HU186523B - Process for producing quinoline derivatives - Google Patents
Process for producing quinoline derivatives Download PDFInfo
- Publication number
- HU186523B HU186523B HU821828A HU182882A HU186523B HU 186523 B HU186523 B HU 186523B HU 821828 A HU821828 A HU 821828A HU 182882 A HU182882 A HU 182882A HU 186523 B HU186523 B HU 186523B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compounds
- compound
- alkyl
- group
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 33
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title description 7
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 167
- -1 heteroaryl radical Chemical class 0.000 claims abstract description 81
- 150000003839 salts Chemical class 0.000 claims abstract description 55
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 50
- 239000001257 hydrogen Substances 0.000 claims abstract description 50
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 34
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 29
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims abstract description 4
- 239000003937 drug carrier Substances 0.000 claims abstract description 3
- 239000008024 pharmaceutical diluent Substances 0.000 claims abstract description 3
- XIPUIGPNIDKXJU-UHFFFAOYSA-N [CH]1CC1 Chemical compound [CH]1CC1 XIPUIGPNIDKXJU-UHFFFAOYSA-N 0.000 claims abstract 2
- 239000002253 acid Substances 0.000 claims description 52
- 238000002360 preparation method Methods 0.000 claims description 37
- 239000007858 starting material Substances 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 16
- ROZCPMNZUNJWFN-UHFFFAOYSA-N 3-phenyl-1h-quinoline-2-thione Chemical compound S=C1NC2=CC=CC=C2C=C1C1=CC=CC=C1 ROZCPMNZUNJWFN-UHFFFAOYSA-N 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 6
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 235000019253 formic acid Nutrition 0.000 claims description 5
- 125000005936 piperidyl group Chemical group 0.000 claims description 5
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- HYOLQGVNMQNERE-UHFFFAOYSA-N n,n-dimethyl-2-(3-phenylquinolin-2-yl)sulfanylethanamine Chemical compound CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 HYOLQGVNMQNERE-UHFFFAOYSA-N 0.000 claims description 4
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 3
- ARPRLCXPAGXBRL-UHFFFAOYSA-N n,n,2-trimethyl-1-(3-phenylquinolin-2-yl)sulfanylpropan-2-amine Chemical compound CN(C)C(C)(C)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 ARPRLCXPAGXBRL-UHFFFAOYSA-N 0.000 claims description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- ZUGSZYLRCNAKOS-UHFFFAOYSA-N 2-[3-(2-methoxyphenyl)quinolin-2-yl]sulfanyl-n,n-dimethylethanamine Chemical compound COC1=CC=CC=C1C1=CC2=CC=CC=C2N=C1SCCN(C)C ZUGSZYLRCNAKOS-UHFFFAOYSA-N 0.000 claims description 2
- GXGJIOMUZAGVEH-UHFFFAOYSA-N Chamazulene Chemical group CCC1=CC=C(C)C2=CC=C(C)C2=C1 GXGJIOMUZAGVEH-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 2
- 125000004980 cyclopropylene group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- KBSPNHZTNNSAPF-UHFFFAOYSA-N n,n-dimethyl-1-(3-phenylquinolin-2-yl)sulfanylpropan-2-amine Chemical compound CN(C)C(C)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 KBSPNHZTNNSAPF-UHFFFAOYSA-N 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims 2
- 239000004480 active ingredient Substances 0.000 claims 2
- 239000002585 base Substances 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 125000003386 piperidinyl group Chemical group 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 125000004360 trifluorophenyl group Chemical group 0.000 claims 1
- 239000003420 antiserotonin agent Substances 0.000 abstract description 5
- 125000005843 halogen group Chemical group 0.000 abstract description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 abstract 1
- 150000003254 radicals Chemical class 0.000 abstract 1
- 125000006413 ring segment Chemical group 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 260
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 257
- 239000000203 mixture Substances 0.000 description 141
- 239000000243 solution Substances 0.000 description 126
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 114
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 108
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 101
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 89
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 86
- 235000019439 ethyl acetate Nutrition 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- 239000002904 solvent Substances 0.000 description 68
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 62
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- 239000003208 petroleum Substances 0.000 description 55
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 50
- 239000007787 solid Substances 0.000 description 44
- 239000000284 extract Substances 0.000 description 43
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 43
- 235000019341 magnesium sulphate Nutrition 0.000 description 43
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- 229920006395 saturated elastomer Polymers 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 28
- 235000011167 hydrochloric acid Nutrition 0.000 description 28
- 239000003463 adsorbent Substances 0.000 description 27
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 27
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 27
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 25
- 239000003480 eluent Substances 0.000 description 25
- 239000011541 reaction mixture Substances 0.000 description 25
- 239000011780 sodium chloride Substances 0.000 description 25
- 239000012312 sodium hydride Substances 0.000 description 25
- 229910000104 sodium hydride Inorganic materials 0.000 description 25
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 23
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 239000002480 mineral oil Substances 0.000 description 22
- 235000010446 mineral oil Nutrition 0.000 description 22
- 239000006185 dispersion Substances 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 239000000725 suspension Substances 0.000 description 17
- 239000005457 ice water Substances 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 15
- 229910052786 argon Inorganic materials 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 14
- 238000010438 heat treatment Methods 0.000 description 14
- 239000003960 organic solvent Substances 0.000 description 14
- 150000003248 quinolines Chemical class 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 13
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 241001465754 Metazoa Species 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 10
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 230000001603 reducing effect Effects 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 150000005642 2-chloroquinolines Chemical class 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000012298 atmosphere Substances 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- NRVFDGZJTPCULU-UHFFFAOYSA-N meda Chemical compound Cl.CN(C)CCS NRVFDGZJTPCULU-UHFFFAOYSA-N 0.000 description 5
- 238000001556 precipitation Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229950001675 spiperone Drugs 0.000 description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 4
- 150000003931 anilides Chemical class 0.000 description 4
- UORVGPXVDQYIDP-BJUDXGSMSA-N borane Chemical class [10BH3] UORVGPXVDQYIDP-BJUDXGSMSA-N 0.000 description 4
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 3
- GCTSNHICSYLSKH-UHFFFAOYSA-N 3-(4-fluorophenyl)-1h-quinoline-2-thione Chemical compound C1=CC(F)=CC=C1C1=CC2=CC=CC=C2NC1=S GCTSNHICSYLSKH-UHFFFAOYSA-N 0.000 description 3
- LDCYZAJDBXYCGN-VIFPVBQESA-N 5-hydroxy-L-tryptophan Chemical compound C1=C(O)C=C2C(C[C@H](N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-VIFPVBQESA-N 0.000 description 3
- 229940000681 5-hydroxytryptophan Drugs 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- BXTUQKSEPOCUOO-UHFFFAOYSA-N [2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCC(C)(C)NC(=O)OC(C)(C)C)C=C1 BXTUQKSEPOCUOO-UHFFFAOYSA-N 0.000 description 3
- QTVLBXMNUXAWHI-UHFFFAOYSA-N [4-(2-sulfanylidene-1H-quinolin-3-yl)phenyl] acetate Chemical compound C(C)(=O)OC1=CC=C(C=C1)C=1C(NC2=CC=CC=C2C=1)=S QTVLBXMNUXAWHI-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 229960001582 fenfluramine Drugs 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000004533 oil dispersion Substances 0.000 description 3
- LDCYZAJDBXYCGN-UHFFFAOYSA-N oxitriptan Natural products C1=C(O)C=C2C(CC(N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-UHFFFAOYSA-N 0.000 description 3
- 230000002035 prolonged effect Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- YMHFBBYSPSTAGC-UYAOXDASSA-N (1r,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclohexan-1-amine Chemical compound N[C@@H]1CCCC[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YMHFBBYSPSTAGC-UYAOXDASSA-N 0.000 description 2
- WDGDPUJOJYRONC-NVXWUHKLSA-N (1s,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclopropane-1-carboxylic acid Chemical compound OC(=O)[C@@H]1C[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 WDGDPUJOJYRONC-NVXWUHKLSA-N 0.000 description 2
- QVNWEEMEEDJTKH-ZDUSSCGKSA-N (2s)-1-(3-phenylquinolin-2-yl)sulfanylpropan-2-amine Chemical compound C[C@H](N)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 QVNWEEMEEDJTKH-ZDUSSCGKSA-N 0.000 description 2
- OPCJOXGBLDJWRM-UHFFFAOYSA-N 1,2-diamino-2-methylpropane Chemical compound CC(C)(N)CN OPCJOXGBLDJWRM-UHFFFAOYSA-N 0.000 description 2
- OUBWNDCPZQITIW-UHFFFAOYSA-N 1-(3-phenylquinolin-2-yl)sulfanylpropan-2-one Chemical compound CC(=O)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 OUBWNDCPZQITIW-UHFFFAOYSA-N 0.000 description 2
- IENKZJXYYFTJQZ-UHFFFAOYSA-N 1-[3-(4-fluorophenyl)quinolin-2-yl]sulfanylpropan-2-one Chemical compound CC(=O)CSC1=NC2=CC=CC=C2C=C1C1=CC=C(F)C=C1 IENKZJXYYFTJQZ-UHFFFAOYSA-N 0.000 description 2
- XNGJEHMQLGWOBI-UHFFFAOYSA-N 1-chloro-n,n,2-trimethylpropan-2-amine;hydrochloride Chemical compound Cl.CN(C)C(C)(C)CCl XNGJEHMQLGWOBI-UHFFFAOYSA-N 0.000 description 2
- LFARBJHRSSLIGX-UHFFFAOYSA-N 2-chloro-3-phenylquinoline Chemical compound ClC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 LFARBJHRSSLIGX-UHFFFAOYSA-N 0.000 description 2
- CBICQVIAVZYAIA-UHFFFAOYSA-N 2-chloro-3-propan-2-ylquinoline Chemical compound C1=CC=C2N=C(Cl)C(C(C)C)=CC2=C1 CBICQVIAVZYAIA-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- ZNGINKJHQQQORD-UHFFFAOYSA-N 2-trimethylsilylethanol Chemical compound C[Si](C)(C)CCO ZNGINKJHQQQORD-UHFFFAOYSA-N 0.000 description 2
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 2
- VFSFPTHUKJFFRF-UHFFFAOYSA-N 3-phenyl-2-piperidin-3-ylsulfanylquinoline Chemical compound C1CCNCC1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 VFSFPTHUKJFFRF-UHFFFAOYSA-N 0.000 description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- UIJMCNPGQVFHAL-UHFFFAOYSA-N 4-(2-chloroquinolin-3-yl)phenol Chemical compound C1=CC(O)=CC=C1C1=CC2=CC=CC=C2N=C1Cl UIJMCNPGQVFHAL-UHFFFAOYSA-N 0.000 description 2
- CCBPQIQEELRHPM-UHFFFAOYSA-N 4-(2-sulfanylidene-1h-quinolin-3-yl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC2=CC=CC=C2NC1=S CCBPQIQEELRHPM-UHFFFAOYSA-N 0.000 description 2
- UYLHDMFIIXZYJE-UHFFFAOYSA-N 4-(2-sulfanylidene-1h-quinolin-3-yl)benzonitrile Chemical compound S=C1NC2=CC=CC=C2C=C1C1=CC=C(C#N)C=C1 UYLHDMFIIXZYJE-UHFFFAOYSA-N 0.000 description 2
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 2
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 206010028347 Muscle twitching Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- KLEPSZKPAIHWIS-LBPRGKRZSA-N [(2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] 4-methylbenzenesulfonate Chemical compound CC(C)(C)OC(=O)N[C@@H](C)COS(=O)(=O)C1=CC=C(C)C=C1 KLEPSZKPAIHWIS-LBPRGKRZSA-N 0.000 description 2
- RWKBRBMFURLQBK-UHFFFAOYSA-N [4-(2-chloroquinolin-3-yl)phenyl] acetate Chemical compound C(C)(=O)OC1=CC=C(C=C1)C=1C(=NC2=CC=CC=C2C=1)Cl RWKBRBMFURLQBK-UHFFFAOYSA-N 0.000 description 2
- QEXMAYMATHBQRP-UHFFFAOYSA-N acetic acid [4-[(1-oxo-2-phenylethyl)amino]phenyl] ester Chemical compound C1=CC(OC(=O)C)=CC=C1NC(=O)CC1=CC=CC=C1 QEXMAYMATHBQRP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000674 adrenergic antagonist Substances 0.000 description 2
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- ODCCJTMPMUFERV-UHFFFAOYSA-N ditert-butyl carbonate Chemical compound CC(C)(C)OC(=O)OC(C)(C)C ODCCJTMPMUFERV-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007928 intraperitoneal injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- NIICABLYCYLATR-UHFFFAOYSA-N n,n,2-trimethyl-2-(3-phenylquinolin-2-yl)sulfanylpropanamide Chemical compound CN(C)C(=O)C(C)(C)SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 NIICABLYCYLATR-UHFFFAOYSA-N 0.000 description 2
- LVQGMFVMZZCKHX-UHFFFAOYSA-N n,n-dimethyl-2-(3-phenylquinolin-2-yl)sulfanylacetamide Chemical compound CN(C)C(=O)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 LVQGMFVMZZCKHX-UHFFFAOYSA-N 0.000 description 2
- XMRXKCIELMKQPF-UHFFFAOYSA-N n,n-dimethyl-2-(3-phenylquinolin-2-yl)sulfanylethanamine;hydron;chloride Chemical compound Cl.CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 XMRXKCIELMKQPF-UHFFFAOYSA-N 0.000 description 2
- YSLJUQZRWVCNKQ-UHFFFAOYSA-N n,n-dimethyl-2-(3-phenylquinolin-2-yl)sulfanylpropanamide Chemical compound CN(C)C(=O)C(C)SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YSLJUQZRWVCNKQ-UHFFFAOYSA-N 0.000 description 2
- YOGYPGYLBUVWJR-UHFFFAOYSA-N n-methyl-2-(3-phenylquinolin-2-yl)sulfanylethanamine Chemical compound CNCCSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YOGYPGYLBUVWJR-UHFFFAOYSA-N 0.000 description 2
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- MBGGBVCUIVRRBF-UHFFFAOYSA-N sulfinpyrazone Chemical compound O=C1N(C=2C=CC=CC=2)N(C=2C=CC=CC=2)C(=O)C1CCS(=O)C1=CC=CC=C1 MBGGBVCUIVRRBF-UHFFFAOYSA-N 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- IJKKZLRVBDQFQM-UHFFFAOYSA-N tert-butyl 3-(3-phenylquinolin-2-yl)sulfanylpiperidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 IJKKZLRVBDQFQM-UHFFFAOYSA-N 0.000 description 2
- SKOKKOPKFKENHX-UHFFFAOYSA-N tert-butyl 3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CN(C(=O)OC(C)(C)C)CCC1 SKOKKOPKFKENHX-UHFFFAOYSA-N 0.000 description 2
- WDCSZQNLQCIBGA-INIZCTEOSA-N tert-butyl n-[(2s)-1-(3-phenylquinolin-2-yl)sulfanylpropan-2-yl]carbamate Chemical compound CC(C)(C)OC(=O)N[C@@H](C)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 WDCSZQNLQCIBGA-INIZCTEOSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- ZKZFLOMHEKCISH-OVAHNPOGSA-N (1r,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclohexan-1-amine;hydrochloride Chemical compound Cl.N[C@@H]1CCCC[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 ZKZFLOMHEKCISH-OVAHNPOGSA-N 0.000 description 1
- YLBWHZUFJIAVRO-NVXWUHKLSA-N (1r,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclopropan-1-amine Chemical compound N[C@@H]1C[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 YLBWHZUFJIAVRO-NVXWUHKLSA-N 0.000 description 1
- FTFJHAZPJYUWPR-KGZKBUQUSA-N (1r,2r)-2-chlorocyclohexan-1-amine;hydrochloride Chemical compound Cl.N[C@@H]1CCCC[C@H]1Cl FTFJHAZPJYUWPR-KGZKBUQUSA-N 0.000 description 1
- ZKZFLOMHEKCISH-VKLKMBQZSA-N (1s,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclohexan-1-amine;hydrochloride Chemical compound Cl.N[C@H]1CCCC[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 ZKZFLOMHEKCISH-VKLKMBQZSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 description 1
- BKMMTJMQCTUHRP-VKHMYHEASA-N (S)-2-aminopropan-1-ol Chemical compound C[C@H](N)CO BKMMTJMQCTUHRP-VKHMYHEASA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- MUUYUOLOWAKXBQ-UHFFFAOYSA-N 1-[3-(4-fluorophenyl)quinolin-2-yl]sulfanyl-n,n-dimethylpropan-2-amine;hydrochloride Chemical compound Cl.CN(C)C(C)CSC1=NC2=CC=CC=C2C=C1C1=CC=C(F)C=C1 MUUYUOLOWAKXBQ-UHFFFAOYSA-N 0.000 description 1
- PFHLGQKVKALLMD-UHFFFAOYSA-N 2,2-dimethylhexan-3-ol Chemical compound CCCC(O)C(C)(C)C PFHLGQKVKALLMD-UHFFFAOYSA-N 0.000 description 1
- NTOIKDYVJIWVSU-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid Chemical compound C1=CC(C)=CC=C1C(=O)C(O)(C(O)=O)C(O)(C(O)=O)C(=O)C1=CC=C(C)C=C1 NTOIKDYVJIWVSU-UHFFFAOYSA-N 0.000 description 1
- IVEWTCACRDEAOB-UHFFFAOYSA-N 2-(2-methoxyphenyl)acetic acid Chemical compound COC1=CC=CC=C1CC(O)=O IVEWTCACRDEAOB-UHFFFAOYSA-N 0.000 description 1
- PYUKVSFOQRHAGK-UHFFFAOYSA-N 2-(2-methyl-1,3-thiazol-4-yl)-n-phenylacetamide Chemical compound S1C(C)=NC(CC(=O)NC=2C=CC=CC=2)=C1 PYUKVSFOQRHAGK-UHFFFAOYSA-N 0.000 description 1
- RJCFWJNYLJRLRC-UHFFFAOYSA-N 2-(2-methyl-1,3-thiazol-4-yl)acetic acid Chemical compound CC1=NC(CC(O)=O)=CS1 RJCFWJNYLJRLRC-UHFFFAOYSA-N 0.000 description 1
- QENNHUFOYPFLMJ-UHFFFAOYSA-N 2-(3-phenylquinolin-2-yl)sulfanylethanamine;hydrochloride Chemical compound Cl.NCCSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 QENNHUFOYPFLMJ-UHFFFAOYSA-N 0.000 description 1
- WCTJRKVPYCQVQM-UHFFFAOYSA-N 2-(4-acetyloxyphenyl)acetic acid Chemical compound CC(=O)OC1=CC=C(CC(O)=O)C=C1 WCTJRKVPYCQVQM-UHFFFAOYSA-N 0.000 description 1
- AZZOFXGSQFRBCS-UHFFFAOYSA-N 2-(chloromethyl)-1-methylpiperidine;hydrochloride Chemical compound Cl.CN1CCCCC1CCl AZZOFXGSQFRBCS-UHFFFAOYSA-N 0.000 description 1
- DENMGZODXQRYAR-UHFFFAOYSA-N 2-(dimethylamino)ethanethiol Chemical compound CN(C)CCS DENMGZODXQRYAR-UHFFFAOYSA-N 0.000 description 1
- KFBOVHNCMVWTFT-UHFFFAOYSA-N 2-[3-(2-methoxyphenyl)quinolin-2-yl]sulfanyl-n,n-dimethylethanamine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C1=CC2=CC=CC=C2N=C1SCCN(C)C KFBOVHNCMVWTFT-UHFFFAOYSA-N 0.000 description 1
- RMAFNWUXBQPLMF-UHFFFAOYSA-N 2-[3-(2-methoxyphenyl)quinolin-2-yl]sulfanylethanamine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C1=CC2=CC=CC=C2N=C1SCCN RMAFNWUXBQPLMF-UHFFFAOYSA-N 0.000 description 1
- RBWDAFWJSCEAQV-UHFFFAOYSA-N 2-[3-(4-fluorophenyl)quinolin-2-yl]sulfanyl-n,n-dimethylethanamine Chemical compound CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(F)C=C1 RBWDAFWJSCEAQV-UHFFFAOYSA-N 0.000 description 1
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 description 1
- JJDUHFSDEPSCOX-UHFFFAOYSA-N 2-bromo-n,2-dimethylpropanamide Chemical compound CNC(=O)C(C)(C)Br JJDUHFSDEPSCOX-UHFFFAOYSA-N 0.000 description 1
- KRZIUCWIMUOCTD-UHFFFAOYSA-N 2-chloro-3-(4-fluorophenyl)quinoline Chemical compound C1=CC(F)=CC=C1C1=CC2=CC=CC=C2N=C1Cl KRZIUCWIMUOCTD-UHFFFAOYSA-N 0.000 description 1
- XBPPLECAZBTMMK-UHFFFAOYSA-N 2-chloro-n,n-dimethylacetamide Chemical compound CN(C)C(=O)CCl XBPPLECAZBTMMK-UHFFFAOYSA-N 0.000 description 1
- YFBQXUGQIFAFMM-UHFFFAOYSA-N 2-chloro-n-methylethanamine Chemical compound CNCCCl YFBQXUGQIFAFMM-UHFFFAOYSA-N 0.000 description 1
- OFUFXTHGZWIDDB-UHFFFAOYSA-N 2-chloroquinoline Chemical class C1=CC=CC2=NC(Cl)=CC=C21 OFUFXTHGZWIDDB-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- ZUUMKEWZKIFREK-UHFFFAOYSA-N 2-methyl-2-(3-phenylquinolin-2-yl)sulfanylpropanoic acid Chemical compound OC(=O)C(C)(C)SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 ZUUMKEWZKIFREK-UHFFFAOYSA-N 0.000 description 1
- LFUADSBZGHDSQJ-FGZHOGPDSA-N 2-trimethylsilylethyl n-[(1r,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclopropyl]carbamate Chemical compound C[Si](C)(C)CCOC(=O)N[C@@H]1C[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 LFUADSBZGHDSQJ-FGZHOGPDSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- NIXBHCMOVYHNPF-UHFFFAOYSA-N 3-butyl-1h-quinoline-2-thione Chemical compound C1=CC=C2NC(=S)C(CCCC)=CC2=C1 NIXBHCMOVYHNPF-UHFFFAOYSA-N 0.000 description 1
- YVFSVOCDUMPOCA-UHFFFAOYSA-N 4-(2-chloroquinolin-3-yl)benzonitrile Chemical compound ClC1=NC2=CC=CC=C2C=C1C1=CC=C(C#N)C=C1 YVFSVOCDUMPOCA-UHFFFAOYSA-N 0.000 description 1
- VSBJEJPAYZGXEN-UHFFFAOYSA-N 4-[2-[2-(dimethylamino)ethylsulfanyl]quinolin-3-yl]benzoic acid Chemical compound CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(C(O)=O)C=C1 VSBJEJPAYZGXEN-UHFFFAOYSA-N 0.000 description 1
- NSWMWEOOYJXQAX-UHFFFAOYSA-N 4-[2-[2-(dimethylamino)ethylsulfanyl]quinolin-3-yl]benzoic acid;hydrochloride Chemical compound Cl.CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(C(O)=O)C=C1 NSWMWEOOYJXQAX-UHFFFAOYSA-N 0.000 description 1
- ABOBBQNDTHXHOK-UHFFFAOYSA-N 4-[2-[2-(dimethylamino)ethylsulfanyl]quinolin-3-yl]benzonitrile;hydrochloride Chemical compound Cl.CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(C#N)C=C1 ABOBBQNDTHXHOK-UHFFFAOYSA-N 0.000 description 1
- YITQNFULOYTRKN-UHFFFAOYSA-N 4-[2-[2-(dimethylamino)ethylsulfanyl]quinolin-3-yl]phenol;hydrochloride Chemical compound Cl.CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(O)C=C1 YITQNFULOYTRKN-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- KRUZBMLYYUQATF-UHFFFAOYSA-N 6-bromo-2-chloro-3-phenylquinoline Chemical compound ClC1=NC2=CC=C(Br)C=C2C=C1C1=CC=CC=C1 KRUZBMLYYUQATF-UHFFFAOYSA-N 0.000 description 1
- HUNMSLDDIPSBDA-UHFFFAOYSA-N 6-chloro-3-phenyl-1h-quinolin-2-one Chemical compound C=1C2=CC(Cl)=CC=C2NC(=O)C=1C1=CC=CC=C1 HUNMSLDDIPSBDA-UHFFFAOYSA-N 0.000 description 1
- QUMHZORVXHEODT-UHFFFAOYSA-N 7-bromo-2-chloro-3-phenylquinoline Chemical compound ClC1=NC2=CC(Br)=CC=C2C=C1C1=CC=CC=C1 QUMHZORVXHEODT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 235000011330 Armoracia rusticana Nutrition 0.000 description 1
- 240000003291 Armoracia rusticana Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 235000002568 Capsicum frutescens Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- CTPAGZHGJPZMIV-UHFFFAOYSA-N Cl.CN(C(CSC1=NC2=CC=CC=C2C=C1C1=CC=C(C=C1)O)(C)C)C Chemical compound Cl.CN(C(CSC1=NC2=CC=CC=C2C=C1C1=CC=C(C=C1)O)(C)C)C CTPAGZHGJPZMIV-UHFFFAOYSA-N 0.000 description 1
- FSOGTVJGZBKGDE-UHFFFAOYSA-N Cl.NC(CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1)(C)C Chemical compound Cl.NC(CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1)(C)C FSOGTVJGZBKGDE-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- PLDUPXSUYLZYBN-UHFFFAOYSA-N Fluphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 PLDUPXSUYLZYBN-UHFFFAOYSA-N 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- ZFMITUMMTDLWHR-UHFFFAOYSA-N Minoxidil Chemical compound NC1=[N+]([O-])C(N)=CC(N2CCCCC2)=N1 ZFMITUMMTDLWHR-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 241001516577 Phylloxera Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940125684 antimigraine agent Drugs 0.000 description 1
- 239000002282 antimigraine agent Substances 0.000 description 1
- 229940127218 antiplatelet drug Drugs 0.000 description 1
- 239000000164 antipsychotic agent Substances 0.000 description 1
- 229940005529 antipsychotics Drugs 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 229960002274 atenolol Drugs 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical class B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000005013 brain tissue Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- 229940070400 clinidine Drugs 0.000 description 1
- 238000003350 crude synaptosomal preparation Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- GNPCQCLIYQXNRC-IEBWSBKVSA-N ethyl (1s,2r)-2-(3-phenylquinolin-2-yl)sulfanylcyclopropane-1-carboxylate Chemical compound CCOC(=O)[C@@H]1C[C@H]1SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 GNPCQCLIYQXNRC-IEBWSBKVSA-N 0.000 description 1
- SAZVRBIIIQJYQT-UHFFFAOYSA-N ethyl 2-bromocyclopropane-1-carboxylate Chemical compound CCOC(=O)C1CC1Br SAZVRBIIIQJYQT-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 1
- 229960004801 imipramine Drugs 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Substances CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 230000007803 itching Effects 0.000 description 1
- QRYFGTULTGLGHU-NBERXCRTSA-N iturelix Chemical compound C([C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)NC(=O)[C@H](CCCCNC(=O)C=1C=NC=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)CCCNC(=O)C1=CC=CN=C1 QRYFGTULTGLGHU-NBERXCRTSA-N 0.000 description 1
- 108010083551 iturelix Proteins 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- YLUSDZORDPJHJE-RNFRBKRXSA-N methyl n-[(1r,2r)-2-iodocyclohexyl]carbamate Chemical compound COC(=O)N[C@@H]1CCCC[C@H]1I YLUSDZORDPJHJE-RNFRBKRXSA-N 0.000 description 1
- 229960003632 minoxidil Drugs 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- HVIXPSLXHVWFAU-UHFFFAOYSA-N n,n,2-trimethyl-1-(3-phenylquinolin-2-yl)sulfanylpropan-2-amine;hydrochloride Chemical compound Cl.CN(C)C(C)(C)CSC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 HVIXPSLXHVWFAU-UHFFFAOYSA-N 0.000 description 1
- POLQWUGBRUERKQ-UHFFFAOYSA-N n,n-dimethyl-2-(3-phenylquinolin-2-yl)sulfanylpropan-1-amine;hydrochloride Chemical compound Cl.CN(C)CC(C)SC1=NC2=CC=CC=C2C=C1C1=CC=CC=C1 POLQWUGBRUERKQ-UHFFFAOYSA-N 0.000 description 1
- CWINCCAVZKJOHM-UHFFFAOYSA-N n,n-dimethyl-2-(3-propan-2-ylquinolin-2-yl)sulfanylethanamine Chemical compound C1=CC=C2N=C(SCCN(C)C)C(C(C)C)=CC2=C1 CWINCCAVZKJOHM-UHFFFAOYSA-N 0.000 description 1
- VUKDHRQGHZISMW-UHFFFAOYSA-N n,n-dimethyl-2-(3-propan-2-ylquinolin-2-yl)sulfanylethanamine;hydrochloride Chemical compound Cl.C1=CC=C2N=C(SCCN(C)C)C(C(C)C)=CC2=C1 VUKDHRQGHZISMW-UHFFFAOYSA-N 0.000 description 1
- JRTOLDFHNMOLDW-UHFFFAOYSA-N n,n-dimethyl-2-[3-(4-methylphenyl)quinolin-2-yl]sulfanylethanamine Chemical compound CN(C)CCSC1=NC2=CC=CC=C2C=C1C1=CC=C(C)C=C1 JRTOLDFHNMOLDW-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- QWJXFNYAVPBLDW-UHFFFAOYSA-N n-(4-fluorophenyl)-2-phenylacetamide Chemical compound C1=CC(F)=CC=C1NC(=O)CC1=CC=CC=C1 QWJXFNYAVPBLDW-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- RBYMQIJKLZJKCD-UHFFFAOYSA-N n-[4-(2-methylphenyl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C1=CC=CC=C1C RBYMQIJKLZJKCD-UHFFFAOYSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000002090 nicotinolytic effect Effects 0.000 description 1
- 229960000965 nimesulide Drugs 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229960005489 paracetamol Drugs 0.000 description 1
- 230000001734 parasympathetic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- BIWOSRSKDCZIFM-UHFFFAOYSA-N piperidin-3-ol Chemical compound OC1CCCNC1 BIWOSRSKDCZIFM-UHFFFAOYSA-N 0.000 description 1
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 description 1
- 229960001289 prazosin Drugs 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 208000002815 pulmonary hypertension Diseases 0.000 description 1
- 239000006215 rectal suppository Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- DKGZKTPJOSAWFA-UHFFFAOYSA-N spiperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C(NCN2C=2C=CC=CC=2)=O)CC1 DKGZKTPJOSAWFA-UHFFFAOYSA-N 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 229960003329 sulfinpyrazone Drugs 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- UIJXHKXIOCDSEB-UHFFFAOYSA-N tert-butyl 3-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(O)C1 UIJXHKXIOCDSEB-UHFFFAOYSA-N 0.000 description 1
- KTMAYMHFKURUIC-LURJTMIESA-N tert-butyl N-[(1S)-1-hydroxypropyl]carbamate Chemical compound CC[C@H](O)NC(=O)OC(C)(C)C KTMAYMHFKURUIC-LURJTMIESA-N 0.000 description 1
- SBWYTQQSTIUXOP-UHFFFAOYSA-N tert-butyl n-(1-hydroxy-2-methylpropan-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)CO SBWYTQQSTIUXOP-UHFFFAOYSA-N 0.000 description 1
- PDAFIZPRSXHMCO-LURJTMIESA-N tert-butyl n-[(2s)-1-hydroxypropan-2-yl]carbamate Chemical compound OC[C@H](C)NC(=O)OC(C)(C)C PDAFIZPRSXHMCO-LURJTMIESA-N 0.000 description 1
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 231100000048 toxicity data Toxicity 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/42—Oxygen atoms attached in position 3 or 5
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/08—Antiepileptics; Anticonvulsants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C233/11—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to carbon atoms of an unsaturated carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/28—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0803—Compounds with Si-C or Si-Si linkages
- C07F7/081—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te
- C07F7/0812—Compounds with Si-C or Si-Si linkages comprising at least one atom selected from the elements N, O, halogen, S, Se or Te comprising a heterocyclic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pain & Pain Management (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8117642 | 1981-06-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU186523B true HU186523B (en) | 1985-08-28 |
Family
ID=10522379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU821828A HU186523B (en) | 1981-06-09 | 1982-06-07 | Process for producing quinoline derivatives |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4435405A (enExample) |
| EP (1) | EP0066993B1 (enExample) |
| JP (1) | JPS58965A (enExample) |
| AR (1) | AR230437A1 (enExample) |
| AT (1) | ATE11534T1 (enExample) |
| AU (1) | AU556719B2 (enExample) |
| CA (1) | CA1189077A (enExample) |
| CS (1) | CS238624B2 (enExample) |
| DE (1) | DE3262122D1 (enExample) |
| DK (1) | DK152428C (enExample) |
| ES (3) | ES8401034A1 (enExample) |
| FI (1) | FI77451C (enExample) |
| GR (1) | GR76452B (enExample) |
| HU (1) | HU186523B (enExample) |
| IE (1) | IE53064B1 (enExample) |
| IL (1) | IL65852A (enExample) |
| IN (1) | IN158970B (enExample) |
| NO (1) | NO161066C (enExample) |
| NZ (1) | NZ200878A (enExample) |
| PH (1) | PH18503A (enExample) |
| PL (1) | PL135871B1 (enExample) |
| PT (1) | PT75024B (enExample) |
| SU (1) | SU1192618A3 (enExample) |
| YU (2) | YU43269B (enExample) |
| ZA (1) | ZA823586B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE27152T1 (de) * | 1982-04-07 | 1987-05-15 | Ici Plc | Chinolin-derivate. |
| EP0093521B1 (en) * | 1982-05-04 | 1988-08-24 | Imperial Chemical Industries Plc | Quinoline derivatives |
| US4585866A (en) * | 1982-06-09 | 1986-04-29 | Merrell Dow Pharmaceuticals Inc. | Treatment of migraine with substituted tropyl benzoate derivatives |
| GB8308601D0 (en) * | 1983-03-29 | 1983-05-05 | Ici Plc | Heterocyclic compounds |
| JPS60166406A (ja) * | 1984-02-09 | 1985-08-29 | 株式会社イナックス | 乾式プレス装置の坏土充填方法 |
| GB8630071D0 (en) * | 1986-12-17 | 1987-01-28 | Glaxo Group Ltd | Medicaments |
| JP2733511B2 (ja) * | 1988-10-22 | 1998-03-30 | 日本臓器製薬株式会社 | 新規アミノアルカン誘導体 |
| JPH03147803A (ja) * | 1989-11-06 | 1991-06-24 | Tiger Mach Seisakusho:Kk | 表面多色変化模様のあるコンクリートブロックの製造方法 |
| US6566361B2 (en) | 1999-06-30 | 2003-05-20 | Laboratories, Upsa | Azapirone pain treatment |
| FR2795645B1 (fr) | 1999-06-30 | 2001-09-21 | Union Pharma Scient Appl | Nouvelle association pharmaceutique a activite analgesique |
| WO2001023350A1 (fr) * | 1999-09-28 | 2001-04-05 | Nihon Nohyaku Co., Ltd. | Derives de thioalkylamine et methode de preparation desdits derives |
| FR2810664B1 (fr) * | 2000-06-27 | 2004-12-24 | Adir | Nouveaux composes cyclopropaniques 1,1 et 1,2-dissubstitues, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| GB0306604D0 (en) * | 2003-03-21 | 2003-04-30 | Curidium Ltd | Second medical use |
| ATE511396T1 (de) | 2007-02-28 | 2011-06-15 | Thromboserin Ltd | Therapeutische zusammensetzungen enthaltend thromboserin oder dessen salze zur verwendung in der prophylaxe oder behandlung von thrombose in patienten mit blutungsrisiko |
| WO2009082268A2 (ru) | 2007-12-21 | 2009-07-02 | Alla Chem, Llc | ЛИГАНДЫ α-АДРЕНОЦЕПТОРОВ, ДОПАМИНОВЫХ, ГИСТАМИНОВЫХ, ИМИДАЗОЛИНОВЫХ И СЕРОТОНИНОВЫХ РЕЦЕПТОРОВ И ИХ ПРИМЕНЕНИЕ |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1049379B (de) | 1959-01-29 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen-Bayerwerk | Verfahren zur Herstellung von 4 - (tert.-Aminoalkylmercapto)chinolinverbindungen | |
| DE430960C (de) | 1924-07-11 | 1926-06-23 | J G Farbenindustrie Akt Ges | Verfahren zur Darstellung von basischen AEthern von Chinolinderivaten |
| US1572768A (en) | 1925-06-26 | 1926-02-09 | Winthrop Chem Co Inc | Pharmaceutical product |
| US1860286A (en) | 1929-05-16 | 1932-05-24 | Soc Of Chemical Ind | Basic ethers of aryl-quinolines |
| GB1511390A (en) * | 1975-12-04 | 1978-05-17 | Pfizer Ltd | Imidazolylalkyl sulphide antifungal agents |
| US4343805A (en) | 1978-12-16 | 1982-08-10 | John Wyeth & Brother Limited | Heterocyclic compounds |
-
1982
- 1982-05-19 IN IN381/DEL/82A patent/IN158970B/en unknown
- 1982-05-20 AU AU83863/82A patent/AU556719B2/en not_active Expired
- 1982-05-21 DE DE8282302607T patent/DE3262122D1/de not_active Expired
- 1982-05-21 AT AT82302607T patent/ATE11534T1/de not_active IP Right Cessation
- 1982-05-21 EP EP82302607A patent/EP0066993B1/en not_active Expired
- 1982-05-23 IL IL65852A patent/IL65852A/xx not_active IP Right Cessation
- 1982-05-24 ZA ZA823586A patent/ZA823586B/xx unknown
- 1982-05-25 IE IE1243/82A patent/IE53064B1/en not_active IP Right Cessation
- 1982-05-26 US US06/382,116 patent/US4435405A/en not_active Expired - Lifetime
- 1982-05-27 GR GR68281A patent/GR76452B/el unknown
- 1982-05-28 PH PH27361A patent/PH18503A/en unknown
- 1982-06-02 CA CA000404277A patent/CA1189077A/en not_active Expired
- 1982-06-02 FI FI821965A patent/FI77451C/fi not_active IP Right Cessation
- 1982-06-07 HU HU821828A patent/HU186523B/hu unknown
- 1982-06-08 PT PT75024A patent/PT75024B/pt unknown
- 1982-06-08 NO NO821904A patent/NO161066C/no not_active IP Right Cessation
- 1982-06-08 JP JP57097043A patent/JPS58965A/ja active Granted
- 1982-06-08 YU YU1232/82A patent/YU43269B/xx unknown
- 1982-06-08 PL PL1982236836A patent/PL135871B1/pl unknown
- 1982-06-08 CS CS824253A patent/CS238624B2/cs unknown
- 1982-06-08 NZ NZ200878A patent/NZ200878A/en unknown
- 1982-06-08 SU SU823450275A patent/SU1192618A3/ru active
- 1982-06-09 DK DK257782A patent/DK152428C/da not_active IP Right Cessation
- 1982-06-09 ES ES512960A patent/ES8401034A1/es not_active Expired
-
1983
- 1983-01-14 ES ES519006A patent/ES519006A0/es active Granted
- 1983-08-30 AR AR294046A patent/AR230437A1/es active
- 1983-09-01 ES ES525298A patent/ES8502688A1/es not_active Expired
-
1984
- 1984-11-08 YU YU1882/84A patent/YU42905B/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3507494B2 (ja) | タキキニン拮抗薬 | |
| EP1077940B1 (en) | 4-phenylpiperidines for the treatment of pruritic dermatoses | |
| US5348962A (en) | Hydroxyquinolone derivatives compounds which have pharmaceutical utility | |
| US20040242589A1 (en) | 3-arylsulfonyl-7-piperzinyl-indoles-benzofurans and -benzothiophenes with 5-ht6 receptor affinity for treating cns disorders | |
| EP1870405A1 (en) | Carbonylated (Aza)cyclohexanes as dopamine D3 receptor ligands | |
| CZ2004634A3 (cs) | Chinolinová sloučeninaŹ způsob výroby a použití a farmaceutický přípravek | |
| HU186523B (en) | Process for producing quinoline derivatives | |
| IL109234A (en) | Indole derivatives, their preparation and pharmaceutical compositions containing them | |
| AP877A (en) | Tetrahydroquinoline derivatives as EAA antagonists. | |
| KR20030059084A (ko) | 카르복사미드 화합물 및 이것의 사람 11cby 수용체의길항제로서의 용도 | |
| EP1066279A1 (en) | Imidazolone anorectic agents: ii. phenyl derivatives | |
| JP5355551B2 (ja) | キノロン化合物及び医薬組成物 | |
| SK50895A3 (en) | 3-indolylpiperidine derivative, method of its preparation, its use for preparation of pharmaceutical composition and pharmaceutical composition containing them | |
| CA2243474C (en) | Quinolin-2-(1h)-ones | |
| AU694212B2 (en) | Benzofuran derivatives as d4 receptor antagonists | |
| JPWO2009041559A1 (ja) | インダゾールアクリル酸アミド化合物 | |
| EP0093521B1 (en) | Quinoline derivatives | |
| US4243666A (en) | 4-Amino-2-piperidino-quinazolines | |
| EP0315405A1 (en) | 4-phenyl-4-(N-(2-fluorophenyl)amido) piperidine derivatives | |
| WO1999005095A1 (en) | Aminocycloalkane compounds | |
| US5376748A (en) | Nitroquinolone derivatives | |
| CA2012569A1 (en) | Benzothiopyranylamines | |
| JP3786983B2 (ja) | ピロリジノン誘導体 | |
| JP2012012388A (ja) | 医薬 | |
| SK2192002A3 (en) | Piperidine alcohol derivative, process for the preparation and use thereof and pharmaceutical composition comprising same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |