HRP921309A2 - A process for the preparation of pyridine derivatives - Google Patents
A process for the preparation of pyridine derivatives Download PDFInfo
- Publication number
- HRP921309A2 HRP921309A2 HRP921309A HRP921309A2 HR P921309 A2 HRP921309 A2 HR P921309A2 HR P921309 A HRP921309 A HR P921309A HR P921309 A2 HRP921309 A2 HR P921309A2
- Authority
- HR
- Croatia
- Prior art keywords
- formula
- compound
- radical
- image
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 46
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000003222 pyridines Chemical class 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 180
- 238000006243 chemical reaction Methods 0.000 claims description 59
- 238000010534 nucleophilic substitution reaction Methods 0.000 claims description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 34
- -1 methoxy, difluoromethoxy 2,2,2-trifluoroethoxy, isopropyloxy, 2-methylpropyloxy Chemical group 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 29
- 239000003054 catalyst Substances 0.000 claims description 29
- 238000007254 oxidation reaction Methods 0.000 claims description 28
- 230000003647 oxidation Effects 0.000 claims description 27
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 22
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 12
- 238000005660 chlorination reaction Methods 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 230000002140 halogenating effect Effects 0.000 claims description 10
- 229910009112 xH2O Inorganic materials 0.000 claims description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 8
- 150000001204 N-oxides Chemical class 0.000 claims description 8
- 230000006179 O-acylation Effects 0.000 claims description 8
- 238000006137 acetoxylation reaction Methods 0.000 claims description 8
- 125000000746 allylic group Chemical group 0.000 claims description 8
- 238000006392 deoxygenation reaction Methods 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims description 8
- 238000004821 distillation Methods 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 7
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 claims description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 6
- 150000007942 carboxylates Chemical class 0.000 claims description 6
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 230000003197 catalytic effect Effects 0.000 claims description 5
- 150000003983 crown ethers Chemical group 0.000 claims description 5
- 159000000011 group IA salts Chemical class 0.000 claims description 5
- 150000004965 peroxy acids Chemical class 0.000 claims description 5
- 150000004714 phosphonium salts Chemical group 0.000 claims description 5
- 150000003242 quaternary ammonium salts Chemical group 0.000 claims description 5
- 150000003839 salts Chemical group 0.000 claims description 5
- 229950009390 symclosene Drugs 0.000 claims description 5
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 claims description 4
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 claims description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- OMBRFUXPXNIUCZ-UHFFFAOYSA-N dioxidonitrogen(1+) Chemical class O=[N+]=O OMBRFUXPXNIUCZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- 239000011574 phosphorus Substances 0.000 claims description 4
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 4
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- 229910015667 MoO4 Inorganic materials 0.000 claims description 3
- 229910020350 Na2WO4 Inorganic materials 0.000 claims description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 3
- 239000011609 ammonium molybdate Substances 0.000 claims description 3
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 claims description 3
- 235000018660 ammonium molybdate Nutrition 0.000 claims description 3
