FI64351C - Nytt foerfarande foer framstaellning av n-cyklohexyl-n-metyl-n-(2-amino-3,5-dibrom-bensyl)-amin - Google Patents
Nytt foerfarande foer framstaellning av n-cyklohexyl-n-metyl-n-(2-amino-3,5-dibrom-bensyl)-amin Download PDFInfo
- Publication number
- FI64351C FI64351C FI762141A FI762141A FI64351C FI 64351 C FI64351 C FI 64351C FI 762141 A FI762141 A FI 762141A FI 762141 A FI762141 A FI 762141A FI 64351 C FI64351 C FI 64351C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- cyclohexyl
- formula
- amino
- acid
- Prior art date
Links
- OJGDCBLYJGHCIH-UHFFFAOYSA-N bromhexine Chemical compound C1CCCCC1N(C)CC1=CC(Br)=CC(Br)=C1N OJGDCBLYJGHCIH-UHFFFAOYSA-N 0.000 title claims 3
- 239000002253 acid Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 claims description 11
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 claims description 11
- WMJWASKQHNPDBY-UHFFFAOYSA-N 1-bromo-3-(bromomethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=C(Br)C=CC=C1CBr WMJWASKQHNPDBY-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000002516 radical scavenger Substances 0.000 claims description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 4
- 239000007868 Raney catalyst Substances 0.000 claims description 4
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 239000011135 tin Substances 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 238000007883 cyanide addition reaction Methods 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- -1 2-amino-3,5-dibromobenzyl Chemical group 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000005893 bromination reaction Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 230000031709 bromination Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- HXBMIQJOSHZCFX-UHFFFAOYSA-N 1-(bromomethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CBr HXBMIQJOSHZCFX-UHFFFAOYSA-N 0.000 description 2
- XDKMDDOCVPNVMB-UHFFFAOYSA-N 1-bromo-3-methyl-2-nitrobenzene Chemical compound CC1=CC=CC(Br)=C1[N+]([O-])=O XDKMDDOCVPNVMB-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- DGDAVTPQCQXLGU-UHFFFAOYSA-N 5437-38-7 Chemical compound CC1=CC=CC(C(O)=O)=C1[N+]([O-])=O DGDAVTPQCQXLGU-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000009776 industrial production Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- LRVPHKNSGVHIMB-UHFFFAOYSA-N n-methylcyclohexanamine;hydrobromide Chemical compound Br.CNC1CCCCC1 LRVPHKNSGVHIMB-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- LOOOTYOQFFOBCI-UHFFFAOYSA-N 2,4-dibromo-6-methylaniline Chemical compound CC1=CC(Br)=CC(Br)=C1N LOOOTYOQFFOBCI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- ZTLCGLNRDJJEFV-UHFFFAOYSA-N CN(C(C1=C(C(=CC=C1)CC)[N+](=O)[O-])=O)C1CCCCC1 Chemical compound CN(C(C1=C(C(=CC=C1)CC)[N+](=O)[O-])=O)C1CCCCC1 ZTLCGLNRDJJEFV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 208000014085 Chronic respiratory disease Diseases 0.000 description 1
- 206010015946 Eye irritation Diseases 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 102100026459 POU domain, class 3, transcription factor 2 Human genes 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- ZCBDEPONEUTHFL-UHFFFAOYSA-M [N+](=O)([O-])C1=C(C(=O)[O-])C=CC=C1C.[Ag+] Chemical compound [N+](=O)([O-])C1=C(C(=O)[O-])C=CC=C1C.[Ag+] ZCBDEPONEUTHFL-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical class BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 229910052614 beryl Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 231100000013 eye irritation Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000000510 mucolytic effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 108010072897 transcription factor Brn-2 Proteins 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/29—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE002384 | 1975-10-28 | ||
| HUEE002384 | 1975-10-28 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI762141A7 FI762141A7 (enExample) | 1977-04-29 |
| FI64351B FI64351B (fi) | 1983-07-29 |
| FI64351C true FI64351C (fi) | 1983-11-10 |
Family
ID=10995655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI762141A FI64351C (fi) | 1975-10-28 | 1976-07-27 | Nytt foerfarande foer framstaellning av n-cyklohexyl-n-metyl-n-(2-amino-3,5-dibrom-bensyl)-amin |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS5253836A (enExample) |
| AT (1) | AT351504B (enExample) |
| CH (1) | CH622488A5 (enExample) |
| CS (1) | CS199633B2 (enExample) |
| DE (1) | DE2633518A1 (enExample) |
| DK (1) | DK145293C (enExample) |
| ES (1) | ES450304A1 (enExample) |
| FI (1) | FI64351C (enExample) |
| PL (1) | PL103750B1 (enExample) |
| SE (1) | SE415654B (enExample) |
| SU (1) | SU580829A3 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61139688U (enExample) * | 1985-02-18 | 1986-08-29 | ||
| JPS61206065U (enExample) * | 1985-06-15 | 1986-12-26 | ||
| DE19529432C1 (de) * | 1995-08-10 | 1997-05-15 | Boehringer Ingelheim Kg | Verfahren zur Herstellung von Benzylaminderivaten |
-
1976
- 1976-07-19 CH CH935976A patent/CH622488A5/de not_active IP Right Cessation
- 1976-07-20 SE SE7608246A patent/SE415654B/xx unknown
- 1976-07-23 AT AT544276A patent/AT351504B/de not_active IP Right Cessation
- 1976-07-26 DE DE19762633518 patent/DE2633518A1/de not_active Withdrawn
- 1976-07-27 FI FI762141A patent/FI64351C/fi not_active IP Right Cessation
- 1976-07-28 CS CS764956A patent/CS199633B2/cs unknown
- 1976-07-30 PL PL1976191536A patent/PL103750B1/pl unknown
- 1976-07-30 JP JP51091253A patent/JPS5253836A/ja active Granted
- 1976-07-30 ES ES450304A patent/ES450304A1/es not_active Expired
- 1976-07-30 DK DK346376A patent/DK145293C/da active
- 1976-07-30 SU SU7602386749A patent/SU580829A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| FI64351B (fi) | 1983-07-29 |
| PL103750B1 (pl) | 1979-07-31 |
| ATA544276A (de) | 1978-01-15 |
| JPS5616786B2 (enExample) | 1981-04-18 |
| SU580829A3 (ru) | 1977-11-15 |
| DE2633518A1 (de) | 1977-05-12 |
| FI762141A7 (enExample) | 1977-04-29 |
| DK145293C (da) | 1983-03-14 |
| ES450304A1 (es) | 1977-10-01 |
| CH622488A5 (en) | 1981-04-15 |
| DK346376A (da) | 1977-04-29 |
| AT351504B (de) | 1979-07-25 |
| SE415654B (sv) | 1980-10-20 |
| CS199633B2 (en) | 1980-07-31 |
| SE7608246L (sv) | 1977-04-29 |
| DK145293B (da) | 1982-10-25 |
| JPS5253836A (en) | 1977-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Speziale et al. | Preparation of some new 2-chloroacetamides | |
| DE102006039909A1 (de) | Verfahren zum Herstellen von 3-Dihalomethyl-pyrazol-4-carbonsäurederivaten | |
| FI64372B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 1-substitueradaminometyl-1-etyl-indolo-(2,3-a)-kinolizidiner | |
| NO161543B (no) | Sprengladning for bruk ved skjoeting av roer ved eksplosjonssveising. | |
| DE69813729T3 (de) | Verfahren zur Herstellung von 1-(9'H-Carbazol-4'yloxy)-3-2''-(2'''-methoxy-phenoxy)ethyl)-amino)-2-ol (Carvedilol) und Zwischenverbindungen | |
| FI60559B (fi) | Foerfarande foer framstaellning av ny-(tertiaer amino)-orto-aminobutyrofenonfoereningar | |
| FI64351C (fi) | Nytt foerfarande foer framstaellning av n-cyklohexyl-n-metyl-n-(2-amino-3,5-dibrom-bensyl)-amin | |
| DE602005003472T2 (de) | Verfahren zur herstellung von 2-oxo-1-pyrrolidinderivaten durch intramolekulare allylierung | |
| US5710331A (en) | Preparation of N-alkenyl carboxamides | |
| US3178478A (en) | 2-amino-5-halo-indanes | |
| NO154391B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-amino-naftalen-derivater. | |
| US3226446A (en) | Hydroxybenzyloxy-amine derivatives | |
| US2681931A (en) | Basic amides of bicyclo [2. 2.1]-5-heptene-2-carboxylic acid and 2-norcamphanecarboxylic acid and derivatives thereof | |
| EP1418171B1 (de) | Process for the preparation of perfluoralkylanilines | |
| CH657848A5 (de) | 3,3-dialkyl- und 3,3-alkylen-indolinderivate, verfahren zu ihrer herstellung und pharmazeutische praeparate sie enthaltend. | |
| US3222388A (en) | Diaryl-acetonitriles and 2,2,3- triarylpropionitriles | |
| US3360562A (en) | 2-tertiaryaminomethyl-n-acylanilines | |
| FI56672C (fi) | Nytt foerfarande foer framstaellning av 2-amino-benzaminer | |
| DE3816634A1 (de) | Cyclobuten-3,4-dion-zwischenverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| Henze et al. | Synthesis of 5-Disubstituted Aminomethyl-5-phenethylhydantoins1 | |
| JPS60158147A (ja) | 3−アミノ−4−フルオロ−(6−ハロゲノ)フエニルアルキルエ−テルの製造法 | |
| SU1595844A1 (ru) | Способ получени N,N @ -азиридинометиламинов | |
| FI59793C (fi) | Mellanprodukt foer framstaellning av en heterocyklisk benzamid med farmakologisk aktivitet och foerfarande foer framstaellning av mellanprodukten | |
| CA1289558C (en) | Purification of 1-(alkylamino)-alkyl-2-keto-1,4- diazacycloalkanes | |
| EP0090769A2 (de) | Verfahren zur Herstellung von 1,2,5,6-Tetrahydro-4H-pyrrolo(3,2,1-ij)-chinolin-4-on und neue 5-Halogen-1,2,3-(1,2-dihydropyrrolo)-4-chinolone als Zwischenprodukte zur Durchführung des Verfahrens |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: E GY T GYOGYSZERVEGYESZETI GYAR |