FI61477C - Vaextfungicida substituerade n-acylanilinderivat - Google Patents
Vaextfungicida substituerade n-acylanilinderivat Download PDFInfo
- Publication number
- FI61477C FI61477C FI750922A FI750922A FI61477C FI 61477 C FI61477 C FI 61477C FI 750922 A FI750922 A FI 750922A FI 750922 A FI750922 A FI 750922A FI 61477 C FI61477 C FI 61477C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- alkyl
- halogen
- formula
- alkoxy
- Prior art date
Links
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 104
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 36
- 229910052736 halogen Inorganic materials 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 16
- -1 halogen anion Chemical class 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical class [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 claims description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 claims 2
- 150000008061 acetanilides Chemical class 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 229960001413 acetanilide Drugs 0.000 claims 1
- 230000026030 halogenation Effects 0.000 claims 1
- 238000005658 halogenation reaction Methods 0.000 claims 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 37
- 239000004480 active ingredient Substances 0.000 description 23
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 241000233866 Fungi Species 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 239000007921 spray Substances 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 230000003287 optical effect Effects 0.000 description 8
- 239000002689 soil Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 7
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 235000012211 aluminium silicate Nutrition 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 5
- 235000021536 Sugar beet Nutrition 0.000 description 5
- 230000000855 fungicidal effect Effects 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 235000019993 champagne Nutrition 0.000 description 4
- HNCCKHGOWJUHJZ-UHFFFAOYSA-N methyl 2-(n-(2-chloroacetyl)-2,6-dimethylanilino)propanoate Chemical compound COC(=O)C(C)N(C(=O)CCl)C1=C(C)C=CC=C1C HNCCKHGOWJUHJZ-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000005520 cutting process Methods 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- NEOYGRJJOGVQPO-UHFFFAOYSA-N methyl 2-(2,6-dimethylanilino)propanoate Chemical compound COC(=O)C(C)NC1=C(C)C=CC=C1C NEOYGRJJOGVQPO-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 235000021395 porridge Nutrition 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 2
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001281803 Plasmopara viticola Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 241000233639 Pythium Species 0.000 description 2
- 241000208292 Solanaceae Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 230000035876 healing Effects 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- ACEONLNNWKIPTM-UHFFFAOYSA-N methyl 2-bromopropanoate Chemical compound COC(=O)C(C)Br ACEONLNNWKIPTM-UHFFFAOYSA-N 0.000 description 2
- 230000003641 microbiacidal effect Effects 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000003032 phytopathogenic effect Effects 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- SRAWNDFHGTVUNZ-UHFFFAOYSA-M sodium;3,6-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(CCCC)=CC2=CC(CCCC)=CC=C21 SRAWNDFHGTVUNZ-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000014101 wine Nutrition 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- GSFSVEDCYBDIGW-UHFFFAOYSA-N 2-(1,3-benzothiazol-2-yl)-6-chlorophenol Chemical compound OC1=C(Cl)C=CC=C1C1=NC2=CC=CC=C2S1 GSFSVEDCYBDIGW-UHFFFAOYSA-N 0.000 description 1
- WMSDRWJBTDSIQR-UHFFFAOYSA-N 2-(2,6-dimethylanilino)propanoic acid Chemical compound OC(=O)C(C)NC1=C(C)C=CC=C1C WMSDRWJBTDSIQR-UHFFFAOYSA-N 0.000 description 1
- XWKAVQKJQBISOL-UHFFFAOYSA-N 2-(phenylazaniumyl)propanoate Chemical compound OC(=O)C(C)NC1=CC=CC=C1 XWKAVQKJQBISOL-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- FUCUHFQBEBZAFY-UHFFFAOYSA-N 6-ethyl-2,3-dimethylaniline Chemical compound CCC1=CC=C(C)C(C)=C1N FUCUHFQBEBZAFY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 241001647031 Avena sterilis Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- 241001480059 Erysiphaceae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 101000874141 Homo sapiens Probable ATP-dependent RNA helicase DDX43 Proteins 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 240000005265 Lupinus mutabilis Species 0.000 description 1
- 235000008755 Lupinus mutabilis Nutrition 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 240000005561 Musa balbisiana Species 0.000 description 1
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 102100035724 Probable ATP-dependent RNA helicase DDX43 Human genes 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241000221535 Pucciniales Species 0.000 description 1
- 235000019095 Sechium edule Nutrition 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 101150095510 TMEM35A gene Proteins 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000006364 carbonyl oxy methylene group Chemical group [H]C([H])([*:2])OC([*:1])=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000007952 growth promoter Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 1
- NEOYGRJJOGVQPO-SNVBAGLBSA-N methyl (2r)-2-(2,6-dimethylanilino)propanoate Chemical compound COC(=O)[C@@H](C)NC1=C(C)C=CC=C1C NEOYGRJJOGVQPO-SNVBAGLBSA-N 0.000 description 1
- JGXFICGIDYFDAL-UHFFFAOYSA-N methyl 2-(6-ethyl-2,3-dimethylanilino)propanoate Chemical compound CCC1=CC=C(C)C(C)=C1NC(C)C(=O)OC JGXFICGIDYFDAL-UHFFFAOYSA-N 0.000 description 1
- BXUXLILOCHOGLH-UHFFFAOYSA-N methyl 2-(6-ethyl-N-(2-methoxyacetyl)-2,3-dimethylanilino)propanoate Chemical compound COC(=O)C(C)N(C1=C(C(=CC=C1CC)C)C)C(COC)=O BXUXLILOCHOGLH-UHFFFAOYSA-N 0.000 description 1
- VSDUZFOSJDMAFZ-VIFPVBQESA-N methyl L-phenylalaninate Chemical compound COC(=O)[C@@H](N)CC1=CC=CC=C1 VSDUZFOSJDMAFZ-VIFPVBQESA-N 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000003971 tillage Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- INDZTCRIYSRWOH-UHFFFAOYSA-N undec-10-enyl carbamimidothioate;hydroiodide Chemical compound I.NC(=N)SCCCCCCCCCC=C INDZTCRIYSRWOH-UHFFFAOYSA-N 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/32—Isothioureas having sulfur atoms of isothiourea groups bound to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH499574A CH592410A5 (en) | 1974-04-09 | 1974-04-09 | n-Substd. acetanilides - microbicides useful for treating phytopathogenic fungi, prepd. by acylation of substd. anilines |
| CH499574 | 1974-04-09 | ||
| CH325975 | 1975-03-14 | ||
| CH325975A CH608690A5 (en) | 1975-03-14 | 1975-03-14 | Microbicidal composition |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI750922A7 FI750922A7 (tr) | 1975-10-10 |
| FI61477B FI61477B (fi) | 1982-04-30 |
| FI61477C true FI61477C (fi) | 1982-08-10 |
Family
ID=25692584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI750922A FI61477C (fi) | 1974-04-09 | 1975-03-26 | Vaextfungicida substituerade n-acylanilinderivat |
Country Status (33)
| Country | Link |
|---|---|
| US (3) | US4294850A (tr) |
| JP (1) | JPS5443573B2 (tr) |
| AR (1) | AR226272A1 (tr) |
| AT (1) | AT341827B (tr) |
| BG (1) | BG26357A3 (tr) |
| CA (1) | CA1059141A (tr) |
| CS (1) | CS187468B2 (tr) |
| CY (1) | CY1010A (tr) |
| DD (2) | DD124973A5 (tr) |
| DE (1) | DE2515091C2 (tr) |
| DK (1) | DK142360B (tr) |
| ES (1) | ES436385A1 (tr) |
| FI (1) | FI61477C (tr) |
| FR (1) | FR2267042B1 (tr) |
| GB (1) | GB1500581A (tr) |
| HK (1) | HK40379A (tr) |
| HU (1) | HU173318B (tr) |
| IE (1) | IE40913B1 (tr) |
| IL (1) | IL47046A (tr) |
| IT (1) | IT1049536B (tr) |
| KE (1) | KE2960A (tr) |
| LU (1) | LU72224A1 (tr) |
| MY (1) | MY8000056A (tr) |
| NL (1) | NL184781C (tr) |
| NO (1) | NO144960C (tr) |
| OA (1) | OA04979A (tr) |
| PH (1) | PH13585A (tr) |
| PL (2) | PL97724B1 (tr) |
| RO (3) | RO79678A (tr) |
| SE (1) | SE430015B (tr) |
| SU (2) | SU730268A3 (tr) |
| TR (1) | TR18846A (tr) |
| YU (1) | YU37311B (tr) |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| OA04979A (fr) | 1974-04-09 | 1980-11-30 | Ciba Geigy | Nouveaux dérivés de l'aniline utiles comme agents microbicides et leur procédé de préparation. |
| US4147792A (en) * | 1977-02-04 | 1979-04-03 | Ciba-Geigy Corporation | Fungicidal compositions |
| CH627343A5 (en) * | 1977-03-28 | 1982-01-15 | Ciba Geigy Ag | Microbicide |
| CH629939A5 (de) * | 1977-03-29 | 1982-05-28 | Ciba Geigy Ag | Mikrobizides mittel. |
| AT368358B (de) * | 1977-12-24 | 1982-10-11 | Fisons Ltd | Schaedlingsbekaempfungs- und pflanzenwachstumsregulierungsmittel |
| DE2802211A1 (de) | 1978-01-19 | 1979-07-26 | Basf Ag | N-substituierte 2,6-dialkylaniline und verfahren zur herstellung von n- substituierten 2,6-dialkylanilinen |
| BG28977A3 (en) | 1978-02-02 | 1980-08-15 | Montedison Spa | Fungicide means and method for fungus fighting |
| CS217978B2 (en) * | 1978-04-01 | 1983-02-25 | Lilly Industries Ltd | Fungicide means |
| CH635313A5 (de) * | 1978-05-19 | 1983-03-31 | Ciba Geigy Ag | Pflanzenmikrobizid wirkende hydrazino-acetanilid-derivate, verfahren zu ihrer herstellung sowie mikrobizide mittel mit diesen praeparaten als wirkstoffe. |
| CH635819A5 (de) * | 1978-06-02 | 1983-04-29 | Ciba Geigy Ag | Alkoxy-alkoxy-acetyl acylalanine, deren herstellung und verwendung als pflanzenfungizide. |
| CH637368A5 (de) * | 1978-10-27 | 1983-07-29 | Ciba Geigy Ag | Anilinderivate und daraus hergestellte schaedlingsbekaempfungsmittel. |
| CH641760A5 (de) * | 1978-11-27 | 1984-03-15 | Ciba Geigy Ag | Schaedlingsbekaempfungsmittel. |
| CH639940A5 (en) * | 1978-12-05 | 1983-12-15 | Ciba Geigy Ag | Substituted N-alkoxycarbonylethyl-N-acylanilines, microbicides containing them, and process for the preparation of the compounds |
| DE2948734A1 (de) * | 1978-12-07 | 1980-06-19 | Ciba Geigy Ag | Schaedlingsbekaempfungsmittel |
| FR2447373A1 (fr) * | 1979-01-24 | 1980-08-22 | Rhone Poulenc Agrochimie | Produits derives de l'aniline ayant une activite antifongique ainsi que leur procede de preparation |
| FR2451914A1 (fr) * | 1979-03-20 | 1980-10-17 | Ciba Geigy Ag | Composes aromatiques azotes possedant des proprietes microbicides |
| CH639643A5 (en) * | 1979-03-21 | 1983-11-30 | Ciba Geigy Ag | Pesticides |
| MA18800A1 (fr) * | 1979-04-10 | 1980-12-31 | Ciba Geigy Ag | Naphtylamines acylees,procede pour leur preparation et leur application comme phytofongicides |
| DE2915026A1 (de) * | 1979-04-12 | 1980-10-30 | Bayer Ag | N,n-disubstituierte ethylglycin (thiol)ester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| FR2455576A1 (fr) * | 1979-05-03 | 1980-11-28 | Ciba Geigy Ag | Derives de n-(alcoxy- ou alcoxycarbonylalcoyl)-n-alcoxyalcoxyacetylaniline, leur preparation et leur application a la lutte anti-parasitaire |
| DE2917893A1 (de) * | 1979-05-03 | 1980-11-13 | Ciba Geigy Ag | N-(alkoxy- bzw. alkoxycarbonalalkyl)- n-hydroxyacetyl- bzw. propionyl-anilin- derivate als pflanzenfungizide |
| ES493517A0 (es) * | 1979-07-25 | 1981-05-16 | Hoechst Ag | Procedimiento para la preparacion de anilidas de acido tio- glicolico, fungicidas |
| ATE2426T1 (de) * | 1979-08-29 | 1983-03-15 | Ciba-Geigy Ag | Sulfinyl- und sulfonylacetanilide, verfahren zu deren herstellung und deren verwendung als mikrobizide. |
| MA19111A1 (fr) * | 1979-10-26 | 1981-12-31 | Ciba Geigy Ag | Derives de l'homoserine,procede pour leur preparation et leur utilisation en tant que microbicides |
| DE2946910A1 (de) * | 1979-11-21 | 1981-07-02 | Hoechst Ag, 6230 Frankfurt | Fungizide sulfonyl-, bzw. sulfinylacetanilide |
| US4377587A (en) * | 1980-07-25 | 1983-03-22 | Ciba-Geigy Corporation | Arylamine derivatives and use thereof as microbicides |
| MA19215A1 (fr) * | 1980-07-25 | 1982-04-01 | Ciba Geigy Ag | Nouveaux derives arylamines,procede pour leur fabrication et utilisation en tant que microbicides . |
| US4448773A (en) * | 1981-04-29 | 1984-05-15 | Ciba-Geigy Corporation | Microbicidal N-alkoxycarbonyl-alkyl-N-substituted acetyl-anilines and -naphthylamines |
| FR2505327A1 (fr) * | 1981-05-08 | 1982-11-12 | Rhone Poulenc Agrochimie | Procede d'halogenation en meta de n-(o,o'-dialkyl phenyl) alaninates et homologues |
| FR2513993A1 (fr) * | 1981-10-06 | 1983-04-08 | Rhone Poulenc Agrochimie | Nouveaux fongicides homologues des n-phenyl alaninates et leur procede de preparation et leur application |
| US4742079A (en) * | 1982-01-26 | 1988-05-03 | Sandoz Ltd. | Fungicides containing cymoxanil and metalaxyl |
| CH654979A5 (de) * | 1982-01-26 | 1986-03-27 | Sandoz Ag | Fungizide und ihre verwendung. |
| EP0230209A3 (de) * | 1985-12-16 | 1987-08-12 | Ciba-Geigy Ag | Mikrobizide |
| HU198825B (en) * | 1987-03-09 | 1989-12-28 | Chinoin Gyogyszer Es Vegyeszet | Synergic fungicides |
| HU202481B (en) * | 1989-04-19 | 1991-03-28 | Nitrokemia Ipartelepek | Process for producing n-phenyl-n-(methoxyacetyl)-dl-alanine methyl ester derivatives |
| CA2023176A1 (en) * | 1989-08-25 | 1991-02-26 | Margaret M. Bowers-Daines | Preparation and use of iodopropargyl esters of a-amino acid derivatives as antimicrobial agents |
| US5252745A (en) * | 1989-08-25 | 1993-10-12 | Rohm And Haas Company | Preparation and use of iodopropargyl esters of α-amino acid derivatives as antimicrobial agents |
| US5266597A (en) * | 1990-11-23 | 1993-11-30 | Eastman Kodak Company | Fungicidal 2-acylacetanilide derivatives |
| US5155136A (en) * | 1990-11-23 | 1992-10-13 | Eastman Kodak Company | Fungicidal, 2-acylacetanilide derivatives |
| CH687169A5 (de) | 1994-07-11 | 1996-10-15 | Ciba Geigy Ag | Mikrobizide. |
| US5723491A (en) * | 1994-07-11 | 1998-03-03 | Novartis Corporation | Fungicidal composition and method of controlling fungus infestation |
| DE4429014A1 (de) | 1994-08-16 | 1996-02-22 | Basf Ag | Verfahren zur Herstellung von cyclischen Aminen |
| JP2002518302A (ja) | 1998-06-17 | 2002-06-25 | バイエル アクチェンゲゼルシャフト | 植物有害生物の防除剤 |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| EP1744629B1 (de) | 2004-04-30 | 2012-12-05 | Basf Se | Fungizide mischungen |
| AU2006228957A1 (en) * | 2005-04-01 | 2006-10-05 | Methylgene Inc. | Inhibitors of histone deacetylase |
| ATE484194T1 (de) | 2005-06-09 | 2010-10-15 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| ITMI20051558A1 (it) | 2005-08-09 | 2007-02-10 | Isagro Spa | Miscele e-o composizioni sinergiche cin elevata attivita'fungicida |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| EP2091331A2 (en) | 2006-09-18 | 2009-08-26 | Basf Se | Pesticidal mixtures comprising an anthranilamide insecticide and a fungicide |
| EP2164323A1 (en) | 2006-12-15 | 2010-03-24 | Rohm and Haas Company | Mixtures comprising 1-methylcyclopropene |
| BR122019020351B1 (pt) | 2007-02-06 | 2020-08-18 | Basf Se | Misturas, composição pesticida, método para controlar fungos nocivos fitopatogênicos, método para proteger plantas do ataque ou infestação pelos insetos, acarídeos ou nematôdeos e método para proteger semente |
| EP2392662A3 (en) | 2007-04-23 | 2012-03-14 | Basf Se | Plant productivity enhancement by combining chemical agents with transgenic modifications |
| EP2000028A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| EP2000030A1 (de) * | 2007-06-06 | 2008-12-10 | Bayer CropScience AG | Fungizide Wirkstoffkombinationen |
| UA103008C2 (ru) | 2007-09-26 | 2013-09-10 | Басф Се | Трехкомпонентные фунгицидные композиции, содержащие боскалид и хлороталонил |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| JP5417814B2 (ja) * | 2008-11-25 | 2014-02-19 | 住友化学株式会社 | 植物病害防除用組成物及び植物病害の防除方法 |
| AU2010272872B2 (en) | 2009-07-16 | 2014-08-28 | Bayer Intellectual Property Gmbh | Synergistic active substance combinations containing phenyl triazoles |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| EP2417853A1 (en) | 2010-08-05 | 2012-02-15 | Basf Se | Synergistic fungicidal and insecticidal mixtures comprising a fungicide and an insecticide |
| EA201300731A1 (ru) | 2010-12-20 | 2014-01-30 | Басф Се | Пестицидно активные смеси, которые содержат соединения пиразола |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| EP3295797A1 (en) | 2011-03-23 | 2018-03-21 | Bayer Intellectual Property GmbH | Active compound combinations |
| EP3378313A1 (en) | 2011-03-23 | 2018-09-26 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| WO2013030338A2 (en) | 2011-09-02 | 2013-03-07 | Basf Se | Agricultural mixtures comprising arylquinazolinone compounds |
| JP2013142063A (ja) * | 2012-01-10 | 2013-07-22 | Sumitomo Chemical Co Ltd | 植物病害防除組成物およびその用途 |
| WO2013189801A1 (en) | 2012-06-20 | 2013-12-27 | Basf Se | Pyrazole compound and pesticidal mixtures comprising a pyrazole compound |
| WO2014056780A1 (en) | 2012-10-12 | 2014-04-17 | Basf Se | A method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| JP6051799B2 (ja) * | 2012-11-12 | 2016-12-27 | 住友化学株式会社 | 農薬用組成物及び植物の生長を促進する方法 |
| BR112015014753B8 (pt) | 2012-12-20 | 2020-03-03 | Basf Agro Bv | composições, uso de uma composição, método para o combate de fungos fitopatogênicos e uso dos componentes |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| CN105722833A (zh) | 2013-09-16 | 2016-06-29 | 巴斯夫欧洲公司 | 杀真菌的嘧啶化合物 |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| BR112017028388B1 (pt) | 2015-07-02 | 2022-02-22 | Basf Agro B.V | Composição, uso de uma composição, métodos de combate a fungos fitopatogênicos, deproteção de sementes raízes e brotos das plantas resultantes, de controle de insetos, acarídeosou nematoides de proteção de plantas e de aprimoramento da saúde das plantas e uso de umacomposição |
| US20180310552A1 (en) | 2015-10-27 | 2018-11-01 | Bayer Cropscience Aktiengesellschaft | Composition comprising a safener, a fungicide and metalaxyl |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1164160A (en) * | 1966-12-30 | 1969-09-17 | Shell Int Research | N,N-Disubstituted Amino Acid Derivatives and their use as Herbicides |
| GB1289283A (tr) * | 1970-03-04 | 1972-09-13 | ||
| DE2212268C3 (de) * | 1971-03-15 | 1979-09-13 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | N-Halogenacetylanilinoessigsäureester, Verfahren zu deren Herstellung und diese enthaltende herbicide Massen |
| SE397191B (sv) * | 1972-10-13 | 1977-10-24 | Ciba Geigy Ag | N-(1'-alkoxikarbonyl-etyl)-n-haloacetyl-2,6-dialkylaniliner till anvendning som fungicid |
| OA04979A (fr) | 1974-04-09 | 1980-11-30 | Ciba Geigy | Nouveaux dérivés de l'aniline utiles comme agents microbicides et leur procédé de préparation. |
| US4206228A (en) | 1974-04-09 | 1980-06-03 | Ciba-Geigy Corporation | Microbicidal aniline derivatives |
| US4204002A (en) | 1974-04-09 | 1980-05-20 | Ciba-Geigy Corporation | Methods of using N-(substituted)-N-alkoxy carbonyl anilino compounds |
| US4151299A (en) * | 1974-04-09 | 1979-04-24 | Ciba-Geigy Corporation | Certain aniline derivatives as microbicidal agents |
| CH623458A5 (tr) * | 1975-09-30 | 1981-06-15 | Ciba Geigy Ag |
-
1973
- 1973-04-08 OA OA55472A patent/OA04979A/xx unknown
-
1975
- 1975-03-26 FI FI750922A patent/FI61477C/fi not_active IP Right Cessation
- 1975-03-26 NO NO751088A patent/NO144960C/no unknown
- 1975-03-26 SE SE7503519A patent/SE430015B/xx not_active IP Right Cessation
- 1975-03-26 DK DK136375AA patent/DK142360B/da not_active IP Right Cessation
- 1975-04-07 LU LU72224A patent/LU72224A1/xx unknown
- 1975-04-07 FR FR7510722A patent/FR2267042B1/fr not_active Expired
- 1975-04-07 HU HU75CI1567A patent/HU173318B/hu unknown
- 1975-04-07 CA CA223,937A patent/CA1059141A/en not_active Expired
- 1975-04-07 DE DE2515091A patent/DE2515091C2/de not_active Expired
- 1975-04-07 PH PH17028A patent/PH13585A/en unknown
- 1975-04-08 GB GB14380/75A patent/GB1500581A/en not_active Expired
- 1975-04-08 ES ES436385A patent/ES436385A1/es not_active Expired
- 1975-04-08 BG BG029586A patent/BG26357A3/xx unknown
- 1975-04-08 AT AT263875A patent/AT341827B/de not_active IP Right Cessation
- 1975-04-08 DD DD192564A patent/DD124973A5/xx unknown
- 1975-04-08 IT IT22134/75A patent/IT1049536B/it active
- 1975-04-08 DD DD185303A patent/DD118979A5/xx unknown
- 1975-04-08 IL IL47046A patent/IL47046A/xx unknown
- 1975-04-08 IE IE787/75A patent/IE40913B1/xx unknown
- 1975-04-08 CY CY1010A patent/CY1010A/xx unknown
- 1975-04-08 YU YU0893/75A patent/YU37311B/xx unknown
- 1975-04-08 TR TR18846A patent/TR18846A/tr unknown
- 1975-04-09 RO RO7581942A patent/RO79678A/ro unknown
- 1975-04-09 NL NLAANVRAGE7504236,A patent/NL184781C/xx not_active IP Right Cessation
- 1975-04-09 PL PL1975179458A patent/PL97724B1/pl unknown
- 1975-04-09 JP JP4314775A patent/JPS5443573B2/ja not_active Expired
- 1975-04-09 PL PL1975192740A patent/PL104373B1/pl unknown
- 1975-04-09 RO RO106424A patent/RO83787B/ro unknown
- 1975-04-09 CS CS752436A patent/CS187468B2/cs unknown
- 1975-04-09 RO RO106425A patent/RO84020B/ro unknown
- 1975-04-09 SU SU752124200A patent/SU730268A3/ru active
-
1976
- 1976-07-01 SU SU762375578A patent/SU639445A3/ru active
-
1979
- 1979-04-08 AR AR258284A patent/AR226272A1/es active
- 1979-05-11 KE KE2960A patent/KE2960A/xx unknown
- 1979-06-21 HK HK403/79A patent/HK40379A/xx unknown
- 1979-12-07 US US06/101,355 patent/US4294850A/en not_active Expired - Lifetime
-
1980
- 1980-12-30 MY MY56/80A patent/MY8000056A/xx unknown
-
1981
- 1981-06-15 US US06/273,801 patent/US4439447A/en not_active Expired - Lifetime
- 1981-06-15 US US06/274,019 patent/US4427696A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI61477C (fi) | Vaextfungicida substituerade n-acylanilinderivat | |
| US4425357A (en) | Acyl anilines exerting a fungicidal action | |
| FI63567B (fi) | Substituerad furan-2-karbonsyra-anilid med fungicidisk verkan och dess anvaendning | |
| US4349550A (en) | Fungicidal N-(pyridazinoacetyl)-anilines | |
| FI61476B (fi) | Saosom vaextfungicider anvaendbara halogenacetanilider | |
| US4143155A (en) | Sulfonylglycolic anilide fungicides | |
| FI61478B (fi) | Vaextfungicida n-(1'-metoxi- och etoxikarbonyl-etyl)-n-acyl-anilinderivat | |
| US4025648A (en) | Haloacylanilides and use as fungicides | |
| US4075349A (en) | Microbicidal compositions | |
| US4276303A (en) | Microbicidal compositions | |
| US4151295A (en) | Microbicides for controlling plant diseases | |
| JPS648615B2 (tr) | ||
| US4330556A (en) | Microbicidal N-1'-hydrocarbyloxycarbonylethyl)-N-alkoxyacetylanilines | |
| US4207338A (en) | Microbicidal composition | |
| US4101672A (en) | Microbicidal alanine thioesters | |
| US4153712A (en) | Pyrazolylacetanilide compounds and fungicidal compositions | |
| FI61475C (fi) | Saosom vaextfungicider anvaendbara haloacylanilider | |
| US4034108A (en) | N-(1'-alkoxycarbonyl-ethyl)-N-haloacetyl-2,6-dialkylanilines for the control of phytopathogenic fungi | |
| US4423059A (en) | Fungicidal N-(pyrrolidinoacetyl)-anilines | |
| US4165381A (en) | Microbicidal compositions | |
| US4214005A (en) | Fungicidal alkoxyalkoxyacetyl acylalanines | |
| US4689343A (en) | Novel thiolane-2,4-dione-3-carboxamide fungicides | |
| US4224337A (en) | Pesticidal compositions | |
| US4428964A (en) | Sulfinyl- and sulfonylacetanilides and their use as microbicides | |
| JPH0147458B2 (tr) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: CIBA-GEIGY AG |