FI60009C - Ett nytt foerfarande foer framstaellning av terapeutiskt vaerdefulla 4-(4-piperidyliden)-4h-benso(4,5)-cyklohepta(1,2-b)tiofen-10(9h)-oner - Google Patents
Ett nytt foerfarande foer framstaellning av terapeutiskt vaerdefulla 4-(4-piperidyliden)-4h-benso(4,5)-cyklohepta(1,2-b)tiofen-10(9h)-oner Download PDFInfo
- Publication number
- FI60009C FI60009C FI243371A FI243371A FI60009C FI 60009 C FI60009 C FI 60009C FI 243371 A FI243371 A FI 243371A FI 243371 A FI243371 A FI 243371A FI 60009 C FI60009 C FI 60009C
- Authority
- FI
- Finland
- Prior art keywords
- cyclohepta
- benzo
- piperidylidene
- methyl
- bromo
- Prior art date
Links
- -1 4-PIPERIDYLIDEN Chemical class 0.000 title description 25
- 150000001875 compounds Chemical class 0.000 claims description 40
- 238000000034 method Methods 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 150000007513 acids Chemical class 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 230000001590 oxidative effect Effects 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 44
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 35
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- 229930192474 thiophene Natural products 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000010438 heat treatment Methods 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 238000004452 microanalysis Methods 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- NFHHBIGYIAIGFH-UHFFFAOYSA-N 2h-cyclohepta[b]thiophene Chemical compound C1=CC=CC2=CCSC2=C1 NFHHBIGYIAIGFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- MWWHYPORGYMFIP-UHFFFAOYSA-N cyclohepta[b]thiophen-4-one Chemical compound O=C1C=CC=CC2=C1C=CS2 MWWHYPORGYMFIP-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HERSKCAGZCXYMC-UHFFFAOYSA-N thiophen-3-ol Chemical compound OC=1C=CSC=1 HERSKCAGZCXYMC-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- SEPPVOUBHWNCAW-FNORWQNLSA-N (E)-4-oxonon-2-enal Chemical compound CCCCCC(=O)\C=C\C=O SEPPVOUBHWNCAW-FNORWQNLSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- OYGMIRYICCMQKU-UHFFFAOYSA-N 8-chloro-10-(1-methylpiperidin-4-ylidene)-5h-benzo[3,4]cyclohepta[1,3-b]thiophen-4-one Chemical compound C1CN(C)CCC1=C1C2=CC(Cl)=CC=C2CC(=O)C2=C1C=CS2 OYGMIRYICCMQKU-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- NEZGEPPPHIDPML-UHFFFAOYSA-N BrC1=CC2=C(C(C3=C1SC=C3)=C3CCN(CC3)C)C=C(C=C2)Cl Chemical compound BrC1=CC2=C(C(C3=C1SC=C3)=C3CCN(CC3)C)C=C(C=C2)Cl NEZGEPPPHIDPML-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AKUFYPLYKXDVAG-UHFFFAOYSA-N O[S+]1C=CC=C1 Chemical compound O[S+]1C=CC=C1 AKUFYPLYKXDVAG-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 150000002901 organomagnesium compounds Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- LWRYDHOHXNQTSK-UHFFFAOYSA-N thiophene oxide Chemical compound O=S1C=CC=C1 LWRYDHOHXNQTSK-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1412070A CH537404A (de) | 1970-09-24 | 1970-09-24 | Verfahren zur Herstellung neuer Thiophenderivate |
| CH1412070 | 1970-09-24 | ||
| CH163271 | 1971-02-04 | ||
| CH163271 | 1971-02-04 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI60009B FI60009B (fi) | 1981-07-31 |
| FI60009C true FI60009C (fi) | 1981-11-10 |
Family
ID=25688218
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI243371A FI60009C (fi) | 1970-09-24 | 1971-08-31 | Ett nytt foerfarande foer framstaellning av terapeutiskt vaerdefulla 4-(4-piperidyliden)-4h-benso(4,5)-cyklohepta(1,2-b)tiofen-10(9h)-oner |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS558984B1 (cs) |
| CS (1) | CS181213B2 (cs) |
| DD (1) | DD94823A5 (cs) |
| DK (1) | DK127429B (cs) |
| ES (1) | ES394742A1 (cs) |
| FI (1) | FI60009C (cs) |
| HU (1) | HU162650B (cs) |
| IE (1) | IE36493B1 (cs) |
| IL (1) | IL37621A (cs) |
| NO (1) | NO135364C (cs) |
| PL (1) | PL82784B1 (cs) |
| RO (1) | RO60524A (cs) |
| YU (1) | YU35252B (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60112084A (ja) * | 1983-11-24 | 1985-06-18 | Canon Inc | クリ−ニング装置 |
| JP5096500B2 (ja) | 2008-01-30 | 2012-12-12 | 日本臓器製薬株式会社 | ピペリジン誘導体 |
-
1971
- 1971-08-31 IL IL37621A patent/IL37621A/xx unknown
- 1971-08-31 DD DD15743571A patent/DD94823A5/xx unknown
- 1971-08-31 FI FI243371A patent/FI60009C/fi active
- 1971-08-31 CS CS622971A patent/CS181213B2/cs unknown
- 1971-09-01 NO NO324971A patent/NO135364C/no unknown
- 1971-09-01 IE IE111271A patent/IE36493B1/xx unknown
- 1971-09-02 HU HUSA002232 patent/HU162650B/hu unknown
- 1971-09-02 ES ES394742A patent/ES394742A1/es not_active Expired
- 1971-09-02 YU YU224571A patent/YU35252B/xx unknown
- 1971-09-02 PL PL15032671A patent/PL82784B1/pl unknown
- 1971-09-03 JP JP6798071A patent/JPS558984B1/ja active Pending
- 1971-09-06 RO RO6814571A patent/RO60524A/ro unknown
- 1971-09-06 DK DK437071A patent/DK127429B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| PL82784B1 (cs) | 1975-10-31 |
| NO135364C (no) | 1977-03-30 |
| RO60524A (cs) | 1976-07-15 |
| JPS558984B1 (cs) | 1980-03-07 |
| YU224571A (en) | 1980-04-30 |
| ES394742A1 (es) | 1974-10-01 |
| IE36493B1 (en) | 1976-11-24 |
| IL37621A0 (en) | 1971-11-29 |
| IE36493L (en) | 1972-03-24 |
| YU35252B (en) | 1980-10-31 |
| DD94823A5 (cs) | 1973-01-05 |
| FI60009B (fi) | 1981-07-31 |
| IL37621A (en) | 1975-05-22 |
| HU162650B (cs) | 1973-03-28 |
| CS181213B2 (en) | 1978-03-31 |
| NO135364B (cs) | 1976-12-20 |
| DK127429B (da) | 1973-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100381484B1 (ko) | 4-트리플루오로메틸니코틴산의제조방법 | |
| DE2144490A1 (de) | Neue heterocyclische Verbindungen und Verfahren zu deren Herstellung | |
| JP5400840B2 (ja) | N−アルキル−2(ヒドロキシ−4ベンゾイル)−3ベンゾフラン及びその中間体の調製方法 | |
| NO122614B (cs) | ||
| HU193941B (en) | Process for production of 6-substituted-4-dialkil-tetra-hydrobenz/c,d/ indole derivatives | |
| NO162414B (no) | Fleksibel beholder for transport og lagring av massegods. | |
| FI70006B (fi) | Saosom mellanprodukter vid framstaellning av n-alkylerade 9-aminoalkyl-9-aminokarbonylfluorenderivat anvaendbara 9-aminoalkyl-9-aminokarbonylfluorener | |
| HU185133B (en) | Process for producing 1-hydroxy-octahydro-benzo-bracket-c-bracket closed-quinolines and derivatives | |
| FI60009C (fi) | Ett nytt foerfarande foer framstaellning av terapeutiskt vaerdefulla 4-(4-piperidyliden)-4h-benso(4,5)-cyklohepta(1,2-b)tiofen-10(9h)-oner | |
| US20020061919A1 (en) | Process for the preparation of 1,2,3,9-tetrahydro-9-methyl-3-{(2-methyl-1h-imidazol-1-yl)methyl}-4h-carbazol-4-one | |
| CA1250586A (en) | 1h-imidazole derivatives and process for their production | |
| AT391865B (de) | Verfahren zur herstellung neuer benzothiophenderivate | |
| FI60396C (fi) | Nytt foerfarande foer framstaellning av terapeutiskt vaerdefulla 4-(4-piperidyliden)-4h-benso(4,5)cyklohepta(1,2-b)tiofen-10(9h)-oner | |
| US7692025B2 (en) | Process for the preparation of anticancer drugs | |
| Hibino et al. | Total synthesis of aaptamine of potent α-blocking activity via thermal cyclization of 1-azahexatriene systems | |
| HU208320B (en) | Process for producing 0-carboxypyridyl and 0-carboxyquinolyl imidazolinones | |
| US3047572A (en) | Dimethylaminophenotfflazine | |
| JP3534816B2 (ja) | メチルチオベンゼン類の製造方法 | |
| EA012180B1 (ru) | Способ получения арипипразола и соответствующие промежуточные продукты и их получение | |
| JPS58208252A (ja) | アリルアミン誘導体、その製造法および用途 | |
| SusanáHutchison | Gas-phase rearrangement and cyclisation reactions of 2-benzylphenylaminyl radicals and related 2-hetero-analogues | |
| Snyder et al. | Amine Replacement Reactions of α-Dimethylaminomethyl-β-methoxynaphthalene | |
| US6034252A (en) | Substituted thienocycloalkylpyrazoles: dopamine receptor subtype specific ligands | |
| NO121670B (cs) | ||
| KR101620158B1 (ko) | 1-알킬-2-페닐-4-퀴놀론의 제조방법 |