- 229940010552 ammonium molybdate Drugs 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 230000026030 halogenation Effects 0.000 claims description 3
- 238000005658 halogenation reaction Methods 0.000 claims description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 3
- 238000006396 nitration reaction Methods 0.000 claims description 3
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 claims description 3
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 claims description 3
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 claims description 3
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 claims description 3
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 3
- FBEIPJNQGITEBL-UHFFFAOYSA-J tetrachloroplatinum Chemical compound Cl[Pt](Cl)(Cl)Cl FBEIPJNQGITEBL-UHFFFAOYSA-J 0.000 claims description 3
- JNVLJWBOAWSXKO-UHFFFAOYSA-K trichloronickel Chemical compound Cl[Ni](Cl)Cl JNVLJWBOAWSXKO-UHFFFAOYSA-K 0.000 claims description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 3
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 2
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 claims description 2
- 229910006124 SOCl2 Inorganic materials 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 2
- WBZKQQHYRPRKNJ-UHFFFAOYSA-L disulfite Chemical compound [O-]S(=O)S([O-])(=O)=O WBZKQQHYRPRKNJ-UHFFFAOYSA-L 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 150000003949 imides Chemical class 0.000 claims description 2
- 150000007529 inorganic bases Chemical class 0.000 claims description 2
- HAPIXNBOBZHNCA-UHFFFAOYSA-N methyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate Chemical compound COC(=O)C1=CC=C(C)C(B2OC(C)(C)C(C)(C)O2)=C1 HAPIXNBOBZHNCA-UHFFFAOYSA-N 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- PWBJWDKDPAPGED-UHFFFAOYSA-N n'-chlorobutanediamide Chemical group NC(=O)CCC(=O)NCl PWBJWDKDPAPGED-UHFFFAOYSA-N 0.000 claims description 2
- WMSQJZHVGMMPQT-UHFFFAOYSA-N n-chlorobenzamide Chemical compound ClNC(=O)C1=CC=CC=C1 WMSQJZHVGMMPQT-UHFFFAOYSA-N 0.000 claims description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 claims description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 2
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- CGFYHILWFSGVJS-UHFFFAOYSA-N silicic acid;trioxotungsten Chemical compound O[Si](O)(O)O.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 CGFYHILWFSGVJS-UHFFFAOYSA-N 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 claims 2
- IXCZEYQFCLQBNN-UHFFFAOYSA-N COC.[Na] Chemical compound COC.[Na] IXCZEYQFCLQBNN-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000003158 alcohol group Chemical group 0.000 claims 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims 1
- SWRNIYAQKATHDJ-UHFFFAOYSA-N dichloro(dichlorophosphanyl)phosphane Chemical compound ClP(Cl)P(Cl)Cl SWRNIYAQKATHDJ-UHFFFAOYSA-N 0.000 claims 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 claims 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- USSBDBZGEDUBHE-UHFFFAOYSA-L magnesium;2-oxidooxycarbonylbenzoate Chemical compound [Mg+2].[O-]OC(=O)C1=CC=CC=C1C([O-])=O USSBDBZGEDUBHE-UHFFFAOYSA-L 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 150000003254 radicals Chemical class 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000012265 solid product Substances 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- CFMTVTYBZMKULI-UHFFFAOYSA-N 2,3-dimethyl-4-nitro-1-oxidopyridin-1-ium Chemical compound CC1=C(C)[N+]([O-])=CC=C1[N+]([O-])=O CFMTVTYBZMKULI-UHFFFAOYSA-N 0.000 description 6
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 6
- 239000007832 Na2SO4 Substances 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 229960000381 omeprazole Drugs 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- SIXIIKVOZAGHPV-UHFFFAOYSA-N lansoprazole Chemical compound CC1=C(OCC(F)(F)F)C=CN=C1CS(=O)C1=NC2=CC=C[CH]C2=N1 SIXIIKVOZAGHPV-UHFFFAOYSA-N 0.000 description 4
- 229960003174 lansoprazole Drugs 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 3
- GMSURXZOJDDQEF-UHFFFAOYSA-N 2,3-dimethyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium Chemical compound CC1=C(C)[N+]([O-])=CC=C1OCC(F)(F)F GMSURXZOJDDQEF-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 3
- 229940011051 isopropyl acetate Drugs 0.000 description 3
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000010517 secondary reaction Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- COLOHWPRNRVWPI-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound [CH2]C(F)(F)F COLOHWPRNRVWPI-UHFFFAOYSA-N 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N 2,3-dimethylpyridine Chemical compound CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- WTUOROFNVRAWHM-UHFFFAOYSA-N 2-(chloromethyl)-3-methyl-4-nitro-1-oxidopyridin-1-ium Chemical compound CC1=C([N+]([O-])=O)C=C[N+]([O-])=C1CCl WTUOROFNVRAWHM-UHFFFAOYSA-N 0.000 description 2
- LAIUFBWHERIJIH-UHFFFAOYSA-N 3-Methylheptane Chemical class CCCCC(C)CC LAIUFBWHERIJIH-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- MCUYHRNUDDANSO-UHFFFAOYSA-N 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium Chemical compound CC1=C(C)[N+]([O-])=CC=C1Cl MCUYHRNUDDANSO-UHFFFAOYSA-N 0.000 description 2
- YIDBERCXNYKRKU-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)-3-methylpyridin-1-ium;chloride Chemical compound Cl.CC1=C(Cl)C=CN=C1CCl YIDBERCXNYKRKU-UHFFFAOYSA-N 0.000 description 2
- ZYUFKURTVOBEOQ-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)-3-methylpyridine Chemical compound CC1=C(Cl)C=CN=C1CCl ZYUFKURTVOBEOQ-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DLGYNVMUCSTYDQ-UHFFFAOYSA-N azane;pyridine Chemical compound N.C1=CC=NC=C1 DLGYNVMUCSTYDQ-UHFFFAOYSA-N 0.000 description 2
- 230000003139 buffering effect Effects 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 1
- IPJMZFJRPTWZTD-UHFFFAOYSA-N (4-chloro-3-methylpyridin-2-yl)methanol Chemical compound CC1=C(Cl)C=CN=C1CO IPJMZFJRPTWZTD-UHFFFAOYSA-N 0.000 description 1
- JKIGKIFWZNSOJX-UHFFFAOYSA-N (4-chloro-3-methylpyridin-2-yl)methanol;hydrochloride Chemical compound Cl.CC1=C(Cl)C=CN=C1CO JKIGKIFWZNSOJX-UHFFFAOYSA-N 0.000 description 1
- JHTAYQLERRPGDL-UHFFFAOYSA-N (4-chloro-3-methylpyridin-2-yl)methyl acetate Chemical compound CC(=O)OCC1=NC=CC(Cl)=C1C JHTAYQLERRPGDL-UHFFFAOYSA-N 0.000 description 1
- QWLULCKKOHDCIE-UHFFFAOYSA-N 2,3-dimethyl-1-oxidopyridin-1-ium Chemical compound CC1=CC=C[N+]([O-])=C1C QWLULCKKOHDCIE-UHFFFAOYSA-N 0.000 description 1
- CMZBQUWICURDCD-UHFFFAOYSA-N 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-1-ium;chloride Chemical compound Cl.CC1=C(OCC(F)(F)F)C=CN=C1CCl CMZBQUWICURDCD-UHFFFAOYSA-N 0.000 description 1
- AENYCMZUDXQARW-UHFFFAOYSA-N 2-(chloromethyl)-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine Chemical compound CC1=C(OCC(F)(F)F)C=CN=C1CCl AENYCMZUDXQARW-UHFFFAOYSA-N 0.000 description 1
- JGITUYGRSZWVLB-UHFFFAOYSA-N 2-(chloromethyl)-3-methyl-4-nitropyridine Chemical compound CC1=C(CCl)N=CC=C1[N+]([O-])=O JGITUYGRSZWVLB-UHFFFAOYSA-N 0.000 description 1
- HLHGTWPLDSUGJJ-UHFFFAOYSA-N 2-[(3-methyl-4-nitropyridin-2-yl)methylsulfanyl]-1h-benzimidazole Chemical compound N1=CC=C([N+]([O-])=O)C(C)=C1CSC1=NC2=CC=CC=C2N1 HLHGTWPLDSUGJJ-UHFFFAOYSA-N 0.000 description 1
- NKBICFMRRCFCFT-UHFFFAOYSA-N 2-[(4-chloro-3-methylpyridin-2-yl)methylsulfanyl]-1h-benzimidazole Chemical compound CC1=C(Cl)C=CN=C1CSC1=NC2=CC=CC=C2N1 NKBICFMRRCFCFT-UHFFFAOYSA-N 0.000 description 1
- CCHLMSUZHFPSFC-UHFFFAOYSA-N 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfanyl]-1h-benzimidazole Chemical compound CC1=C(OCC(F)(F)F)C=CN=C1CSC1=NC2=CC=CC=C2N1 CCHLMSUZHFPSFC-UHFFFAOYSA-N 0.000 description 1
- OADFBXPNLFABBM-UHFFFAOYSA-N 2-chloro-3-methyl-4-nitropyridine Chemical compound CC1=C(Cl)N=CC=C1[N+]([O-])=O OADFBXPNLFABBM-UHFFFAOYSA-N 0.000 description 1
- WJWLNMWPSHIDHR-UHFFFAOYSA-N 4-chloro-2,3-dimethylpyridine Chemical compound CC1=NC=CC(Cl)=C1C WJWLNMWPSHIDHR-UHFFFAOYSA-N 0.000 description 1
- AQPUOEAMOPWYPF-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)-3-methyl-1-oxidopyridin-1-ium Chemical compound CC1=C(Cl)C=C[N+]([O-])=C1CCl AQPUOEAMOPWYPF-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000013626 chemical specie Substances 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ES9102594A ES2036948B1 (es) | 1991-11-21 | 1991-11-21 | Procedimiento de obtencion de compuestos derivados de piridina. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HRP921309A2 true HRP921309A2 (en) | 1995-02-28 |
Family
ID=8274245
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HRP921309 HRP921309A2 (en) | 1991-11-21 | 1992-11-20 | A process for the preparation of pyridine derivatives |
Country Status (4)
| Country | Link |
|---|---|
| ES (4) | ES2036948B1 (es) |
| HR (1) | HRP921309A2 (es) |
| SI (1) | SI9200336A (es) |
| YU (1) | YU99792A (es) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2060541B1 (es) * | 1993-02-26 | 1995-11-16 | Vinas Lab | Nuevo procedimiento para la sintesis de un derivado de 2-(2-piridilmetilsufinil) bencimidazol, y nuevos productos intermedios obtenidos con el mismo. |
| ES2063705B1 (es) * | 1993-06-14 | 1995-07-16 | S A L V A T Lab Sa | Intermedio para la sintesis de lansoprazol y su procedimiento de obtencion. |
| ES2166269B1 (es) * | 1999-07-14 | 2003-04-01 | Sint Quimica Sa | Nuevo procedimiento de obtencion de derivados de 2-(2-piridinilmetilsulfinil)-1h-benzimidazol. |
| ES2163372B1 (es) * | 2000-03-13 | 2003-05-01 | Esteve Quimica Sa | Procedimiento de oxidacion de un grupo tioeter a sulfoxido. |
| ES2171116B1 (es) * | 2000-04-14 | 2003-08-01 | Esteve Quimica Sa | Procedimiento para la obtencion de derivados de (((piridil sustituido)metil)tio)bencimidazol. |
| ES2187248B1 (es) * | 2000-08-25 | 2004-01-16 | Sint Quimica Sa | Nuevo procedimiento de obtencion de derivados de 2-(2-piridinilmetilsulfinil)-1h-benzimidazol. |
| TWI270542B (en) | 2002-02-07 | 2007-01-11 | Sumitomo Chemical Co | Method for preparing sulfone or sulfoxide compound |
| JP2006500380A (ja) | 2002-08-21 | 2006-01-05 | テバ ファーマシューティカル インダストリーズ リミティド | ランソプラゾールの精製方法 |
| WO2004046135A1 (en) | 2002-11-18 | 2004-06-03 | Teva Pharmaceutical Industries Ltd. | Stable lansoprazole containing more than 500 ppm, up to about 3,000 ppm water and more than 200 ppm, up to about 5,000 ppm alcohol |
| CA2515130A1 (en) | 2003-02-05 | 2004-08-26 | Teva Pharmaceutical Industries Ltd. | Method of stabilizing lansoprazole |
| US7601737B2 (en) | 2005-07-26 | 2009-10-13 | Nycomed Gmbh | Isotopically substituted proton pump inhibitors |
| WO2009066309A2 (en) * | 2007-07-12 | 2009-05-28 | Cadila Healthcare Limited | Process for preparation of omeprazole |
| WO2009010937A1 (en) | 2007-07-17 | 2009-01-22 | Ranbaxy Laboratories Limited | Process for the preparation op pantoprazole sodium and pantoprazole sodium sesquihydrate |
| ES2363075B1 (es) * | 2009-12-23 | 2012-03-27 | Laboratorios Viñas S.A. | Procedimiento para la obtención de 4-cloro-2-clorometil -3-metilpiridina |
| CN102267979A (zh) * | 2011-06-15 | 2011-12-07 | 扬州天和药业有限公司 | 一种制备兰索拉唑的方法 |
| CN110317164B (zh) * | 2019-07-06 | 2022-08-19 | 抚州三和医药化工有限公司 | 一种奥美拉唑中间体的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8204879D0 (sv) * | 1982-08-26 | 1982-08-26 | Haessle Ab | Novel chemical intermediates |
| JPS6150978A (ja) * | 1984-08-16 | 1986-03-13 | Takeda Chem Ind Ltd | ピリジン誘導体およびその製造法 |
| ES8604202A1 (es) * | 1985-06-01 | 1986-01-16 | Rubio Lab | Procedimiento para la obtencion de un derivado benzimidazo- lico |
| FI864138A (fi) * | 1985-10-16 | 1987-04-17 | Fisons Plc | Heterocykliska blandningar. |
| JPS62209062A (ja) * | 1986-03-10 | 1987-09-14 | Yamanouchi Pharmaceut Co Ltd | ２−ピリジルメチルチオ−または２−ピリジルメチルスルフイニル−置換縮合環化合物 |
| ES2023609A6 (es) * | 1990-11-29 | 1992-01-16 | Inke Sa | Procedimiento para la obtencion del 2-(((3-metil -4-(2,2,2-trifluoroetoxi) -2-piridinil) metilisulfinil) -1h-bemzimidazol. |
| ES2024357A6 (es) * | 1990-12-05 | 1992-02-16 | Genesis Para La Investigacion | Procedimiento de obtencion de halohidrato de 2-halometil-3,5-dimetil-4-metoxipiri-dina. |
-
1991
- 1991-11-21 ES ES9102594A patent/ES2036948B1/es not_active Expired - Fee Related
-
1992
- 1992-11-19 YU YU99792A patent/YU99792A/sh unknown
- 1992-11-20 HR HRP921309 patent/HRP921309A2/hr not_active Application Discontinuation
- 1992-11-20 SI SI9200336A patent/SI9200336A/sl unknown
-
1993
- 1993-01-15 ES ES9300064A patent/ES2066701B1/es not_active Expired - Fee Related
- 1993-05-04 ES ES9300935A patent/ES2067407B1/es not_active Expired - Fee Related
-
1994
- 1994-11-24 ES ES9402419A patent/ES2105953B1/es not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES2036948B1 (es) | 1994-09-01 |
| ES2066701A1 (es) | 1995-03-01 |
| ES2105953B1 (es) | 1998-07-01 |
| ES2105953A1 (es) | 1997-10-16 |
| ES2036948A1 (es) | 1993-06-01 |
| ES2066701B1 (es) | 1995-12-01 |
| YU99792A (sh) | 1995-10-03 |
| ES2067407A1 (es) | 1995-03-16 |
| ES2067407B1 (es) | 1996-04-16 |
| SI9200336A (en) | 1993-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HRP921309A2 (en) | A process for the preparation of pyridine derivatives | |
| AU649355B2 (en) | Process for preparation of omeprazole and related anti-ulcer agents | |
| SU602118A3 (ru) | Способ получени производных бензимидазола или их солей | |
| US4973695A (en) | Process for preparing pyridine-2,3-dicarboxylic acid compounds | |
| HU195210B (en) | Process for producing pyridine derivatives and pharmaceutical preparations comprising these compounds as active substance | |
| US5958955A (en) | Method for the synthesis of a benzimidazole compound | |
| AU780314B2 (en) | Method for obtaining derivatives of (((pyridil substituted) methyl)thio)benzimidazol | |
| RU2014333C1 (ru) | Производные 4-оксо-3н-фталазин-1-уксусной кислоты, способ получения производных сложных алкиловых эфиров 4-оксо-3н-фталазин-1-уксусной кислоты | |
| US20040049044A1 (en) | Process for the preparation of pantoprazole and intermediates therefor | |
| KR0141483B1 (ko) | 치환된 피리딘-2,3-디카르복실산의 제조 방법 | |
| WO1998040377A1 (en) | Process for the preparation of 2-[[(2-pyridinyl)methyl]sulfinyl]-1h-benzimidazoles and novel compounds of use for such purpose | |
| KR950014792B1 (ko) | 벤즈이미다졸 유도체 및 이의 제조방법 | |
| JP2831000B2 (ja) | （２−アミノベンゾイル）酢酸エステル誘導体 | |
| KR910006983B1 (ko) | 피리딘 유도체의 제조방법 | |
| KR910003634B1 (ko) | 니트로벤조일-3-시클로프로필아미노아크릴레이트 및 그 제조방법 | |
| US4147876A (en) | Easily hydrolyzable esters of 4-(2-carboxyethyl)phenyl trans-4-aminomethylcyclohexanecarboxylate and process of use | |
| KR920003690B1 (ko) | 퀴놀린 유도체의 제조방법 | |
| KR0139260B1 (ko) | 고리화된 이미다졸을 가지는 벤즈이미다졸 유도체 | |
| KR900004878B1 (ko) | 퀴놀론 유도체의 제조방법 | |
| KR940005019B1 (ko) | 피리딘 유도체의 제조방법 | |
| KR910009816B1 (ko) | 피리딘 유도체의 제조방법 | |
| US4960955A (en) | Process for making 4-chloro-2-methyl-5-nitro-phenol | |
| SU527136A3 (ru) | Способ получени пиридохинолиновых эфиров | |
| KR800000736B1 (ko) | 4-옥소-1,2,3,4-테트라히드로 피리도 [2,3-d] 피리미딘 유도체의 제조방법 | |
| KR0131049B1 (ko) | 벤즈이미다졸 유도체의 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1OB | Publication of a patent application | ||
| AIPI | Request for the grant of a patent on the basis of a substantive examination of a patent application | ||
| ODBC | Application rejected |