FI79520C - Foerfarande foer framstaellning av tioetrar. - Google Patents
Foerfarande foer framstaellning av tioetrar. Download PDFInfo
- Publication number
- FI79520C FI79520C FI830755A FI830755A FI79520C FI 79520 C FI79520 C FI 79520C FI 830755 A FI830755 A FI 830755A FI 830755 A FI830755 A FI 830755A FI 79520 C FI79520 C FI 79520C
- Authority
- FI
- Finland
- Prior art keywords
- mmol
- mixture
- reaction
- added
- solution
- Prior art date
Links
- 238000006243 chemical reaction Methods 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 24
- 150000003573 thiols Chemical class 0.000 claims description 19
- 230000008569 process Effects 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 150000003568 thioethers Chemical class 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000007935 neutral effect Effects 0.000 claims description 2
- 239000002519 antifouling agent Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000002674 ointment Substances 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 109
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 84
- 239000000203 mixture Substances 0.000 description 57
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 37
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 238000004128 high performance liquid chromatography Methods 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 150000004820 halides Chemical class 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 7
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 7
- 229940081974 saccharin Drugs 0.000 description 7
- 235000019204 saccharin Nutrition 0.000 description 7
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- -1 trimethylethyl group Chemical group 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- VJMQFIRIMMSSRW-UHFFFAOYSA-N trimethyl(phenylsulfanyl)silane Chemical compound C[Si](C)(C)SC1=CC=CC=C1 VJMQFIRIMMSSRW-UHFFFAOYSA-N 0.000 description 6
- DOOAJZCMASXUKA-UHFFFAOYSA-N trimethyl-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]silane Chemical compound CC1=NN=C(S[Si](C)(C)C)S1 DOOAJZCMASXUKA-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 4
- HYEOHFICEUDSGE-UHFFFAOYSA-N (4-chlorophenyl)sulfanyl-trimethylsilane Chemical compound C[Si](C)(C)SC1=CC=C(Cl)C=C1 HYEOHFICEUDSGE-UHFFFAOYSA-N 0.000 description 3
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 3
- MRLUWCIEBHJONW-UHFFFAOYSA-N 1-phenyl-2-phenylsulfanylethanone Chemical compound C=1C=CC=CC=1C(=O)CSC1=CC=CC=C1 MRLUWCIEBHJONW-UHFFFAOYSA-N 0.000 description 3
- DTDSLINPWQLVJT-UHFFFAOYSA-N 2-benzylsulfanyl-5-methyl-1,3,4-thiadiazole Chemical compound S1C(C)=NN=C1SCC1=CC=CC=C1 DTDSLINPWQLVJT-UHFFFAOYSA-N 0.000 description 3
- JDGRFWCNKDXETA-UHFFFAOYSA-N 2-butylsulfanyl-5-methyl-1,3,4-thiadiazole Chemical compound CCCCSC1=NN=C(C)S1 JDGRFWCNKDXETA-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- LKMCJXXOBRCATQ-UHFFFAOYSA-N benzylsulfanylbenzene Chemical compound C=1C=CC=CC=1CSC1=CC=CC=C1 LKMCJXXOBRCATQ-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 125000000962 organic group Chemical group 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- JGAMHGKSASEHSH-UHFFFAOYSA-N trimethyl-(3-trimethylsilylsulfanyl-1,2,4-triazol-1-yl)silane Chemical compound C[Si](C)(C)SC=1N=CN([Si](C)(C)C)N=1 JGAMHGKSASEHSH-UHFFFAOYSA-N 0.000 description 3
- XFUXRGYTHIIJLX-UHFFFAOYSA-N (3,4-dichlorophenyl)sulfanyl-trimethylsilane Chemical compound C[Si](C)(C)SC1=CC=C(Cl)C(Cl)=C1 XFUXRGYTHIIJLX-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DGZBRVOXGIVBLN-UHFFFAOYSA-N [(diphenoxyphosphorylamino)-phenoxyphosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)NP(=O)(OC=1C=CC=CC=1)OC1=CC=CC=C1 DGZBRVOXGIVBLN-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 229910000077 silane Inorganic materials 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- DCJSKIYTYQHURT-UHFFFAOYSA-N trimethyl-(1-methylimidazol-2-yl)sulfanylsilane Chemical compound CN1C=CN=C1S[Si](C)(C)C DCJSKIYTYQHURT-UHFFFAOYSA-N 0.000 description 2
- MUBRTKGNEIAYDP-UHFFFAOYSA-N trimethyl-(1-phenyltetrazol-5-yl)sulfanylsilane Chemical compound C[Si](C)(C)SC1=NN=NN1C1=CC=CC=C1 MUBRTKGNEIAYDP-UHFFFAOYSA-N 0.000 description 2
- MVGNSLRLKOUKHV-UHFFFAOYSA-N trimethyl-(4-methylphenyl)sulfanylsilane Chemical compound CC1=CC=C(S[Si](C)(C)C)C=C1 MVGNSLRLKOUKHV-UHFFFAOYSA-N 0.000 description 2
- SAAMGLGCZVEVLE-LCZXQBLYSA-N (6R)-4-methyl-5,8-dioxo-5lambda4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class CC1S([C@H]2N(C(=C1)C(=O)O)C(C2)=O)=O SAAMGLGCZVEVLE-LCZXQBLYSA-N 0.000 description 1
- UYUPBMSHAHJMCD-QQDRFEGGSA-N (6r)-3-(bromomethyl)-5,8-dioxo-7-[(2-phenylacetyl)amino]-5$l^{4}-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@H]2S(=O)CC(CBr)=C(N2C1=O)C(=O)O)NC(=O)CC1=CC=CC=C1 UYUPBMSHAHJMCD-QQDRFEGGSA-N 0.000 description 1
- CWWPRUSTCGPZGJ-NQPNHJOESA-N (6r)-4-methyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound C1=CC(C)S[C@@H]2CC(=O)N21 CWWPRUSTCGPZGJ-NQPNHJOESA-N 0.000 description 1
- PVPKFKCDIRXVLO-UHFFFAOYSA-N 1-chloro-4-(2-chloroethylsulfanyl)benzene Chemical compound ClCCSC1=CC=C(Cl)C=C1 PVPKFKCDIRXVLO-UHFFFAOYSA-N 0.000 description 1
- QCCIQLSVFMEUDX-UHFFFAOYSA-N 1-chloro-4-[2-(4-chlorophenyl)sulfanylethylsulfanyl]benzene Chemical compound C1=CC(Cl)=CC=C1SCCSC1=CC=C(Cl)C=C1 QCCIQLSVFMEUDX-UHFFFAOYSA-N 0.000 description 1
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 1
- DCGQYKQKBKCNGM-UHFFFAOYSA-N 1-methyl-3-[(4-nitrophenyl)methyl]imidazole-2-thione Chemical compound S=C1N(C)C=CN1CC1=CC=C([N+]([O-])=O)C=C1 DCGQYKQKBKCNGM-UHFFFAOYSA-N 0.000 description 1
- BGBJCIINHQWDMB-UHFFFAOYSA-N 1-methyl-4-prop-2-enylsulfanylbenzene Chemical compound CC1=CC=C(SCC=C)C=C1 BGBJCIINHQWDMB-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- UJVOAHVGRTVDDA-UHFFFAOYSA-N 1-phenyl-2-(1h-1,2,4-triazol-5-ylsulfanyl)ethanone Chemical compound C=1C=CC=CC=1C(=O)CSC1=NC=NN1 UJVOAHVGRTVDDA-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 1
- IFSMQECCEDCXGG-UHFFFAOYSA-N 2,2-bis(trimethylsilyl)ethanethioic S-acid Chemical compound C[Si](C)(C)C(C(=O)S)[Si](C)(C)C IFSMQECCEDCXGG-UHFFFAOYSA-N 0.000 description 1
- CDKRZOFYUPIFBM-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)sulfanylacetonitrile Chemical compound ClC1=CC=C(SCC#N)C=C1Cl CDKRZOFYUPIFBM-UHFFFAOYSA-N 0.000 description 1
- XFCBPCPKBAJHCI-UHFFFAOYSA-N 2-(4-methylphenyl)ethanethioic s-acid Chemical compound CC1=CC=C(CC(O)=S)C=C1 XFCBPCPKBAJHCI-UHFFFAOYSA-N 0.000 description 1
- HCFDKQCIJODUNE-UHFFFAOYSA-N 2-butylsulfanyl-1-phenylethanone Chemical compound CCCCSCC(=O)C1=CC=CC=C1 HCFDKQCIJODUNE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- HNJZDPKMMZXSKT-UHFFFAOYSA-N 3,4-dichlorobenzenethiol Chemical compound SC1=CC=C(Cl)C(Cl)=C1 HNJZDPKMMZXSKT-UHFFFAOYSA-N 0.000 description 1
- WNXNEHDGTOUERE-UHFFFAOYSA-N 3-(4-nitrophenyl)propanethioic s-acid Chemical compound OC(=S)CCC1=CC=C([N+]([O-])=O)C=C1 WNXNEHDGTOUERE-UHFFFAOYSA-N 0.000 description 1
- JHXCCDBMPGIEQX-UHFFFAOYSA-N 3-bromo-4-hydroxychromen-2-one Chemical compound C1=CC=CC2=C1OC(=O)C(Br)=C2O JHXCCDBMPGIEQX-UHFFFAOYSA-N 0.000 description 1
- ZTMBRCRTMABELR-UHFFFAOYSA-N 4-hydroxy-3-phenylsulfanylchromen-2-one Chemical compound O=C1OC=2C=CC=CC=2C(O)=C1SC1=CC=CC=C1 ZTMBRCRTMABELR-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- XWJSARMMLGAOPU-UHFFFAOYSA-N Br.[N+](=O)([O-])C1=CC=C(CSC=2NC=CN2)C=C1 Chemical compound Br.[N+](=O)([O-])C1=CC=C(CSC=2NC=CN2)C=C1 XWJSARMMLGAOPU-UHFFFAOYSA-N 0.000 description 1
- IDZKARSUDJJEME-UHFFFAOYSA-N CC1=NN=C(SC)[S+]1SC Chemical compound CC1=NN=C(SC)[S+]1SC IDZKARSUDJJEME-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- WDXARJCUWSVIJS-UHFFFAOYSA-N ClC=1C=C(SC1)C(C1=CC=C(C=C1)[N+](=O)[O-])SC(C1=CC=C(C=C1)[N+](=O)[O-])C=1SC=C(C1)Cl Chemical compound ClC=1C=C(SC1)C(C1=CC=C(C=C1)[N+](=O)[O-])SC(C1=CC=C(C=C1)[N+](=O)[O-])C=1SC=C(C1)Cl WDXARJCUWSVIJS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ZBRWRIUYVDWUNH-UHFFFAOYSA-N [(4-methylphenyl)sulfonylamino]phosphonic acid Chemical compound CC1=CC=C(S(=O)(=O)NP(O)(O)=O)C=C1 ZBRWRIUYVDWUNH-UHFFFAOYSA-N 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005600 alkyl phosphonate group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- GTZSIXUFBXARQI-UHFFFAOYSA-N butylsulfanyl(trimethyl)silane Chemical compound CCCCS[Si](C)(C)C GTZSIXUFBXARQI-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- FDSGHYHRLSWSLQ-UHFFFAOYSA-N dichloromethane;propan-2-one Chemical compound ClCCl.CC(C)=O FDSGHYHRLSWSLQ-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- AEHWKBXBXYNPCX-UHFFFAOYSA-N ethylsulfanylbenzene Chemical compound CCSC1=CC=CC=C1 AEHWKBXBXYNPCX-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- ZVBWPVOCTORPLM-UHFFFAOYSA-N formylsilicon Chemical compound [Si]C=O ZVBWPVOCTORPLM-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- QQHAJLWUCXZSGA-UHFFFAOYSA-N hydron;1-phenyl-2-(1h-1,2,4-triazol-5-ylsulfanyl)ethanone;bromide Chemical compound Br.C=1C=CC=CC=1C(=O)CSC=1N=CNN=1 QQHAJLWUCXZSGA-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000004028 organic sulfates Chemical class 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZHUPZVIALZHGGP-UHFFFAOYSA-N phenylsulfanylmethylsulfanylbenzene Chemical compound C=1C=CC=CC=1SCSC1=CC=CC=C1 ZHUPZVIALZHGGP-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- ZQVVDGCXUVWWSY-UHFFFAOYSA-N tert-butyl-dimethyl-phenylsulfanylsilane Chemical compound CC(C)(C)[Si](C)(C)SC1=CC=CC=C1 ZQVVDGCXUVWWSY-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- JCEZYJSPNBDMTK-UHFFFAOYSA-N trimethyl-(1-methyltetrazol-5-yl)sulfanylsilane Chemical compound CN1N=NN=C1S[Si](C)(C)C JCEZYJSPNBDMTK-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C319/00—Preparation of thiols, sulfides, hydropolysulfides or polysulfides
- C07C319/14—Preparation of thiols, sulfides, hydropolysulfides or polysulfides of sulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/84—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/42—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4
- C07D311/44—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3
- C07D311/46—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3 unsubstituted in the carbocyclic ring
- C07D311/50—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms in positions 2 and 4 with one hydrogen atom in position 3 unsubstituted in the carbocyclic ring with elements other than carbon and hydrogen in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0898—Compounds with a Si-S linkage
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP82200327 | 1982-03-11 | ||
| EP82200327A EP0088831A1 (en) | 1982-03-11 | 1982-03-11 | Process for the preparation of thioethers |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI830755A0 FI830755A0 (fi) | 1983-03-07 |
| FI830755L FI830755L (fi) | 1983-09-12 |
| FI79520B FI79520B (fi) | 1989-09-29 |
| FI79520C true FI79520C (fi) | 1990-01-10 |
Family
ID=8189469
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI830755A FI79520C (fi) | 1982-03-11 | 1983-03-07 | Foerfarande foer framstaellning av tioetrar. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4496720A (es) |
| EP (2) | EP0088831A1 (es) |
| JP (1) | JPS58185557A (es) |
| AU (1) | AU562282B2 (es) |
| CA (1) | CA1195688A (es) |
| DE (1) | DE3360454D1 (es) |
| DK (1) | DK87283A (es) |
| ES (1) | ES520531A0 (es) |
| FI (1) | FI79520C (es) |
| GR (1) | GR78451B (es) |
| HU (1) | HU191515B (es) |
| IE (1) | IE54623B1 (es) |
| IL (1) | IL67966A0 (es) |
| NO (1) | NO157537C (es) |
| PT (1) | PT76284A (es) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0123735A1 (en) * | 1983-04-29 | 1984-11-07 | Gist-Brocades N.V. | New process for the preparation of 20-keto-delta-16-steroids and new intermediate compounds formed in this process |
| DE3738277A1 (de) * | 1987-11-11 | 1989-05-24 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE3738276A1 (de) * | 1987-11-11 | 1989-05-24 | Bayer Ag | Verfahren zur herstellung von polyarylensulfiden |
| DE19844607A1 (de) * | 1998-09-29 | 2000-03-30 | Degussa | Sulfanylsilane |
| US20120178697A9 (en) | 2003-09-22 | 2012-07-12 | Jie Zheng | Compositions and methods for the inhibition of dishevelled proteins |
| US8901256B2 (en) | 2012-01-12 | 2014-12-02 | Prc-Desoto International, Inc. | Polythioethers, moisture curable compositions and methods for their manufacture and use |
| US9518197B2 (en) | 2014-03-07 | 2016-12-13 | Prc-Desoto International, Inc. | Cure-on-demand moisture-curable urethane-containing fuel resistant prepolymers and compositions thereof |
| US10370561B2 (en) | 2016-06-28 | 2019-08-06 | Prc-Desoto International, Inc. | Urethane/urea-containing bis(alkenyl) ethers, prepolymers prepared using urethane/urea-containing bis(alkenyl) ethers, and uses thereof |
| US11098222B2 (en) | 2018-07-03 | 2021-08-24 | Prc-Desoto International, Inc. | Sprayable polythioether coatings and sealants |
| CN115772119B (zh) * | 2022-11-29 | 2024-06-07 | 信阳师范学院 | 一种n-杂环硫醚类化合物的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6052711B2 (ja) * | 1978-03-09 | 1985-11-20 | 旭化成株式会社 | セフアロスポリン化合物の製法 |
| NL8005041A (nl) * | 1980-09-05 | 1982-04-01 | Gist Brocades Nv | Werkwijze voor de bereiding van thioethers, alsmede gesilyleerde thiolen voor toepassing bij deze werkwijze. |
-
1982
- 1982-03-11 EP EP82200327A patent/EP0088831A1/en not_active Withdrawn
-
1983
- 1983-02-21 IL IL67966A patent/IL67966A0/xx unknown
- 1983-02-24 AU AU11817/83A patent/AU562282B2/en not_active Ceased
- 1983-02-24 DK DK87283A patent/DK87283A/da not_active Application Discontinuation
- 1983-02-24 PT PT76284A patent/PT76284A/pt unknown
- 1983-03-07 US US06/472,667 patent/US4496720A/en not_active Expired - Fee Related
- 1983-03-07 FI FI830755A patent/FI79520C/fi not_active IP Right Cessation
- 1983-03-07 NO NO830784A patent/NO157537C/no unknown
- 1983-03-08 EP EP83200329A patent/EP0091141B1/en not_active Expired
- 1983-03-08 DE DE8383200329T patent/DE3360454D1/de not_active Expired
- 1983-03-10 GR GR70758A patent/GR78451B/el unknown
- 1983-03-10 IE IE524/83A patent/IE54623B1/en unknown
- 1983-03-10 HU HU83832A patent/HU191515B/hu not_active IP Right Cessation
- 1983-03-11 ES ES520531A patent/ES520531A0/es active Granted
- 1983-03-11 JP JP58040526A patent/JPS58185557A/ja active Granted
- 1983-03-11 CA CA000423463A patent/CA1195688A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1195688A (en) | 1985-10-22 |
| NO830784L (no) | 1983-09-12 |
| DE3360454D1 (en) | 1985-09-05 |
| US4496720A (en) | 1985-01-29 |
| FI830755L (fi) | 1983-09-12 |
| ES8404988A1 (es) | 1984-05-16 |
| HU191515B (en) | 1987-03-30 |
| AU562282B2 (en) | 1987-06-04 |
| NO157537C (no) | 1988-04-06 |
| DK87283A (da) | 1983-09-12 |
| FI79520B (fi) | 1989-09-29 |
| AU1181783A (en) | 1983-09-15 |
| IE54623B1 (en) | 1989-12-20 |
| PT76284A (en) | 1983-03-01 |
| EP0091141A1 (en) | 1983-10-12 |
| FI830755A0 (fi) | 1983-03-07 |
| IL67966A0 (en) | 1983-06-15 |
| EP0091141B1 (en) | 1985-07-31 |
| NO157537B (no) | 1987-12-28 |
| JPS58185557A (ja) | 1983-10-29 |
| JPH0321022B2 (es) | 1991-03-20 |
| ES520531A0 (es) | 1984-05-16 |
| EP0088831A1 (en) | 1983-09-21 |
| GR78451B (es) | 1984-09-27 |
| IE830524L (en) | 1983-09-11 |
| DK87283D0 (da) | 1983-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI79520C (fi) | Foerfarande foer framstaellning av tioetrar. | |
| KR101832396B1 (ko) | 에르고티오네인 및 이것의 유사체의 합성법 | |
| FI81776C (fi) | Foerfarande foer trimetylsilylering av organiska foereningar innehaollande en eller flera aktiva vaeteatomer medelst hexametyldisilazan. | |
| WO2018125820A1 (en) | Processes for the preparation of pesticidal compounds | |
| JPH01172378A (ja) | 新規２−グアニジノ−チアゾール化合物、その製造及びファモチジン法の中間体としての使用 | |
| FI80700B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara mitomycinanaloger. | |
| FI71938B (fi) | Foerfarande foer framstaellning av 3'-bromsubstituerade deacetoxicefalosporansyrasulfoxidderivat | |
| FI73438B (fi) | Foerfarande foer framstaellning av 7-acylamino-3-(tiosubstituerad)metyl-3-cefem-4-karboxylsyra-1-oxid derivat. | |
| DE69232776T2 (de) | Verfahren zur Herstellung von Cephalosporinen und Zwischenverbindungen in diesem Verfahren | |
| EP1678129B1 (en) | Improved process for preparing benzhydrylthioacetamide | |
| KR870000496B1 (ko) | 티오에테르류의 제조방법 | |
| US4883878A (en) | Process for unsymmetrical dithioacetals and dithioketals | |
| EP0717045B1 (en) | Process for producing indolocarbazole derivative | |
| JP2545225B2 (ja) | 光学的活性ヒダントイン化合物 | |
| Christophersen et al. | Acyl thiocyanates—III: The synthesis of stable Aroyl thiocyanates | |
| CN103709171B (zh) | 具有哒嗪并[3,4-b]吲哚骨架结构的衍生物及其合成方法 | |
| Jonas | Configuration of sodium salt and preparation of sulphonates and carboxylates of (E)-and (Z)-3-(hydroxymethylene) dihydro-2 (3H)-furanone | |
| KR960011778B1 (ko) | 신규한 결정성 세팔로스포린 유도체의 제조방법 | |
| RU1830070C (ru) | Способ получени аллил-7 @ -феноксиацетиламино-3-метил-1-карба(детиа)-3-цефем-4-карбоксилата | |
| FI71562C (fi) | Foerfarande foer framstaellning av 6- - substituerade penicillansyraderivat och saosom mellanprodukter anvaendbara 6-perfluoralkylsulfonyloxipenicillansyraderivat. | |
| EP0120094B1 (en) | Azetidinone compounds | |
| KR960011777B1 (ko) | 신규한 결정성 세팔로스포린 유도체 및 그의 제조방법 | |
| JPS6111226B2 (es) | ||
| JP2000256306A (ja) | 芳香族チオール類の製造法 | |
| JPS63119454A (ja) | 新規なα−クロロケトン誘導体および製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: GIST-BROCADES N.V. |