HU176057B - Insecticide compositions containing 4-/benzoyl-ureido/-2,4-dichloro-diphenyl-ether derivatives as active substances and process for preparing the active materials - Google Patents
Insecticide compositions containing 4-/benzoyl-ureido/-2,4-dichloro-diphenyl-ether derivatives as active substances and process for preparing the active materials Download PDFInfo
- Publication number
- HU176057B HU176057B HU76BA3428A HUBA003428A HU176057B HU 176057 B HU176057 B HU 176057B HU 76BA3428 A HU76BA3428 A HU 76BA3428A HU BA003428 A HUBA003428 A HU BA003428A HU 176057 B HU176057 B HU 176057B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- active ingredient
- weight
- benzoyl
- derivative
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 28
- 239000002917 insecticide Substances 0.000 title abstract 2
- 239000013543 active substance Substances 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000011149 active material Substances 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 14
- 230000000749 insecticidal effect Effects 0.000 claims abstract description 8
- 239000004480 active ingredient Substances 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000003995 emulsifying agent Substances 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- -1 benzoylureido Chemical group 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000000969 carrier Substances 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- 150000003936 benzamides Chemical class 0.000 claims description 4
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical class O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims description 4
- 239000012159 carrier gas Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000002270 dispersing agent Substances 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 239000004088 foaming agent Substances 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- GYNAVKULVOETAD-UHFFFAOYSA-N n-phenoxyaniline Chemical class C=1C=CC=CC=1NOC1=CC=CC=C1 GYNAVKULVOETAD-UHFFFAOYSA-N 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 239000012467 final product Substances 0.000 claims description 2
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims 1
- 239000003349 gelling agent Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 14
- 150000002170 ethers Chemical class 0.000 abstract description 4
- 238000002360 preparation method Methods 0.000 abstract description 3
- 230000003389 potentiating effect Effects 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 238000009472 formulation Methods 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 241000254173 Coleoptera Species 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 229920000151 polyglycol Polymers 0.000 description 6
- 239000010695 polyglycol Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 241001124076 Aphididae Species 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 4
- KGGHWIKBOIQEAJ-UHFFFAOYSA-N 2-fluorobenzamide Chemical compound NC(=O)C1=CC=CC=C1F KGGHWIKBOIQEAJ-UHFFFAOYSA-N 0.000 description 4
- 240000007124 Brassica oleracea Species 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 235000013312 flour Nutrition 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 239000011435 rock Substances 0.000 description 4
- ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 2-chlorobenzoyl isocyanate Chemical compound ClC1=CC=CC=C1C(=O)N=C=O ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 241001608568 Phaedon Species 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 230000001055 chewing effect Effects 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- VPGSXIKVUASQIY-UHFFFAOYSA-N 1,2-dibutylnaphthalene Chemical compound C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 VPGSXIKVUASQIY-UHFFFAOYSA-N 0.000 description 2
- RBGDLYUEXLWQBZ-UHFFFAOYSA-N 2-chlorobenzamide Chemical compound NC(=O)C1=CC=CC=C1Cl RBGDLYUEXLWQBZ-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- OQOCWFFSZSSEDS-UHFFFAOYSA-N 3-chloro-4-(4-chlorophenoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=C(Cl)C=C1 OQOCWFFSZSSEDS-UHFFFAOYSA-N 0.000 description 2
- 241001143309 Acanthoscelides obtectus Species 0.000 description 2
- 241000238818 Acheta domesticus Species 0.000 description 2
- 241001425390 Aphis fabae Species 0.000 description 2
- 240000003291 Armoracia rusticana Species 0.000 description 2
- 235000011330 Armoracia rusticana Nutrition 0.000 description 2
- 241001510109 Blaberus giganteus Species 0.000 description 2
- 235000011303 Brassica alboglabra Nutrition 0.000 description 2
- 235000011302 Brassica oleracea Nutrition 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011299 Brassica oleracea var botrytis Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 240000003259 Brassica oleracea var. botrytis Species 0.000 description 2
- 241001664260 Byturus tomentosus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000257303 Hymenoptera Species 0.000 description 2
- 241000255777 Lepidoptera Species 0.000 description 2
- 241000257166 Lucilia cuprina Species 0.000 description 2
- 241000255676 Malacosoma Species 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 241000721621 Myzus persicae Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000238675 Periplaneta americana Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241000500439 Plutella Species 0.000 description 2
- 241000500437 Plutella xylostella Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 241001510236 Rhyparobia maderae Species 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 1
- NHNAEZDWNCRWRW-UHFFFAOYSA-N 2-bromobenzamide Chemical compound NC(=O)C1=CC=CC=C1Br NHNAEZDWNCRWRW-UHFFFAOYSA-N 0.000 description 1
- WGFILESHIVMXAY-UHFFFAOYSA-N 2-bromobenzoyl isocyanate Chemical compound BrC1=CC=CC=C1C(=O)N=C=O WGFILESHIVMXAY-UHFFFAOYSA-N 0.000 description 1
- PYICUGLWMXYTNN-UHFFFAOYSA-N 2-chloro-1-(4-chlorophenoxy)-4-isocyanatobenzene Chemical compound C1=CC(Cl)=CC=C1OC1=CC=C(N=C=O)C=C1Cl PYICUGLWMXYTNN-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- REUCDVKHMVGFOG-UHFFFAOYSA-N 2-fluorobenzoyl isocyanate Chemical compound FC1=CC=CC=C1C(=O)N=C=O REUCDVKHMVGFOG-UHFFFAOYSA-N 0.000 description 1
- XXUNIGZDNWWYED-UHFFFAOYSA-N 2-methylbenzamide Chemical compound CC1=CC=CC=C1C(N)=O XXUNIGZDNWWYED-UHFFFAOYSA-N 0.000 description 1
- RZMVHCYCUAKRMM-UHFFFAOYSA-N 2-methylbenzoyl isocyanate Chemical compound CC1=CC=CC=C1C(=O)N=C=O RZMVHCYCUAKRMM-UHFFFAOYSA-N 0.000 description 1
- JGFOIVLPTZNBQC-UHFFFAOYSA-N 3-chloro-4-(2,4-dichlorophenoxy)aniline Chemical compound ClC1=CC(N)=CC=C1OC1=CC=C(Cl)C=C1Cl JGFOIVLPTZNBQC-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- 241000881711 Acipenser sturio Species 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 241001136265 Agriotes Species 0.000 description 1
- 241000218475 Agrotis segetum Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000387321 Aspidiotus nerii Species 0.000 description 1
- 241000238788 Blaberus craniifer Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 241000252826 Brahmaea certhia Species 0.000 description 1
- 241000907225 Bruchidius Species 0.000 description 1
- 241000257163 Calliphora vicina Species 0.000 description 1
- 241000255579 Ceratitis capitata Species 0.000 description 1
- 241000254137 Cicadidae Species 0.000 description 1
- 241001414836 Cimex Species 0.000 description 1
- 241001479447 Coccus hesperidum Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241001094913 Cryptomyzus Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000214781 Depressaria daucella Species 0.000 description 1
- 241001641895 Dermestes Species 0.000 description 1
- 241001641896 Dermestes lardarius Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- 241001127100 Dryocopus martius Species 0.000 description 1
- 241001581006 Dysaphis plantaginea Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- 241000630736 Ephestia Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000483001 Euproctis chrysorrhoea Species 0.000 description 1
- 241000239245 Euscelis Species 0.000 description 1
- 241000953886 Fannia canicularis Species 0.000 description 1
- 241000287227 Fringillidae Species 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241001675057 Gastrophysa viridula Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 241000652697 Henschoutedenia flexivitta Species 0.000 description 1
- 241001659688 Hercinothrips femoralis Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241000256602 Isoptera Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000254158 Lampyridae Species 0.000 description 1
- 241000948337 Lasius niger Species 0.000 description 1
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 241000193981 Loxostege sticticalis Species 0.000 description 1
- 241000721703 Lymantria dispar Species 0.000 description 1
- 241000721714 Macrosiphum euphorbiae Species 0.000 description 1
- 235000011430 Malus pumila Nutrition 0.000 description 1
- 244000070406 Malus silvestris Species 0.000 description 1
- 235000015103 Malus silvestris Nutrition 0.000 description 1
- 241000254099 Melolontha melolontha Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000332345 Myzus cerasi Species 0.000 description 1
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical class NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 description 1
- 241000961933 Nephotettix virescens Species 0.000 description 1
- 244000187664 Nerium oleander Species 0.000 description 1
- 241001491877 Operophtera brumata Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- 241000257186 Phormia regina Species 0.000 description 1
- 241000255969 Pieris brassicae Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 235000005805 Prunus cerasus Nutrition 0.000 description 1
- 235000014441 Prunus serotina Nutrition 0.000 description 1
- 241000722238 Pseudococcus maritimus Species 0.000 description 1
- 241001350474 Rhopalosiphum nymphaeae Species 0.000 description 1
- 241000125167 Rhopalosiphum padi Species 0.000 description 1
- 241001510241 Rhyparobia Species 0.000 description 1
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 1
- 235000001535 Ribes X utile Nutrition 0.000 description 1
- 235000016919 Ribes petraeum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 241001412173 Rubus canescens Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 241000256251 Spodoptera frugiperda Species 0.000 description 1
- 241000256250 Spodoptera littoralis Species 0.000 description 1
- 241001494115 Stomoxys calcitrans Species 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 241001238451 Tortrix viridana Species 0.000 description 1
- 241001414831 Triatoma infestans Species 0.000 description 1
- 241000254113 Tribolium castaneum Species 0.000 description 1
- 241000893966 Trichophyton verrucosum Species 0.000 description 1
- 241000267822 Trogoderma granarium Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XUFQPHANEAPEMJ-UHFFFAOYSA-N famotidine Chemical compound NC(N)=NC1=NC(CSCCC(N)=NS(N)(=O)=O)=CS1 XUFQPHANEAPEMJ-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/34—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the groups, e.g. biuret; Thio analogues thereof; Urea-aldehyde condensation products
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2531202A DE2531202C2 (de) | 1975-07-12 | 1975-07-12 | 2',4-Dichlor-4'-benzoylureido- diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU176057B true HU176057B (en) | 1980-12-28 |
Family
ID=5951355
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU76BA3428A HU176057B (en) | 1975-07-12 | 1976-07-06 | Insecticide compositions containing 4-/benzoyl-ureido/-2,4-dichloro-diphenyl-ether derivatives as active substances and process for preparing the active materials |
Country Status (37)
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| USRE32418E (en) * | 1977-05-13 | 1987-05-12 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4170657A (en) * | 1977-05-13 | 1979-10-09 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| US4117009A (en) * | 1977-06-09 | 1978-09-26 | Gaf Corporation | Method of making N-[4-chlorophenyl)amino]carbonyl)-2,6-difluorobenzamide |
| DE2860137D1 (en) * | 1977-07-28 | 1980-12-11 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, substances containing them, and their use as pesticides |
| JPS5823871B2 (ja) * | 1978-02-06 | 1983-05-18 | 石原産業株式会社 | N↓−ピリジルオキシフエニルウレア系化合物及びそれらを含有する殺虫剤 |
| ZA793186B (en) * | 1978-07-06 | 1981-02-25 | Duphar Int Res | New urea and thiourea compounds, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| GR73690B (cg-RX-API-DMAC10.html) * | 1979-01-15 | 1984-04-02 | Celamerck Gmbh & Co Kg | |
| US4505931A (en) * | 1979-02-01 | 1985-03-19 | Ciba-Geigy Corporation | Pesticidal N-(4-alkenylthio)-phenyl-N'-benzoylureas |
| US4310548A (en) * | 1979-02-01 | 1982-01-12 | Ciba-Geigy Corporation | Pesticidal N-tetrafluorophenyl-N'-benzoyl ureas |
| US4339460A (en) | 1979-02-01 | 1982-07-13 | Ciba-Geigy Corporation | Pesticidal N-[4-(3'-bromoallyloxy)-phenyl]-N'-benzoyl ureas |
| JPS55124763A (en) * | 1979-03-19 | 1980-09-26 | Ishihara Sangyo Kaisha Ltd | 5-trifluoromethyl-2-pyridone derivative |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| DE3026825A1 (de) * | 1980-07-16 | 1982-02-18 | Basf Ag, 6700 Ludwigshafen | Substituierte n-benzoyl-n'-phenoxyphenylharnstoffe, ihre herstellung, ihre verwendung zur bekaempfung von bekaempfung von insekten und mittel dafuer |
| DE3104407A1 (de) * | 1981-02-07 | 1982-08-19 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| DE3217619A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,4-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4880838A (en) * | 1982-06-30 | 1989-11-14 | Rhone-Poulenc | Pesticidal 1-(4-Phenoxyphenyl)-5-Benzoyl urea compounds and process for preparation |
| US4529819A (en) * | 1982-08-02 | 1985-07-16 | The Dow Chemical Company | Method for making benzoylphenylureas |
| US5166179A (en) * | 1982-08-31 | 1992-11-24 | Arno Lange | N-benzoyl-N'-phenoxyphenylureas, their preparation and their use for controlling pests |
| EP0131071B1 (en) * | 1983-01-24 | 1987-05-13 | Duphar International Research B.V | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same |
| US4560770A (en) * | 1983-02-09 | 1985-12-24 | Ciba-Geigy Corporation | Pesticidal compositions based on N-pyrrolylphenyl-N'-benzoylurea compounds |
| US4873264A (en) * | 1983-05-20 | 1989-10-10 | Rhone-Poulenc Nederlands B.V. | Novel pesticidal 1-(alkyl-phenoxy-aryl)-3-benzoyl ureas and process for preparation |
| CA1339745C (en) * | 1984-04-10 | 1998-03-17 | Martin Anderson | Pesticidal benzoylurea compounds |
| US4623658A (en) | 1984-04-10 | 1986-11-18 | Shell Oil Company | Pesticidal benzoylurea compounds |
| US4638088A (en) * | 1984-11-15 | 1987-01-20 | Union Carbide Corporation | Pesticidal biphenylyloxy and biphenylylalkoxy aryl acyl urea compounds |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| WO1986005781A1 (en) * | 1985-03-29 | 1986-10-09 | Union Carbide Corporation | Pesticidal 1-(4-phenoxyphenyl)-3-benzoyl urea compounds and process for preparation |
| AU585002B2 (en) * | 1985-03-29 | 1989-06-08 | Union Carbide Corporation | Pesticidal 1-(4-phenoxyphenyl)-3-benzoyl urea compounds and process for preparation |
| DE3542201A1 (de) * | 1985-11-29 | 1987-06-04 | Basf Ag | N-benzoyl-,n'-phenoxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| US4734404A (en) * | 1986-06-06 | 1988-03-29 | Rhone-Poulenc Nederland B.V. | Pesticidal benzoylureidoaryl phosphate compounds |
| NZ221964A (en) * | 1986-10-03 | 1990-03-27 | Ishihara Sangyo Kaisha | Benzoylurea compounds and insecticidal compositions |
| DE3731561A1 (de) * | 1987-09-19 | 1989-04-06 | Basf Ag | N-benzoyl-n'-(2,3-dichlor-4-phenoxy)phenyl- harnstoffe |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE920245C (de) * | 1950-04-29 | 1954-11-18 | Variapat Ag | Verfahren zur Herstellung von aromatischen, farblosen, wasserloeslichen Trifluormethyl- und Sulfosaeuregruppen enthaltenden unsymmetrischen Harnstoffen bzw. Thioharnstoffen |
| US2722544A (en) * | 1950-12-26 | 1955-11-01 | Variapat Ag | Trifluoromethyl halogenated diphenylcarbamide sulfonic acids and their preparation |
| NL254547A (cg-RX-API-DMAC10.html) * | 1959-08-05 | |||
| NL254871A (cg-RX-API-DMAC10.html) * | 1959-08-14 | |||
| US3261865A (en) * | 1962-09-04 | 1966-07-19 | Monsanto Co | N-(chlorobenzoyl)ureas |
| US3284433A (en) * | 1963-07-17 | 1966-11-08 | Merck & Co Inc | 4-phenoxy-carbanilides |
| US3450747A (en) * | 1965-05-07 | 1969-06-17 | Monsanto Co | Preparation of aroyl isocyanates and aryl isocyanatoformates |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US3798276A (en) * | 1972-03-14 | 1974-03-19 | H Bayer | Herbicidal 4-trifluoromethyl-4'-nitrodiphenyl ethers |
| EG11593A (en) * | 1973-07-03 | 1980-07-31 | Bayer Ag | Halogenated 4-trifluiromethyl-4-cyano-diphenyl-ethers process for their preparation and their use as herbicides |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
-
1975
- 1975-07-12 DE DE2531202A patent/DE2531202C2/de not_active Expired
-
1976
- 1976-06-24 US US05/699,541 patent/US4068002A/en not_active Expired - Lifetime
- 1976-06-29 NO NO762256A patent/NO762256L/no unknown
- 1976-07-06 EG EG404/76A patent/EG12060A/xx active
- 1976-07-06 HU HU76BA3428A patent/HU176057B/hu unknown
- 1976-07-06 RO RO7686833A patent/RO72545A/ro unknown
- 1976-07-07 BG BG033692A patent/BG27347A3/xx unknown
- 1976-07-07 PH PH18657A patent/PH11596A/en unknown
- 1976-07-07 GB GB28247/76A patent/GB1492364A/en not_active Expired
- 1976-07-07 CS CS764500A patent/CS193553B2/cs unknown
- 1976-07-08 TR TR18803A patent/TR18803A/xx unknown
- 1976-07-08 BR BR7604474A patent/BR7604474A/pt unknown
- 1976-07-08 SE SE7607825A patent/SE421412B/xx unknown
- 1976-07-08 AU AU15634/76A patent/AU503708B2/en not_active Expired
- 1976-07-08 CH CH879176A patent/CH618965A5/de not_active IP Right Cessation
- 1976-07-08 OA OA55880A patent/OA05382A/xx unknown
- 1976-07-08 BE BE168733A patent/BE843906A/xx not_active IP Right Cessation
- 1976-07-08 FI FI761999A patent/FI62827C/fi not_active IP Right Cessation
- 1976-07-09 IT IT25201/76A patent/IT1065066B/it active
- 1976-07-09 NL NL7607637A patent/NL7607637A/xx not_active Application Discontinuation
- 1976-07-09 JP JP51081079A patent/JPS6029381B2/ja not_active Expired
- 1976-07-09 IL IL50008A patent/IL50008A/xx unknown
- 1976-07-09 CA CA256,712A patent/CA1067915A/en not_active Expired
- 1976-07-09 DD DD193780A patent/DD126000A5/xx unknown
- 1976-07-09 ZA ZA764100A patent/ZA764100B/xx unknown
- 1976-07-09 PT PT65345A patent/PT65345B/pt unknown
- 1976-07-09 DK DK313276A patent/DK313276A/da unknown
- 1976-07-09 ES ES449719A patent/ES449719A1/es not_active Expired
- 1976-07-09 IE IE1515/76A patent/IE43260B1/en unknown
- 1976-07-10 PL PL1976191119A patent/PL98245B1/zh unknown
- 1976-07-10 GR GR51235A patent/GR60789B/el unknown
- 1976-07-12 AR AR263919A patent/AR209499A1/es active
- 1976-07-12 LU LU75368A patent/LU75368A1/xx unknown
- 1976-07-12 AT AT510376A patent/AT346126B/de not_active IP Right Cessation
- 1976-07-12 FR FR7621301A patent/FR2318151A1/fr active Granted
-
1977
- 1977-08-16 ES ES461620A patent/ES461620A1/es not_active Expired
-
1980
- 1980-01-25 KE KE3020A patent/KE3020A/xx unknown
- 1980-12-30 MY MY263/80A patent/MY8000263A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU176057B (en) | Insecticide compositions containing 4-/benzoyl-ureido/-2,4-dichloro-diphenyl-ether derivatives as active substances and process for preparing the active materials | |
| US4005223A (en) | Insecticidal 2-chloro-4'-[N-(N'-benzoyl)-ureido]-diphenyl ethers | |
| US3992553A (en) | Benzoylureido-diphenyl ether insecticides | |
| US4085226A (en) | Insecticidal N-(substituted phenyl)-N'-benzoyl ureas | |
| US4064267A (en) | 2',3,6'-Trichloro-4-cyano-4'-[N-(N'-(o-substituted-benzoyl))-ureido]-diphenyl ether insecticides | |
| US3932406A (en) | 2-Trifluoromethylimino-1,3-dithiolo [4,5-b]-quinoxalines | |
| US3954836A (en) | N-methyl-N-(benzene sulfonic acid methylamide-N'-sulfenyl)-carbamic acid esters | |
| US3939192A (en) | N-sulfenylate-N-methyl-carbamic acid esters of 2-oximino-alkanecarboxylic acid nitriles | |
| IL46172A (en) | Pyrimidine-thionothiolphosphoric acid esters their preparation and their use as insecticides and acaricides | |
| DE2537413A1 (de) | Benzoylureido-diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als insektizide | |
| IL47958A (en) | Pyrimidinylthionophosphonic acid esters process for their preparation and insecticidal acaricidal and nematicidal compositions containing them | |
| US3996367A (en) | N,N-dimethyl-O-[1-methyl-3-N-methylcarbaminyl-methyl-pyrazol(5)yl]-carbamic acid ester | |
| US4001404A (en) | N-dithiophosphoryl-carbamic acid esters | |
| US4006244A (en) | Benzo-1,3-dioxolan-4-yl N-methyl-N-phenylmercapto-carbamates | |
| US4104376A (en) | Synergistic composition for the control of insects | |
| US3833602A (en) | N-carbamoyl-and n-thiocarbamoyl-4,5,6,7-tetrahydrobenztriazoles | |
| US4014923A (en) | N-carboxylated N-methylcarbamic acid aryl esters | |
| US3968232A (en) | N-methyl-N-alkoxycarbonylsulphenyl-carbamates | |
| US4281011A (en) | Insecticidal N-methyl-N-(benzene sulfonic acid methylamide-N'-sulfenyl)-carbamic acid oxime esters | |
| US3966920A (en) | O,S-Dialkyl-O-(2-cyanophenyl)-thionothiolphosphoric acid esters and insecticidal and acaricidal compositions and method | |
| US4013794A (en) | O-alkyl-s-alkyl-o-phenyl phosphates and insecticidal and acaricidal method of use | |
| US4000268A (en) | N,N-dimethyl-N'-[O-phenyl-(thiono)-alkane-phosphonyl]-formamidines | |
| IL38701A (en) | Substituted pyrazol(3)yl-carbamic acid esters,their preparation and their use as insecticides or acaricides | |
| US3979512A (en) | S-(amidocarbonyl)-methyl-O-alkyl-monothiophosphoric acid ester amides | |
| US3966850A (en) | O-ethyl-S-n-propyl-O-(2-bromo-4-cyanophenyl)-thionothiol-phosphoric acid ester |