HU183293B - Process for preparing 1-/cyclohexyl/-4-aryl-4-piperidine-carboxylic acid derivatives - Google Patents
Process for preparing 1-/cyclohexyl/-4-aryl-4-piperidine-carboxylic acid derivatives Download PDFInfo
- Publication number
- HU183293B HU183293B HU81148A HU14881A HU183293B HU 183293 B HU183293 B HU 183293B HU 81148 A HU81148 A HU 81148A HU 14881 A HU14881 A HU 14881A HU 183293 B HU183293 B HU 183293B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- parts
- defined above
- phenyl
- Prior art date
Links
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 title abstract description 10
- 238000004519 manufacturing process Methods 0.000 title description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 90
- 230000001387 anti-histamine Effects 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 163
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 127
- 239000000203 mixture Substances 0.000 claims description 59
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 54
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 42
- -1 C 1-6 -alkoxy Chemical group 0.000 claims description 40
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 38
- 239000003054 catalyst Substances 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 29
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 18
- 238000010992 reflux Methods 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 14
- 229910052763 palladium Inorganic materials 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 229910052697 platinum Inorganic materials 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical group 0.000 claims description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 7
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 238000010533 azeotropic distillation Methods 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 claims description 5
- 239000000739 antihistaminic agent Substances 0.000 claims description 5
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 230000000694 effects Effects 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- VFOFBQDZFDIMFR-UHFFFAOYSA-N 2-phenylpiperidine-1-carboxylic acid Chemical class OC(=O)N1CCCCC1C1=CC=CC=C1 VFOFBQDZFDIMFR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 239000012298 atmosphere Substances 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 229910052987 metal hydride Inorganic materials 0.000 claims description 3
- 150000004681 metal hydrides Chemical class 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 238000007911 parenteral administration Methods 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 150000002576 ketones Chemical class 0.000 claims description 2
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 230000002829 reductive effect Effects 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- 230000002195 synergetic effect Effects 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- ZCGOMHNNNFPNMX-YHYDXASRSA-N Levocabastinum Chemical compound C1([C@@]2(C(O)=O)CCN(C[C@H]2C)C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)=CC=CC=C1 ZCGOMHNNNFPNMX-YHYDXASRSA-N 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 229940124531 pharmaceutical excipient Drugs 0.000 claims 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 6
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 description 131
- 239000002585 base Substances 0.000 description 94
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 93
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- 239000000243 solution Substances 0.000 description 49
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 45
- 238000006243 chemical reaction Methods 0.000 description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- 229960001701 chloroform Drugs 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- 239000000047 product Substances 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 26
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 23
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 22
- 238000003756 stirring Methods 0.000 description 22
- 239000011541 reaction mixture Substances 0.000 description 20
- 150000002431 hydrogen Chemical class 0.000 description 19
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000003480 eluent Substances 0.000 description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 229930192474 thiophene Natural products 0.000 description 11
- FNWWTNNFZGBMEM-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-oxocyclohexane-1-carbonitrile Chemical compound C1=CC(F)=CC=C1C1(C#N)CCC(=O)CC1 FNWWTNNFZGBMEM-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 239000008346 aqueous phase Substances 0.000 description 9
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 238000010828 elution Methods 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N methyl cyanide Natural products CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 235000017281 sodium acetate Nutrition 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 238000006845 Michael addition reaction Methods 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 3
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- DZZGGKPKWGPNJA-UHFFFAOYSA-N Normeperidinicacid Chemical class C=1C=CC=CC=1C1(C(=O)O)CCNCC1 DZZGGKPKWGPNJA-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229920002055 compound 48/80 Polymers 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- 150000002081 enamines Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- XRNHONQUDLZJPC-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C=C(C=CC=2)C(F)(F)F)(C#N)CC1 XRNHONQUDLZJPC-UHFFFAOYSA-N 0.000 description 2
- BQQAXQSWBZWPAQ-UHFFFAOYSA-N 1-(chloromethyl)-4-fluoro-2-methylbenzene Chemical compound CC1=CC(F)=CC=C1CCl BQQAXQSWBZWPAQ-UHFFFAOYSA-N 0.000 description 2
- VHULROKXGBQUDA-UHFFFAOYSA-N 2-(4-fluoro-2-methylphenyl)acetonitrile Chemical compound CC1=CC(F)=CC=C1CC#N VHULROKXGBQUDA-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- PLRXAFVBCHEMGD-UHFFFAOYSA-N 3-piperidin-1-ylpropan-1-ol Chemical compound OCCCN1CCCCC1 PLRXAFVBCHEMGD-UHFFFAOYSA-N 0.000 description 2
- IPEAFVGALSDSIF-UHFFFAOYSA-N 4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=CC=2)F)(C#N)CC1 IPEAFVGALSDSIF-UHFFFAOYSA-N 0.000 description 2
- YYFWRAUDAXLUTQ-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C(Cl)=O)CC1 YYFWRAUDAXLUTQ-UHFFFAOYSA-N 0.000 description 2
- GGEWQZXOTUPZNX-UHFFFAOYSA-N 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound COC1=CC=C(Cl)C=C1C1(C(O)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 GGEWQZXOTUPZNX-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- NJDLNVYIGQXVCT-UHFFFAOYSA-N benzyl 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylate Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 NJDLNVYIGQXVCT-UHFFFAOYSA-N 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- BYAHCVUFQWXWSI-UHFFFAOYSA-N ethyl 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=CC=C(Cl)C=2)OC)CCN1S(=O)(=O)C1=CC=C(C)C=C1 BYAHCVUFQWXWSI-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical class OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012439 solid excipient Substances 0.000 description 2
- 239000008223 sterile water Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- YSULUXOLTMBSFF-UHFFFAOYSA-N (4-fluoro-2-methylphenyl)methanol Chemical compound CC1=CC(F)=CC=C1CO YSULUXOLTMBSFF-UHFFFAOYSA-N 0.000 description 1
- WAPNOHKVXSQRPX-SSDOTTSWSA-N (R)-1-phenylethanol Chemical compound C[C@@H](O)C1=CC=CC=C1 WAPNOHKVXSQRPX-SSDOTTSWSA-N 0.000 description 1
- YTWIPFTXSGLNMH-UHFFFAOYSA-N 1,2-dimethylpiperidine-4-carboxamide Chemical compound CC1CC(C(N)=O)CCN1C YTWIPFTXSGLNMH-UHFFFAOYSA-N 0.000 description 1
- MHUFQTUDUIWESC-UHFFFAOYSA-N 1-(4-fluoro-2-methylphenyl)-4-oxocyclohexane-1-carbonitrile Chemical compound CC1=CC(F)=CC=C1C1(C#N)CCC(=O)CC1 MHUFQTUDUIWESC-UHFFFAOYSA-N 0.000 description 1
- YEXVKPVHKVOTBS-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C=C(C=CC=2)C(F)(F)F)(C(Cl)=O)CC1 YEXVKPVHKVOTBS-UHFFFAOYSA-N 0.000 description 1
- GQOUATHWNIOHDL-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C=C(C=CC=2)C(F)(F)F)(C(O)=O)CC1 GQOUATHWNIOHDL-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical class OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- VGYXMKUEUVWVSB-UHFFFAOYSA-N 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-4-(2-fluorophenyl)-3-methylpiperidine-4-carboxylic acid Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C(O)=O)C1=CC=CC=C1F VGYXMKUEUVWVSB-UHFFFAOYSA-N 0.000 description 1
- QSIAGSYOKYMGIK-UHFFFAOYSA-N 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-4-(2-fluorophenyl)-3-methylpiperidine-4-carboxylic acid;hydrochloride Chemical compound Cl.CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C(O)=O)C1=CC=CC=C1F QSIAGSYOKYMGIK-UHFFFAOYSA-N 0.000 description 1
- XCIQQZWJNVYGFZ-UHFFFAOYSA-N 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-4-phenylpiperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=C(F)C=C1 XCIQQZWJNVYGFZ-UHFFFAOYSA-N 0.000 description 1
- RJPNVPITBYXBNB-UHFFFAOYSA-N 1-bromo-4-fluoro-2-methylbenzene Chemical compound CC1=CC(F)=CC=C1Br RJPNVPITBYXBNB-UHFFFAOYSA-N 0.000 description 1
- NREUBTUYADXMHQ-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(CCl)=CC=C1Cl NREUBTUYADXMHQ-UHFFFAOYSA-N 0.000 description 1
- ZMFMOZGIQRPJEA-UHFFFAOYSA-N 1-cyclohexyl-4-phenylpiperidine Chemical class C1CCCCC1N1CCC(C=2C=CC=CC=2)CC1 ZMFMOZGIQRPJEA-UHFFFAOYSA-N 0.000 description 1
- INVROMPFKQTVQD-UHFFFAOYSA-N 1-phenyl-4-[4-phenyl-4-(piperidine-1-carbonyl)piperidin-1-yl]cyclohex-3-ene-1-carbonitrile Chemical compound C1CN(C=2CCC(CC=2)(C#N)C=2C=CC=CC=2)CCC1(C=1C=CC=CC=1)C(=O)N1CCCCC1 INVROMPFKQTVQD-UHFFFAOYSA-N 0.000 description 1
- FHCUCTFVFZRHID-UHFFFAOYSA-N 1-phenyl-4-[4-phenyl-4-(piperidine-1-carbonyl)piperidin-1-yl]cyclohexane-1-carbonitrile;hydrochloride Chemical compound Cl.C1CN(C2CCC(CC2)(C#N)C=2C=CC=CC=2)CCC1(C=1C=CC=CC=1)C(=O)N1CCCCC1 FHCUCTFVFZRHID-UHFFFAOYSA-N 0.000 description 1
- VJARIBGMDPJLCL-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)acetonitrile Chemical compound ClC1=CC=C(CC#N)C(Cl)=C1 VJARIBGMDPJLCL-UHFFFAOYSA-N 0.000 description 1
- JHQBLYITVCBGTO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C=C1 JHQBLYITVCBGTO-UHFFFAOYSA-N 0.000 description 1
- COYCHCYSJJZVQR-UHFFFAOYSA-N 2-(5-fluoro-2-methylphenyl)acetonitrile Chemical compound CC1=CC=C(F)C=C1CC#N COYCHCYSJJZVQR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MLJVBFZNPNMMCP-UHFFFAOYSA-N 2-[4-chloro-2-(trifluoromethyl)phenyl]acetonitrile Chemical compound FC(F)(F)C1=CC(Cl)=CC=C1CC#N MLJVBFZNPNMMCP-UHFFFAOYSA-N 0.000 description 1
- UESHPQPPVLJYLU-UHFFFAOYSA-N 2-ethylpiperidine-1-carboxylic acid Chemical compound CCC1CCCCN1C(O)=O UESHPQPPVLJYLU-UHFFFAOYSA-N 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- ONPJWQSDZCGSQM-UHFFFAOYSA-N 2-phenylprop-2-enoic acid Chemical compound OC(=O)C(=C)C1=CC=CC=C1 ONPJWQSDZCGSQM-UHFFFAOYSA-N 0.000 description 1
- UFQKATWGZBQOMS-UHFFFAOYSA-N 3,4-dihydroxypentanoic acid Chemical compound CC(O)C(O)CC(O)=O UFQKATWGZBQOMS-UHFFFAOYSA-N 0.000 description 1
- REKYPYSUBKSCAT-UHFFFAOYSA-N 3-hydroxypentanoic acid Chemical compound CCC(O)CC(O)=O REKYPYSUBKSCAT-UHFFFAOYSA-N 0.000 description 1
- VOGXNUPJCZPKOH-UHFFFAOYSA-N 4-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(Cl)=CC=2)Cl)(C#N)CC1 VOGXNUPJCZPKOH-UHFFFAOYSA-N 0.000 description 1
- QLECXHDYOXONGJ-UHFFFAOYSA-N 4-(2-fluorophenyl)-3-methyl-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound FC1=C(C=CC=C1)C1(C(CN(CC1)S(=O)(=O)C1=CC=C(C=C1)C)C)C#N QLECXHDYOXONGJ-UHFFFAOYSA-N 0.000 description 1
- JRQLMRDTCUBTNA-UHFFFAOYSA-N 4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound COC1=CC=CC=C1C1(C#N)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 JRQLMRDTCUBTNA-UHFFFAOYSA-N 0.000 description 1
- PFRIQQVXLNZKFP-UHFFFAOYSA-N 4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical group COC1=CC=CC=C1C1(C(O)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 PFRIQQVXLNZKFP-UHFFFAOYSA-N 0.000 description 1
- APLLEMWXOWUFCM-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C#N)CC1 APLLEMWXOWUFCM-UHFFFAOYSA-N 0.000 description 1
- ZPMQDIHZFCJQON-UHFFFAOYSA-N 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=C(Cl)C=CC=2)C)(C(O)=O)CC1 ZPMQDIHZFCJQON-UHFFFAOYSA-N 0.000 description 1
- KMWYAZOULFIPLF-UHFFFAOYSA-N 4-(4-chlorophenyl)-n,n-dimethylpiperidine-4-carboxamide Chemical compound C=1C=C(Cl)C=CC=1C1(C(=O)N(C)C)CCNCC1 KMWYAZOULFIPLF-UHFFFAOYSA-N 0.000 description 1
- IQHALOUVYPEAPM-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(F)=CC=2)C)(C#N)CC1 IQHALOUVYPEAPM-UHFFFAOYSA-N 0.000 description 1
- UQTGVCOKYKBMTP-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(F)=CC=2)C)(C(Cl)=O)CC1 UQTGVCOKYKBMTP-UHFFFAOYSA-N 0.000 description 1
- STKOBEGLGNQNAP-UHFFFAOYSA-N 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC(F)=CC=2)C)(C(O)=O)CC1 STKOBEGLGNQNAP-UHFFFAOYSA-N 0.000 description 1
- KJIZIGVYRJHSEO-UHFFFAOYSA-N 4-(5-chloro-2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound COC1=CC=C(Cl)C=C1C1(C(Cl)=O)CCN(S(=O)(=O)C=2C=CC(C)=CC=2)CC1 KJIZIGVYRJHSEO-UHFFFAOYSA-N 0.000 description 1
- CQJIGPGICAGYGI-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C#N)CC1 CQJIGPGICAGYGI-UHFFFAOYSA-N 0.000 description 1
- PHMBKRHVYVITEL-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbonyl chloride Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C(Cl)=O)CC1 PHMBKRHVYVITEL-UHFFFAOYSA-N 0.000 description 1
- HIFMUWZZNPWVNT-UHFFFAOYSA-N 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(C=2C(=CC=C(F)C=2)C)(C(O)=O)CC1 HIFMUWZZNPWVNT-UHFFFAOYSA-N 0.000 description 1
- DPBWFNDFMCCGGJ-UHFFFAOYSA-N 4-Piperidine carboxamide Chemical compound NC(=O)C1CCNCC1 DPBWFNDFMCCGGJ-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- WNWVKZTYMQWFHE-UHFFFAOYSA-N 4-ethylmorpholine Chemical group [CH2]CN1CCOCC1 WNWVKZTYMQWFHE-UHFFFAOYSA-N 0.000 description 1
- RYGXCMJMVYJVGM-UHFFFAOYSA-N 4-oxo-1-pyridin-2-ylcyclohexane-1-carbonitrile Chemical compound C1CC(=O)CCC1(C#N)C1=CC=CC=N1 RYGXCMJMVYJVGM-UHFFFAOYSA-N 0.000 description 1
- DYANFOFNHRHFGZ-UHFFFAOYSA-N 4-phenylpiperidine-4-carbonyl chloride;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1(C(=O)Cl)CCNCC1 DYANFOFNHRHFGZ-UHFFFAOYSA-N 0.000 description 1
- JPUKONSIEHCAQA-UHFFFAOYSA-N 4-phenylpiperidine-4-carboxamide Chemical compound C=1C=CC=CC=1C1(C(=O)N)CCNCC1 JPUKONSIEHCAQA-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- CNKUBSWMHWKTGZ-UHFFFAOYSA-N CO.ClC1=C(C=CC=C1)C(F)(F)F Chemical compound CO.ClC1=C(C=CC=C1)C(F)(F)F CNKUBSWMHWKTGZ-UHFFFAOYSA-N 0.000 description 1
- 206010009192 Circulatory collapse Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- OURRXQUGYQRVML-AREMUKBSSA-N [4-[(2s)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate Chemical compound CC1=CC(C)=CC=C1C(=O)OCC1=CC=C([C@@H](CN)C(=O)NC=2C=C3C=CN=CC3=CC=2)C=C1 OURRXQUGYQRVML-AREMUKBSSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000013011 aqueous formulation Substances 0.000 description 1
- 150000004792 aryl magnesium halides Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- KMIIXHWQCAAVAK-UHFFFAOYSA-N benzyl 1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-4-(2-fluorophenyl)-3-methylpiperidine-4-carboxylate Chemical compound CC1CN(C2CCC(CC2)(C#N)C=2C=CC(F)=CC=2)CCC1(C=1C(=CC=CC=1)F)C(=O)OCC1=CC=CC=C1 KMIIXHWQCAAVAK-UHFFFAOYSA-N 0.000 description 1
- JHAQCDVSKFELGB-UHFFFAOYSA-N benzyl 3-methyl-4-phenylpiperidine-4-carboxylate Chemical compound CC1CNCCC1(C=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 JHAQCDVSKFELGB-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001721 carbon Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- MTGYIZREWZMYCL-UHFFFAOYSA-N ethyl 1-(4-cyano-4-phenylcyclohexen-1-yl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=CC=C1 MTGYIZREWZMYCL-UHFFFAOYSA-N 0.000 description 1
- CEEOQIFZVMNMNF-UHFFFAOYSA-N ethyl 1-(4-cyano-4-phenylcyclohexyl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=CC=C1 CEEOQIFZVMNMNF-UHFFFAOYSA-N 0.000 description 1
- BKZFYLFPQVGOTM-UHFFFAOYSA-N ethyl 1-(4-cyano-4-pyridin-2-ylcyclohexyl)-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=CC=N1 BKZFYLFPQVGOTM-UHFFFAOYSA-N 0.000 description 1
- YHCJFDQFCZIRLM-UHFFFAOYSA-N ethyl 1-(4-methoxyphenyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)CCN1C1=CC=C(OC)C=C1 YHCJFDQFCZIRLM-UHFFFAOYSA-N 0.000 description 1
- AVGHPYONFURRIC-UHFFFAOYSA-N ethyl 1-(4-methylphenyl)sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=C(C=CC=2)C(F)(F)F)CCN1S(=O)(=O)C1=CC=C(C)C=C1 AVGHPYONFURRIC-UHFFFAOYSA-N 0.000 description 1
- WFYINZLCFHNTMC-UHFFFAOYSA-N ethyl 1-[4-(4-chlorophenyl)-4-cyanocyclohexen-1-yl]-4-phenylpiperidine-4-carboxylate Chemical group C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=C(Cl)C=C1 WFYINZLCFHNTMC-UHFFFAOYSA-N 0.000 description 1
- GRIFSQKSHSXGQS-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-fluoro-2-methylphenyl)cyclohexyl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=C(F)C=C1C GRIFSQKSHSXGQS-UHFFFAOYSA-N 0.000 description 1
- FHWBUJSKRYRENQ-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-methoxyphenyl)cyclohexen-1-yl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)=CCC1(C#N)C1=CC=C(OC)C=C1 FHWBUJSKRYRENQ-UHFFFAOYSA-N 0.000 description 1
- LZLMOXJDFGPISM-UHFFFAOYSA-N ethyl 1-[4-cyano-4-(4-methoxyphenyl)cyclohexyl]-4-phenylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1C(CC1)CCC1(C#N)C1=CC=C(OC)C=C1 LZLMOXJDFGPISM-UHFFFAOYSA-N 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical group CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- ZAIHLOCRLUZMLV-UHFFFAOYSA-N ethyl 4-(2,4-dichlorophenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=C(Cl)C=1C1(C(=O)OCC)CCNCC1 ZAIHLOCRLUZMLV-UHFFFAOYSA-N 0.000 description 1
- RVZZSPDCBKQJPE-UHFFFAOYSA-N ethyl 4-(2-fluorophenyl)piperidine-4-carboxylate Chemical compound C=1C=CC=C(F)C=1C1(C(=O)OCC)CCNCC1 RVZZSPDCBKQJPE-UHFFFAOYSA-N 0.000 description 1
- FNNBDUCZTBPRNS-UHFFFAOYSA-N ethyl 4-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=CC=CC=2)OC)CCN1S(=O)(=O)C1=CC=C(C)C=C1 FNNBDUCZTBPRNS-UHFFFAOYSA-N 0.000 description 1
- FWGBILJBFMPONQ-UHFFFAOYSA-N ethyl 4-(2-methoxyphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC=C(OC)C=1C1(C(=O)OCC)CCNCC1 FWGBILJBFMPONQ-UHFFFAOYSA-N 0.000 description 1
- WSVAFFOPFBYYFB-UHFFFAOYSA-N ethyl 4-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=C(Cl)C=CC=2)C)CCN1S(=O)(=O)C1=CC=C(C)C=C1 WSVAFFOPFBYYFB-UHFFFAOYSA-N 0.000 description 1
- KFLZJCKZAZUXBT-UHFFFAOYSA-N ethyl 4-(3-chloro-2-methylphenyl)piperidine-4-carboxylate Chemical compound C=1C=CC(Cl)=C(C)C=1C1(C(=O)OCC)CCNCC1 KFLZJCKZAZUXBT-UHFFFAOYSA-N 0.000 description 1
- MTUKGHQGRVKLRQ-UHFFFAOYSA-N ethyl 4-(3-ethoxycarbonylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.CCOC(=O)C1=CC=CC(C2(CCNCC2)C(=O)OCC)=C1 MTUKGHQGRVKLRQ-UHFFFAOYSA-N 0.000 description 1
- GJRKDOZMTZOXPN-UHFFFAOYSA-N ethyl 4-(3-methylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC(C)=CC=1C1(C(=O)OCC)CCNCC1 GJRKDOZMTZOXPN-UHFFFAOYSA-N 0.000 description 1
- JKZZYHKEWOAMDX-UHFFFAOYSA-N ethyl 4-(4-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=CC(F)=CC=2)C)CCN1S(=O)(=O)C1=CC=C(C)C=C1 JKZZYHKEWOAMDX-UHFFFAOYSA-N 0.000 description 1
- WUKZLPFAPAYONG-UHFFFAOYSA-N ethyl 4-(4-fluoro-2-methylphenyl)piperidine-4-carboxylate Chemical group C=1C=C(F)C=C(C)C=1C1(C(=O)OCC)CCNCC1 WUKZLPFAPAYONG-UHFFFAOYSA-N 0.000 description 1
- JHXJBUKUHQPFON-UHFFFAOYSA-N ethyl 4-(5-chloro-2-methoxyphenyl)piperidine-4-carboxylate Chemical compound C=1C(Cl)=CC=C(OC)C=1C1(C(=O)OCC)CCNCC1 JHXJBUKUHQPFON-UHFFFAOYSA-N 0.000 description 1
- ZHGRQJWTLZJPNH-UHFFFAOYSA-N ethyl 4-(5-fluoro-2-methylphenyl)-1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(C=2C(=CC=C(F)C=2)C)CCN1S(=O)(=O)C1=CC=C(C)C=C1 ZHGRQJWTLZJPNH-UHFFFAOYSA-N 0.000 description 1
- HDJXDDARIBRLEJ-UHFFFAOYSA-N ethyl 4-(5-fluoro-2-methylphenyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C(F)=CC=C(C)C=1C1(C(=O)OCC)CCNCC1 HDJXDDARIBRLEJ-UHFFFAOYSA-N 0.000 description 1
- QWPZTQCCONTMPI-UHFFFAOYSA-N ethyl 4-[3-(trifluoromethyl)phenyl]piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C=1C=CC(C(F)(F)F)=CC=1C1(C(=O)OCC)CCNCC1 QWPZTQCCONTMPI-UHFFFAOYSA-N 0.000 description 1
- BBWMASBANDIFMV-UHFFFAOYSA-N ethyl 4-phenylpiperidine-4-carboxylate;hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C1(C(=O)OCC)CC[NH2+]CC1 BBWMASBANDIFMV-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002496 iodine Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PTVBBIMKLOMGSY-UHFFFAOYSA-N n,n-bis(2-chloroethyl)-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N(CCCl)CCCl)C=C1 PTVBBIMKLOMGSY-UHFFFAOYSA-N 0.000 description 1
- KQWQFEKDXWRGMD-UHFFFAOYSA-N n-(2-chloroethyl)-4-methylbenzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)NCCCl)C=C1 KQWQFEKDXWRGMD-UHFFFAOYSA-N 0.000 description 1
- IJZSFOIZVXCSFP-UHFFFAOYSA-N n-(4-bromo-2-methylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(Br)C=C1C IJZSFOIZVXCSFP-UHFFFAOYSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- QKHMFBKXTNQCTM-UHFFFAOYSA-N norpethidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCNCC1 QKHMFBKXTNQCTM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- FSDNTQSJGHSJBG-UHFFFAOYSA-N piperidine-4-carbonitrile Chemical class N#CC1CCNCC1 FSDNTQSJGHSJBG-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000011158 quantitative evaluation Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 206010040560 shock Diseases 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/64—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
- C07C29/40—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones with compounds containing carbon-to-metal bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/96—Sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11492480A | 1980-01-24 | 1980-01-24 | |
| US06/191,631 US4369184A (en) | 1980-01-24 | 1980-09-29 | 1-(Cyclohexyl)-4-aryl-4-piperidinecarboxylic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU183293B true HU183293B (en) | 1984-04-28 |
Family
ID=26812674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU81148A HU183293B (en) | 1980-01-24 | 1981-01-23 | Process for preparing 1-/cyclohexyl/-4-aryl-4-piperidine-carboxylic acid derivatives |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4369184A (en:Method) |
| EP (1) | EP0034415B1 (en:Method) |
| AU (1) | AU538130B2 (en:Method) |
| BG (2) | BG35465A3 (en:Method) |
| CA (1) | CA1187080A (en:Method) |
| CS (1) | CS221818B2 (en:Method) |
| DE (1) | DE3163787D1 (en:Method) |
| DK (1) | DK152670C (en:Method) |
| ES (2) | ES498793A0 (en:Method) |
| FI (1) | FI76562C (en:Method) |
| GR (1) | GR71898B (en:Method) |
| HK (1) | HK81088A (en:Method) |
| HU (1) | HU183293B (en:Method) |
| IE (1) | IE50706B1 (en:Method) |
| IL (1) | IL61968A (en:Method) |
| LU (1) | LU88220I2 (en:Method) |
| MA (1) | MA19046A1 (en:Method) |
| MY (1) | MY8700593A (en:Method) |
| NL (1) | NL930017I2 (en:Method) |
| NO (1) | NO1994012I1 (en:Method) |
| NZ (1) | NZ196117A (en:Method) |
| PH (1) | PH16611A (en:Method) |
| PL (2) | PL127679B1 (en:Method) |
| SU (1) | SU1230467A3 (en:Method) |
| YU (1) | YU48446B (en:Method) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6322584A (ja) * | 1986-07-15 | 1988-01-30 | Senjiyu Seiyaku Kk | 1−ハイドロキシ−5−オキソ−5H−ピリド〔3,2−a〕フエノキサジン−3−カルボン酸エステル類 |
| DE4108527A1 (de) * | 1991-03-15 | 1992-09-17 | Basf Ag | Neue 1-(4-cyano-4-aryl-cyclohexyl)piperazine, ihre herstellung und verwendung |
| SE9400447D0 (sv) * | 1994-02-11 | 1994-02-11 | Astra Ab | New compounds |
| AU1716995A (en) * | 1994-03-18 | 1995-10-09 | Ciba-Geigy Ag | Aqueous solution of levocabastine for ophthalmic use |
| US5661163A (en) * | 1995-06-07 | 1997-08-26 | Merck & Co., Inc. | Alpha-1a adrenergic receptor antagonists |
| JP2000509374A (ja) | 1996-04-19 | 2000-07-25 | アルファ セラピュティック コーポレイション | 凍結乾燥した血液タンパク質のウイルス不活性化方法 |
| US6267986B1 (en) | 1999-09-24 | 2001-07-31 | Ranbaxy Laboratories Limited | Process for the preparation of a controlled drug delivery system containing pseudoephedrine and a long acting antihistamine |
| US20020146409A1 (en) * | 2001-01-30 | 2002-10-10 | Herring Steven W. | Methods for stabilizing lyophilized blood proteins |
| ATE472329T1 (de) * | 2002-08-30 | 2010-07-15 | Nycomed Gmbh | Verwendung der kombination von ciclesonid und antihistaminika zur behandlung von allergischer rhinitis |
| BRPI0706365A2 (pt) | 2006-01-06 | 2011-03-22 | Sepracor Inc | Cicloalquilaminas como inibidores da recaptação de monoamina |
| ES2391585T3 (es) | 2006-06-01 | 2012-11-28 | Msd Consumer Care, Inc. | Formulación farmacéutica de liberación sostenida que comprende fenilefrina |
| NZ573174A (en) | 2006-06-01 | 2012-01-12 | Msd Consumer Care Inc | Sustained release pharmaceutical dosage form containing phenylephrine |
| CN101951886A (zh) * | 2007-12-21 | 2011-01-19 | 先灵-普劳健康护理产品公司 | 增强羟甲唑啉的光稳定性 |
| JP6083818B2 (ja) | 2011-11-18 | 2017-02-22 | ヘプタレス セラピューティクス リミテッドHeptares Therapeutics Limited | ムスカリンm1受容体アゴニスト |
| GB201404922D0 (en) | 2014-03-19 | 2014-04-30 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
| GB201513743D0 (en) | 2015-08-03 | 2015-09-16 | Heptares Therapeutics Ltd | Muscarinic agonists |
| GB201519352D0 (en) | 2015-11-02 | 2015-12-16 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
| US10259787B2 (en) | 2016-10-14 | 2019-04-16 | Heptares Therapeutics Limited | Substituted cyclohexanes as muscarinic M1 receptor and/or M4 receptor agonists |
| GB201617454D0 (en) | 2016-10-14 | 2016-11-30 | Heptares Therapeutics Limited | Pharmaceutical compounds |
| GB201810239D0 (en) | 2018-06-22 | 2018-08-08 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
| GB201819960D0 (en) | 2018-12-07 | 2019-01-23 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
| GB201819961D0 (en) | 2018-12-07 | 2019-01-23 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
| GB202020191D0 (en) | 2020-12-18 | 2021-02-03 | Heptares Therapeutics Ltd | Pharmaceutical compounds |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1206436B (de) * | 1957-07-05 | 1965-12-09 | Janssen Pharmaceutica Nv | Verfahren zur Herstellung von Derivaten von 2, 2-Diaryl-4-(4'-phenyl-piperidino)-butyronitrilen |
| NL127792C (en:Method) * | 1965-06-29 |
-
1980
- 1980-09-29 US US06/191,631 patent/US4369184A/en not_active Expired - Lifetime
-
1981
- 1981-01-08 GR GR63814A patent/GR71898B/el unknown
- 1981-01-16 AU AU66255/81A patent/AU538130B2/en not_active Expired
- 1981-01-21 CS CS81435A patent/CS221818B2/cs unknown
- 1981-01-22 DK DK029381A patent/DK152670C/da not_active IP Right Cessation
- 1981-01-22 MA MA19247A patent/MA19046A1/fr unknown
- 1981-01-22 PH PH25120A patent/PH16611A/en unknown
- 1981-01-23 CA CA000369180A patent/CA1187080A/en not_active Expired
- 1981-01-23 ES ES498793A patent/ES498793A0/es active Granted
- 1981-01-23 SU SU813233002A patent/SU1230467A3/ru active
- 1981-01-23 EP EP81300313A patent/EP0034415B1/en not_active Expired
- 1981-01-23 LU LU88220C patent/LU88220I2/xx unknown
- 1981-01-23 BG BG050518A patent/BG35465A3/xx unknown
- 1981-01-23 PL PL1981229365A patent/PL127679B1/pl unknown
- 1981-01-23 HU HU81148A patent/HU183293B/hu unknown
- 1981-01-23 IE IE125/81A patent/IE50706B1/en not_active IP Right Cessation
- 1981-01-23 PL PL1981233921A patent/PL127483B1/pl unknown
- 1981-01-23 FI FI810193A patent/FI76562C/fi not_active IP Right Cessation
- 1981-01-23 YU YU18381A patent/YU48446B/sh unknown
- 1981-01-23 DE DE8181300313T patent/DE3163787D1/de not_active Expired
- 1981-01-23 IL IL61968A patent/IL61968A/xx not_active IP Right Cessation
- 1981-01-26 NZ NZ196117A patent/NZ196117A/en unknown
- 1981-12-30 ES ES508441A patent/ES508441A0/es active Granted
-
1987
- 1987-12-30 MY MY593/87A patent/MY8700593A/xx unknown
-
1988
- 1988-10-06 HK HK810/88A patent/HK81088A/en not_active IP Right Cessation
-
1993
- 1993-03-02 NL NL930017C patent/NL930017I2/nl unknown
- 1993-06-16 BG BG097872A patent/BG60472B2/bg unknown
-
1994
- 1994-08-30 NO NO1994012C patent/NO1994012I1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU183293B (en) | Process for preparing 1-/cyclohexyl/-4-aryl-4-piperidine-carboxylic acid derivatives | |
| US4126689A (en) | N-aryl-n-(1-alkyl-4-piperidinyl)-arylacetamides | |
| US3998834A (en) | N-(4-piperidinyl)-n-phenylamides and -carbamates | |
| EP0160422B1 (en) | N-aryl-n-(4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds | |
| US4329353A (en) | 1-(4-Aryl-cyclohexyl)piperidine derivatives, method of use thereof and pharmaceutical compositions thereof | |
| US4355037A (en) | 3-(4-Piperidyl)-1,2-benzisoxales | |
| US4179569A (en) | N-(4-piperidinyl)-N-phenylamides | |
| SK98098A3 (en) | Optical resolution of methylphenidate to enantiomers by 0,0'-bisaroyl-2,3-dihydroxybutanedione acids | |
| EP0674514A1 (en) | Use of aryloxyalkyl substituted cyclic amines as calcium channel antagonists and new phenyloxyalkyl piperidin derivatives | |
| CA2076146A1 (en) | Piperidine derivatives | |
| IE921215A1 (en) | Prodrug esters of phenolic 2-piperidino-1-alkanols | |
| SU747424A3 (ru) | Способ получени -арил- (1- -4-пиперидинил) ацетамидов или их солей | |
| US4197304A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| KR840002003B1 (ko) | 1-(시클로헥실)-4-아릴-4-피폐리딘카르복산 유도체의 제조방법 | |
| US4196210A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US20050148583A1 (en) | Phenoxyalkylamine derivatives useful as opioid delta receptor ligands | |
| HU187362B (en) | Process for producing 1-bracket-4-aryl-cyclohexyl-bracket closed-piperidine derivatives | |
| US20020099214A1 (en) | Compounds useful in therapy | |
| US4411904A (en) | Diphenylpropanamines, compositions thereof and use thereof | |
| US4157393A (en) | N-aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| US6881845B2 (en) | Process for preparing (±)trans-4-p-fluorophenyl-3-hydroxymethyl-1-methylpiperidine | |
| EP0502031B1 (en) | N-substituted azaheterocyclic carboxylic acids and a pharmaceutical composition | |
| AU606314B2 (en) | Hydropyridine derivatives | |
| US4197303A (en) | N-Aryl-N-(1-L-4-piperidinyl)-arylacetamides | |
| JPS6130668B2 (en:Method) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |