GB1346874A - Nematic aryl esters of aryl carboxylic acids and mixtures containing these esters - Google Patents
Nematic aryl esters of aryl carboxylic acids and mixtures containing these estersInfo
- Publication number
- GB1346874A GB1346874A GB3326772A GB3326772A GB1346874A GB 1346874 A GB1346874 A GB 1346874A GB 3326772 A GB3326772 A GB 3326772A GB 3326772 A GB3326772 A GB 3326772A GB 1346874 A GB1346874 A GB 1346874A
- Authority
- GB
- United Kingdom
- Prior art keywords
- acid
- esters
- straight
- formula
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 aryl carboxylic acids Chemical class 0.000 title abstract 3
- 150000007860 aryl ester derivatives Chemical class 0.000 title abstract 2
- 150000002148 esters Chemical class 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 title 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 abstract 2
- GAHWOZNGFZSNJC-UHFFFAOYSA-N 4-phenylmethoxycarbonyloxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OC(=O)OCC1=CC=CC=C1 GAHWOZNGFZSNJC-UHFFFAOYSA-N 0.000 abstract 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 abstract 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 abstract 2
- 229940031826 phenolate Drugs 0.000 abstract 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract 1
- VXZCKDYGSRIOGX-UHFFFAOYSA-N benzyl (4-carbonochloridoylphenyl) carbonate Chemical compound C1=CC(C(=O)Cl)=CC=C1OC(=O)OCC1=CC=CC=C1 VXZCKDYGSRIOGX-UHFFFAOYSA-N 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/10—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings
- C09K19/20—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers
- C09K19/2007—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers the chain containing -COO- or -OCO- groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/10—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings
- C09K19/20—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers
- C09K19/2007—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and oxygen atoms as chain links, e.g. esters or ethers the chain containing -COO- or -OCO- groups
- C09K2019/2035—Ph-COO-Ph
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
- Surface Treatment Of Glass (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2139628A DE2139628C3 (de) | 1971-08-07 | 1971-08-07 | 4-Benzolyloxybenzoesäurephenylester und diese enthaltende nematische Gemische |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1346874A true GB1346874A (en) | 1974-02-13 |
Family
ID=5816088
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB3326772A Expired GB1346874A (en) | 1971-08-07 | 1972-07-12 | Nematic aryl esters of aryl carboxylic acids and mixtures containing these esters |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4002670A (cg-RX-API-DMAC10.html) |
| JP (3) | JPS5641623B2 (cg-RX-API-DMAC10.html) |
| AT (1) | AT327304B (cg-RX-API-DMAC10.html) |
| BE (1) | BE787198A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1025471A (cg-RX-API-DMAC10.html) |
| CH (2) | CH582230A5 (cg-RX-API-DMAC10.html) |
| DD (1) | DD98667A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2139628C3 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2195617B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1346874A (cg-RX-API-DMAC10.html) |
| IL (1) | IL39929A (cg-RX-API-DMAC10.html) |
| IT (1) | IT963535B (cg-RX-API-DMAC10.html) |
| NL (1) | NL178685C (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2934918A1 (de) * | 1978-08-30 | 1980-03-13 | Hitachi Ltd | Nematische fluessigkristallzusammensetzung fuer anzeigeeinrichtungen |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5411265B2 (cg-RX-API-DMAC10.html) * | 1971-10-04 | 1979-05-14 | ||
| JPS5222959B2 (cg-RX-API-DMAC10.html) * | 1971-10-04 | 1977-06-21 | ||
| JPS5633384B2 (cg-RX-API-DMAC10.html) * | 1971-10-04 | 1981-08-03 | ||
| JPS5633383B2 (cg-RX-API-DMAC10.html) * | 1971-10-04 | 1981-08-03 | ||
| US4086002A (en) * | 1972-02-03 | 1978-04-25 | Haffmann-La Roche Inc. | Field effect light shutter employing low temperature nematic liquid crystals |
| FR2184512B1 (cg-RX-API-DMAC10.html) * | 1972-05-19 | 1975-11-28 | Thomson Csf | |
| US4011173A (en) * | 1972-08-03 | 1977-03-08 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Modified nematic mixtures with positive dielectric anisotropy |
| JPS5023385A (cg-RX-API-DMAC10.html) * | 1973-07-06 | 1975-03-13 | ||
| US4000084A (en) * | 1973-12-17 | 1976-12-28 | Hughes Aircraft Company | Liquid crystal mixtures for electro-optical display devices |
| US4137192A (en) * | 1974-01-25 | 1979-01-30 | Canon Kabushiki Kaisha | Liquid crystalline composition |
| US4020002A (en) * | 1974-02-28 | 1977-04-26 | Beckman Instruments, Inc. | Non-schiff base field effect liquid crystal composition |
| US4147651A (en) * | 1974-09-03 | 1979-04-03 | Beckman Instruments, Inc. | Biphenyl based liquid crystal compositions |
| US3975286A (en) * | 1974-09-03 | 1976-08-17 | Beckman Instruments, Inc. | Low voltage actuated field effect liquid crystals compositions and method of synthesis |
| US4136053A (en) * | 1974-10-22 | 1979-01-23 | Merck Patent Gesellschaft Mit Beschankter Haftung | Biphenyl esters and liquid crystalline mixtures comprising them |
| GB1501718A (en) * | 1974-12-23 | 1978-02-22 | Suwa Seikosha Kk | Nematic liquid crystal material |
| JPS51115435A (en) * | 1975-04-01 | 1976-10-12 | Matsushita Electric Ind Co Ltd | Process for preparation of aromatic ester derivatives |
| US4031028A (en) * | 1976-06-18 | 1977-06-21 | Motorola, Inc. | Nematic liquid crystal composition |
| US4113647A (en) * | 1976-08-13 | 1978-09-12 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystalline materials |
| US4128496A (en) * | 1976-09-09 | 1978-12-05 | General Electric Company | Dichroic liquid crystal compositions |
| US4128497A (en) * | 1976-09-09 | 1978-12-05 | General Electric Company | Dichroic liquid crystal compositions |
| FR2377441A1 (fr) * | 1977-01-14 | 1978-08-11 | Thomson Csf | Nouvelle famille de cristaux liquides de proprietes ameliorees, et dispositifs utilisant de tels cristaux liquides |
| GB1603076A (en) * | 1977-04-05 | 1981-11-18 | Secr Defence | Esters of (+)-4-(2'-methylbutyl)phenol and their use as liquid crystal materials |
| US4337999A (en) * | 1977-08-29 | 1982-07-06 | Sharp Corporation | Fluorescent liquid crystal display compositions and devices |
| US4128312A (en) * | 1977-10-04 | 1978-12-05 | Hughes Aircraft Company | Long life reflective liquid crystal display for dc operation |
| AT364000B (de) * | 1978-01-30 | 1981-09-10 | Bbc Brown Boveri & Cie | Fluessigkristallsubstanz |
| JPS5941983B2 (ja) * | 1978-02-17 | 1984-10-11 | 大日本インキ化学工業株式会社 | トランス(エカトリアル↓−エカトリアル)1,4↓−ジ置換シクロヘキサン誘導体 |
| US4261652A (en) * | 1978-08-04 | 1981-04-14 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystal compounds and materials and devices containing them |
| DE2918775A1 (de) | 1979-05-10 | 1980-11-20 | Merck Patent Gmbh | Diketone, verfahren zu ihrer herstellung und ihre verwendung als komponenten fluessigkristalliner dielektrika |
| US4296631A (en) * | 1979-09-21 | 1981-10-27 | Becton, Dickinson And Company | Liquid crystal compositions and devices |
| GB2063250B (en) * | 1979-10-02 | 1984-05-31 | Bdh Chemicals Ltd | Liquid crystal esters |
| US4366330A (en) * | 1979-10-02 | 1982-12-28 | Bch Chemicals Limited | Intermediates useful in the production of liquid crystal compounds |
| US4309304A (en) * | 1979-11-01 | 1982-01-05 | Exxon Research & Engineering Co. | Liquid crystal compositions for multiplexed displays |
| US4328116A (en) * | 1979-11-01 | 1982-05-04 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions for multiplexed displays |
| US4399298A (en) * | 1980-02-15 | 1983-08-16 | Chisso Corporation | Carboxylic acid ester derivatives of 4-fluorophenol |
| DE3023989A1 (de) * | 1980-06-26 | 1982-01-21 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristallines dielektrikum |
| US4550981A (en) * | 1982-09-30 | 1985-11-05 | Hoffmann-La Roche Inc. | Liquid crystalline esters and mixtures |
| JPS5973555A (ja) * | 1982-10-20 | 1984-04-25 | Seiko Epson Corp | エステル−アゾキシ化合物 |
| JPS6126691A (ja) * | 1984-07-13 | 1986-02-05 | Matsushita Electric Ind Co Ltd | 液晶組成物 |
| US4556727A (en) * | 1984-07-18 | 1985-12-03 | University Patents, Inc. | Ferroelectric smectic liquid crystals |
| ES8702932A1 (es) * | 1984-10-11 | 1987-02-01 | Raychem Corp | Metodo para preparar una poli(eter cetona) aromatica |
| DE3438424C1 (de) * | 1984-10-19 | 1986-05-15 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V., 3400 Göttingen | Hexasubstituierte Tribenzocyclononatrien-Derivate,Verfahren zu deren Herstellung und ihre Verwendung |
| GB8501509D0 (en) * | 1985-01-22 | 1985-02-20 | Secr Defence | Esters |
| IT1213579B (it) * | 1986-07-03 | 1989-12-20 | Angelo Signor Marino Nicolini | Flogistica. esteri di salsalato con guaiacolo atti al trattamento di broncopneumapatie a base |
| US8848158B2 (en) | 2008-07-01 | 2014-09-30 | Gentex Corporation | Liquid crystal display device and associated liquid crystal media for use in the same |
| US7803285B2 (en) * | 2008-07-01 | 2010-09-28 | Gentex Corporation | Liquid crystal display device and associated liquid crystal media for use in the same |
| US9255579B2 (en) | 2010-03-31 | 2016-02-09 | Nabtesco Automotive Corporation | Vacuum pump having rotary compressing elements |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1974689A (en) * | 1930-09-27 | 1934-09-25 | Winthrop Chem Co Inc | Agents for killing insects |
| US2544891A (en) * | 1946-12-20 | 1951-03-13 | Eastman Kodak Co | Cellulose organic acid ester plastics containing paramethoxyphenyl para-anisate |
| US3046305A (en) * | 1959-09-24 | 1962-07-24 | Pure Oil Co | Process for the production of paralkyl-phenol and para-alkyl-benzoic acid |
| US3519599A (en) * | 1968-03-18 | 1970-07-07 | Eastman Kodak Co | Substituted phenyl benzoates useful as ultraviolet light inhibitors |
| DE2009528B2 (de) * | 1970-02-28 | 1978-08-10 | Minnesota Mining And Manufacturing Co., Saint Paul, Minn. (V.St.A.) | Nematogene Mischungen |
| JPS4937350B1 (cg-RX-API-DMAC10.html) * | 1970-05-02 | 1974-10-08 | ||
| DE2024269A1 (en) * | 1970-05-19 | 1971-12-02 | Merck Patent Gmbh | Nematic mixtures - of low melting point, used in electronics |
| DE2123175C3 (de) * | 1970-06-15 | 1979-12-13 | Veb Werk Fuer Fernsehelektronik, Ddr 1160 Berlin-Oberschoeneweide | Verwendung von nematischen kristallinflüssigen Verbindungen |
-
0
- BE BE787198D patent/BE787198A/xx unknown
-
1971
- 1971-08-07 DE DE2139628A patent/DE2139628C3/de not_active Expired
-
1972
- 1972-07-12 GB GB3326772A patent/GB1346874A/en not_active Expired
- 1972-07-17 IL IL39929A patent/IL39929A/xx unknown
- 1972-07-18 NL NLAANVRAGE7209901,A patent/NL178685C/xx active Search and Examination
- 1972-07-21 CH CH562876A patent/CH582230A5/xx not_active IP Right Cessation
- 1972-07-21 CH CH1092072A patent/CH582125A5/xx not_active IP Right Cessation
- 1972-07-28 IT IT27636/72A patent/IT963535B/it active
- 1972-08-03 US US05/277,502 patent/US4002670A/en not_active Expired - Lifetime
- 1972-08-04 AT AT676072A patent/AT327304B/de not_active IP Right Cessation
- 1972-08-04 DD DD164868A patent/DD98667A5/xx unknown
- 1972-08-04 CA CA148,772A patent/CA1025471A/en not_active Expired
- 1972-08-07 FR FR727228417A patent/FR2195617B1/fr not_active Expired
- 1972-08-07 JP JP7845572A patent/JPS5641623B2/ja not_active Expired
- 1972-11-07 JP JP47110839A patent/JPS5952194B2/ja not_active Expired
-
1982
- 1982-10-29 JP JP57189396A patent/JPS5899441A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2934918A1 (de) * | 1978-08-30 | 1980-03-13 | Hitachi Ltd | Nematische fluessigkristallzusammensetzung fuer anzeigeeinrichtungen |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4828443A (cg-RX-API-DMAC10.html) | 1973-04-14 |
| CH582230A5 (cg-RX-API-DMAC10.html) | 1976-11-30 |
| DE2139628A1 (de) | 1973-02-22 |
| FR2195617B1 (cg-RX-API-DMAC10.html) | 1977-08-26 |
| NL178685C (nl) | 1986-05-01 |
| BE787198A (fr) | 1973-02-05 |
| DE2139628C3 (de) | 1981-12-24 |
| JPS4885488A (cg-RX-API-DMAC10.html) | 1973-11-13 |
| JPS5952194B2 (ja) | 1984-12-18 |
| JPS5899441A (ja) | 1983-06-13 |
| CA1025471A (en) | 1978-01-31 |
| SU451255A3 (ru) | 1974-11-25 |
| DE2139628B2 (de) | 1981-02-05 |
| IL39929A (en) | 1975-05-22 |
| IL39929A0 (en) | 1972-09-28 |
| NL7209901A (cg-RX-API-DMAC10.html) | 1973-02-09 |
| JPS619302B2 (cg-RX-API-DMAC10.html) | 1986-03-22 |
| AT327304B (de) | 1976-01-26 |
| JPS5641623B2 (cg-RX-API-DMAC10.html) | 1981-09-29 |
| FR2195617A1 (cg-RX-API-DMAC10.html) | 1974-03-08 |
| IT963535B (it) | 1974-01-21 |
| CH582125A5 (cg-RX-API-DMAC10.html) | 1976-11-30 |
| ATA676072A (de) | 1975-04-15 |
| NL178685B (nl) | 1985-12-02 |
| DD98667A5 (cg-RX-API-DMAC10.html) | 1973-07-05 |
| US4002670A (en) | 1977-01-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1346874A (en) | Nematic aryl esters of aryl carboxylic acids and mixtures containing these esters | |
| GB1399086A (en) | Cephalosporin compounds | |
| GB1387733A (en) | 3-trisubstituted benzoyl-propionic acid and a mehtod for the production thereof | |
| GB1359415A (en) | Process for making aryloxy derivatives of aromatic diesters and dinitriles and products derived therefrom | |
| GB1307809A (en) | Capronylhydroxy-benzoic acid esters their use as nematogenic compounds and nematogenic mixtures containing them | |
| GB1376482A (en) | 3,5-dialkyl-4-hydroxyphenylalkanoic acid esters of glycols and compositions stabilized thereby | |
| GB1214594A (en) | Stabilised polyester resins | |
| GB1427390A (en) | Substituted benzoyloxy benzoic acid phenyl esters and nematic liquid crystal compoitions containing them | |
| GB1324162A (en) | Aromatic dicarboxylic acids | |
| JPS579742A (en) | 4'-(trans-4"-alkylcyclohexyl)4-biphenylcarboxylic acid ester | |
| ES338638A1 (es) | Procedimiento para la preparacion de nuevos esteres de aci-do fenilacetico sus tituidos. | |
| GB1472132A (en) | Cyclopentanone triesters and process therefor | |
| GB1388834A (en) | Cyclic acetal derivatives and their use as herbicides | |
| GB1476384A (en) | Liquid motor fuel compositions | |
| GB1458709A (en) | Aromatic nitriles containing carboxylic and carbonate ester groups and having liquid crystalline properties | |
| GB1367379A (en) | Alkenyl succinic anhydride derivatives and their use as lubricating oil additives | |
| GB1399088A (en) | Cephalosporin compounds | |
| GB1387908A (en) | Polymerisable anthranilic acid esters | |
| GB1441941A (en) | Process for the preparation of 5-substituted resorcinols and related intermediates | |
| GB1331181A (en) | Phenylacetohydroxamic acids process for their manufacture and preparations containing them | |
| GB1394391A (en) | Process for preparing aluminium salts of carboxylic compounds | |
| JPS56150030A (en) | 4'-alkyl-4-fluorobiphenyl | |
| GB1501476A (en) | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives and a process for the preparation thereof | |
| GB1135103A (en) | Novel phenol formates and process for preparing the same | |
| GB1382364A (en) | Stilbene compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |