOYSA-M sodium azetidine-1-sulfonate Chemical compound [Na+].N1(CCC1)S(=O)(=O)[O-] QSMGUTWCBAOBCD-UHFFFAOYSA-M 0.000 description 5
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- 239000004246 zinc acetate Substances 0.000 description 5
- AHYYPIXVIWSSAE-UJKLMHGXSA-N (3r,4r)-3-amino-4-methylsulfanylazetidin-2-one;4-methylbenzenesulfonic acid Chemical compound CS[C@H]1NC(=O)[C@H]1N.CC1=CC=C(S(O)(=O)=O)C=C1 AHYYPIXVIWSSAE-UJKLMHGXSA-N 0.000 description 4
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000003115 biocidal effect Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- DOPUXCOYNJWBME-VQTJNVASSA-N diazonio-[(2r,3s)-4-oxo-3-(tritylamino)azetidin-2-yl]azanide Chemical compound [N-]=[N+]=N[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 DOPUXCOYNJWBME-VQTJNVASSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000007529 inorganic bases Chemical class 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- YSVZADAAWQNYCF-UHFFFAOYSA-N methylsulfanylmethane;sodium Chemical compound [Na].CSC YSVZADAAWQNYCF-UHFFFAOYSA-N 0.000 description 4
- 150000007522 mineralic acids Chemical class 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- ZBZYMXHTRAAATC-IRLDBZIGSA-N (3r,4s)-4-methylsulfanyl-3-(tritylamino)azetidin-2-one Chemical compound CS[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZBZYMXHTRAAATC-IRLDBZIGSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RCKOQDGLJNVEQS-SCZZXKLOSA-N [(2s,3s)-3-amino-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl] acetate Chemical compound CC(=O)O[C@H]1[C@H](N)C(=O)N1[Si](C)(C)C(C)(C)C RCKOQDGLJNVEQS-SCZZXKLOSA-N 0.000 description 3
- JOSXTSZPEJSZFT-YPMHNXCESA-N [(2s,3s)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] acetate Chemical compound CC(=O)O[C@@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 JOSXTSZPEJSZFT-YPMHNXCESA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000001539 azetidines Chemical class 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- ZYHWVPDVHWZSSG-UHFFFAOYSA-L disodium 2-oxoazetidine-1-sulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)N1CCC1=O.[O-]S(=O)(=O)N1CCC1=O ZYHWVPDVHWZSSG-UHFFFAOYSA-L 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000002736 metal compounds Chemical class 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- WCBKTLLELNCILY-ZYHUDNBSSA-N n-[(2r,3r)-2-methylsulfonyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CS(=O)(=O)[C@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 WCBKTLLELNCILY-ZYHUDNBSSA-N 0.000 description 3
- ZTNJVYDHNGGQOH-YPMHNXCESA-N n-[(2s,3r)-2-ethylsulfanyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CCS[C@@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 ZTNJVYDHNGGQOH-YPMHNXCESA-N 0.000 description 3
- ZUSSTQCWRDLYJA-UHFFFAOYSA-N n-hydroxy-5-norbornene-2,3-dicarboximide Chemical compound C1=CC2CC1C1C2C(=O)N(O)C1=O ZUSSTQCWRDLYJA-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 3
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- AYQZTQXDNITKRP-IFMALSPDSA-N (3r,4r)-4-methylsulfonyl-3-(tritylamino)azetidin-2-one Chemical compound CS(=O)(=O)[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AYQZTQXDNITKRP-IFMALSPDSA-N 0.000 description 2
- VZFYTPZQMBHCNH-XNMGPUDCSA-N (3r,4r)-4-phenylsulfanyl-3-(tritylamino)azetidin-2-one Chemical compound S([C@H]1NC([C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C=1C=CC=CC=1)=O)C1=CC=CC=C1 VZFYTPZQMBHCNH-XNMGPUDCSA-N 0.000 description 2
- AOBOMZLWAHSFEF-IFMALSPDSA-N (3s,4r)-4-methoxy-3-(tritylamino)azetidin-2-one Chemical compound CO[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AOBOMZLWAHSFEF-IFMALSPDSA-N 0.000 description 2
- XFRZJXHENYWIEC-UHFFFAOYSA-N 1-methylsulfanylazetidin-2-one Chemical compound CSN1CCC1=O XFRZJXHENYWIEC-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- GVZULGMTOHFOIC-LDYMZIIASA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-n-[(2r,3r)-2-methylsulfonyl-4-oxoazetidin-3-yl]acetamide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](S(C)(=O)=O)NC1=O GVZULGMTOHFOIC-LDYMZIIASA-N 0.000 description 2
- ZQKZYYXVQHLGNH-KCJUWKMLSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-n-[(2s,3r)-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@H](SC)NC1=O ZQKZYYXVQHLGNH-KCJUWKMLSA-N 0.000 description 2
- KTZYEBWIFFYNFI-CJNGLKHVSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-n-[(3r,4s)-2-oxo-4-phenylsulfanylazetidin-3-yl]acetamide Chemical compound S([C@H]1[C@@H](C(N1)=O)NC(=O)C(=NOC)C=1N=C(NC(=O)CCl)SC=1)C1=CC=CC=C1 KTZYEBWIFFYNFI-CJNGLKHVSA-N 0.000 description 2
- VFUINRPPSGYCJX-UHFFFAOYSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl chloride;hydrochloride Chemical compound Cl.CON=C(C(Cl)=O)C1=CSC(NC(=O)CCl)=N1 VFUINRPPSGYCJX-UHFFFAOYSA-N 0.000 description 2
- LSDJRBFOXKCGFY-UHFFFAOYSA-N 2-chloro-n-(1,3-thiazol-2-yl)acetamide Chemical compound ClCC(=O)NC1=NC=CS1 LSDJRBFOXKCGFY-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- WIOZPTKQKIKZLI-UHFFFAOYSA-N 2-methylsulfanyl-4-oxoazetidine-1-sulfonic acid Chemical compound O=C1N(C(C1)SC)S(=O)(=O)O WIOZPTKQKIKZLI-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- OAPGTYNZWCOATC-XJKCOSOUSA-N 4-ethyl-N-[(1R)-2-[[(2R,3R)-2-methylsulfonyl-4-oxoazetidin-3-yl]amino]-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide Chemical compound CCN1CCN(C(=O)N[C@@H](C(=O)N[C@H]2[C@H](NC2=O)S(C)(=O)=O)C2=CC=CC=C2)C(=O)C1=O OAPGTYNZWCOATC-XJKCOSOUSA-N 0.000 description 2
- QRXUBAMTDBBVGB-IOASZLSFSA-N 4-ethyl-N-[(1R)-2-[[(2S,3R)-2-methylsulfanyl-4-oxoazetidin-3-yl]amino]-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N[C@H]1SC QRXUBAMTDBBVGB-IOASZLSFSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 241000588697 Enterobacter cloacae Species 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- HYOOAZRITDRFJR-BBXPGFNESA-N N(=[N+]=[N-])[C@@H]1[C@@H](C(N1)=O)NC(CC1(SC=CC1)NC(=O)N1C(C(N(CC1)CC)=O)=O)=O Chemical compound N(=[N+]=[N-])[C@@H]1[C@@H](C(N1)=O)NC(CC1(SC=CC1)NC(=O)N1C(C(N(CC1)CC)=O)=O)=O HYOOAZRITDRFJR-BBXPGFNESA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- AXFZADXWLMXITO-UHFFFAOYSA-N N-acetylcysteamine Chemical compound CC(=O)NCCS AXFZADXWLMXITO-UHFFFAOYSA-N 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- BMPDYAADFJEQAK-CKEIUWERSA-N S-[(2R,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N[C@@H]1SC(C)=O BMPDYAADFJEQAK-CKEIUWERSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- IGWOEQVUOSTMHM-CPUCHLNUSA-N [(2S,3S)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] acetate Chemical compound CCN1CCN(C(=O)N[C@@H](C(=O)N[C@H]2[C@@H](NC2=O)OC(C)=O)C2=CC=CC=C2)C(=O)C1=O IGWOEQVUOSTMHM-CPUCHLNUSA-N 0.000 description 2
- OCIUTSUGQWLMMO-CRAIPNDOSA-N [(2r,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] 2-phenylacetate Chemical compound O([C@@H]1[C@@H](C(N1)=O)NC(=O)C(=NOC)C=1N=C(NC(=O)CCl)SC=1)C(=O)CC1=CC=CC=C1 OCIUTSUGQWLMMO-CRAIPNDOSA-N 0.000 description 2
- HNSKTCSJBGRQIZ-JGVFFNPUSA-N [(2r,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]-diazonioazanide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H]([N-][N+]#N)NC1=O HNSKTCSJBGRQIZ-JGVFFNPUSA-N 0.000 description 2
- RWKLOJNPGDFGNX-MLMRRJNNSA-N [(2s,3s)-3-[(2-bromo-2-phenylacetyl)amino]-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-2-yl] acetate Chemical compound O=C1N([Si](C)(C)C(C)(C)C)[C@@H](OC(=O)C)[C@@H]1NC(=O)C(Br)C1=CC=CC=C1 RWKLOJNPGDFGNX-MLMRRJNNSA-N 0.000 description 2
- OHNGCWLERYAKFP-RISCZKNCSA-N [(2s,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC(C)C)C(=O)N[C@H]1[C@H](OC(C)=O)NC1=O OHNGCWLERYAKFP-RISCZKNCSA-N 0.000 description 2
- HNSKTCSJBGRQIZ-JAMMHHFISA-N [(3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]-diazonioazanide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1C(N=[N+]=[N-])NC1=O HNSKTCSJBGRQIZ-JAMMHHFISA-N 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- KHUNFTAJVUPPCY-UHFFFAOYSA-N azetidine-1-sulfonic acid Chemical compound OS(=O)(=O)N1CCC1 KHUNFTAJVUPPCY-UHFFFAOYSA-N 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 2
- 229960000603 cefalotin Drugs 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- DCFKHNIGBAHNSS-UHFFFAOYSA-N chloro(triethyl)silane Chemical compound CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 description 2
- YCXVDEMHEKQQCI-UHFFFAOYSA-N chloro-dimethyl-propan-2-ylsilane Chemical compound CC(C)[Si](C)(C)Cl YCXVDEMHEKQQCI-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000002458 infectious effect Effects 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- ZTNJVYDHNGGQOH-DGCLKSJQSA-N n-[(2r,3r)-2-ethylsulfanyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CCS[C@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 ZTNJVYDHNGGQOH-DGCLKSJQSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- OFOLIKLWAWXNKP-FYYLOGMGSA-N s-[(2r,3r)-4-oxo-3-(tritylamino)azetidin-2-yl] ethanethioate Chemical compound CC(=O)S[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 OFOLIKLWAWXNKP-FYYLOGMGSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- NQSRLJUWHMTAMC-UKLSQQIQSA-M sodium;(2s,3s)-2-acetyloxy-3-amino-4-oxoazetidine-1-sulfonic acid;acetate Chemical compound [Na+].CC([O-])=O.CC(=O)O[C@H]1[C@H](N)C(=O)N1S(O)(=O)=O NQSRLJUWHMTAMC-UKLSQQIQSA-M 0.000 description 2
- LYPGDCWPTHTUDO-UHFFFAOYSA-M sodium;methanesulfinate Chemical compound [Na+].CS([O-])=O LYPGDCWPTHTUDO-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- KKHOWJDSXBFVRT-GMSGAONNSA-N (2R,3R)-2-(2-aminoethylsulfanyl)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid Chemical compound C=1SC(N)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](SCCN)N(S(O)(=O)=O)C1=O KKHOWJDSXBFVRT-GMSGAONNSA-N 0.000 description 1
- JETQIUPBHQNHNZ-NJBDSQKTSA-N (2s,5r,6r)-3,3-dimethyl-7-oxo-6-[[(2r)-2-phenyl-2-sulfoacetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H](C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)S(O)(=O)=O)=CC=CC=C1 JETQIUPBHQNHNZ-NJBDSQKTSA-N 0.000 description 1
- ATBZAEBLUUQUOG-XJDOXCRVSA-N (3r)-4-fluoro-3-(tritylamino)azetidin-2-one Chemical compound FC1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ATBZAEBLUUQUOG-XJDOXCRVSA-N 0.000 description 1
- ADUOCEHMCXQWCE-VVJJHMBFSA-N (3r,4r)-3-amino-4-methylsulfonylazetidin-2-one Chemical compound CS(=O)(=O)[C@H]1NC(=O)[C@H]1N ADUOCEHMCXQWCE-VVJJHMBFSA-N 0.000 description 1
- ULHZXAQPJZFHCE-FYYLOGMGSA-N (3r,4r)-4-[(4-methyl-5h-tetrazol-1-yl)sulfanyl]-3-(tritylamino)azetidin-2-one Chemical compound N1=NN(C)CN1S[C@@H]1[C@H](NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)N1 ULHZXAQPJZFHCE-FYYLOGMGSA-N 0.000 description 1
- MOZTTZBTRBOIAT-FONMRSAGSA-N (3r,4s)-3-amino-4-methylsulfanylazetidin-2-one Chemical compound CS[C@@H]1NC(=O)[C@H]1N MOZTTZBTRBOIAT-FONMRSAGSA-N 0.000 description 1
- ULHZXAQPJZFHCE-GGAORHGYSA-N (3r,4s)-4-[(4-methyl-5h-tetrazol-1-yl)sulfanyl]-3-(tritylamino)azetidin-2-one Chemical compound N1=NN(C)CN1S[C@H]1[C@H](NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)N1 ULHZXAQPJZFHCE-GGAORHGYSA-N 0.000 description 1
- VZFYTPZQMBHCNH-VPUSJEBWSA-N (3r,4s)-4-phenylsulfanyl-3-(tritylamino)azetidin-2-one Chemical compound S([C@@H]1NC([C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C=1C=CC=CC=1)=O)C1=CC=CC=C1 VZFYTPZQMBHCNH-VPUSJEBWSA-N 0.000 description 1
- ATBZAEBLUUQUOG-FIWHBWSRSA-N (3s)-4-fluoro-3-(tritylamino)azetidin-2-one Chemical compound FC1NC(=O)[C@@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ATBZAEBLUUQUOG-FIWHBWSRSA-N 0.000 description 1
- OEYMQQDJCUHKQS-UHFFFAOYSA-N (4-oxoazetidin-2-yl) acetate Chemical class CC(=O)OC1CC(=O)N1 OEYMQQDJCUHKQS-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KQDQZEZWWRPNQH-UHFFFAOYSA-N 1,3-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1CN2 KQDQZEZWWRPNQH-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 1
- BQXQFUSRUBQNOH-UHFFFAOYSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[2-methyl-1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]oxyiminoacetic acid Chemical compound C[Si](C)(C)CCOC(=O)C(C)(C)ON=C(C(O)=O)C1=CSC(NC(=O)CCl)=N1 BQXQFUSRUBQNOH-UHFFFAOYSA-N 0.000 description 1
- ZQKZYYXVQHLGNH-LDYMZIIASA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyimino-n-[(2r,3r)-2-methylsulfanyl-4-oxoazetidin-3-yl]acetamide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](SC)NC1=O ZQKZYYXVQHLGNH-LDYMZIIASA-N 0.000 description 1
- WONGWASOKZNYNK-UHFFFAOYSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-n-(2-fluoro-4-oxoazetidin-3-yl)-2-methoxyiminoacetamide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)NC1C(F)NC1=O WONGWASOKZNYNK-UHFFFAOYSA-N 0.000 description 1
- SXOZVGHXQYRWLT-CJNGLKHVSA-N 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-n-[(2s,3r)-2-cyclohexylsulfanyl-4-oxoazetidin-3-yl]-2-methoxyiminoacetamide Chemical compound S([C@H]1[C@@H](C(N1)=O)NC(=O)C(=NOC)C=1N=C(NC(=O)CCl)SC=1)C1CCCCC1 SXOZVGHXQYRWLT-CJNGLKHVSA-N 0.000 description 1
- IAMBCEMERNRGFN-ZWNOBZJWSA-N 2-[[2-[[(2r,3r)-2-(2-acetamidoethylsulfanyl)-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid Chemical compound O=C1N(S(O)(=O)=O)[C@H](SCCNC(=O)C)[C@@H]1NC(=O)C(=NOC(C)(C)C(O)=O)C1=CSC(N)=N1 IAMBCEMERNRGFN-ZWNOBZJWSA-N 0.000 description 1
- LEVZBWKEPIZXBQ-UHFFFAOYSA-N 2-[[carboxy-[2-(tritylamino)-1,3-thiazol-4-yl]methylidene]amino]oxy-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)ON=C(C(O)=O)C1=CSC(NC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=N1 LEVZBWKEPIZXBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- PHJIKEFBFYEHKR-SKDRFNHKSA-N 2-methoxyimino-N-[(2S,3R)-2-methylsulfanyl-4-oxoazetidin-3-yl]-2-[2-(propanethioylamino)-1,3-thiazol-4-yl]acetamide Chemical compound CS[C@H]1[C@@H](C(N1)=O)NC(C(=NOC)C=1N=C(SC1)NC(CC)=S)=O PHJIKEFBFYEHKR-SKDRFNHKSA-N 0.000 description 1
- QQKAZZAULUMMKR-UHFFFAOYSA-N 2-n-hydroxybenzene-1,2-dicarboxamide Chemical compound NC(=O)C1=CC=CC=C1C(=O)NO QQKAZZAULUMMKR-UHFFFAOYSA-N 0.000 description 1
- WCQCELYGZBVPPC-UHFFFAOYSA-N 2-oxoimidazolidine-1-sulfonic acid Chemical compound O=C1NCCN1S(=O)(=O)O WCQCELYGZBVPPC-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- RJRMJUAGZCZPOK-YLJYHZDGSA-N 2-trimethylsilylethyl 2-[[2-[[(2r,3r)-2-(2-acetamidoethylsulfanyl)-4-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate Chemical compound CC(=O)NCCS[C@H]1NC(=O)[C@H]1NC(=O)C(=NOC(C)(C)C(=O)OCC[Si](C)(C)C)C1=CSC(NC(=O)CCl)=N1 RJRMJUAGZCZPOK-YLJYHZDGSA-N 0.000 description 1
- BTEQQLFQAPLTLI-UHFFFAOYSA-N 2-trimethylsilylethyl carbonochloridate Chemical compound C[Si](C)(C)CCOC(Cl)=O BTEQQLFQAPLTLI-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- ZUYZLPVPFRKUHW-IOASZLSFSA-N 4-ethyl-N-[(1R)-2-[[(2S,3S)-2-methoxy-4-oxoazetidin-3-yl]amino]-2-oxo-1-phenylethyl]-2,3-dioxopiperazine-1-carboxamide Chemical compound CCN1CCN(C(=O)N[C@@H](C(=O)N[C@H]2[C@@H](NC2=O)OC)C2=CC=CC=C2)C(=O)C1=O ZUYZLPVPFRKUHW-IOASZLSFSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- WZPSXMPWJCIGAY-UHFFFAOYSA-N 4-methylsulfanylazetidin-2-one Chemical compound CSC1CC(=O)N1 WZPSXMPWJCIGAY-UHFFFAOYSA-N 0.000 description 1
- ZKAQPVQEYCFRTK-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carbonyl chloride Chemical compound CC=1ON=CC=1C(Cl)=O ZKAQPVQEYCFRTK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 108020004256 Beta-lactamase Proteins 0.000 description 1
- CTLKYOQRAAHXFF-UHFFFAOYSA-N C(C)(C)SN1C(CC1)=O Chemical compound C(C)(C)SN1C(CC1)=O CTLKYOQRAAHXFF-UHFFFAOYSA-N 0.000 description 1
- OUHLMDFGPKSIAL-UHFFFAOYSA-O C[N+](NN=N1)=C1S.[Na+] Chemical compound C[N+](NN=N1)=C1S.[Na+] OUHLMDFGPKSIAL-UHFFFAOYSA-O 0.000 description 1
- YLDCBBDINKXDHE-UHFFFAOYSA-N C[SiH](C)N[Si](C)(C)CCl Chemical compound C[SiH](C)N[Si](C)(C)CCl YLDCBBDINKXDHE-UHFFFAOYSA-N 0.000 description 1
- QYQDKDWGWDOFFU-IUODEOHRSA-N Cefotiam Chemical compound CN(C)CCN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CC=3N=C(N)SC=3)[C@H]2SC1 QYQDKDWGWDOFFU-IUODEOHRSA-N 0.000 description 1
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- RQIMLPLOXTUQGE-UHFFFAOYSA-N N,N-bis[dimethyl(propan-2-yl)silyl]acetamide Chemical compound C(C)(=O)N([Si](C(C)C)(C)C)[Si](C(C)C)(C)C RQIMLPLOXTUQGE-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- WMTIVUKAFBCYNN-SOCHQFKDSA-N N-[(2S)-3-chloro-1-[[(2R,3R)-2-methylsulfanyl-4-oxoazetidin-3-yl]amino]-1-oxopropan-2-yl]-4-ethyl-2,3-dioxopiperazine-1-carboxamide Chemical compound C(C)N1C(C(N(CC1)C(=O)N[C@@H](C(=O)N[C@@H]1C(N[C@@H]1SC)=O)CCl)=O)=O WMTIVUKAFBCYNN-SOCHQFKDSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- YKFRUJSEPGHZFJ-UHFFFAOYSA-N N-trimethylsilylimidazole Chemical compound C[Si](C)(C)N1C=CN=C1 YKFRUJSEPGHZFJ-UHFFFAOYSA-N 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010057190 Respiratory tract infections Diseases 0.000 description 1
- BMPDYAADFJEQAK-CPUCHLNUSA-N S-[(2S,3R)-3-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N[C@H]1SC(C)=O BMPDYAADFJEQAK-CPUCHLNUSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- HTWSUTFJYFUSDS-BXKDBHETSA-N [(2r,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](OC(C)=O)NC1=O HTWSUTFJYFUSDS-BXKDBHETSA-N 0.000 description 1
- XNWYXJNNWPBVKG-AEFFLSMTSA-N [(2s,3s)-1-[tert-butyl(dimethyl)silyl]-4-oxo-3-[(2-phenylacetyl)amino]azetidin-2-yl] acetate Chemical compound O=C1N([Si](C)(C)C(C)(C)C)[C@@H](OC(=O)C)[C@@H]1NC(=O)CC1=CC=CC=C1 XNWYXJNNWPBVKG-AEFFLSMTSA-N 0.000 description 1
- CNXFWMLZEVVCGG-WDSKDSINSA-N [(2s,3s)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxo-1-sulfoazetidin-2-yl]-diazonioazanide Chemical compound C=1SC(N)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H]([N-][N+]#N)N(S(O)(=O)=O)C1=O CNXFWMLZEVVCGG-WDSKDSINSA-N 0.000 description 1
- DLKPRGZATXCSNK-XCBNKYQSSA-N [(2s,3s)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] acetate Chemical compound C=1SC(N)=NC=1C(=NOC)C(=O)N[C@H]1[C@H](OC(C)=O)NC1=O DLKPRGZATXCSNK-XCBNKYQSSA-N 0.000 description 1
- HNSKTCSJBGRQIZ-YUMQZZPRSA-N [(2s,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]-diazonioazanide Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@H]([N-][N+]#N)NC1=O HNSKTCSJBGRQIZ-YUMQZZPRSA-N 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- XPLPIJRTRVFWAB-UFDLFPFVSA-M [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N(S([O-])(=O)=O)[C@@H]1SC(C)=O Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N(S([O-])(=O)=O)[C@@H]1SC(C)=O XPLPIJRTRVFWAB-UFDLFPFVSA-M 0.000 description 1
- WHOBJIHWQPDCPR-YLAFAASESA-M [Na+].O=C1N(S([O-])(=O)=O)[C@@H](OC(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@@H](OC(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 WHOBJIHWQPDCPR-YLAFAASESA-M 0.000 description 1
- JLBDXRYUUIVPPT-YLAFAASESA-M [Na+].O=C1N(S([O-])(=O)=O)[C@@H](SCC)[C@@H]1NC(=O)COC1=CC=CC=C1 Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@@H](SCC)[C@@H]1NC(=O)COC1=CC=CC=C1 JLBDXRYUUIVPPT-YLAFAASESA-M 0.000 description 1
- AYDFLPGJBYEUMB-MHDYBILJSA-M [Na+].O=C1N(S([O-])(=O)=O)[C@H](S(=O)(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@H](S(=O)(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 AYDFLPGJBYEUMB-MHDYBILJSA-M 0.000 description 1
- VTBNJALYBHELFR-LOCPCMAASA-M [Na+].O=C1N(S([O-])(=O)=O)[C@H](SC(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@H](SC(=O)C)[C@@H]1NC(=O)COC1=CC=CC=C1 VTBNJALYBHELFR-LOCPCMAASA-M 0.000 description 1
- DCXIXBKMLFMRDI-GBWFEORMSA-M [Na+].O=C1N(S([O-])(=O)=O)[C@H](SCCNC(=O)C)[C@@H]1NC(=O)C(C=1N=C(NC=O)SC=1)=NOCC1=NN=NN1 Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@H](SCCNC(=O)C)[C@@H]1NC(=O)C(C=1N=C(NC=O)SC=1)=NOCC1=NN=NN1 DCXIXBKMLFMRDI-GBWFEORMSA-M 0.000 description 1
- FAGRXDHADNCKLR-UHFFFAOYSA-N [Na].O=C1NCC1 Chemical compound [Na].O=C1NCC1 FAGRXDHADNCKLR-UHFFFAOYSA-N 0.000 description 1
- BQCLJECBJVWSES-UHFFFAOYSA-N acetyl chloride;hydrochloride Chemical compound Cl.CC(Cl)=O BQCLJECBJVWSES-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229960003022 amoxicillin Drugs 0.000 description 1
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 1
- 229960003669 carbenicillin Drugs 0.000 description 1
- 125000001721 carboxyacetyl group Chemical group 0.000 description 1
- NZDASSHFKWDBBU-KVMCETHSSA-N carfecillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C=1C=CC=CC=1)C(=O)OC1=CC=CC=C1 NZDASSHFKWDBBU-KVMCETHSSA-N 0.000 description 1
- 229960002543 carfecillin Drugs 0.000 description 1
- JIRBAUWICKGBFE-MNRDOXJOSA-N carindacillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(=O)OC=1C=C2CCCC2=CC=1)C1=CC=CC=C1 JIRBAUWICKGBFE-MNRDOXJOSA-N 0.000 description 1
- 229960000717 carindacillin Drugs 0.000 description 1
- RRYMAQUWDLIUPV-BXKDBHETSA-N cefacetrile Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CC#N)[C@@H]12 RRYMAQUWDLIUPV-BXKDBHETSA-N 0.000 description 1
- 229960003972 cefacetrile Drugs 0.000 description 1
- QYIYFLOTGYLRGG-GPCCPHFNSA-N cefaclor Chemical compound C1([C@H](C(=O)N[C@@H]2C(N3C(=C(Cl)CS[C@@H]32)C(O)=O)=O)N)=CC=CC=C1 QYIYFLOTGYLRGG-GPCCPHFNSA-N 0.000 description 1
- 229960005361 cefaclor Drugs 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 229960002420 cefatrizine Drugs 0.000 description 1
- 229960001139 cefazolin Drugs 0.000 description 1
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 1
- HJJDBAOLQAWBMH-YCRCPZNHSA-N cefmenoxime Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NN=NN1C HJJDBAOLQAWBMH-YCRCPZNHSA-N 0.000 description 1
- 229960003791 cefmenoxime Drugs 0.000 description 1
- 229960004261 cefotaxime Drugs 0.000 description 1
- AZZMGZXNTDTSME-JUZDKLSSSA-M cefotaxime sodium Chemical compound [Na+].N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 AZZMGZXNTDTSME-JUZDKLSSSA-M 0.000 description 1
- 229960001242 cefotiam Drugs 0.000 description 1
- SYLKGLMBLAAGSC-QLVMHMETSA-N cefsulodin Chemical compound C1=CC(C(=O)N)=CC=[N+]1CC1=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)[C@@H](C=3C=CC=CC=3)S(O)(=O)=O)[C@H]2SC1 SYLKGLMBLAAGSC-QLVMHMETSA-N 0.000 description 1
- 229960001668 cefuroxime Drugs 0.000 description 1
- JFPVXVDWJQMJEE-IZRZKJBUSA-N cefuroxime Chemical compound N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)\C(=N/OC)C1=CC=CO1 JFPVXVDWJQMJEE-IZRZKJBUSA-N 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- ITKVLPYNJQOCPW-UHFFFAOYSA-N chloro-(chloromethyl)-dimethylsilane Chemical compound C[Si](C)(Cl)CCl ITKVLPYNJQOCPW-UHFFFAOYSA-N 0.000 description 1
- KWYZNESIGBQHJK-UHFFFAOYSA-N chloro-dimethyl-phenylsilane Chemical compound C[Si](C)(Cl)C1=CC=CC=C1 KWYZNESIGBQHJK-UHFFFAOYSA-N 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 1
- 229960003326 cloxacillin Drugs 0.000 description 1
- LQOLIRLGBULYKD-JKIFEVAISA-N cloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1Cl LQOLIRLGBULYKD-JKIFEVAISA-N 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- WMOFSBKLSPNWET-NKWVEPMBSA-N diazonio-[(2r,3s)-3-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]azanide Chemical compound C=1SC(NC=O)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](N=[N+]=[N-])NC1=O WMOFSBKLSPNWET-NKWVEPMBSA-N 0.000 description 1
- DOPUXCOYNJWBME-PMACEKPBSA-N diazonio-[(2s,3s)-4-oxo-3-(tritylamino)azetidin-2-yl]azanide Chemical compound [N-]=[N+]=N[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 DOPUXCOYNJWBME-PMACEKPBSA-N 0.000 description 1
- UFCXHBIETZKGHB-UHFFFAOYSA-N dichloro(diethoxy)silane Chemical compound CCO[Si](Cl)(Cl)OCC UFCXHBIETZKGHB-UHFFFAOYSA-N 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 229960001585 dicloxacillin Drugs 0.000 description 1
- YFAGHNZHGGCZAX-JKIFEVAISA-N dicloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl YFAGHNZHGGCZAX-JKIFEVAISA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- OFIMFPOYQOEGGI-RISCZKNCSA-N ethyl 2-[(2s,3s)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl]oxyacetate Chemical compound CCOC(=O)CO[C@@H]1NC(=O)[C@H]1NC(=O)C(=NOC)C1=CSC(NC(=O)CCl)=N1 OFIMFPOYQOEGGI-RISCZKNCSA-N 0.000 description 1
- ZANNOFHADGWOLI-UHFFFAOYSA-N ethyl 2-hydroxyacetate Chemical compound CCOC(=O)CO ZANNOFHADGWOLI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- CHRLNRKNUAPHRT-UHFFFAOYSA-N ethylsulfanylethane;sodium Chemical compound [Na].CCSCC CHRLNRKNUAPHRT-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- HYVVJDQGXFXBRZ-UHFFFAOYSA-N metam Chemical compound CNC(S)=S HYVVJDQGXFXBRZ-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- LTNUFNRZWBFOTO-INEUFUBQSA-N methyl 2-[(2r,3r)-3-amino-4-oxoazetidin-2-yl]sulfanylacetate Chemical compound COC(=O)CS[C@H]1NC(=O)[C@H]1N LTNUFNRZWBFOTO-INEUFUBQSA-N 0.000 description 1
- BHPBDGORZAUFAL-ISKFKSNPSA-N methyl 2-[(2r,3r)-4-oxo-3-(tritylamino)azetidin-2-yl]sulfanylacetate Chemical compound COC(=O)CS[C@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BHPBDGORZAUFAL-ISKFKSNPSA-N 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- FZIBCCGGICGWBP-UHFFFAOYSA-N methyl 3-methylbut-2-enoate Chemical compound COC(=O)C=C(C)C FZIBCCGGICGWBP-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- RRGKFENWEWNGLJ-UHFFFAOYSA-N n,n-bis[tert-butyl(dimethyl)silyl]acetamide Chemical compound CC(C)(C)[Si](C)(C)N(C(=O)C)[Si](C)(C)C(C)(C)C RRGKFENWEWNGLJ-UHFFFAOYSA-N 0.000 description 1
- MXHTZQSKTCCMFG-UHFFFAOYSA-N n,n-dibenzyl-1-phenylmethanamine Chemical compound C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CC1=CC=CC=C1 MXHTZQSKTCCMFG-UHFFFAOYSA-N 0.000 description 1
- XEZCNUKQMKEPPA-UHFFFAOYSA-N n-(2-oxoazetidin-1-yl)-2-phenoxyacetamide Chemical compound C1CC(=O)N1NC(=O)COC1=CC=CC=C1 XEZCNUKQMKEPPA-UHFFFAOYSA-N 0.000 description 1
- VDZUQGYAAXGBTA-GYJVPHDTSA-N n-[(2r,3r)-2-methylsulfinyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CS(=O)[C@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 VDZUQGYAAXGBTA-GYJVPHDTSA-N 0.000 description 1
- DPQMSFHINRMOOZ-ZYHUDNBSSA-N n-[(2r,3s)-2-methoxy-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CO[C@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 DPQMSFHINRMOOZ-ZYHUDNBSSA-N 0.000 description 1
- NROOJDSNQVUYLT-WWUFLPHOSA-N n-[(2s,3r)-2-ethylsulfinyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CCS(=O)[C@@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 NROOJDSNQVUYLT-WWUFLPHOSA-N 0.000 description 1
- WCBKTLLELNCILY-PWSUYJOCSA-N n-[(2s,3r)-2-methylsulfonyl-4-oxoazetidin-3-yl]-2-phenoxyacetamide Chemical compound CS(=O)(=O)[C@@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 WCBKTLLELNCILY-PWSUYJOCSA-N 0.000 description 1
- LXWSITXSRCHWPA-UHFFFAOYSA-N n-[2-(3-amino-4-oxoazetidin-2-yl)sulfanylethyl]acetamide;4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1.CC(=O)NCCSC1NC(=O)C1N LXWSITXSRCHWPA-UHFFFAOYSA-N 0.000 description 1
- HHVRLRAKIHWOMY-ONEGZZNKSA-N n-[2-[(e)-2-acetamidoethenyl]sulfanyl-4-oxoazetidin-3-yl]-2-(2-chloroacetyl)imino-2-(methoxyamino)acetamide Chemical compound ClCC(=O)NC(=NOC)C(=O)NC1C(S\C=C\NC(C)=O)NC1=O HHVRLRAKIHWOMY-ONEGZZNKSA-N 0.000 description 1
- ARYPAVHVOFRARA-UHFFFAOYSA-N n-[2-[4-oxo-3-(tritylamino)azetidin-2-yl]sulfanylethyl]acetamide Chemical compound CC(=O)NCCSC1NC(=O)C1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ARYPAVHVOFRARA-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QHUOBLDKFGCVCG-UHFFFAOYSA-N n-methyl-n-trimethylsilylacetamide Chemical compound CC(=O)N(C)[Si](C)(C)C QHUOBLDKFGCVCG-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004706 n-propylthio group Chemical group C(CC)S* 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- 229910000480 nickel oxide Inorganic materials 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 229960002292 piperacillin Drugs 0.000 description 1
- WCMIIGXFCMNQDS-IDYPWDAWSA-M piperacillin sodium Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N2[C@@H](C([O-])=O)C(C)(C)S[C@@H]21 WCMIIGXFCMNQDS-IDYPWDAWSA-M 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 208000020029 respiratory tract infectious disease Diseases 0.000 description 1
- JHZPFFVDLSLXIE-BXKDBHETSA-N s-[(2r,3r)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@@H](SC(C)=O)NC1=O JHZPFFVDLSLXIE-BXKDBHETSA-N 0.000 description 1
- QQYKTKGGSONTPM-DGCLKSJQSA-N s-[(2r,3r)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-2-yl] ethanethioate Chemical compound CC(=O)S[C@H]1NC(=O)[C@H]1NC(=O)COC1=CC=CC=C1 QQYKTKGGSONTPM-DGCLKSJQSA-N 0.000 description 1
- JHZPFFVDLSLXIE-SKDRFNHKSA-N s-[(2s,3r)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidin-2-yl] ethanethioate Chemical compound C=1SC(NC(=O)CCl)=NC=1C(=NOC)C(=O)N[C@H]1[C@H](SC(C)=O)NC1=O JHZPFFVDLSLXIE-SKDRFNHKSA-N 0.000 description 1
- OFOLIKLWAWXNKP-GGAORHGYSA-N s-[(2s,3r)-4-oxo-3-(tritylamino)azetidin-2-yl] ethanethioate Chemical compound CC(=O)S[C@@H]1NC(=O)[C@H]1NC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 OFOLIKLWAWXNKP-GGAORHGYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- BHSBNKAZZUNKFA-SOWVLMPRSA-M sodium;(2r,3r)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonate Chemical compound [Na+].S([C@@H]1[C@@H](C(N1S([O-])(=O)=O)=O)NC(=O)C(=NOC)C=1N=C(N)SC=1)C1=NN=NN1C BHSBNKAZZUNKFA-SOWVLMPRSA-M 0.000 description 1
- XVBGZSHDZSTBBM-JHQAJZDGSA-M sodium;(2r,3r)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonate Chemical compound [Na+].S([C@@H]1[C@@H](C(N1S([O-])(=O)=O)=O)NC(=O)C(=NOC)C=1N=C(NC(=O)CCl)SC=1)C1=NN=NN1C XVBGZSHDZSTBBM-JHQAJZDGSA-M 0.000 description 1
- BHSBNKAZZUNKFA-VNUWRVCDSA-M sodium;(2s,3r)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(1-methyltetrazol-5-yl)sulfanyl-4-oxoazetidine-1-sulfonate Chemical compound [Na+].S([C@H]1[C@@H](C(N1S([O-])(=O)=O)=O)NC(=O)C(=NOC)C=1N=C(N)SC=1)C1=NN=NN1C BHSBNKAZZUNKFA-VNUWRVCDSA-M 0.000 description 1
- XVQUTCKJCOSAEM-NINOIYOQSA-M sodium;(2s,3r)-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-(2-methoxy-2-oxoethyl)sulfanyl-4-oxoazetidine-1-sulfonate Chemical compound [Na+].C=1SC(N)=NC=1C(=NOC)C(=O)N[C@H]1[C@H](SCC(=O)OC)N(S([O-])(=O)=O)C1=O XVQUTCKJCOSAEM-NINOIYOQSA-M 0.000 description 1
- OFQGDEQYNQPSRT-KATIXKQHSA-M sodium;(2s,3s)-2-acetyloxy-3-[[2-(2-amino-1,3-thiazol-4-yl)-2-propan-2-yloxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate Chemical compound [Na+].C=1SC(N)=NC=1C(=NOC(C)C)C(=O)N[C@H]1[C@H](OC(C)=O)N(S([O-])(=O)=O)C1=O OFQGDEQYNQPSRT-KATIXKQHSA-M 0.000 description 1
- RVXCTCRRIIDFCS-YLAFAASESA-M sodium;(2s,3s)-2-acetyloxy-4-oxo-3-[(2-phenylacetyl)amino]azetidine-1-sulfonate Chemical compound [Na+].O=C1N(S([O-])(=O)=O)[C@@H](OC(=O)C)[C@@H]1NC(=O)CC1=CC=CC=C1 RVXCTCRRIIDFCS-YLAFAASESA-M 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- 229960004932 sulbenicillin Drugs 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- SOROUYSPFADXSN-SUWVAFIASA-N talampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(=O)OC2C3=CC=CC=C3C(=O)O2)(C)C)=CC=CC=C1 SOROUYSPFADXSN-SUWVAFIASA-N 0.000 description 1
- 229960002780 talampicillin Drugs 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- SIOVKLKJSOKLIF-HJWRWDBZSA-N trimethylsilyl (1z)-n-trimethylsilylethanimidate Chemical compound C[Si](C)(C)OC(/C)=N\[Si](C)(C)C SIOVKLKJSOKLIF-HJWRWDBZSA-N 0.000 description 1
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/085—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a nitrogen atom directly attached in position 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0803—Compounds with Si-C or Si-Si linkages
- C07F7/081—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te
- C07F7/0812—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te comprising a heterocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/10—Compounds having one or more C—Si linkages containing nitrogen having a Si-N linkage
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/568—Four-membered rings
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Oncology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Saccharide Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PCT/JP1980/000296 WO1982001872A1 (en) | 1980-12-05 | 1980-12-05 | Azetidine derivatives and process for their preparation |
| PCT/JP1981/000102 WO1982003858A1 (en) | 1981-04-30 | 1981-04-30 | Acetidine derivatives and process for their preparation |
| PCT/JP1981/000192 WO1983000690A1 (fr) | 1981-08-25 | 1981-08-25 | Derives d'azetidine et leur procede de preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189545B true HU189545B (en) | 1986-07-28 |
Family
ID=27303167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU813576A HU189545B (en) | 1980-12-05 | 1981-11-26 | Process for producing 2-oxo-azetidine derivatives |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4822790A (enExample) |
| EP (1) | EP0053815B1 (enExample) |
| JP (1) | JPS57131759A (enExample) |
| KR (1) | KR880001564B1 (enExample) |
| AT (3) | ATE13178T1 (enExample) |
| AU (1) | AU551463B2 (enExample) |
| CH (1) | CH656122A5 (enExample) |
| DE (2) | DE3148020A1 (enExample) |
| DK (1) | DK534381A (enExample) |
| ES (2) | ES507716A0 (enExample) |
| FI (1) | FI79528C (enExample) |
| FR (1) | FR2495612A1 (enExample) |
| GB (1) | GB2091723B (enExample) |
| HU (1) | HU189545B (enExample) |
| IE (1) | IE53451B1 (enExample) |
| IL (1) | IL64314A (enExample) |
| IT (1) | IT1146726B (enExample) |
| LU (1) | LU83820A1 (enExample) |
| MX (1) | MX7096E (enExample) |
| NL (1) | NL8105468A (enExample) |
| NO (1) | NO160297C (enExample) |
| NZ (1) | NZ199168A (enExample) |
| PT (1) | PT74087B (enExample) |
| SE (1) | SE8107273L (enExample) |
| SU (2) | SU1662348A3 (enExample) |
| WO (1) | WO1982002042A1 (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU557649B2 (en) * | 1981-03-30 | 1987-01-08 | E.R. Squibb & Sons, Inc. | 4-substituted mercapto-2-oxo-1-azetidinesulfonic acid salts |
| US4734496A (en) * | 1981-05-29 | 1988-03-29 | E. R. Squibb & Sons, Inc. | 4-amino derivatives of 2-oxo-1-azetidinesulfonic acid salts |
| JPS588060A (ja) * | 1981-06-29 | 1983-01-18 | イ−・ア−ル・スクイブ・アンド・サンズ・インコ−ポレイテツド | アリ−ルチオアゼチジノンスルホン酸塩類 |
| IT1157292B (it) * | 1981-07-16 | 1987-02-11 | Squibb & Sons Inc | Derivati 4-sostituiti dei sali dell'acido 2-osso-1-azetidinsolfonico e procedimento per la loro preparazione |
| ATE24726T1 (de) * | 1981-10-05 | 1987-01-15 | Squibb & Sons Inc | 4-aether-derivate von 2-azetidinon-1-sulfonsaeuren. |
| AU564150B2 (en) * | 1982-04-30 | 1987-08-06 | Takeda Chemical Industries Ltd. | 1-sulfo-2-azetidinone derivatives |
| JPS58210060A (ja) * | 1982-05-31 | 1983-12-07 | Takeda Chem Ind Ltd | 2−オキソアゼチジン誘導体、その製造法および用途 |
| JPS5916888A (ja) * | 1982-07-20 | 1984-01-28 | Takeda Chem Ind Ltd | 1−スルホ−2−アゼチジノン誘導体およびその製造法 |
| US4681937A (en) * | 1982-09-27 | 1987-07-21 | E. R. Squibb & Sons, Inc. | 3-acylamino-2-oxo-1-azetidinyl esters of phosphonic acids, phosphoric acid and phosphoric acid esters |
| JPS59101485A (ja) * | 1982-11-29 | 1984-06-12 | Otsuka Chem Co Ltd | アセチジノン誘導体 |
| DE3342929A1 (de) * | 1983-11-26 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Ss-lactamantibiotika, verfahren zu deren herstellung sowie ihre verwendung als arzneimittel |
| US4883869A (en) * | 1984-12-20 | 1989-11-28 | The Upjohn Company | Novel beta-lactams containing amino acid substituents |
| US5006650A (en) * | 1987-02-11 | 1991-04-09 | The Upjohn Company | Novel N-1 substituted beta-lactams as antibiotics |
| US5001235A (en) * | 1987-02-27 | 1991-03-19 | The Upjohn Company | Antibiotic beta-lactams containing a pyridone carboxylic acid or acid derivative |
| CA1317298C (en) * | 1987-03-03 | 1993-05-04 | Upjohn Company (The) | Antibiotic sulfonylaminocarbonyl activated .beta.-lactams |
| US5015737A (en) * | 1987-07-22 | 1991-05-14 | The Upjohn Company | Therapeutically useful beta-lactams |
| AU4133697A (en) * | 1996-09-23 | 1998-04-14 | Synphar Laboratories, Inc. | 3,4-disubstituted azetidin-2-one derivatives useful as cysteine proteinase regulators |
| HRP970146A2 (en) * | 1997-03-13 | 1998-10-31 | Mice Kovacevic | Epoxi-azetidines, preparation and use |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6046955B2 (ja) * | 1977-12-30 | 1985-10-18 | 武田薬品工業株式会社 | 抗生物質g−6302 |
| JPS5549394A (en) * | 1978-10-03 | 1980-04-09 | Takeda Chem Ind Ltd | Antibiotic substance sb-72310 |
| US4260627A (en) * | 1978-10-24 | 1981-04-07 | Merck & Co., Inc. | 1-, 6- And 2-substituted-1-carba-2-penem-3-carboxylic acids |
| DE3064810D1 (en) * | 1979-06-08 | 1983-10-20 | Takeda Chemical Industries Ltd | 3-methoxy-2-oxoazetidine derivatives and their production |
| EP0021678B1 (en) * | 1979-06-08 | 1984-11-07 | Takeda Chemical Industries, Ltd. | 1-sulpho-2-oxoazetidine derivatives, their production and pharmaceutical compositions thereof |
| NZ205240A (en) * | 1980-02-07 | 1984-07-31 | Squibb & Sons Inc | Sulphonamide derivatives,being starting materials for producing beta-lactams |
| AU557649B2 (en) * | 1981-03-30 | 1987-01-08 | E.R. Squibb & Sons, Inc. | 4-substituted mercapto-2-oxo-1-azetidinesulfonic acid salts |
| JPS588060A (ja) * | 1981-06-29 | 1983-01-18 | イ−・ア−ル・スクイブ・アンド・サンズ・インコ−ポレイテツド | アリ−ルチオアゼチジノンスルホン酸塩類 |
| IT1157292B (it) * | 1981-07-16 | 1987-02-11 | Squibb & Sons Inc | Derivati 4-sostituiti dei sali dell'acido 2-osso-1-azetidinsolfonico e procedimento per la loro preparazione |
| FR2515182B1 (fr) * | 1981-10-23 | 1986-05-09 | Roussel Uclaf | Nouveaux produits derives de l'acide 3-amino 2-oxo azetidine 1-sulfamique, leur procede de preparation, leur application comme medicaments et les produits intermediaires necessaires a leur preparation |
-
1980
- 1980-12-05 MX MX819801U patent/MX7096E/es unknown
-
1981
- 1981-11-19 IL IL64314A patent/IL64314A/xx unknown
- 1981-11-26 HU HU813576A patent/HU189545B/hu not_active IP Right Cessation
- 1981-12-02 DK DK534381A patent/DK534381A/da not_active Application Discontinuation
- 1981-12-02 FI FI813851A patent/FI79528C/fi not_active IP Right Cessation
- 1981-12-02 NO NO814113A patent/NO160297C/no unknown
- 1981-12-03 US US06/326,939 patent/US4822790A/en not_active Expired - Fee Related
- 1981-12-03 SU SU813364650A patent/SU1662348A3/ru active
- 1981-12-04 EP EP81110154A patent/EP0053815B1/en not_active Expired
- 1981-12-04 AT AT81110154T patent/ATE13178T1/de not_active IP Right Cessation
- 1981-12-04 DE DE19813148020 patent/DE3148020A1/de not_active Withdrawn
- 1981-12-04 IT IT68585/81A patent/IT1146726B/it active
- 1981-12-04 NZ NZ199168A patent/NZ199168A/en unknown
- 1981-12-04 ES ES507716A patent/ES507716A0/es active Granted
- 1981-12-04 AT AT0520781A patent/AT379800B/de not_active IP Right Cessation
- 1981-12-04 IE IE2859/81A patent/IE53451B1/en unknown
- 1981-12-04 GB GB8136617A patent/GB2091723B/en not_active Expired
- 1981-12-04 LU LU83820A patent/LU83820A1/xx unknown
- 1981-12-04 SE SE8107273A patent/SE8107273L/xx unknown
- 1981-12-04 NL NL8105468A patent/NL8105468A/nl not_active Application Discontinuation
- 1981-12-04 DE DE8181110154T patent/DE3170437D1/de not_active Expired
- 1981-12-04 CH CH7786/81A patent/CH656122A5/de not_active IP Right Cessation
- 1981-12-04 PT PT74087A patent/PT74087B/pt unknown
- 1981-12-04 FR FR8122774A patent/FR2495612A1/fr active Granted
- 1981-12-04 JP JP56196078A patent/JPS57131759A/ja active Pending
- 1981-12-05 WO PCT/JP1981/000368 patent/WO1982002042A1/ja not_active Ceased
- 1981-12-05 KR KR1019810004759A patent/KR880001564B1/ko not_active Expired
- 1981-12-07 AU AU78313/81A patent/AU551463B2/en not_active Ceased
-
1982
- 1982-06-25 ES ES513420A patent/ES513420A0/es active Granted
-
1983
- 1983-02-02 SU SU833547568A patent/SU1531852A3/ru active
-
1984
- 1984-05-23 AT AT0170384A patent/AT380471B/de not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189545B (en) | Process for producing 2-oxo-azetidine derivatives | |
| EP0093376B2 (en) | 1-Sulfo-2-azetidinone derivatives, their production and use | |
| EP0053816B1 (en) | 1-sulfo-2-oxoazetidine derivatives, their production and use | |
| EP0021678B1 (en) | 1-sulpho-2-oxoazetidine derivatives, their production and pharmaceutical compositions thereof | |
| US4794108A (en) | 1-carboxymethoxy acetidinones and their production | |
| EP0265185A2 (en) | Cephalosporins, processes for their preparation and pharmaceutical compositions containing them | |
| US4725591A (en) | β-lactamase inhibitory composition | |
| US4684724A (en) | 4-Cyano-2-azetidinones and production thereof | |
| EP0095764B1 (en) | 2-oxoazetidinone derivatives, their production and use | |
| US4416817A (en) | 3-Methoxy-2-oxoazetidine derivatives and their production | |
| EP0100041B1 (en) | 1-sulfo-2-azetidinone derivatives, their production and use | |
| EP0135194A1 (en) | Azetidinones and their production | |
| KR880000874B1 (ko) | 1-술포-2-옥소아제티딘 유도체의 제조방법 | |
| EP0053387A1 (en) | Method of preparing 1-sulfo-2-oxoazetidine derivatives and intermediates therefor | |
| CS253572B2 (cs) | Způsob přípravy 1-sulfo-2-oxoazetidinu | |
| JPH08512283A (ja) | カルバセファロスポリン化合物、その合成および使用 | |
| JPH0425264B2 (enExample) | ||
| JPH09110876A (ja) | 新規なセファロスポリン誘導体またはその塩 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |