FI81349C - Foerfarande foer framstaellning av ergolinderivat. - Google Patents
Foerfarande foer framstaellning av ergolinderivat. Download PDFInfo
- Publication number
- FI81349C FI81349C FI841631A FI841631A FI81349C FI 81349 C FI81349 C FI 81349C FI 841631 A FI841631 A FI 841631A FI 841631 A FI841631 A FI 841631A FI 81349 C FI81349 C FI 81349C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- ergoline
- group
- aminomethyl
- formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 5
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title description 10
- 150000001875 compounds Chemical class 0.000 claims description 72
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000002220 antihypertensive agent Substances 0.000 claims description 2
- 238000006482 condensation reaction Methods 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 claims 1
- 239000003814 drug Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- -1 ergoline amine Chemical class 0.000 description 9
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 230000035488 systolic blood pressure Effects 0.000 description 7
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 6
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 235000013985 cinnamic acid Nutrition 0.000 description 6
- 229930016911 cinnamic acid Natural products 0.000 description 6
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 6
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 6
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 5
- 101100244083 Arabidopsis thaliana PKL gene Proteins 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 4
- 229960002474 hydralazine Drugs 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 3
- 230000003276 anti-hypertensive effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- ABRBOIYRUQIOOQ-OZOXKJRCSA-N CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NC(C)C)=O)CCC(=O)OC Chemical compound CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NC(C)C)=O)CCC(=O)OC ABRBOIYRUQIOOQ-OZOXKJRCSA-N 0.000 description 2
- LEPTYNBLYNNZKZ-OZOXKJRCSA-N CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NCCC)=O)CCC(=O)OC Chemical compound CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NCCC)=O)CCC(=O)OC LEPTYNBLYNNZKZ-OZOXKJRCSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- KOMHDDJQJLCNRL-UKRRQHHQSA-N [(6ar,10ar)-7-methyl-6,6a,8,10a-tetrahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical compound C1=CC([C@H]2C=C(CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 KOMHDDJQJLCNRL-UKRRQHHQSA-N 0.000 description 2
- IXCCQSTVBSTCLP-PSOPSSQASA-N [(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methanamine Chemical compound C1=CC([C@H]2C[C@@H](CN)CN([C@@H]2C2)C)=C3C2=CNC3=C1 IXCCQSTVBSTCLP-PSOPSSQASA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ZKPPKVINSFBLOE-POWSATBFSA-N 1-[[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]-3-propan-2-ylimidazolidine-2,4-dione Chemical compound O=C1N(C(C)C)C(=O)CN1CC1CN(C)[C@H](CC=2C3=C4C=CC=C3NC=2)[C@@H]4C1 ZKPPKVINSFBLOE-POWSATBFSA-N 0.000 description 1
- HTTUYLAYORPFBE-GDBMZVCRSA-N 1-[[(6ar,10ar)-7-methyl-6,6a,8,10a-tetrahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound CN([C@H]1[C@@H](C=2C=CC=C3NC=C(C=23)C1)C=1)CC=1CN1CC(=O)NC1=O HTTUYLAYORPFBE-GDBMZVCRSA-N 0.000 description 1
- YHSDGTDDNRDFQV-SRCQZFHVSA-N 1-[[(6ar,9r,10ar)-5,7-dimethyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(C)=C(C=34)C2)C1)C)N1CC(=O)NC1=O YHSDGTDDNRDFQV-SRCQZFHVSA-N 0.000 description 1
- MWCQXBWFDMNTTB-IXPVHAAZSA-N 1-[[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N1CC(=O)NC1=O MWCQXBWFDMNTTB-IXPVHAAZSA-N 0.000 description 1
- VXIHQTMCLKWCBN-SGIREYDYSA-N 1-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methyl]imidazolidine-2,4-dione Chemical compound C([C@@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC=C(C=34)C2)C1)C)N1CC(=O)NC1=O VXIHQTMCLKWCBN-SGIREYDYSA-N 0.000 description 1
- RGICCULPCWNRAB-UHFFFAOYSA-N 2-[2-(2-hexoxyethoxy)ethoxy]ethanol Chemical compound CCCCCCOCCOCCOCCO RGICCULPCWNRAB-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- FUELNPXXFWKVLG-FDQGKXFDSA-N 3-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methylamino]propanenitrile Chemical compound C1=CC([C@H]2C[C@@H](CNCCC#N)CN([C@@H]2C2)C)=C3C2=CNC3=C1 FUELNPXXFWKVLG-FDQGKXFDSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- PHQTVNOHJMVYBG-RHSMWYFYSA-N COC(=O)CCNCN1CCC[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C34 Chemical compound COC(=O)CCNCN1CCC[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C34 PHQTVNOHJMVYBG-RHSMWYFYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- GUVNNCDOTNBLIR-UHFFFAOYSA-N N1=CC=CC=C1.C(CCC)O.CN(C=O)C.C(C)(=O)OCC Chemical compound N1=CC=CC=C1.C(CCC)O.CN(C=O)C.C(C)(=O)OCC GUVNNCDOTNBLIR-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- AJOKDRANDABNLO-UWAXEDRTSA-N O=C1N(CC(N1C)=O)CC12C[C@H]3NCCC[C@@H]3C=3C=CC=C(N=C1)C32 Chemical compound O=C1N(CC(N1C)=O)CC12C[C@H]3NCCC[C@@H]3C=3C=CC=C(N=C1)C32 AJOKDRANDABNLO-UWAXEDRTSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 102000003946 Prolactin Human genes 0.000 description 1
- 108010057464 Prolactin Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 206010043087 Tachyphylaxis Diseases 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000009530 blood pressure measurement Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- JZRJLVWOFAGQBH-FVFSQFTHSA-N ethyl 2-[[(6aR,10aR)-6a,7,8,9,10,10a-hexahydro-6H-indolo[4,3-fg]quinolin-5a-yl]methyl-(propan-2-ylcarbamoyl)amino]acetate Chemical compound C(C)OC(=O)CN(C(NC(C)C)=O)CC12C[C@H]3NCCC[C@@H]3C=3C=CC=C(N=C1)C=32 JZRJLVWOFAGQBH-FVFSQFTHSA-N 0.000 description 1
- BOPVKNRDXHVWEG-LSBZLQRGSA-N ethyl 2-[[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl-(methylcarbamoyl)amino]acetate Chemical compound CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NC)=O)CC(=O)OCC BOPVKNRDXHVWEG-LSBZLQRGSA-N 0.000 description 1
- QOSXQPJDPYCNGQ-FDQGKXFDSA-N ethyl 2-[[(6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-yl]methylamino]acetate Chemical compound C1=CC([C@H]2C[C@H](CN(C)[C@@H]2C2)CNCC(=O)OCC)=C3C2=CNC3=C1 QOSXQPJDPYCNGQ-FDQGKXFDSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000009027 insemination Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- YJDCLQNEBBDWBA-LSBZLQRGSA-N methyl 3-[[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl-(methylcarbamoyl)amino]propanoate Chemical compound CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(NC)=O)CCC(=O)OC YJDCLQNEBBDWBA-LSBZLQRGSA-N 0.000 description 1
- AFXWCWRUFVUNLC-MZMPZRCHSA-N methyl 3-[[(6aR,9R,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl-carbamoylamino]propanoate Chemical compound CN1C[C@@H](C[C@@H]2C=3C=CC=C4NC=C(C[C@@H]12)C=34)CN(C(N)=O)CCC(=O)OC AFXWCWRUFVUNLC-MZMPZRCHSA-N 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 210000000287 oocyte Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229940097325 prolactin Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000035485 pulse pressure Effects 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8311679 | 1983-04-28 | ||
| GB838311679A GB8311679D0 (en) | 1983-04-28 | 1983-04-28 | Ergoline derivatives |
| GB838314816A GB8314816D0 (en) | 1983-05-27 | 1983-05-27 | Ergoline derivatives |
| GB8314816 | 1983-05-27 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI841631A0 FI841631A0 (OSRAM) | 1984-04-25 |
| FI841631A7 FI841631A7 (OSRAM) | 1984-10-29 |
| FI81349B FI81349B (fi) | 1990-06-29 |
| FI81349C true FI81349C (fi) | 1990-10-10 |
Family
ID=26285978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI841631A FI81349C (fi) | 1983-04-28 | 1984-04-25 | Foerfarande foer framstaellning av ergolinderivat. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4690929A (OSRAM) |
| EP (1) | EP0126968B1 (OSRAM) |
| KR (1) | KR900008696B1 (OSRAM) |
| AU (1) | AU556968B2 (OSRAM) |
| CA (1) | CA1205801A (OSRAM) |
| DE (1) | DE3475709D1 (OSRAM) |
| DK (1) | DK162996C (OSRAM) |
| ES (1) | ES531906A0 (OSRAM) |
| FI (1) | FI81349C (OSRAM) |
| GR (1) | GR79575B (OSRAM) |
| HU (1) | HU198713B (OSRAM) |
| IE (1) | IE57240B1 (OSRAM) |
| IL (1) | IL71633A (OSRAM) |
| NO (1) | NO161562C (OSRAM) |
| PH (1) | PH21123A (OSRAM) |
| PT (1) | PT78496B (OSRAM) |
| SU (1) | SU1327788A3 (OSRAM) |
| YU (1) | YU43357B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8714767D0 (en) * | 1987-06-24 | 1987-07-29 | Erba Farmitalia | Egoline derivatives |
| NL8400333A (nl) * | 1983-02-16 | 1984-09-17 | Sandoz Ag | Moederkoornalkaloiden, hun bereiding en hun toepassing. |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
| DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
| GB8617907D0 (en) * | 1986-07-22 | 1986-08-28 | Erba Farmitalia | Tetracyclic indole derivatives |
| GB8702364D0 (en) * | 1987-02-03 | 1987-03-11 | Erba Farmitalia | Ergolinyl heterocycles |
| DK338789A (da) * | 1988-07-15 | 1990-01-16 | Schering Ag | 2-substituerede ergolinylurinstofderivater og fremgangsmaade til fremstilling deraf, deres anvendelse som laegemidler samt mellemprodukter til fremstilling deraf |
| EP0464178B1 (en) * | 1990-01-25 | 1995-12-06 | PHARMACIA S.p.A. | Process for preparing ergoline derivatives |
| GB9006772D0 (en) * | 1990-03-27 | 1990-05-23 | Erba Carlo Spa | 4-piperidinyl-ergoline derivatives |
| NZ258559A (en) * | 1992-12-24 | 1996-07-26 | Erba Carlo Spa | Ergoline derivatives; their preparation and pharmaceutical compositions containing them |
| CA2449634C (en) | 2001-06-08 | 2011-08-02 | Societe De Conseils De Recherches Et D'applications Scientifiques (S.C.R | Somatostatin-dopamine chimeric analogs |
| JP2016503402A (ja) | 2012-11-01 | 2016-02-04 | イプセン ファルマ ソシエテ パール アクシオン サンプリフィエIpsen Pharma S.A.S. | ソマトスタチン類似体及びそのダイマー |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127269A (en) * | 1961-09-11 | 1964-03-31 | Colour photography | |
| DK140596B (da) * | 1971-05-19 | 1979-10-08 | Sandoz Ag | Analogifremgangsmåde til fremstilling af 8beta-(ureidomethyl)-ergolenderivater. |
| NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| DE2456930A1 (de) * | 1974-12-02 | 1976-08-12 | Tesch Kg E | Elektronisches zeitspeicherrelais |
| CH615181A5 (en) * | 1975-05-21 | 1980-01-15 | Sandoz Ag | Process for the preparation of novel ergolene derivatives |
| GB2056437A (en) * | 1979-08-07 | 1981-03-18 | Erba Farmitalia | Secoergoline derivatives |
| DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
| DD154897A1 (de) * | 1980-12-02 | 1982-04-28 | Seifert Karlheinz Dipl Chem Dr | Verfahren zur herstellung von 8-substituierten ergolinen |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
-
1984
- 1984-04-23 PH PH30590A patent/PH21123A/en unknown
- 1984-04-24 DE DE8484104568T patent/DE3475709D1/de not_active Expired
- 1984-04-24 SU SU843728545A patent/SU1327788A3/ru active
- 1984-04-24 EP EP84104568A patent/EP0126968B1/en not_active Expired
- 1984-04-24 CA CA000452664A patent/CA1205801A/en not_active Expired
- 1984-04-25 IL IL71633A patent/IL71633A/xx not_active IP Right Cessation
- 1984-04-25 FI FI841631A patent/FI81349C/fi not_active IP Right Cessation
- 1984-04-25 ES ES531906A patent/ES531906A0/es active Granted
- 1984-04-26 US US06/604,041 patent/US4690929A/en not_active Expired - Fee Related
- 1984-04-26 GR GR74511A patent/GR79575B/el unknown
- 1984-04-26 IE IE1018/84A patent/IE57240B1/en not_active IP Right Cessation
- 1984-04-26 PT PT78496A patent/PT78496B/pt not_active IP Right Cessation
- 1984-04-26 YU YU742/84A patent/YU43357B/xx unknown
- 1984-04-26 NO NO841657A patent/NO161562C/no unknown
- 1984-04-27 AU AU27421/84A patent/AU556968B2/en not_active Ceased
- 1984-04-27 DK DK212784A patent/DK162996C/da not_active IP Right Cessation
- 1984-04-27 KR KR1019840002271A patent/KR900008696B1/ko not_active Expired
- 1984-04-27 HU HU841656A patent/HU198713B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0126968A1 (en) | 1984-12-05 |
| US4690929A (en) | 1987-09-01 |
| PT78496A (en) | 1984-05-01 |
| DK162996B (da) | 1992-01-06 |
| SU1327788A3 (ru) | 1987-07-30 |
| PT78496B (en) | 1986-07-22 |
| FI841631A0 (OSRAM) | 1984-04-25 |
| YU43357B (en) | 1989-06-30 |
| HUT34024A (en) | 1985-01-28 |
| DK212784A (da) | 1984-10-29 |
| PH21123A (en) | 1987-07-27 |
| ES8506031A1 (es) | 1985-06-01 |
| HU198713B (en) | 1989-11-28 |
| AU556968B2 (en) | 1986-11-27 |
| IL71633A0 (en) | 1984-07-31 |
| DK212784D0 (da) | 1984-04-27 |
| KR900008696B1 (ko) | 1990-11-27 |
| DK162996C (da) | 1992-06-01 |
| DE3475709D1 (en) | 1989-01-26 |
| YU74284A (en) | 1986-10-31 |
| AU2742184A (en) | 1984-11-01 |
| NO161562C (no) | 1989-08-30 |
| KR840008353A (ko) | 1984-12-14 |
| FI841631A7 (OSRAM) | 1984-10-29 |
| ES531906A0 (es) | 1985-06-01 |
| IE57240B1 (en) | 1992-06-17 |
| NO161562B (no) | 1989-05-22 |
| EP0126968B1 (en) | 1988-12-21 |
| IL71633A (en) | 1987-12-20 |
| CA1205801A (en) | 1986-06-10 |
| NO841657L (no) | 1984-10-29 |
| GR79575B (OSRAM) | 1984-10-30 |
| FI81349B (fi) | 1990-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI81349C (fi) | Foerfarande foer framstaellning av ergolinderivat. | |
| US4031098A (en) | Camptothecin analogues | |
| US3922347A (en) | Method of inhibiting prolactin secretion with 8-acylaminoergolenes | |
| BRPI0614828A2 (pt) | uso de derivados de tienopiridona como ativadores de ampk e composições farmacêuticas contendo-os | |
| RU2086551C1 (ru) | (s,s)-n-(2-оксициклопентил)-1-изопропил-6-метилэрголин-8-карбоксамид или (s,r)-n-(2-оксициклопентил)-1-изопропил-6-метилэрголин-8-карбоксамид, их гидраты или их фармацевтически приемлемые кислотно-аддитивные соли | |
| CS232000B2 (en) | Manufacturing process of new ergoline derovatives | |
| HK77693A (en) | Cycloalkylamides of (8beta)-1-alkyl-6-(substituted) ergolines | |
| JPS6210087A (ja) | 4,7−ジヒドロチエノ〔2,3−b〕ピリジン誘導体,その製造法および循環器系疾患治療剤 | |
| US3985752A (en) | 6-Methyl-8-(substituted) methylergolines | |
| SK282423B6 (sk) | Benzénsulfónamidové deriváty, spôsob ich prípravy, liečivo a farmaceutická kompozícia s ich obsahom | |
| US4285950A (en) | 10-halo-E-homoeburnane derivatives, a process for the preparation thereof, a process for the use thereof as vasodilators, and vasodilating compositions thereof | |
| US4737499A (en) | Ergotalkaloids for treating senile dementia | |
| US4549020A (en) | Eburnane oxime ethers | |
| US5141944A (en) | N-(2-hydroxycyclopentyl)-1-isopropyl-6-methylergoline-8-carboxamides | |
| US4500708A (en) | Benzothiazine derivatives | |
| US4123535A (en) | Psychostimulating 14-amino-14,15-dihydroeburnamenines | |
| NZ207963A (en) | Ergoline derivatives,processes for their preparation and pharmaceutical compositions | |
| US4783464A (en) | N-substituted ergoline- and 9,10-didehydro-ergoline-8-carboxamide-and-8-aminomethyl-derivatives, their production and their pharmaceutical composition | |
| HU215594B (hu) | Ciklohexadiénszármazékok, ezeket tartalmazó gyógyszerkészítmények, és eljárás a vegyületek előállítására | |
| Bender et al. | Gastric antisecretory 9H-xanthen-9-amines | |
| CS245799B2 (cs) | Způsob výroby derivátů ergolinu | |
| CA1159057A (en) | Process for preparing 7,8-dihydroxy-1- (sulfamylphenyl)-2,3,4,5-tetrahydro-1h-3-benzazepine derivatives | |
| SI9800045A (sl) | Postopek za pripravo novih derivatov tieno (3, 2 - c) piridina |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: FARMITALIA CARLO ERBA S.R.L |