DK162996C - Ergolinderivater og deres farmaceutisk acceptable salte, fremgangsmaade til deres fremstilling og farmaceutiske midler med indhold heraf - Google Patents
Ergolinderivater og deres farmaceutisk acceptable salte, fremgangsmaade til deres fremstilling og farmaceutiske midler med indhold herafInfo
- Publication number
- DK162996C DK162996C DK212784A DK212784A DK162996C DK 162996 C DK162996 C DK 162996C DK 212784 A DK212784 A DK 212784A DK 212784 A DK212784 A DK 212784A DK 162996 C DK162996 C DK 162996C
- Authority
- DK
- Denmark
- Prior art keywords
- pharmaceutical
- procedures
- preparation
- acceptable salts
- products containing
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 239000000825 pharmaceutical preparation Substances 0.000 title 1
- 229940127557 pharmaceutical product Drugs 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8311679 | 1983-04-28 | ||
| GB838311679A GB8311679D0 (en) | 1983-04-28 | 1983-04-28 | Ergoline derivatives |
| GB838314816A GB8314816D0 (en) | 1983-05-27 | 1983-05-27 | Ergoline derivatives |
| GB8314816 | 1983-05-27 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| DK212784D0 DK212784D0 (da) | 1984-04-27 |
| DK212784A DK212784A (da) | 1984-10-29 |
| DK162996B DK162996B (da) | 1992-01-06 |
| DK162996C true DK162996C (da) | 1992-06-01 |
Family
ID=26285978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK212784A DK162996C (da) | 1983-04-28 | 1984-04-27 | Ergolinderivater og deres farmaceutisk acceptable salte, fremgangsmaade til deres fremstilling og farmaceutiske midler med indhold heraf |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4690929A (OSRAM) |
| EP (1) | EP0126968B1 (OSRAM) |
| KR (1) | KR900008696B1 (OSRAM) |
| AU (1) | AU556968B2 (OSRAM) |
| CA (1) | CA1205801A (OSRAM) |
| DE (1) | DE3475709D1 (OSRAM) |
| DK (1) | DK162996C (OSRAM) |
| ES (1) | ES531906A0 (OSRAM) |
| FI (1) | FI81349C (OSRAM) |
| GR (1) | GR79575B (OSRAM) |
| HU (1) | HU198713B (OSRAM) |
| IE (1) | IE57240B1 (OSRAM) |
| IL (1) | IL71633A (OSRAM) |
| NO (1) | NO161562C (OSRAM) |
| PH (1) | PH21123A (OSRAM) |
| PT (1) | PT78496B (OSRAM) |
| SU (1) | SU1327788A3 (OSRAM) |
| YU (1) | YU43357B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8714767D0 (en) * | 1987-06-24 | 1987-07-29 | Erba Farmitalia | Egoline derivatives |
| NL8400333A (nl) * | 1983-02-16 | 1984-09-17 | Sandoz Ag | Moederkoornalkaloiden, hun bereiding en hun toepassing. |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
| DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
| GB8617907D0 (en) * | 1986-07-22 | 1986-08-28 | Erba Farmitalia | Tetracyclic indole derivatives |
| GB8702364D0 (en) * | 1987-02-03 | 1987-03-11 | Erba Farmitalia | Ergolinyl heterocycles |
| DK338789A (da) * | 1988-07-15 | 1990-01-16 | Schering Ag | 2-substituerede ergolinylurinstofderivater og fremgangsmaade til fremstilling deraf, deres anvendelse som laegemidler samt mellemprodukter til fremstilling deraf |
| US5210194A (en) * | 1990-01-25 | 1993-05-11 | Farmitalia Carlo Erba S.R.L. An Italian Body Corporate | Process for preparing ergoline derivatives |
| GB9006772D0 (en) * | 1990-03-27 | 1990-05-23 | Erba Carlo Spa | 4-piperidinyl-ergoline derivatives |
| PL304893A1 (en) * | 1992-12-24 | 1995-01-09 | Erba Carlo Spa | Serotoninergic derivatives of ergoline |
| PT2062914E (pt) | 2001-06-08 | 2014-07-18 | Ipsen Pharma Sas | Análogos quiméricos de somatostatina-dopamina |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
| WO2014070965A2 (en) | 2012-11-01 | 2014-05-08 | Ipsen Pharma S.A.S | Somatostatin analogs and dimers thereof |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127269A (en) * | 1961-09-11 | 1964-03-31 | Colour photography | |
| DK140596B (da) * | 1971-05-19 | 1979-10-08 | Sandoz Ag | Analogifremgangsmåde til fremstilling af 8beta-(ureidomethyl)-ergolenderivater. |
| NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| DE2456930A1 (de) * | 1974-12-02 | 1976-08-12 | Tesch Kg E | Elektronisches zeitspeicherrelais |
| CH615181A5 (en) * | 1975-05-21 | 1980-01-15 | Sandoz Ag | Process for the preparation of novel ergolene derivatives |
| GB2056437A (en) * | 1979-08-07 | 1981-03-18 | Erba Farmitalia | Secoergoline derivatives |
| DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
| DD154897A1 (de) * | 1980-12-02 | 1982-04-28 | Seifert Karlheinz Dipl Chem Dr | Verfahren zur herstellung von 8-substituierten ergolinen |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
-
1984
- 1984-04-23 PH PH30590A patent/PH21123A/en unknown
- 1984-04-24 DE DE8484104568T patent/DE3475709D1/de not_active Expired
- 1984-04-24 CA CA000452664A patent/CA1205801A/en not_active Expired
- 1984-04-24 EP EP84104568A patent/EP0126968B1/en not_active Expired
- 1984-04-24 SU SU843728545A patent/SU1327788A3/ru active
- 1984-04-25 IL IL71633A patent/IL71633A/xx not_active IP Right Cessation
- 1984-04-25 ES ES531906A patent/ES531906A0/es active Granted
- 1984-04-25 FI FI841631A patent/FI81349C/fi not_active IP Right Cessation
- 1984-04-26 GR GR74511A patent/GR79575B/el unknown
- 1984-04-26 IE IE1018/84A patent/IE57240B1/en not_active IP Right Cessation
- 1984-04-26 PT PT78496A patent/PT78496B/pt not_active IP Right Cessation
- 1984-04-26 NO NO841657A patent/NO161562C/no unknown
- 1984-04-26 US US06/604,041 patent/US4690929A/en not_active Expired - Fee Related
- 1984-04-26 YU YU742/84A patent/YU43357B/xx unknown
- 1984-04-27 AU AU27421/84A patent/AU556968B2/en not_active Ceased
- 1984-04-27 HU HU841656A patent/HU198713B/hu not_active IP Right Cessation
- 1984-04-27 DK DK212784A patent/DK162996C/da not_active IP Right Cessation
- 1984-04-27 KR KR1019840002271A patent/KR900008696B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| YU74284A (en) | 1986-10-31 |
| DK212784A (da) | 1984-10-29 |
| AU556968B2 (en) | 1986-11-27 |
| NO161562B (no) | 1989-05-22 |
| YU43357B (en) | 1989-06-30 |
| US4690929A (en) | 1987-09-01 |
| KR900008696B1 (ko) | 1990-11-27 |
| DK212784D0 (da) | 1984-04-27 |
| EP0126968A1 (en) | 1984-12-05 |
| SU1327788A3 (ru) | 1987-07-30 |
| HUT34024A (en) | 1985-01-28 |
| DK162996B (da) | 1992-01-06 |
| EP0126968B1 (en) | 1988-12-21 |
| NO161562C (no) | 1989-08-30 |
| AU2742184A (en) | 1984-11-01 |
| ES8506031A1 (es) | 1985-06-01 |
| FI841631A7 (OSRAM) | 1984-10-29 |
| FI81349C (fi) | 1990-10-10 |
| FI81349B (fi) | 1990-06-29 |
| IL71633A0 (en) | 1984-07-31 |
| PH21123A (en) | 1987-07-27 |
| IL71633A (en) | 1987-12-20 |
| IE57240B1 (en) | 1992-06-17 |
| PT78496B (en) | 1986-07-22 |
| FI841631A0 (OSRAM) | 1984-04-25 |
| HU198713B (en) | 1989-11-28 |
| GR79575B (OSRAM) | 1984-10-30 |
| NO841657L (no) | 1984-10-29 |
| DE3475709D1 (en) | 1989-01-26 |
| CA1205801A (en) | 1986-06-10 |
| PT78496A (en) | 1984-05-01 |
| ES531906A0 (es) | 1985-06-01 |
| KR840008353A (ko) | 1984-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK573384D0 (da) | Sphingosinderivater, fremgangsmaade til deres fremstilling og farmaceutiske kompositioner indeholdende disse derivater | |
| DK162996C (da) | Ergolinderivater og deres farmaceutisk acceptable salte, fremgangsmaade til deres fremstilling og farmaceutiske midler med indhold heraf | |
| DK160314C (da) | Analogifremgangsmaade til fremstilling af bicycliske pyrimidin-5-on-derivater og farmaceutisk acceptable salte deraf | |
| DK491186D0 (da) | Pyridonderivater og fremgangsmaade til fremstilling deraf | |
| DK164543C (da) | Salte af l-carnitin og alkanoyl-l-carnitiner, fremgangsmaade til deres fremstilling og farmaceutiske kompositioner indeholdende forbindelserne | |
| LTIP915A (en) | Catehol derivatives,methods for their preparation and pharmaceutical compositions containing them | |
| DK164917C (da) | Analogifremgangsmaade til fremstilling af bicyklisk substituerede dipeptidderivater og deres farmaceutisk acceptable salte | |
| DK170785A (da) | 4-substituerede-piperazin-2-carboxylsyre-derivater og farmaceutisk acceptable salte deraf, fremgangsmaade til fremstilling af saadanne forbindelser og farmaceutiske praeparater indeholdende disse | |
| ZA849499B (en) | Indole derivatives,processes for their preparation and pharmaceutical compositions containing them | |
| DK468284D0 (da) | 1,2,4-triazolonderivater og fremgangsmaade til fremstilling deraf | |
| DK507084D0 (da) | Hydroxybenzenderivater, fremgangsmaade til fremstilling heraf og farmaceutisk praeparat indeholdende et saadant derivat | |
| DK160150C (da) | Benzothiazinderivater, fremgangsmaade til fremstilling heraf og farmaceutiske praeparater indeholdende samme | |
| DK435588A (da) | Aralkylaminoalkoxyphenylderivater, fremgangsmaade til deres fremstilling og midler indeholdende disse | |
| DK156831C (da) | Bis-dioxopiperazin-derivater med antitumor-aktivitet og farmaceutisk acceptable salte deraf | |
| DK162886C (da) | 1,4-dihydropyridin-derivater, fremgangsmaade til fremstilling deraf og farmaceutisk praeparat indeholdende forbindelserne | |
| DK165975C (da) | 3-(substitueret amino)-carbonylderivater af 2,2,5,5-tetramethylpyrrolin eller -pyrrolidin og farmaceutisk acceptable salte deraf, fremgangsmaade til deres fremstilling, antiarrhytmisk farmaceutisk praeparat indeholdende dem og fremgangsmaade til praeparatets fremstilling | |
| DK483481A (da) | Enkephalinderivater og farmaceutisk acceptable salte deraf deres fremstilling og anvendelse | |
| DK573788A (da) | Quinolinderivater eller farmaceutiske acceptable estere eller salte deraf, deres fremstilling og anvendelse | |
| DK152115C (da) | Analogifremgangsmaade til fremstilling af fluorerede 2,5-diamino-3-pentenderivater og farmaceutisk acceptable salte deraf | |
| DK425384A (da) | Acylindol-derivater, fremgangsmaade til fremstilling deraf og farmaceutiske praeparater som indeholder dem | |
| DK162050C (da) | Pyrazolderivater med ergolinskelet eller salte deraf, deres fremstilling, farmaceutiske praeparater indeholdende disse og fremgangsmaade til fremstilling af de farmaceutiske praeparater | |
| DK395788A (da) | Oploeselige silybinderivater, fremgangsmaade til deres fremstilling og farmaceutiske kompositioner indeholdende forbindelserne | |
| DK442183D0 (da) | Thiatriazin-derivater, fremgangsmader til fremstilling deraf og deres anvendelse som laegemidler | |
| DK567184D0 (da) | Pyridonderivater, fremgangsmaader til fremstilling deraf samt farmaceutiske midler indeholdende disse | |
| DK164787C (da) | 3-substituerede pyrazolooe1,5-aaapyridinderivater, fremgangsmaade til fremstilling deraf og farmaceutisk praeparat indeholdende et saadant derivat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |