FI82238C - Foerfarande foer framstaellning av farmakologiskt verksamma dihydroxifenyletyldiaminer. - Google Patents
Foerfarande foer framstaellning av farmakologiskt verksamma dihydroxifenyletyldiaminer. Download PDFInfo
- Publication number
- FI82238C FI82238C FI822630A FI822630A FI82238C FI 82238 C FI82238 C FI 82238C FI 822630 A FI822630 A FI 822630A FI 822630 A FI822630 A FI 822630A FI 82238 C FI82238 C FI 82238C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- group
- compound
- solution
- ethyl
- Prior art date
Links
- -1 dihydroxyphenyl Chemical group 0.000 title claims description 48
- 238000000034 method Methods 0.000 title claims description 31
- 230000008569 process Effects 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 121
- 229910052757 nitrogen Inorganic materials 0.000 claims description 37
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 125000006239 protecting group Chemical group 0.000 claims description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 2
- 230000002829 reductive effect Effects 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 99
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 239000000203 mixture Substances 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 37
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000007787 solid Substances 0.000 description 29
- 230000000694 effects Effects 0.000 description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 24
- 238000010992 reflux Methods 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 239000000725 suspension Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- 102000005962 receptors Human genes 0.000 description 11
- 108020003175 receptors Proteins 0.000 description 11
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 235000019341 magnesium sulphate Nutrition 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 7
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical class NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 7
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 7
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 229960001317 isoprenaline Drugs 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 229960002052 salbutamol Drugs 0.000 description 6
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 description 5
- 210000001367 artery Anatomy 0.000 description 5
- 239000002876 beta blocker Substances 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 238000007796 conventional method Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 230000001746 atrial effect Effects 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 229910000085 borane Inorganic materials 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 125000001245 hexylamino group Chemical group [H]N([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- 230000001965 increasing effect Effects 0.000 description 4
- 230000001537 neural effect Effects 0.000 description 4
- 230000002018 overexpression Effects 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 125000003395 phenylethylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 230000000638 stimulation Effects 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- JTXPCFSZPQUXDM-UHFFFAOYSA-N 2,3-bis(phenylmethoxy)bicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid Chemical compound OC(=O)C1CC(C=2OCC=3C=CC=CC=3)=C1C=CC=2OCC1=CC=CC=C1 JTXPCFSZPQUXDM-UHFFFAOYSA-N 0.000 description 3
- ASXGAOFCKGHGMF-UHFFFAOYSA-N 6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol Chemical compound OC1=C(O)C=C2CC(N)CCC2=C1 ASXGAOFCKGHGMF-UHFFFAOYSA-N 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- FTQWRYSLUYAIRQ-UHFFFAOYSA-N n-[(octadecanoylamino)methyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCNC(=O)CCCCCCCCCCCCCCCCC FTQWRYSLUYAIRQ-UHFFFAOYSA-N 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 125000003884 phenylalkyl group Chemical group 0.000 description 3
- 229960003712 propranolol Drugs 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 210000003437 trachea Anatomy 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- SBMYBOVJMOVVQW-UHFFFAOYSA-N 2-[3-[[4-(2,2-difluoroethyl)piperazin-1-yl]methyl]-4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound FC(CN1CCN(CC1)CC1=NN(C=C1C=1C=NC(=NC=1)NC1CC2=CC=CC=C2C1)CC(=O)N1CC2=C(CC1)NN=N2)F SBMYBOVJMOVVQW-UHFFFAOYSA-N 0.000 description 2
- ANOUKFYBOAKOIR-UHFFFAOYSA-N 3,4-dimethoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1OC ANOUKFYBOAKOIR-UHFFFAOYSA-N 0.000 description 2
- QWJAYVTYQZXNTI-UHFFFAOYSA-N 4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=CC=C1 QWJAYVTYQZXNTI-UHFFFAOYSA-N 0.000 description 2
- IXAFAYIIDHDJHN-UHFFFAOYSA-N 4-methylpyrene Chemical compound C1=CC=C2C(C)=CC3=CC=CC4=CC=C1C2=C34 IXAFAYIIDHDJHN-UHFFFAOYSA-N 0.000 description 2
- BDHOUGWYKHSPIX-UHFFFAOYSA-N 5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine Chemical compound C1C(N)CCC2=C(OC)C(OC)=CC=C21 BDHOUGWYKHSPIX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 206010007559 Cardiac failure congestive Diseases 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 206010019280 Heart failures Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 240000007711 Peperomia pellucida Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 206010047139 Vasoconstriction Diseases 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 239000000048 adrenergic agonist Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 206010003119 arrhythmia Diseases 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 229940097320 beta blocking agent Drugs 0.000 description 2
- 102000015005 beta-adrenergic receptor activity proteins Human genes 0.000 description 2
- 108040006818 beta-adrenergic receptor activity proteins Proteins 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000004087 circulation Effects 0.000 description 2
- 229960003920 cocaine Drugs 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- FGXWKSZFVQUSTL-UHFFFAOYSA-N domperidone Chemical compound C12=CC=CC=C2NC(=O)N1CCCN(CC1)CCC1N1C2=CC=C(Cl)C=C2NC1=O FGXWKSZFVQUSTL-UHFFFAOYSA-N 0.000 description 2
- 229960001253 domperidone Drugs 0.000 description 2
- 229960003638 dopamine Drugs 0.000 description 2
- RYBJORHCUPVNMB-UHFFFAOYSA-N dopexamine Chemical compound C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=CC=C1 RYBJORHCUPVNMB-UHFFFAOYSA-N 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical group C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 229940044601 receptor agonist Drugs 0.000 description 2
- 239000000018 receptor agonist Substances 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229940037001 sodium edetate Drugs 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 235000011008 sodium phosphates Nutrition 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- 230000025033 vasoconstriction Effects 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- RQEUFEKYXDPUSK-SSDOTTSWSA-N (1R)-1-phenylethanamine Chemical compound C[C@@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-SSDOTTSWSA-N 0.000 description 1
- ZWVMLYRJXORSEP-LURJTMIESA-N (2s)-hexane-1,2,6-triol Chemical compound OCCCC[C@H](O)CO ZWVMLYRJXORSEP-LURJTMIESA-N 0.000 description 1
- GOTMKOSCLKVOGG-OAHLLOKOSA-N (5R)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol Chemical compound C1([C@@H]2C3=CC(O)=C(Cl)C=C3CCN(C2)C)=CC=CC=C1 GOTMKOSCLKVOGG-OAHLLOKOSA-N 0.000 description 1
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 description 1
- NHOWREQLQRFDRW-UHFFFAOYSA-N (methoxyamino)oxymethane Chemical compound CONOC NHOWREQLQRFDRW-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- WXHKGHCTUDDWLT-UHFFFAOYSA-N 2-[2-(3,4-dimethoxyphenyl)ethylamino]hexanoic acid Chemical compound CCCCC(C(O)=O)NCCC1=CC=C(OC)C(OC)=C1 WXHKGHCTUDDWLT-UHFFFAOYSA-N 0.000 description 1
- XXZCIYUJYUESMD-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(morpholin-4-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCOCC1 XXZCIYUJYUESMD-UHFFFAOYSA-N 0.000 description 1
- ICNCZFQYZKPYMS-UHFFFAOYSA-N 2-methylpropanoyl bromide Chemical compound CC(C)C(Br)=O ICNCZFQYZKPYMS-UHFFFAOYSA-N 0.000 description 1
- YDFUKLDDPTVJJN-UHFFFAOYSA-N 2-propylhexanediamide Chemical compound CCCC(C(N)=O)CCCC(N)=O YDFUKLDDPTVJJN-UHFFFAOYSA-N 0.000 description 1
- BWEICTHJUIJQPH-UHFFFAOYSA-N 3-Hydroxyadipic acid 3,6-lactone Chemical compound OC(=O)CC1CCC(=O)O1 BWEICTHJUIJQPH-UHFFFAOYSA-N 0.000 description 1
- SMXUUZUOPBPPDJ-UHFFFAOYSA-N 3-ethylbenzene-1,2-diol;dihydrobromide Chemical compound Br.Br.CCC1=CC=CC(O)=C1O SMXUUZUOPBPPDJ-UHFFFAOYSA-N 0.000 description 1
- IBOFVQJTBBUKMU-UHFFFAOYSA-N 4,4'-methylene-bis-(2-chloroaniline) Chemical compound C1=C(Cl)C(N)=CC=C1CC1=CC=C(N)C(Cl)=C1 IBOFVQJTBBUKMU-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FYHQUWABAJHTCR-UHFFFAOYSA-N 4-[2-(6-aminohexylamino)ethyl]benzene-1,2-diol Chemical compound NCCCCCCNCCC1=CC=C(O)C(O)=C1 FYHQUWABAJHTCR-UHFFFAOYSA-N 0.000 description 1
- UIMGZKTVCYDUQC-UHFFFAOYSA-N 4-[2-[4-(2-phenylethylamino)butylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCNCCC1=CC=CC=C1 UIMGZKTVCYDUQC-UHFFFAOYSA-N 0.000 description 1
- PJQMTWWWOQJGJG-UHFFFAOYSA-N 4-[2-[6-(1,2,3,4-tetrahydronaphthalen-2-ylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNC1CC2=CC=CC=C2CC1 PJQMTWWWOQJGJG-UHFFFAOYSA-N 0.000 description 1
- MQPOIMQXPKHJDJ-UHFFFAOYSA-N 4-[2-[6-(2-pyridin-4-ylethylamino)hexylamino]ethyl]benzene-1,2-diol;trihydrobromide Chemical compound Br.Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=NC=C1 MQPOIMQXPKHJDJ-UHFFFAOYSA-N 0.000 description 1
- KWMPOFGIVABWOO-UHFFFAOYSA-N 4-[2-[6-(4-phenylbutylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCCCC1=CC=CC=C1 KWMPOFGIVABWOO-UHFFFAOYSA-N 0.000 description 1
- CGWKMFICCNUNRB-UHFFFAOYSA-N 4-[2-[6-[(2-hydroxy-2-phenylethyl)amino]hexylamino]ethyl]benzene-1,2-diol Chemical compound C=1C=CC=CC=1C(O)CNCCCCCCNCCC1=CC=C(O)C(O)=C1 CGWKMFICCNUNRB-UHFFFAOYSA-N 0.000 description 1
- KDFNXFVZDZLGNB-UHFFFAOYSA-N 4-[2-[6-[2-(4-aminophenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol Chemical compound C1=CC(N)=CC=C1CCNCCCCCCNCCC1=CC=C(O)C(O)=C1 KDFNXFVZDZLGNB-UHFFFAOYSA-N 0.000 description 1
- SVIJPNNTIJXREY-UHFFFAOYSA-N 4-[2-[6-[2-(4-chlorophenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol Chemical compound C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=C(Cl)C=C1 SVIJPNNTIJXREY-UHFFFAOYSA-N 0.000 description 1
- LDGLRXMWCIGYMA-UHFFFAOYSA-N 4-[2-[6-[2-(4-chlorophenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=C(Cl)C=C1 LDGLRXMWCIGYMA-UHFFFAOYSA-N 0.000 description 1
- ZLRMLXRTTYRUNM-UHFFFAOYSA-N 4-[2-[6-[2-(4-methylphenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=CC(C)=CC=C1CCNCCCCCCNCCC1=CC=C(O)C(O)=C1 ZLRMLXRTTYRUNM-UHFFFAOYSA-N 0.000 description 1
- KJTLKQLRIQPLSV-UHFFFAOYSA-N 4-[2-[6-[2-(4-nitrophenyl)ethylamino]hexylamino]ethyl]benzene-1,2-diol;dihydrobromide Chemical compound Br.Br.C1=C(O)C(O)=CC=C1CCNCCCCCCNCCC1=CC=C([N+]([O-])=O)C=C1 KJTLKQLRIQPLSV-UHFFFAOYSA-N 0.000 description 1
- JWLVGBAVDPTTDJ-UHFFFAOYSA-N 4-[2-[6-[methyl(2-phenylethyl)amino]hexylamino]ethyl]benzene-1,2-diol dihydrobromide Chemical compound Br.Br.CN(CCCCCCNCCC=1C=C(C(=CC1)O)O)CCC1=CC=CC=C1 JWLVGBAVDPTTDJ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- CNOYQLOSBYLHEK-UHFFFAOYSA-N 5,6,7,8-tetrahydronaphthalene-1,2-diol Chemical compound C1CCCC2=C(O)C(O)=CC=C21 CNOYQLOSBYLHEK-UHFFFAOYSA-N 0.000 description 1
- MDKVBKWGRHXAME-UHFFFAOYSA-N 5,6-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride Chemical compound Cl.C1C(N)CCC2=C(OC)C(OC)=CC=C21 MDKVBKWGRHXAME-UHFFFAOYSA-N 0.000 description 1
- GOPOYPFKERUBLH-UHFFFAOYSA-N 5,6-dimethoxy-N-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride Chemical compound Cl.COC1=C2CCCC(C2=CC=C1OC)NC(C)C1=CC=CC=C1 GOPOYPFKERUBLH-UHFFFAOYSA-N 0.000 description 1
- JCTQUEXWIRVMLH-UHFFFAOYSA-N 5-amino-6-[6-(2-phenylethylamino)hexyl]-5,6,7,8-tetrahydronaphthalene-2,3-diol;dihydrobromide Chemical compound Br.Br.C1CC2=CC(O)=C(O)C=C2C(N)C1CCCCCCNCCC1=CC=CC=C1 JCTQUEXWIRVMLH-UHFFFAOYSA-N 0.000 description 1
- YGRAXZCBLZDEIZ-UHFFFAOYSA-N 6-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(2-phenylethylamino)hexan-3-ol;dihydrochloride Chemical compound Cl.Cl.C1=C(OC)C(OC)=CC=C1CCNCCCC(O)CCNCCC1=CC=CC=C1 YGRAXZCBLZDEIZ-UHFFFAOYSA-N 0.000 description 1
- XMVQMBLTFKAIOX-UHFFFAOYSA-N 6-azaniumylhexylazanium;dichloride Chemical compound [Cl-].[Cl-].[NH3+]CCCCCC[NH3+] XMVQMBLTFKAIOX-UHFFFAOYSA-N 0.000 description 1
- 108060003345 Adrenergic Receptor Proteins 0.000 description 1
- 102000017910 Adrenergic receptor Human genes 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- ITNDMWPQHKLUQF-UHFFFAOYSA-N Br.Br.C(C)(=O)O.C(C)(=O)O Chemical compound Br.Br.C(C)(=O)O.C(C)(=O)O ITNDMWPQHKLUQF-UHFFFAOYSA-N 0.000 description 1
- ONUZVFWKGWZKOM-UHFFFAOYSA-N Br.Br.C=1(C(=CC=CC1)O)O Chemical compound Br.Br.C=1(C(=CC=CC1)O)O ONUZVFWKGWZKOM-UHFFFAOYSA-N 0.000 description 1
- HTVQMCMWGWTYHN-UHFFFAOYSA-N Br.Br.CC1=C2CCC2=CC(=C1O)O Chemical compound Br.Br.CC1=C2CCC2=CC(=C1O)O HTVQMCMWGWTYHN-UHFFFAOYSA-N 0.000 description 1
- NDPLSLXDCNBJGQ-UHFFFAOYSA-N Br.Br.NC1=CC=CC2=CC(=C(C=C12)O)O Chemical compound Br.Br.NC1=CC=CC2=CC(=C(C=C12)O)O NDPLSLXDCNBJGQ-UHFFFAOYSA-N 0.000 description 1
- FUYVZVRPLOFDJG-UHFFFAOYSA-N Br.Br.OC1=CC=C(C=C1)CCNCCCCCCNC1=CC=CC(C1(O)CC)O Chemical compound Br.Br.OC1=CC=C(C=C1)CCNCCCCCCNC1=CC=CC(C1(O)CC)O FUYVZVRPLOFDJG-UHFFFAOYSA-N 0.000 description 1
- DIGBWCDSTFBRKO-UHFFFAOYSA-N Br.C1(=CC=CC=C1)CCCNCCCCCCNCCC1=C(C(=CC=C1)O)O Chemical compound Br.C1(=CC=CC=C1)CCCNCCCCCCNCCC1=C(C(=CC=C1)O)O DIGBWCDSTFBRKO-UHFFFAOYSA-N 0.000 description 1
- BPBVFOUDOUDFNT-UHFFFAOYSA-N COC1=C(C=C(C=C1)CCN(CCC2=CC=C(C=C2)Cl)C(=O)CCCCC(=O)N)OC Chemical compound COC1=C(C=C(C=C1)CCN(CCC2=CC=C(C=C2)Cl)C(=O)CCCCC(=O)N)OC BPBVFOUDOUDFNT-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HWASXODGSCEKIL-UHFFFAOYSA-N Cl.Cl.OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 Chemical compound Cl.Cl.OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 HWASXODGSCEKIL-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 102000015554 Dopamine receptor Human genes 0.000 description 1
- 108050004812 Dopamine receptor Proteins 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- VFIDUCMKNJIJTO-BBRMVZONSA-N ICI 118551 Chemical compound CC(C)N[C@@H](C)[C@@H](O)COC1=CC=C(C)C2=C1CCC2 VFIDUCMKNJIJTO-BBRMVZONSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- 208000025966 Neurological disease Diseases 0.000 description 1
- 229920000305 Nylon 6,10 Polymers 0.000 description 1
- 208000027771 Obstructive airways disease Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 1
- QZVCTJOXCFMACW-UHFFFAOYSA-N Phenoxybenzamine Chemical compound C=1C=CC=CC=1CN(CCCl)C(C)COC1=CC=CC=C1 QZVCTJOXCFMACW-UHFFFAOYSA-N 0.000 description 1
- 208000001647 Renal Insufficiency Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- KUHOOIJKNZSYTE-UHFFFAOYSA-N [2-(2-methylpropanoyloxy)-4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]phenyl] 2-methylpropanoate;dihydrochloride Chemical compound Cl.Cl.C1=C(OC(=O)C(C)C)C(OC(=O)C(C)C)=CC=C1CCNCCCCCCNCCC1=CC=CC=C1 KUHOOIJKNZSYTE-UHFFFAOYSA-N 0.000 description 1
- UVMUORJXXBPSQE-UHFFFAOYSA-N [Na].COCCO[AlH2] Chemical compound [Na].COCCO[AlH2] UVMUORJXXBPSQE-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 description 1
- 229960002105 amrinone Drugs 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 210000002376 aorta thoracic Anatomy 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 229960002274 atenolol Drugs 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- 229940125388 beta agonist Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 102000014974 beta2-adrenergic receptor activity proteins Human genes 0.000 description 1
- 108040006828 beta2-adrenergic receptor activity proteins Proteins 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 230000001813 broncholytic effect Effects 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000003943 catecholamines Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 239000000544 cholinesterase inhibitor Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- PIZLBWGMERQCOC-UHFFFAOYSA-N dibenzyl carbonate Chemical compound C=1C=CC=CC=1COC(=O)OCC1=CC=CC=C1 PIZLBWGMERQCOC-UHFFFAOYSA-N 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 235000005583 doda Nutrition 0.000 description 1
- 229940052760 dopamine agonists Drugs 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- 229960001857 dopexamine Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 208000031424 hyperprolactinemia Diseases 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- LFKYBJLFJOOKAE-UHFFFAOYSA-N imidazol-2-ylidenemethanone Chemical compound O=C=C1N=CC=N1 LFKYBJLFJOOKAE-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000004041 inotropic agent Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 201000006370 kidney failure Diseases 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- HDLGIEZOMYJKAK-UHFFFAOYSA-N methyl 6-chloro-6-oxohexanoate Chemical compound COC(=O)CCCCC(Cl)=O HDLGIEZOMYJKAK-UHFFFAOYSA-N 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- 229960004503 metoclopramide Drugs 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- YEWCJOZZLSWGEA-UHFFFAOYSA-N n-[2-(4-chlorophenyl)ethyl]-n'-[2-(3,4-dimethoxyphenyl)ethyl]hexane-1,6-diamine Chemical compound C1=C(OC)C(OC)=CC=C1CCNCCCCCCNCCC1=CC=C(Cl)C=C1 YEWCJOZZLSWGEA-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229960003418 phenoxybenzamine Drugs 0.000 description 1
- MRBDMNSDAVCSSF-UHFFFAOYSA-N phentolamine Chemical compound C1=CC(C)=CC=C1N(C=1C=C(O)C=CC=1)CC1=NCCN1 MRBDMNSDAVCSSF-UHFFFAOYSA-N 0.000 description 1
- 229960001999 phentolamine Drugs 0.000 description 1
- 150000007925 phenylethylamine derivatives Chemical class 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000003087 receptor blocking agent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008327 renal blood flow Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical class C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 239000003451 thiazide diuretic agent Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 230000008673 vomiting Effects 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
- C07D307/33—Oxygen atoms in position 2, the oxygen atom being in its keto or unsubstituted enol form
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI903791A FI903791A7 (fi) | 1981-08-05 | 1982-07-28 | Menetelmä valmistaa farmakologisesti vaikuttavia dihydroksifenyylietyylidiamiineja |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8123962 | 1981-08-05 | ||
| GB8123962 | 1981-08-05 | ||
| GB8130595 | 1981-10-09 | ||
| GB8130594 | 1981-10-09 | ||
| GB8130595 | 1981-10-09 | ||
| GB8130594 | 1981-10-09 | ||
| GB8134551 | 1981-11-17 | ||
| GB8134551 | 1981-11-17 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI822630A0 FI822630A0 (fi) | 1982-07-28 |
| FI822630L FI822630L (fi) | 1983-02-06 |
| FI82238B FI82238B (fi) | 1990-10-31 |
| FI82238C true FI82238C (fi) | 1991-02-11 |
Family
ID=27449264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI822630A FI82238C (fi) | 1981-08-05 | 1982-07-28 | Foerfarande foer framstaellning av farmakologiskt verksamma dihydroxifenyletyldiaminer. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5013760A (online.php) |
| EP (1) | EP0072061B1 (online.php) |
| AU (1) | AU538078B2 (online.php) |
| CA (1) | CA1191846A (online.php) |
| CY (1) | CY1428A (online.php) |
| DE (1) | DE3263531D1 (online.php) |
| DK (1) | DK163181C (online.php) |
| ES (1) | ES8405757A1 (online.php) |
| FI (1) | FI82238C (online.php) |
| GR (1) | GR77995B (online.php) |
| HK (1) | HK41388A (online.php) |
| IE (1) | IE53827B1 (online.php) |
| IL (1) | IL66449A (online.php) |
| LU (1) | LU88284I2 (online.php) |
| MY (1) | MY8700459A (online.php) |
| NL (1) | NL930078I2 (online.php) |
| NO (1) | NO154492C (online.php) |
| NZ (1) | NZ201479A (online.php) |
| PT (1) | PT75380B (online.php) |
| SG (1) | SG46287G (online.php) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI843507A0 (fi) * | 1983-01-21 | 1984-09-07 | Fisons Plc | Aromatiska aminer. |
| GB8301754D0 (en) * | 1983-01-21 | 1983-02-23 | Fisons Plc | Formulation |
| DE3484048D1 (de) * | 1983-10-25 | 1991-03-07 | Fisons Plc | Phenylethylamine, verfahren zu deren herstellung und diese enthaltende zusammensetzungen. |
| US4720586A (en) * | 1983-12-06 | 1988-01-19 | Fisons, Plc | Substituted 3,4-dihydroxy-phenylethylamino compounds |
| NZ214823A (en) * | 1985-01-15 | 1989-08-29 | Glaxo Group Ltd | 2-substituted-3,4-dihydroxyphenethylamino derivatives |
| ATE64369T1 (de) * | 1985-11-20 | 1991-06-15 | Fisons Plc | Catecholamin-derivate, verfahren zu deren herstellung und deren pharmazeutische zusammensetzungen. |
| GB8603765D0 (en) * | 1986-02-15 | 1986-03-19 | Beecham Wuelfung Gmbh & Co Kg | Compounds |
| US5602174A (en) * | 1986-02-15 | 1997-02-11 | Beecham Wuefling Gmbh & Co. | Treatment |
| GB2192394A (en) * | 1986-07-11 | 1988-01-13 | Glaxo Group Ltd | Amine derivatives |
| US5753714A (en) * | 1987-02-03 | 1998-05-19 | Merrell Pharmaceuticals Inc. | Polyamine derivatives |
| AU614749B2 (en) * | 1987-05-19 | 1991-09-12 | Fisons Plc | 2-(3,4-dihydroxyphenyl)ethylamines, and their use pharmaceutical compositions |
| IT1254521B (it) * | 1992-03-17 | 1995-09-25 | Zambon Spa | Derivati della 2-ammino-tetralina attivi sul sistema cardiovascolare |
| IT1271411B (it) * | 1993-09-14 | 1997-05-28 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
| IT1271008B (it) * | 1994-09-13 | 1997-05-26 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidro-naftalene attivi sul sistema cardiovascolare |
| IT1271007B (it) * | 1994-09-13 | 1997-05-26 | Zambon Spa | Derivati del 2-ammino-1,2,3,4-tetraidronaftalene attivi sul sistema cardiovascolare |
| FR2870537A1 (fr) * | 2004-05-19 | 2005-11-25 | Servier Lab | Nouveau procede de synthese du (1s)-4,5-dimethoxy-1-(methyl aminomethyl-)-benzocyclobutane et de ses sels d'addition, et application a la synthese de l'ivabradine et de ses sels d'addition a un acide pharmaceutiquement acceptable |
| KR101727230B1 (ko) | 2008-10-21 | 2017-04-14 | 얀센 리서치 앤드 디벨로프먼트, 엘엘씨 | 생체내 혈관운동 반응을 평가하기 위한 동물 모델 |
| CN105001103B (zh) * | 2015-05-31 | 2017-11-03 | 江苏同禾药业有限公司 | 一种盐酸多培沙明中间体的合成方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2653977A (en) * | 1953-09-29 | Chxnx | ||
| US2739981A (en) * | 1952-08-26 | 1956-03-27 | American Home Prod | Diamines and salts thereof |
| US2937185A (en) * | 1956-08-13 | 1960-05-17 | Lakeside Lab Inc | Diamino alkanols and alkanones |
| US3013020A (en) * | 1958-01-24 | 1961-12-12 | Miles Lab | N,n'-bis-phenyl-alkylene-diamines |
| GB1004071A (en) * | 1961-07-03 | 1965-09-08 | Council Scient Ind Res | Substituted ª‰-phenethylamines and a process for the production thereof |
| GB1025699A (en) * | 1965-01-08 | 1966-04-14 | Boehringer & Soehne Gmbh | New n,n-diphenyl-alkylene-ª‡,ªÏ-diamines |
| DE1768297B1 (de) * | 1968-04-26 | 1971-12-16 | Beiersdorf Ag | Substituierte Alkylendiamine und deren Salze |
| US3867454A (en) * | 1971-03-10 | 1975-02-18 | Sterling Drug Inc | 1,1-BRIDGED-BIS(N-aralkyl-2-aminoethanols) |
| US3933913A (en) * | 1971-06-01 | 1976-01-20 | Smithkline Corporation | N,N'-bis[3-substituted-4-hydroxypheyl)-2-hydroxyethyl)]-polymethylenediamines |
| GB1440440A (en) * | 1972-10-06 | 1976-06-23 | Manuf Prod Pharma | Tetrahydronaphthalene derivatives |
| NO743023L (online.php) * | 1973-08-31 | 1975-03-24 | Sandoz Ag | |
| US3928323A (en) * | 1973-12-18 | 1975-12-23 | Millmaster Onyx Corp | Anti-microbial quaternary ammonium co-polymers |
| US3960959A (en) * | 1973-12-19 | 1976-06-01 | Sandoz Ltd. | N,N'-bis{6-[(3,4-dihydroxyphenyl)alkylamino]-hexyl}hexamethylenediamines and the salts thereof |
| US4210749A (en) * | 1974-11-12 | 1980-07-01 | Pennwalt Corporation | Substituted 1,2,4,5-tetrahydro-3H,3 benzazepines |
| US4163063A (en) * | 1976-01-02 | 1979-07-31 | University Of Iowa Research Foundation | Aminotetralin adrenergic β-agonists |
| GB8301754D0 (en) * | 1983-01-21 | 1983-02-23 | Fisons Plc | Formulation |
-
1982
- 1982-07-22 DE DE8282200930T patent/DE3263531D1/de not_active Expired
- 1982-07-22 EP EP82200930A patent/EP0072061B1/en not_active Expired
- 1982-07-28 FI FI822630A patent/FI82238C/fi not_active IP Right Cessation
- 1982-08-02 IL IL66449A patent/IL66449A/xx not_active IP Right Cessation
- 1982-08-03 CA CA000408660A patent/CA1191846A/en not_active Expired
- 1982-08-03 AU AU86702/82A patent/AU538078B2/en not_active Expired
- 1982-08-03 NZ NZ201479A patent/NZ201479A/en unknown
- 1982-08-04 GR GR68959A patent/GR77995B/el unknown
- 1982-08-04 NO NO82822671A patent/NO154492C/no not_active IP Right Cessation
- 1982-08-04 PT PT75380A patent/PT75380B/pt unknown
- 1982-08-04 DK DK349582A patent/DK163181C/da active
- 1982-08-04 IE IE1872/82A patent/IE53827B1/en not_active IP Right Cessation
- 1982-08-04 ES ES514725A patent/ES8405757A1/es not_active Expired
-
1986
- 1986-04-01 US US06/846,846 patent/US5013760A/en not_active Expired - Lifetime
-
1987
- 1987-05-21 SG SG46287A patent/SG46287G/en unknown
- 1987-12-30 MY MY459/87A patent/MY8700459A/xx unknown
-
1988
- 1988-06-02 HK HK413/88A patent/HK41388A/en not_active IP Right Cessation
- 1988-09-02 CY CY1428A patent/CY1428A/xx unknown
-
1993
- 1993-06-03 LU LU88284C patent/LU88284I2/fr unknown
- 1993-06-17 NL NL930078C patent/NL930078I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0072061B1 (en) | 1985-05-15 |
| DK163181B (da) | 1992-02-03 |
| FI82238B (fi) | 1990-10-31 |
| AU538078B2 (en) | 1984-07-26 |
| LU88284I2 (fr) | 1994-05-04 |
| DK349582A (da) | 1983-02-06 |
| PT75380B (en) | 1986-02-12 |
| ES514725A0 (es) | 1984-06-16 |
| DK163181C (da) | 1992-06-22 |
| CA1191846A (en) | 1985-08-13 |
| SG46287G (en) | 1987-11-13 |
| NO154492C (no) | 1986-10-01 |
| NL930078I2 (nl) | 1993-11-16 |
| NO822671L (no) | 1983-02-07 |
| IL66449A (en) | 1986-12-31 |
| NZ201479A (en) | 1986-07-11 |
| ES8405757A1 (es) | 1984-06-16 |
| MY8700459A (en) | 1987-12-31 |
| IE821872L (en) | 1983-02-05 |
| CY1428A (en) | 1988-09-02 |
| US5013760A (en) | 1991-05-07 |
| HK41388A (en) | 1988-06-10 |
| FI822630L (fi) | 1983-02-06 |
| DE3263531D1 (en) | 1985-06-20 |
| NL930078I1 (nl) | 1993-09-16 |
| NO154492B (no) | 1986-06-23 |
| FI822630A0 (fi) | 1982-07-28 |
| EP0072061A1 (en) | 1983-02-16 |
| PT75380A (en) | 1982-09-01 |
| IE53827B1 (en) | 1989-03-15 |
| GR77995B (online.php) | 1984-09-26 |
| AU8670282A (en) | 1983-02-10 |
| IL66449A0 (en) | 1982-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI82238C (fi) | Foerfarande foer framstaellning av farmakologiskt verksamma dihydroxifenyletyldiaminer. | |
| FI88289C (fi) | Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara fenoxiaettiksyraderivat | |
| RU2114108C1 (ru) | ПРОИЗВОДНЫЕ 7-(2-АМИНОЭТИЛ)БЕНЗОТИАЗОЛОНА ИЛИ ИХ ФАРМАЦЕВТИЧЕСКИ ПРИЕМЛЕМЫЕ СОЛИ, СПОСОБЫ ИХ ПОЛУЧЕНИЯ, ПРОИЗВОДНЫЕ N-[2-(4-ГИДРОКСИ-2-ОКСО-3H-1,3-БЕНЗОТИАЗОЛ-7-ИЛ)ЭТИЛАМИДА]ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ, ПРОЯВЛЯЮЩАЯ АГОНИСТИЧЕСКУЮ АКТИВНОСТЬ В ОТНОШЕНИИ β2-АДРЕНОРЕЦЕПТОРОВ | |
| CA2004575A1 (en) | 2-amino-4 or 5-methoxycyclohexyl amides useful as analgesics | |
| HU215846B (hu) | Eljárás aril-glicin-amid-származékok előállítására | |
| JP3990399B2 (ja) | β2−受容体興奮作用を有する新規フェニルエタノールアミン類化合物及びそれらの製造方法 | |
| EP0142283B1 (en) | Phenylethylamines, process for their preparation and compositions containing them | |
| KR870000183B1 (ko) | 페닐알킬아민의 제조방법 | |
| PL95166B1 (online.php) | ||
| RU2177476C2 (ru) | Биологически активные этанамины бензотиазолона | |
| JPWO1994001392A1 (ja) | (−)−リトドリン | |
| US6214882B1 (en) | Benzenesulphonamide derivatives, preparation thereof and therapeutical uses thereof | |
| US4840967A (en) | Carbamate or urea derivatives, their preparation and pharmaceutical compositions comprising them | |
| US5023378A (en) | Amine derivatives | |
| JPH0517900B2 (online.php) | ||
| PT93844A (pt) | Processo para a preparacao de derivados de fenetanolamina | |
| EP3481383B1 (en) | Compositions and methods for the treatment of irritable bowel syndrome | |
| EP0118974B1 (en) | 3,4-dihydroxyphenyl ethyl amine derivatives and pharmaceutical compositions containing them | |
| JPH0310614B2 (online.php) | ||
| KR20030026853A (ko) | 바닐로이드 수용체의 효현제로서 강력한 진통효과를나타내는 단순구조의 레시니페라톡신 동족체 및 이를함유하는 약학적 조성물 | |
| EP0747345A2 (en) | Ethylamido fluorenes and improved method of making same | |
| KR0168494B1 (ko) | N-아릴알킬호모바닐릭아미드 유도체 및 이의 제조방법 | |
| FI85140C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-(1h-indol-4-yl)-bensamidderivat. | |
| EP0223598B1 (en) | Catecholamine derivatives, processes for their preparation and pharmaceutical compositions thereof | |
| FI87350B (fi) | Foerfarande foer framstaellning av antiarrytmiska medel samt mellanprodukter foer dessa medel. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ND | Supplementary protection certificate (spc) granted | ||
| SPCG | Supplementary protection certificate granted |
Spc suppl protection certif: L6 Extension date: 20030411 |
|
| QB | Licence granted / registered | ||
| MA | Patent expired |
Owner name: FISONS PLC |