EA011890B1 - Замещённые бензазолы и их применение в качестве ингибиторов raf-киназы - Google Patents
Замещённые бензазолы и их применение в качестве ингибиторов raf-киназы Download PDFInfo
- Publication number
- EA011890B1 EA011890B1 EA200600689A EA200600689A EA011890B1 EA 011890 B1 EA011890 B1 EA 011890B1 EA 200600689 A EA200600689 A EA 200600689A EA 200600689 A EA200600689 A EA 200600689A EA 011890 B1 EA011890 B1 EA 011890B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- amino
- methyl
- oxy
- carboxamide
- phenyl
- Prior art date
Links
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical class C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 title abstract description 12
- 102000009929 raf Kinases Human genes 0.000 title abstract 3
- 108010077182 raf Kinases Proteins 0.000 title abstract 3
- 239000003112 inhibitor Substances 0.000 title description 6
- 239000000203 mixture Substances 0.000 claims abstract description 187
- 150000001875 compounds Chemical class 0.000 claims abstract description 107
- 238000000034 method Methods 0.000 claims abstract description 52
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 45
- 201000011510 cancer Diseases 0.000 claims abstract description 33
- 241001465754 Metazoa Species 0.000 claims abstract description 27
- 230000000694 effects Effects 0.000 claims abstract description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 14
- 230000001404 mediated effect Effects 0.000 claims abstract description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 610
- -1 nitro, amino, imino Chemical group 0.000 claims description 562
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 206
- 125000000217 alkyl group Chemical group 0.000 claims description 75
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 59
- 229910052739 hydrogen Inorganic materials 0.000 claims description 54
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 48
- 239000001257 hydrogen Substances 0.000 claims description 40
- 125000003118 aryl group Chemical group 0.000 claims description 39
- 108091000080 Phosphotransferase Proteins 0.000 claims description 30
- 102000020233 phosphotransferase Human genes 0.000 claims description 30
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 125000001072 heteroaryl group Chemical group 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 108091054455 MAP kinase family Proteins 0.000 claims description 19
- 102000043136 MAP kinase family Human genes 0.000 claims description 19
- 150000002148 esters Chemical class 0.000 claims description 19
- 239000000651 prodrug Substances 0.000 claims description 18
- 229940002612 prodrug Drugs 0.000 claims description 18
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 125000001424 substituent group Chemical group 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 13
- 239000003814 drug Substances 0.000 claims description 12
- 125000005842 heteroatom Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 230000019491 signal transduction Effects 0.000 claims description 8
- 230000002401 inhibitory effect Effects 0.000 claims description 7
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 7
- 239000005517 L01XE01 - Imatinib Substances 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 6
- 229940088597 hormone Drugs 0.000 claims description 6
- 239000005556 hormone Substances 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 5
- 206010006187 Breast cancer Diseases 0.000 claims description 5
- 208000026310 Breast neoplasm Diseases 0.000 claims description 5
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 5
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 5
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 5
- 229960004316 cisplatin Drugs 0.000 claims description 5
- 230000001419 dependent effect Effects 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 claims description 5
- 229960004768 irinotecan Drugs 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 229960004641 rituximab Drugs 0.000 claims description 5
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 claims description 4
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 4
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 4
- 229940123237 Taxane Drugs 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 229940045799 anthracyclines and related substance Drugs 0.000 claims description 4
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims description 4
- 229960004562 carboplatin Drugs 0.000 claims description 4
- 229960004397 cyclophosphamide Drugs 0.000 claims description 4
- 229960002949 fluorouracil Drugs 0.000 claims description 4
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 claims description 4
- 235000008191 folinic acid Nutrition 0.000 claims description 4
- 239000011672 folinic acid Substances 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 4
- 229960005277 gemcitabine Drugs 0.000 claims description 4
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 claims description 4
- 229960002411 imatinib Drugs 0.000 claims description 4
- 229960001691 leucovorin Drugs 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- 229950006410 tezacitabine Drugs 0.000 claims description 4
- GFFXZLZWLOBBLO-ASKVSEFXSA-N tezacitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 GFFXZLZWLOBBLO-ASKVSEFXSA-N 0.000 claims description 4
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 claims description 4
- 229960000303 topotecan Drugs 0.000 claims description 4
- 229960000575 trastuzumab Drugs 0.000 claims description 4
- 206010060862 Prostate cancer Diseases 0.000 claims description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 3
- 229910052796 boron Inorganic materials 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 229940122803 Vinca alkaloid Drugs 0.000 claims description 2
- 229930013930 alkaloid Natural products 0.000 claims description 2
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 2
- 230000002489 hematologic effect Effects 0.000 claims 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 1
- YTGJWQPHMWSCST-UHFFFAOYSA-N Tiopronin Chemical class CC(S)C(=O)NCC(O)=O YTGJWQPHMWSCST-UHFFFAOYSA-N 0.000 claims 1
- 241000863480 Vinca Species 0.000 claims 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 1
- 125000003368 amide group Chemical group 0.000 claims 1
- 239000000919 ceramic Substances 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 239000011701 zinc Substances 0.000 claims 1
- 229910052725 zinc Inorganic materials 0.000 claims 1
- 230000005764 inhibitory process Effects 0.000 abstract description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 255
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 231
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 227
- 230000015572 biosynthetic process Effects 0.000 description 209
- 238000003786 synthesis reaction Methods 0.000 description 177
- 150000003857 carboxamides Chemical class 0.000 description 170
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 168
- 239000000243 solution Substances 0.000 description 129
- 238000001819 mass spectrum Methods 0.000 description 128
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 114
- 239000011541 reaction mixture Substances 0.000 description 112
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 98
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 93
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 76
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 76
- 239000012044 organic layer Substances 0.000 description 72
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 65
- 239000007787 solid Substances 0.000 description 63
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 62
- 238000002514 liquid chromatography mass spectrum Methods 0.000 description 58
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 54
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 54
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 54
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 46
- 229910052757 nitrogen Inorganic materials 0.000 description 46
- 239000000047 product Substances 0.000 description 41
- 239000012267 brine Substances 0.000 description 40
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 40
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 37
- 238000004237 preparative chromatography Methods 0.000 description 35
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 35
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 32
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 32
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 32
- 238000004811 liquid chromatography Methods 0.000 description 31
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 29
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 28
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 28
- 238000004949 mass spectrometry Methods 0.000 description 28
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 28
- 238000000746 purification Methods 0.000 description 28
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 27
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 27
- 239000000725 suspension Substances 0.000 description 27
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 26
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 26
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 25
- 125000003710 aryl alkyl group Chemical group 0.000 description 25
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 24
- 238000004128 high performance liquid chromatography Methods 0.000 description 22
- 239000010410 layer Substances 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- 229910052938 sodium sulfate Inorganic materials 0.000 description 21
- 235000011152 sodium sulphate Nutrition 0.000 description 21
- 238000003756 stirring Methods 0.000 description 21
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 21
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 20
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 20
- 239000010802 sludge Substances 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 19
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 19
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 16
- 239000012298 atmosphere Substances 0.000 description 16
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 16
- 150000004985 diamines Chemical class 0.000 description 15
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000008346 aqueous phase Substances 0.000 description 14
- 229910000027 potassium carbonate Inorganic materials 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 13
- 150000001412 amines Chemical class 0.000 description 13
- 229910052799 carbon Inorganic materials 0.000 description 13
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 13
- IVWFPGYPIXURMK-UHFFFAOYSA-N 3,4-dimethylpyridine-2-carboxamide Chemical compound CC1=CC=NC(C(N)=O)=C1C IVWFPGYPIXURMK-UHFFFAOYSA-N 0.000 description 12
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 150000002431 hydrogen Chemical class 0.000 description 11
- 239000012299 nitrogen atmosphere Substances 0.000 description 11
- 238000004007 reversed phase HPLC Methods 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- HZBPBLHQOUNXFS-UHFFFAOYSA-N tert-butyl 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carboxylate Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)OC(C)(C)C)=C1 HZBPBLHQOUNXFS-UHFFFAOYSA-N 0.000 description 11
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 10
- 125000000753 cycloalkyl group Chemical group 0.000 description 10
- 229910052745 lead Inorganic materials 0.000 description 10
- 239000012074 organic phase Substances 0.000 description 10
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 10
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 9
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 9
- HXXAUIXTYRHFNO-UHFFFAOYSA-N n-methylpyridine-2-carboxamide Chemical compound CNC(=O)C1=CC=CC=N1 HXXAUIXTYRHFNO-UHFFFAOYSA-N 0.000 description 9
- 230000037361 pathway Effects 0.000 description 9
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 9
- XQACWEBGSZBLRG-UHFFFAOYSA-N 1-bromo-4-isothiocyanatobenzene Chemical compound BrC1=CC=C(N=C=S)C=C1 XQACWEBGSZBLRG-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 125000003282 alkyl amino group Chemical group 0.000 description 8
- 208000035475 disorder Diseases 0.000 description 8
- 229940043355 kinase inhibitor Drugs 0.000 description 8
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 8
- IQXUIDYRTHQTET-UHFFFAOYSA-N 4-amino-3-nitrophenol Chemical compound NC1=CC=C(O)C=C1[N+]([O-])=O IQXUIDYRTHQTET-UHFFFAOYSA-N 0.000 description 7
- 239000005711 Benzoic acid Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000002246 antineoplastic agent Substances 0.000 description 7
- 235000010233 benzoic acid Nutrition 0.000 description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 6
- QFFWXJUMBXZQRW-UHFFFAOYSA-N 2-methoxy-4-(methylamino)-5-nitrophenol Chemical compound CNC1=CC(OC)=C(O)C=C1[N+]([O-])=O QFFWXJUMBXZQRW-UHFFFAOYSA-N 0.000 description 6
- CGKYDLSLIFODDP-UHFFFAOYSA-N 3-pyrrolidin-1-ylpropanamide Chemical compound NC(=O)CCN1CCCC1 CGKYDLSLIFODDP-UHFFFAOYSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- 108010029485 Protein Isoforms Proteins 0.000 description 6
- 102000001708 Protein Isoforms Human genes 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000003818 flash chromatography Methods 0.000 description 6
- 239000012634 fragment Substances 0.000 description 6
- 239000002502 liposome Substances 0.000 description 6
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 5
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 5
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 5
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 5
- 102000001253 Protein Kinase Human genes 0.000 description 5
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 5
- 125000004103 aminoalkyl group Chemical group 0.000 description 5
- 230000006907 apoptotic process Effects 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 230000035772 mutation Effects 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 108060006633 protein kinase Proteins 0.000 description 5
- 229940124597 therapeutic agent Drugs 0.000 description 5
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 4
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 4
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 4
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 4
- SWHGADZUKYCULK-UHFFFAOYSA-N 3-(1,3-thiazol-2-yl)pyridine-2-carboxamide Chemical compound NC(=O)C1=NC=CC=C1C1=NC=CS1 SWHGADZUKYCULK-UHFFFAOYSA-N 0.000 description 4
- IUFINAOGHXYFTL-UHFFFAOYSA-N 3-piperidin-2-ylpropanamide Chemical compound NC(=O)CCC1CCCCN1 IUFINAOGHXYFTL-UHFFFAOYSA-N 0.000 description 4
- HOQWETSYPZRCJB-UHFFFAOYSA-N 4-[2-(4-bromo-3-methylanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(O)=O)C=C3N=2)C)=C1 HOQWETSYPZRCJB-UHFFFAOYSA-N 0.000 description 4
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 4
- PEDMFCHWOVJDNW-UHFFFAOYSA-N 5-fluoro-2-nitroaniline Chemical compound NC1=CC(F)=CC=C1[N+]([O-])=O PEDMFCHWOVJDNW-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 4
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 4
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 4
- 239000012455 biphasic mixture Substances 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 125000002883 imidazolyl group Chemical group 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- ANXIFSCWAVKXIU-UHFFFAOYSA-N n-(2-methoxyethyl)pyridine-2-carboxamide Chemical compound COCCNC(=O)C1=CC=CC=N1 ANXIFSCWAVKXIU-UHFFFAOYSA-N 0.000 description 4
- YIBHHPKCUYKTTB-UHFFFAOYSA-N n-benzyl-2-(4-nitrophenyl)ethanamine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCNCC1=CC=CC=C1 YIBHHPKCUYKTTB-UHFFFAOYSA-N 0.000 description 4
- PVNIIMVLHYAWGP-UHFFFAOYSA-M nicotinate Chemical compound [O-]C(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-M 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 125000003367 polycyclic group Chemical group 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 125000006413 ring segment Chemical group 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- 125000001425 triazolyl group Chemical group 0.000 description 4
- 230000004614 tumor growth Effects 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 3
- DEQOLKHWZYWJNR-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]benzimidazol-2-amine Chemical compound NC1=NC2=CC=CC=C2N1C1=CC=CC(C(F)(F)F)=C1 DEQOLKHWZYWJNR-UHFFFAOYSA-N 0.000 description 3
- XEWICNRVCQLKIG-UHFFFAOYSA-N 1-ethyl-4-(4-nitrophenyl)piperazine Chemical compound C1CN(CC)CCN1C1=CC=C([N+]([O-])=O)C=C1 XEWICNRVCQLKIG-UHFFFAOYSA-N 0.000 description 3
- ZVMPEUKZYDFXQN-UHFFFAOYSA-N 1-isothiocyanato-3-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=CC(N=C=S)=C1 ZVMPEUKZYDFXQN-UHFFFAOYSA-N 0.000 description 3
- HIQNBABZXGQVFC-UHFFFAOYSA-N 1-isothiocyanato-4-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=C(N=C=S)C=C1 HIQNBABZXGQVFC-UHFFFAOYSA-N 0.000 description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 3
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 3
- ASKKQCQOXXCVNU-UHFFFAOYSA-N 2-(4-bromoanilino)-1,3-benzoxazol-5-ol Chemical compound N=1C2=CC(O)=CC=C2OC=1NC1=CC=C(Br)C=C1 ASKKQCQOXXCVNU-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- TUADYTFWZPZZTP-UHFFFAOYSA-N 2-amino-4-methoxyphenol Chemical compound COC1=CC=C(O)C(N)=C1 TUADYTFWZPZZTP-UHFFFAOYSA-N 0.000 description 3
- JWYUFVNJZUSCSM-UHFFFAOYSA-N 2-aminobenzimidazole Chemical compound C1=CC=C2NC(N)=NC2=C1 JWYUFVNJZUSCSM-UHFFFAOYSA-N 0.000 description 3
- MGQROXOMFRGAOY-UHFFFAOYSA-N 2-chloro-4-pyridin-3-ylpyrimidine Chemical compound ClC1=NC=CC(C=2C=NC=CC=2)=N1 MGQROXOMFRGAOY-UHFFFAOYSA-N 0.000 description 3
- BRENVJPPZRBCPU-UHFFFAOYSA-N 2-chloro-5-methoxy-1,3-benzoxazole Chemical compound COC1=CC=C2OC(Cl)=NC2=C1 BRENVJPPZRBCPU-UHFFFAOYSA-N 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- OBOSXEWFRARQPU-UHFFFAOYSA-N 2-n,2-n-dimethylpyridine-2,5-diamine Chemical compound CN(C)C1=CC=C(N)C=N1 OBOSXEWFRARQPU-UHFFFAOYSA-N 0.000 description 3
- PNGQEVKCNGURKG-UHFFFAOYSA-N 2-n-(4-bromophenyl)-3h-benzimidazole-2,5-diamine Chemical compound N1C2=CC(N)=CC=C2N=C1NC1=CC=C(Br)C=C1 PNGQEVKCNGURKG-UHFFFAOYSA-N 0.000 description 3
- ZRSLJOXAHACGPX-UHFFFAOYSA-N 2-nitro-4-(4-pyridin-3-ylpyrimidin-2-yl)oxyaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1OC1=NC=CC(C=2C=NC=CC=2)=N1 ZRSLJOXAHACGPX-UHFFFAOYSA-N 0.000 description 3
- IEVJVQXLBZUEMH-UHFFFAOYSA-N 2-piperidin-2-ylethanamine Chemical compound NCCC1CCCCN1 IEVJVQXLBZUEMH-UHFFFAOYSA-N 0.000 description 3
- FPWLQQCGTRLWTG-UHFFFAOYSA-N 3-(3-chloropyridin-4-yl)-4-methylaniline Chemical compound CC1=CC=C(N)C=C1C1=CC=NC=C1Cl FPWLQQCGTRLWTG-UHFFFAOYSA-N 0.000 description 3
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 3
- AIOUQYUFHADEHR-UHFFFAOYSA-N 3-methylpyridine-2-carboxamide Chemical compound CC1=CC=CN=C1C(N)=O AIOUQYUFHADEHR-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- LLPIMIMXCXEFER-UHFFFAOYSA-N 4-(2-morpholin-4-ylethyl)aniline Chemical compound C1=CC(N)=CC=C1CCN1CCOCC1 LLPIMIMXCXEFER-UHFFFAOYSA-N 0.000 description 3
- KEPUOYACJXZYTQ-UHFFFAOYSA-N 4-(4-ethylpiperazin-1-yl)aniline Chemical compound C1CN(CC)CCN1C1=CC=C(N)C=C1 KEPUOYACJXZYTQ-UHFFFAOYSA-N 0.000 description 3
- GCEPYWXJPCACOW-UHFFFAOYSA-N 4-(4-pyridin-3-ylpyrimidin-2-yl)oxybenzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1OC1=NC=CC(C=2C=NC=CC=2)=N1 GCEPYWXJPCACOW-UHFFFAOYSA-N 0.000 description 3
- RCOVTJVRTZGSBP-UHFFFAOYSA-N 4-(chloromethyl)benzoyl chloride Chemical compound ClCC1=CC=C(C(Cl)=O)C=C1 RCOVTJVRTZGSBP-UHFFFAOYSA-N 0.000 description 3
- VVTIATCVLPUOPW-UHFFFAOYSA-N 4-[(4-ethylpiperazin-1-yl)methyl]aniline Chemical compound C1CN(CC)CCN1CC1=CC=C(N)C=C1 VVTIATCVLPUOPW-UHFFFAOYSA-N 0.000 description 3
- JLLIXKAWWJTDNP-UHFFFAOYSA-N 4-[1-methyl-2-(4-methylanilino)benzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1=NC2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N1C JLLIXKAWWJTDNP-UHFFFAOYSA-N 0.000 description 3
- CUGKDFRAPZBFDH-UHFFFAOYSA-N 4-[2-(3-tert-butylanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=CC(C(C)(C)C)=C1 CUGKDFRAPZBFDH-UHFFFAOYSA-N 0.000 description 3
- HWNPZUOQCGNXAZ-UHFFFAOYSA-N 4-[2-(4-bromo-3-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(Br)C(F)=C1 HWNPZUOQCGNXAZ-UHFFFAOYSA-N 0.000 description 3
- XQXDKWDWNQFNJA-UHFFFAOYSA-N 4-[2-(4-bromo-3-methylanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C=2C=C(OC=3C=C(N=CC=3)C(O)=O)C(OC)=CC=2N(C)C=1NC1=CC=C(Br)C(C)=C1 XQXDKWDWNQFNJA-UHFFFAOYSA-N 0.000 description 3
- AHZQRBCQCSFDCG-UHFFFAOYSA-N 4-[2-(4-chloroanilino)-6-methoxy-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C=2C=C(OC=3C=C(N=CC=3)C(O)=O)C(OC)=CC=2N(C)C=1NC1=CC=C(Cl)C=C1 AHZQRBCQCSFDCG-UHFFFAOYSA-N 0.000 description 3
- QUBKUDTUSCUCDN-UHFFFAOYSA-N 4-[2-(4-ethylanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound C1=CC(CC)=CC=C1NC1=NC2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N1C QUBKUDTUSCUCDN-UHFFFAOYSA-N 0.000 description 3
- ZKFSCSZTFQRENK-UHFFFAOYSA-N 4-[2-[2-fluoro-5-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC(C(F)(F)F)=CC=C1F ZKFSCSZTFQRENK-UHFFFAOYSA-N 0.000 description 3
- XSNVSWZFFGOGSN-UHFFFAOYSA-N 4-[2-[4-chloro-3-(trifluoromethyl)anilino]-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(Cl)C(C(F)(F)F)=C1 XSNVSWZFFGOGSN-UHFFFAOYSA-N 0.000 description 3
- VXHDHMUZXWITDG-UHFFFAOYSA-N 4-bromo-1-isothiocyanato-2-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC(Br)=CC=C1N=C=S VXHDHMUZXWITDG-UHFFFAOYSA-N 0.000 description 3
- QGTUVLRFJOUWBN-UHFFFAOYSA-N 5-methoxy-3h-1,3-benzoxazole-2-thione Chemical compound COC1=CC=C2OC(=S)NC2=C1 QGTUVLRFJOUWBN-UHFFFAOYSA-N 0.000 description 3
- DUXQAUHAELQRIN-UHFFFAOYSA-N 6-(4-pyridin-3-ylpyrimidin-2-yl)oxy-1H-benzimidazole-2-carboxamide Chemical compound N1=CC(=CC=C1)C1=NC(=NC=C1)OC1=CC2=C(N=C(N2)C(=O)N)C=C1 DUXQAUHAELQRIN-UHFFFAOYSA-N 0.000 description 3
- 208000003200 Adenoma Diseases 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 201000009030 Carcinoma Diseases 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 101150100676 Map2k1 gene Proteins 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 108090000744 Mitogen-Activated Protein Kinase Kinases Proteins 0.000 description 3
- 102000004232 Mitogen-Activated Protein Kinase Kinases Human genes 0.000 description 3
- AVMWDUALWZIHDV-UHFFFAOYSA-N N=C=S.C1CN(CC)CCN1C1=CC=CC=C1 Chemical compound N=C=S.C1CN(CC)CCN1C1=CC=CC=C1 AVMWDUALWZIHDV-UHFFFAOYSA-N 0.000 description 3
- SXXGOMGNWVBSGG-UHFFFAOYSA-N N=C=S.C1CN(CC)CCN1CC1=CC=CC=C1 Chemical compound N=C=S.C1CN(CC)CCN1CC1=CC=CC=C1 SXXGOMGNWVBSGG-UHFFFAOYSA-N 0.000 description 3
- KVSDZQGPNWEDGY-UHFFFAOYSA-N N=C=S.C1COCCN1CCC1=CC=CC=C1 Chemical compound N=C=S.C1COCCN1CCC1=CC=CC=C1 KVSDZQGPNWEDGY-UHFFFAOYSA-N 0.000 description 3
- MTFFAYYIWDNMSA-UHFFFAOYSA-N N=C=S.C=1C=CC=CC=1CNCCC1=CC=CC=C1 Chemical compound N=C=S.C=1C=CC=CC=1CNCCC1=CC=CC=C1 MTFFAYYIWDNMSA-UHFFFAOYSA-N 0.000 description 3
- QXZIWVRXROLEMZ-UHFFFAOYSA-N N=C=S.CC1=CC=CC=C1Br Chemical compound N=C=S.CC1=CC=CC=C1Br QXZIWVRXROLEMZ-UHFFFAOYSA-N 0.000 description 3
- HHGFEIFUQNJCOF-UHFFFAOYSA-N N=C=S.CC1=CC=CC=C1C1=CC=NC=C1Cl Chemical compound N=C=S.CC1=CC=CC=C1C1=CC=NC=C1Cl HHGFEIFUQNJCOF-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 3
- 239000004473 Threonine Substances 0.000 description 3
- 102000040945 Transcription factor Human genes 0.000 description 3
- 108091023040 Transcription factor Proteins 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229940046836 anti-estrogen Drugs 0.000 description 3
- 230000001833 anti-estrogenic effect Effects 0.000 description 3
- 230000000692 anti-sense effect Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 3
- 125000005129 aryl carbonyl group Chemical group 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000002393 azetidinyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000005841 biaryl group Chemical group 0.000 description 3
- 150000005347 biaryls Chemical group 0.000 description 3
- 125000006268 biphenyl-3-yl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C(*)=C([H])C([H])=C1[H] 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000013058 crude material Substances 0.000 description 3
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 3
- 125000004663 dialkyl amino group Chemical group 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 239000000328 estrogen antagonist Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011981 lindlar catalyst Substances 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- SPPJUUNCUKYHSS-UHFFFAOYSA-N methyl 5-(4-aminophenoxy)pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=CC(N)=CC=2)=C1 SPPJUUNCUKYHSS-UHFFFAOYSA-N 0.000 description 3
- GJRJCCXZJMFAIX-UHFFFAOYSA-N methyl 5-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 GJRJCCXZJMFAIX-UHFFFAOYSA-N 0.000 description 3
- KBFXCDQDPANMIQ-UHFFFAOYSA-N methyl 5-[3-amino-4-(methylamino)phenoxy]pyridine-3-carboxylate Chemical compound C1=C(N)C(NC)=CC=C1OC1=CN=CC(C(=O)OC)=C1 KBFXCDQDPANMIQ-UHFFFAOYSA-N 0.000 description 3
- ADAXEROWSFBHLQ-UHFFFAOYSA-N methyl 5-[3-nitro-4-[(2,2,2-trifluoroacetyl)amino]phenoxy]pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=C(C(NC(=O)C(F)(F)F)=CC=2)[N+]([O-])=O)=C1 ADAXEROWSFBHLQ-UHFFFAOYSA-N 0.000 description 3
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 208000025113 myeloid leukemia Diseases 0.000 description 3
- UCAOGXRUJFKQAP-UHFFFAOYSA-N n,n-dimethyl-5-nitropyridin-2-amine Chemical compound CN(C)C1=CC=C([N+]([O-])=O)C=N1 UCAOGXRUJFKQAP-UHFFFAOYSA-N 0.000 description 3
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 3
- YGGWPDLYLUHWIQ-UHFFFAOYSA-N n,n-dimethylpyridine-2-carboxamide Chemical compound CN(C)C(=O)C1=CC=CC=N1 YGGWPDLYLUHWIQ-UHFFFAOYSA-N 0.000 description 3
- VYNYHJPNFMZHAO-UHFFFAOYSA-N n-(1-methylpiperidin-4-yl)pyridine-2-carboxamide Chemical compound C1CN(C)CCC1NC(=O)C1=CC=CC=N1 VYNYHJPNFMZHAO-UHFFFAOYSA-N 0.000 description 3
- GFKOBLYDSHLGSC-UHFFFAOYSA-N n-(4-bromophenyl)-5-methoxy-1,3-benzoxazol-2-amine Chemical compound N=1C2=CC(OC)=CC=C2OC=1NC1=CC=C(Br)C=C1 GFKOBLYDSHLGSC-UHFFFAOYSA-N 0.000 description 3
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229940127084 other anti-cancer agent Drugs 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- 210000000496 pancreas Anatomy 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 230000035755 proliferation Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- GSISGLUKVBMUJB-UHFFFAOYSA-N tert-butyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylate Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)OC(C)(C)C)=C1 GSISGLUKVBMUJB-UHFFFAOYSA-N 0.000 description 3
- NWVDKZOUGBMLIH-UHFFFAOYSA-N tert-butyl 6-amino-2,3-dihydroindole-1-carboxylate Chemical compound C1=C(N)C=C2N(C(=O)OC(C)(C)C)CCC2=C1 NWVDKZOUGBMLIH-UHFFFAOYSA-N 0.000 description 3
- MQRWVUYQAKQBPO-UHFFFAOYSA-N tert-butyl 6-nitroindole-1-carboxylate Chemical compound C1=C([N+]([O-])=O)C=C2N(C(=O)OC(C)(C)C)C=CC2=C1 MQRWVUYQAKQBPO-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 210000001685 thyroid gland Anatomy 0.000 description 3
- 210000003932 urinary bladder Anatomy 0.000 description 3
- QRZNDBXLPMZTDZ-UHFFFAOYSA-N (2-fluoro-1h-pyridin-2-yl)boronic acid Chemical compound OB(O)C1(F)NC=CC=C1 QRZNDBXLPMZTDZ-UHFFFAOYSA-N 0.000 description 2
- JVHBZLBJDNVILA-UHFFFAOYSA-N (5-fluoro-2-nitrophenyl)methanamine Chemical compound NCC1=CC(F)=CC=C1[N+]([O-])=O JVHBZLBJDNVILA-UHFFFAOYSA-N 0.000 description 2
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 2
- MZZVFXMTZTVUFO-UHFFFAOYSA-N 1-chloro-4-isothiocyanatobenzene Chemical compound ClC1=CC=C(N=C=S)C=C1 MZZVFXMTZTVUFO-UHFFFAOYSA-N 0.000 description 2
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 2
- NFIUJHJMCQQYDL-UHFFFAOYSA-N 1-fluoro-4-isothiocyanatobenzene Chemical compound FC1=CC=C(N=C=S)C=C1 NFIUJHJMCQQYDL-UHFFFAOYSA-N 0.000 description 2
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 2
- PWRIWSXXZAHPKO-UHFFFAOYSA-N 1-isothiocyanato-3-phenoxybenzene Chemical compound S=C=NC1=CC=CC(OC=2C=CC=CC=2)=C1 PWRIWSXXZAHPKO-UHFFFAOYSA-N 0.000 description 2
- SEULWJSKCVACTH-UHFFFAOYSA-N 1-phenylimidazole Chemical compound C1=NC=CN1C1=CC=CC=C1 SEULWJSKCVACTH-UHFFFAOYSA-N 0.000 description 2
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 2
- FYKAQDZYDRVKMU-UHFFFAOYSA-N 2-(4-bromoanilino)-1,3-benzothiazol-5-ol Chemical compound N=1C2=CC(O)=CC=C2SC=1NC1=CC=C(Br)C=C1 FYKAQDZYDRVKMU-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- XDYFAYVQPCTFOY-UHFFFAOYSA-N 2-bromo-5-methoxy-1,3-benzothiazole Chemical compound COC1=CC=C2SC(Br)=NC2=C1 XDYFAYVQPCTFOY-UHFFFAOYSA-N 0.000 description 2
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 2
- AQRGYIVMIMMJBP-UHFFFAOYSA-N 2-fluoro-3-(4-methylpiperazin-1-yl)-6-nitroaniline Chemical compound C1CN(C)CCN1C1=CC=C([N+]([O-])=O)C(N)=C1F AQRGYIVMIMMJBP-UHFFFAOYSA-N 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- PZFRBYNHQICAJS-UHFFFAOYSA-N 2-nitro-4-(3-pyrrolidin-1-ylpropoxy)aniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1OCCCN1CCCC1 PZFRBYNHQICAJS-UHFFFAOYSA-N 0.000 description 2
- VQGHOUODWALEFC-UHFFFAOYSA-N 2-phenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CC=N1 VQGHOUODWALEFC-UHFFFAOYSA-N 0.000 description 2
- MWLBMGPQZJDFKZ-UHFFFAOYSA-N 23491-48-7 Chemical compound C1CN(C)CCN1C1=CC=C([N+]([O-])=O)C(N)=C1 MWLBMGPQZJDFKZ-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 2
- AESPGPVCKLYYMI-UHFFFAOYSA-N 3-chloro-4-(2-methyl-5-nitrophenyl)pyridine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1C1=CC=NC=C1Cl AESPGPVCKLYYMI-UHFFFAOYSA-N 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- GVIWIEQQLKABSU-UHFFFAOYSA-N 3-propylpyridine-2-carboxamide Chemical compound CCCC1=CC=CN=C1C(N)=O GVIWIEQQLKABSU-UHFFFAOYSA-N 0.000 description 2
- WMKSYPPMPLLFOE-UHFFFAOYSA-N 4-(3-bromopropoxy)-2-nitroaniline Chemical compound NC1=CC=C(OCCCBr)C=C1[N+]([O-])=O WMKSYPPMPLLFOE-UHFFFAOYSA-N 0.000 description 2
- XYEZVBVOGISFDY-UHFFFAOYSA-N 4-(4-amino-3-nitrophenoxy)-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N(C)C)=CC(OC=2C=C(C(N)=CC=2)[N+]([O-])=O)=C1 XYEZVBVOGISFDY-UHFFFAOYSA-N 0.000 description 2
- HLOVIIXYRUTEGO-UHFFFAOYSA-N 4-(4-amino-3-nitrophenoxy)pyridine-2-carbonitrile Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1OC1=CC=NC(C#N)=C1 HLOVIIXYRUTEGO-UHFFFAOYSA-N 0.000 description 2
- UWCIKBIHORXIIG-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-phenylpyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)NC=3C=CC=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 UWCIKBIHORXIIG-UHFFFAOYSA-N 0.000 description 2
- GLOUTTMOPHFCFE-UHFFFAOYSA-N 4-[2-(4-chloroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(N)=O)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 GLOUTTMOPHFCFE-UHFFFAOYSA-N 0.000 description 2
- CXNDKOCQUJVQBA-UHFFFAOYSA-N 4-[2-(4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(F)C=C1 CXNDKOCQUJVQBA-UHFFFAOYSA-N 0.000 description 2
- WDHFCUQYGLEYJD-UHFFFAOYSA-N 4-[2-(benzylamino)ethyl]aniline Chemical compound C1=CC(N)=CC=C1CCNCC1=CC=CC=C1 WDHFCUQYGLEYJD-UHFFFAOYSA-N 0.000 description 2
- NGWCQHAOTXTDEK-UHFFFAOYSA-N 4-[2-methoxy-4-(methylamino)-5-nitrophenoxy]-N-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C(=CC(NC)=C(C=2)[N+]([O-])=O)OC)=C1 NGWCQHAOTXTDEK-UHFFFAOYSA-N 0.000 description 2
- LRPNQBSXXIIABY-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)N(C)C)=C1 LRPNQBSXXIIABY-UHFFFAOYSA-N 0.000 description 2
- SQZUOULFVPXUNP-UHFFFAOYSA-N 4-[4-(methylamino)-3-[(3-propan-2-ylphenyl)carbamothioylamino]phenoxy]pyridine-2-carboxylic acid Chemical compound C1=C(NC(=S)NC=2C=C(C=CC=2)C(C)C)C(NC)=CC=C1OC1=CC=NC(C(O)=O)=C1 SQZUOULFVPXUNP-UHFFFAOYSA-N 0.000 description 2
- HFQDSIXPMQRTAX-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carbonitrile Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C#N)=C1 HFQDSIXPMQRTAX-UHFFFAOYSA-N 0.000 description 2
- TZISYNOQFCVJLC-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxylic acid Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(O)=O)=C1 TZISYNOQFCVJLC-UHFFFAOYSA-N 0.000 description 2
- JXHWAPDBDXPBEQ-UHFFFAOYSA-N 4-bromo-2-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1C(F)(F)F JXHWAPDBDXPBEQ-UHFFFAOYSA-N 0.000 description 2
- AHFINSWGYAZBOZ-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)benzaldehyde Chemical group FC(F)(F)C1=CC(Cl)=CC=C1C=O AHFINSWGYAZBOZ-UHFFFAOYSA-N 0.000 description 2
- UIYJJRGPGYNXNE-UHFFFAOYSA-N 4-chloro-n,n-dimethylpyridine-2-carboxamide Chemical compound CN(C)C(=O)C1=CC(Cl)=CC=N1 UIYJJRGPGYNXNE-UHFFFAOYSA-N 0.000 description 2
- FYBNFLRGZHGUDY-UHFFFAOYSA-N 4-chloropyridine-2-carbonyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC=N1 FYBNFLRGZHGUDY-UHFFFAOYSA-N 0.000 description 2
- UZHKPPRLUVCFKK-UHFFFAOYSA-N 5-(4-cyclopentylpiperazin-1-yl)-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC(N2CCN(CC2)C2CCCC2)=C1 UZHKPPRLUVCFKK-UHFFFAOYSA-N 0.000 description 2
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 102000009465 Growth Factor Receptors Human genes 0.000 description 2
- 108010009202 Growth Factor Receptors Proteins 0.000 description 2
- 101100380295 Mus musculus Asah1 gene Proteins 0.000 description 2
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- JTDIZSGAIYUHPX-UHFFFAOYSA-N N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 Chemical compound N=1C2=CC(OC=3C=C(C=NO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 JTDIZSGAIYUHPX-UHFFFAOYSA-N 0.000 description 2
- YMHDDXKXHPNWGR-UHFFFAOYSA-N N=C=S.FC(F)(F)C1=CC=CC=C1Cl Chemical compound N=C=S.FC(F)(F)C1=CC=CC=C1Cl YMHDDXKXHPNWGR-UHFFFAOYSA-N 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000009516 Protein Serine-Threonine Kinases Human genes 0.000 description 2
- 108010009341 Protein Serine-Threonine Kinases Proteins 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000001093 anti-cancer Effects 0.000 description 2
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000003915 cell function Effects 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 2
- 125000006317 cyclopropyl amino group Chemical group 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 201000005787 hematologic cancer Diseases 0.000 description 2
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 description 2
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- GCVAJYRVBRKKSE-UHFFFAOYSA-N methyl 4-[4-(methylamino)-3-nitrophenoxy]pyridine-3-carboxylate Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC=C1C(=O)OC GCVAJYRVBRKKSE-UHFFFAOYSA-N 0.000 description 2
- HTGMFZXESCUYDU-UHFFFAOYSA-N methyl 5-(4-nitrophenoxy)pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OC=2C=CC(=CC=2)[N+]([O-])=O)=C1 HTGMFZXESCUYDU-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000003226 mitogen Substances 0.000 description 2
- IXXDQTFSZHRHDU-UHFFFAOYSA-N n,n-dimethyl-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)N(C)C)=C1 IXXDQTFSZHRHDU-UHFFFAOYSA-N 0.000 description 2
- HIFJEDVYEQQUNE-UHFFFAOYSA-N n-(2-morpholin-4-ylethyl)pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NCCN1CCOCC1 HIFJEDVYEQQUNE-UHFFFAOYSA-N 0.000 description 2
- CQRQLYNNDNSPPP-UHFFFAOYSA-N n-(2-pyridin-4-ylethyl)pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NCCC1=CC=NC=C1 CQRQLYNNDNSPPP-UHFFFAOYSA-N 0.000 description 2
- HJIQWEBLVQWUMD-UHFFFAOYSA-N n-(4-bromophenyl)-5-methoxy-1,3-benzothiazol-2-amine Chemical compound N=1C2=CC(OC)=CC=C2SC=1NC1=CC=C(Br)C=C1 HJIQWEBLVQWUMD-UHFFFAOYSA-N 0.000 description 2
- AXMDSGGERQIART-UHFFFAOYSA-N n-(4-chlorophenyl)-5-[2-(4,5-dihydro-1h-imidazol-2-yl)pyridin-4-yl]oxy-1-methylbenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C=3NCCN=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 AXMDSGGERQIART-UHFFFAOYSA-N 0.000 description 2
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 2
- SENVHKMEPFPSEF-UHFFFAOYSA-N n-methyl-4-[1-methyl-2-(3-phenoxyanilino)benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(OC=5C=CC=CC=5)C=CC=4)N(C)C3=CC=2)=C1 SENVHKMEPFPSEF-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- 238000011275 oncology therapy Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 description 2
- 208000014081 polyp of colon Diseases 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000004262 preparative liquid chromatography Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 2
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 2
- 210000000664 rectum Anatomy 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- PUSNQHCRILPUSG-UHFFFAOYSA-N tert-butyl 4-[5-amino-2-methoxy-4-(methylamino)phenoxy]pyridine-2-carboxylate Chemical compound C1=C(N)C(NC)=CC(OC)=C1OC1=CC=NC(C(=O)OC(C)(C)C)=C1 PUSNQHCRILPUSG-UHFFFAOYSA-N 0.000 description 2
- BSCMJQUASNXFIA-UHFFFAOYSA-N tert-butyl 4-chloropyridine-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1=CC(Cl)=CC=N1 BSCMJQUASNXFIA-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- SFUIGUOONHIVLG-UHFFFAOYSA-N (2-nitrophenyl)boronic acid Chemical class OB(O)C1=CC=CC=C1[N+]([O-])=O SFUIGUOONHIVLG-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- RHMALYOXPBRJBG-WXHCCQJTSA-N (2s)-6-amino-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-6-amino-2-[[(2s)-2-[[(2s)-2-[[2-[[(2s,3r)-2-[[(2s)-2-[[2-[[2-[[(2r)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]propanoyl]amino]- Chemical compound C([C@@H](C(=O)N[C@@H]([C@H](O)C)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(N)=O)NC(=O)CNC(=O)CNC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 RHMALYOXPBRJBG-WXHCCQJTSA-N 0.000 description 1
- YUXKOWPNKJSTPQ-AXWWPMSFSA-N (2s,3r)-2-amino-3-hydroxybutanoic acid;(2s)-2-amino-3-hydroxypropanoic acid Chemical compound OC[C@H](N)C(O)=O.C[C@@H](O)[C@H](N)C(O)=O YUXKOWPNKJSTPQ-AXWWPMSFSA-N 0.000 description 1
- FRQBKPHRQRPPDJ-UHFFFAOYSA-N (3-chloropyridin-4-yl)boronic acid;hydrate Chemical compound O.OB(O)C1=CC=NC=C1Cl FRQBKPHRQRPPDJ-UHFFFAOYSA-N 0.000 description 1
- SWFHGTMLYIBPPA-UHFFFAOYSA-N (4-methoxyphenyl)-phenylmethanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 SWFHGTMLYIBPPA-UHFFFAOYSA-N 0.000 description 1
- HGZDYYSMCSCHRZ-UHFFFAOYSA-N (5-phenylpyridin-3-yl)methanamine Chemical compound NCC1=CN=CC(C=2C=CC=CC=2)=C1 HGZDYYSMCSCHRZ-UHFFFAOYSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- DBSXNGIBAKYMSS-UHFFFAOYSA-N 1,3-difluoro-2-isothiocyanatobenzene Chemical compound FC1=CC=CC(F)=C1N=C=S DBSXNGIBAKYMSS-UHFFFAOYSA-N 0.000 description 1
- ABADUMLIAZCWJD-UHFFFAOYSA-N 1,3-dioxole Chemical compound C1OC=CO1 ABADUMLIAZCWJD-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- QWEWLLNSJDTOKH-UHFFFAOYSA-N 1,3-thiazole-2-carboxamide Chemical compound NC(=O)C1=NC=CS1 QWEWLLNSJDTOKH-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XJKSTNDFUHDPQJ-UHFFFAOYSA-N 1,4-diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=C(C=2C=CC=CC=2)C=C1 XJKSTNDFUHDPQJ-UHFFFAOYSA-N 0.000 description 1
- VDTMHXBNLSMARZ-UHFFFAOYSA-N 1,5-dibromo-3-fluoro-2-isothiocyanatobenzene Chemical compound FC1=CC(Br)=CC(Br)=C1N=C=S VDTMHXBNLSMARZ-UHFFFAOYSA-N 0.000 description 1
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 1
- MMEYJNMZRUJHFR-UHFFFAOYSA-N 1-(difluoromethoxy)-2-isothiocyanatobenzene Chemical compound FC(F)OC1=CC=CC=C1N=C=S MMEYJNMZRUJHFR-UHFFFAOYSA-N 0.000 description 1
- MJUFKCAVCYZGCB-UHFFFAOYSA-N 1-(isocyanatosulfanylmethyl)-4-methylbenzene Chemical compound CC1=CC=C(CSN=C=O)C=C1 MJUFKCAVCYZGCB-UHFFFAOYSA-N 0.000 description 1
- CHZFXZDXTFGTCA-UHFFFAOYSA-N 1-[2-(furan-3-yl)phenyl]piperazine Chemical compound C1CNCCN1C1=CC=CC=C1C1=COC=C1 CHZFXZDXTFGTCA-UHFFFAOYSA-N 0.000 description 1
- ZXZYSSSRXLSVBU-UHFFFAOYSA-N 1-[3-(furan-2-yl)pyridin-4-yl]piperazine Chemical compound C1CNCCN1C1=CC=NC=C1C1=CC=CO1 ZXZYSSSRXLSVBU-UHFFFAOYSA-N 0.000 description 1
- QCYZMMVPXNWSJK-UHFFFAOYSA-N 1-[4-(2-phenylethynyl)phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C#CC1=CC=CC=C1 QCYZMMVPXNWSJK-UHFFFAOYSA-N 0.000 description 1
- KKKDZZRICRFGSD-UHFFFAOYSA-N 1-benzylimidazole Chemical compound C1=CN=CN1CC1=CC=CC=C1 KKKDZZRICRFGSD-UHFFFAOYSA-N 0.000 description 1
- RXWYFLRAEYPAIV-UHFFFAOYSA-N 1-bromo-4-isothiocyanato-2-methylbenzene Chemical compound CC1=CC(N=C=S)=CC=C1Br RXWYFLRAEYPAIV-UHFFFAOYSA-N 0.000 description 1
- JZDZRFNMDCBTNS-UHFFFAOYSA-N 1-butyl-4-phenylbenzene Chemical compound C1=CC(CCCC)=CC=C1C1=CC=CC=C1 JZDZRFNMDCBTNS-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical class CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- VUQPJRPDRDVQMN-UHFFFAOYSA-N 1-chlorooctadecane Chemical class CCCCCCCCCCCCCCCCCCCl VUQPJRPDRDVQMN-UHFFFAOYSA-N 0.000 description 1
- YWCJWMWIEHZSOZ-UHFFFAOYSA-N 1-ethoxy-4-(4-methoxyphenyl)benzene Chemical compound C1=CC(OCC)=CC=C1C1=CC=C(OC)C=C1 YWCJWMWIEHZSOZ-UHFFFAOYSA-N 0.000 description 1
- FRMFJQIVPNSSPX-UHFFFAOYSA-N 1-ethyl-3-isothiocyanatobenzene Chemical compound CCC1=CC=CC(N=C=S)=C1 FRMFJQIVPNSSPX-UHFFFAOYSA-N 0.000 description 1
- XXLWCGRHJFEMQH-UHFFFAOYSA-N 1-ethyl-4-isothiocyanatobenzene Chemical compound CCC1=CC=C(N=C=S)C=C1 XXLWCGRHJFEMQH-UHFFFAOYSA-N 0.000 description 1
- SRQOBNUBCLPPPH-UHFFFAOYSA-N 1-ethyl-4-phenylbenzene Chemical compound C1=CC(CC)=CC=C1C1=CC=CC=C1 SRQOBNUBCLPPPH-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- ODOTYLQYSDVPMA-UHFFFAOYSA-N 1-iodo-2-isothiocyanatobenzene Chemical compound IC1=CC=CC=C1N=C=S ODOTYLQYSDVPMA-UHFFFAOYSA-N 0.000 description 1
- LKCSXVAACHUTGC-UHFFFAOYSA-N 1-iodo-3-isothiocyanatobenzene Chemical compound IC1=CC=CC(N=C=S)=C1 LKCSXVAACHUTGC-UHFFFAOYSA-N 0.000 description 1
- HOHSBFCSOARUBF-UHFFFAOYSA-N 1-isothiocyanato-2,4-dimethylbenzene Chemical compound CC1=CC=C(N=C=S)C(C)=C1 HOHSBFCSOARUBF-UHFFFAOYSA-N 0.000 description 1
- JYKYYPPZLPVIBY-UHFFFAOYSA-N 1-isothiocyanato-2-methylbenzene Chemical compound CC1=CC=CC=C1N=C=S JYKYYPPZLPVIBY-UHFFFAOYSA-N 0.000 description 1
- LNIPHWGHHXXSOX-UHFFFAOYSA-N 1-isothiocyanato-2-phenylsulfanylbenzene Chemical compound S=C=NC1=CC=CC=C1SC1=CC=CC=C1 LNIPHWGHHXXSOX-UHFFFAOYSA-N 0.000 description 1
- OFOKALISZFFLRJ-UHFFFAOYSA-N 1-methyl-4-[(5-phenylthiophen-2-yl)methyl]piperazine Chemical compound C1CN(C)CCN1CC1=CC=C(C=2C=CC=CC=2)S1 OFOKALISZFFLRJ-UHFFFAOYSA-N 0.000 description 1
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 1
- LXINKRZIJMGCDO-UHFFFAOYSA-N 1-methylsulfanyl-4-phenylbenzene Chemical compound C1=CC(SC)=CC=C1C1=CC=CC=C1 LXINKRZIJMGCDO-UHFFFAOYSA-N 0.000 description 1
- GPOYJVWXGJBMOK-UHFFFAOYSA-N 1-phenoxy-4-phenylbenzene Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1OC1=CC=CC=C1 GPOYJVWXGJBMOK-UHFFFAOYSA-N 0.000 description 1
- OUMKBAHMPRLISR-UHFFFAOYSA-N 1-phenyl-4-(trifluoromethyl)benzene Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=CC=CC=C1 OUMKBAHMPRLISR-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- DIPGYZSCGXBTEU-UHFFFAOYSA-N 2,3-difluoro-6-nitroaniline Chemical compound NC1=C(F)C(F)=CC=C1[N+]([O-])=O DIPGYZSCGXBTEU-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- KBXRNBDAFWDLKI-UHFFFAOYSA-N 2-(1h-imidazol-2-yl)pyrazine Chemical compound C1=CNC(C=2N=CC=NC=2)=N1 KBXRNBDAFWDLKI-UHFFFAOYSA-N 0.000 description 1
- XMFNKZPINKPURY-UHFFFAOYSA-N 2-(2-phenylethynyl)pyrazine Chemical compound C1=CC=CC=C1C#CC1=CN=CC=N1 XMFNKZPINKPURY-UHFFFAOYSA-N 0.000 description 1
- JDMNBMWRIUAWFW-UHFFFAOYSA-N 2-(3-fluoro-4-methoxy-5-prop-2-enylphenyl)furan Chemical compound C1=C(CC=C)C(OC)=C(F)C=C1C1=CC=CO1 JDMNBMWRIUAWFW-UHFFFAOYSA-N 0.000 description 1
- JLSBMXUYHUFHTH-UHFFFAOYSA-N 2-(3-methoxyphenyl)thiophene Chemical compound COC1=CC=CC(C=2SC=CC=2)=C1 JLSBMXUYHUFHTH-UHFFFAOYSA-N 0.000 description 1
- FREKGJOVUQPIKK-UHFFFAOYSA-N 2-(3-nitrophenyl)thiophene Chemical compound [O-][N+](=O)C1=CC=CC(C=2SC=CC=2)=C1 FREKGJOVUQPIKK-UHFFFAOYSA-N 0.000 description 1
- OQMCVCHIWJWEHF-UHFFFAOYSA-N 2-(3-phenylphenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=CC(C=2C=CC=CC=2)=C1 OQMCVCHIWJWEHF-UHFFFAOYSA-N 0.000 description 1
- DAIRPGULXRTFPX-UHFFFAOYSA-N 2-(4-ethylphenyl)thiophene Chemical compound C1=CC(CC)=CC=C1C1=CC=CS1 DAIRPGULXRTFPX-UHFFFAOYSA-N 0.000 description 1
- TWKDIVDAGCWHES-UHFFFAOYSA-N 2-(4-methoxyphenyl)thiophene Chemical compound C1=CC(OC)=CC=C1C1=CC=CS1 TWKDIVDAGCWHES-UHFFFAOYSA-N 0.000 description 1
- AFLBPIABCXIKBD-UHFFFAOYSA-N 2-(4-methylsulfanylphenyl)thiophene Chemical compound C1=CC(SC)=CC=C1C1=CC=CS1 AFLBPIABCXIKBD-UHFFFAOYSA-N 0.000 description 1
- JJLKXBIUMBGNNY-UHFFFAOYSA-N 2-(4-phenylphenyl)acetamide Chemical compound C1=CC(CC(=O)N)=CC=C1C1=CC=CC=C1 JJLKXBIUMBGNNY-UHFFFAOYSA-N 0.000 description 1
- PDVGSEUBMMVDCF-UHFFFAOYSA-N 2-(5-phenylpyridin-3-yl)acetamide Chemical compound NC(=O)CC1=CN=CC(C=2C=CC=CC=2)=C1 PDVGSEUBMMVDCF-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- LMXAPFWFOKHBDS-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenyl]furan Chemical compound FC(F)(F)C1=CC=CC(C=2OC=CC=2)=C1 LMXAPFWFOKHBDS-UHFFFAOYSA-N 0.000 description 1
- PIRSOJCCUACUKP-UHFFFAOYSA-N 2-[4-(2-phenylethynyl)phenyl]-1h-pyrrole Chemical compound C1=CNC(C=2C=CC(=CC=2)C#CC=2C=CC=CC=2)=C1 PIRSOJCCUACUKP-UHFFFAOYSA-N 0.000 description 1
- XFZFJQHXWJIBQV-UHFFFAOYSA-N 2-bromo-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1Br XFZFJQHXWJIBQV-UHFFFAOYSA-N 0.000 description 1
- NEURYOYRKPFLKH-UHFFFAOYSA-N 2-chloro-1-isocyanato-4-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC=C(N=C=O)C(Cl)=C1 NEURYOYRKPFLKH-UHFFFAOYSA-N 0.000 description 1
- SLBYCCHSURAIIK-UHFFFAOYSA-N 2-chloro-1-methoxy-4-phenylbenzene Chemical compound C1=C(Cl)C(OC)=CC=C1C1=CC=CC=C1 SLBYCCHSURAIIK-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- HZGOUCYIYIFQHX-UHFFFAOYSA-N 2-isothiocyanato-1,3-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1N=C=S HZGOUCYIYIFQHX-UHFFFAOYSA-N 0.000 description 1
- AKUGVKYPODJPBI-UHFFFAOYSA-N 2-isothiocyanato-1-(2-methoxyphenoxy)-4-(trifluoromethyl)benzene Chemical compound COC1=CC=CC=C1OC1=CC=C(C(F)(F)F)C=C1N=C=S AKUGVKYPODJPBI-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- IRTLROCMFSDSNF-UHFFFAOYSA-N 2-phenyl-1h-pyrrole Chemical compound C1=CNC(C=2C=CC=CC=2)=C1 IRTLROCMFSDSNF-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical class BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- PJRGDKFLFAYRBV-UHFFFAOYSA-N 2-phenylthiophene Chemical compound C1=CSC(C=2C=CC=CC=2)=C1 PJRGDKFLFAYRBV-UHFFFAOYSA-N 0.000 description 1
- OFMALDSHFYWVKM-UHFFFAOYSA-N 2-pyrrolidin-2-ylacetamide Chemical compound NC(=O)CC1CCCN1 OFMALDSHFYWVKM-UHFFFAOYSA-N 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- ZQZJULZPQACTES-UHFFFAOYSA-N 3-(1h-imidazol-2-yl)pyridine Chemical compound C1=CNC(C=2C=NC=CC=2)=N1 ZQZJULZPQACTES-UHFFFAOYSA-N 0.000 description 1
- COYBNLNVTKDNIY-UHFFFAOYSA-N 3-(2,4-dichlorophenyl)-4-methyl-1h-pyrrole Chemical compound CC1=CNC=C1C1=CC=C(Cl)C=C1Cl COYBNLNVTKDNIY-UHFFFAOYSA-N 0.000 description 1
- ZLYFXWKSLUXFMU-UHFFFAOYSA-N 3-(2-phenylethynyl)pyridine Chemical compound C1=CC=CC=C1C#CC1=CC=CN=C1 ZLYFXWKSLUXFMU-UHFFFAOYSA-N 0.000 description 1
- SADHVOSOZBAAGL-UHFFFAOYSA-N 3-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC(OC(F)(F)F)=C1 SADHVOSOZBAAGL-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- QUKFBBRMZXGYBK-UHFFFAOYSA-N 3-ethylpyridine-2-carboxamide Chemical compound CCC1=CC=CN=C1C(N)=O QUKFBBRMZXGYBK-UHFFFAOYSA-N 0.000 description 1
- KOZRFVAOQYOQPI-UHFFFAOYSA-N 3-fluoro-4-(4-methylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1CN(C)CCN1C1=CC=C(N)C(N)=C1F KOZRFVAOQYOQPI-UHFFFAOYSA-N 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- FFCSRWGYGMRBGD-UHFFFAOYSA-N 3-iodoaniline Chemical compound NC1=CC=CC(I)=C1 FFCSRWGYGMRBGD-UHFFFAOYSA-N 0.000 description 1
- PJRBPKOOGLKPFB-UHFFFAOYSA-N 3-isothiocyanatobenzoic acid Chemical compound OC(=O)C1=CC=CC(N=C=S)=C1 PJRBPKOOGLKPFB-UHFFFAOYSA-N 0.000 description 1
- UCSYVYFGMFODMY-UHFFFAOYSA-N 3-phenoxyaniline Chemical compound NC1=CC=CC(OC=2C=CC=CC=2)=C1 UCSYVYFGMFODMY-UHFFFAOYSA-N 0.000 description 1
- MUNOBADFTHUUFG-UHFFFAOYSA-N 3-phenylaniline Chemical compound NC1=CC=CC(C=2C=CC=CC=2)=C1 MUNOBADFTHUUFG-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- KCSYEGTWMVXUSB-UHFFFAOYSA-N 3-piperidin-3-ylpyridine-2-carboxamide Chemical compound N1CC(CCC1)C=1C(=NC=CC=1)C(=O)N KCSYEGTWMVXUSB-UHFFFAOYSA-N 0.000 description 1
- XCCNRBCNYGWTQX-UHFFFAOYSA-N 3-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(N)=C1 XCCNRBCNYGWTQX-UHFFFAOYSA-N 0.000 description 1
- DPKTVUKEPNBABS-UHFFFAOYSA-N 3-tert-butylaniline Chemical compound CC(C)(C)C1=CC=CC(N)=C1 DPKTVUKEPNBABS-UHFFFAOYSA-N 0.000 description 1
- FVJRPDPWARJCQM-UHFFFAOYSA-N 4-(3-pyrrolidin-1-ylpropoxy)benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1OCCCN1CCCC1 FVJRPDPWARJCQM-UHFFFAOYSA-N 0.000 description 1
- GHEGMJFASKYZCV-UHFFFAOYSA-N 4-(4-cyclopentylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1N1CCN(C2CCCC2)CC1 GHEGMJFASKYZCV-UHFFFAOYSA-N 0.000 description 1
- RTDKAEOVZXYWJW-UHFFFAOYSA-N 4-(4-methylpiperazin-1-yl)benzene-1,2-diamine Chemical compound C1CN(C)CCN1C1=CC=C(N)C(N)=C1 RTDKAEOVZXYWJW-UHFFFAOYSA-N 0.000 description 1
- JFTATDWGOBACPO-UHFFFAOYSA-N 4-(4-phenylbuta-1,3-diynyl)aniline Chemical compound C1=CC(N)=CC=C1C#CC#CC1=CC=CC=C1 JFTATDWGOBACPO-UHFFFAOYSA-N 0.000 description 1
- QOWSWEBLNVACCL-UHFFFAOYSA-N 4-Bromophenyl acetate Chemical compound OC(=O)CC1=CC=C(Br)C=C1 QOWSWEBLNVACCL-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical class CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- VJGPGLWXXGATGX-UHFFFAOYSA-N 4-[2-(1,3-benzodioxol-5-ylamino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C5OCOC5=CC=4)N(C)C3=CC=2)=C1 VJGPGLWXXGATGX-UHFFFAOYSA-N 0.000 description 1
- CFDHDHWVAPXQGV-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1h-indol-6-ylamino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C5NCCC5=CC=4)N(C)C3=CC=2)=C1 CFDHDHWVAPXQGV-UHFFFAOYSA-N 0.000 description 1
- UQEUTDUQZTXHOP-UHFFFAOYSA-N 4-[2-(2,6-difluoroanilino)-1-methylbenzimidazol-5-yl]oxy-n,n-dimethylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)N(C)C)=CC(OC=2C=C3N=C(NC=4C(=CC=CC=4F)F)N(C)C3=CC=2)=C1 UQEUTDUQZTXHOP-UHFFFAOYSA-N 0.000 description 1
- SSCFJZWYAZORJU-UHFFFAOYSA-N 4-[2-(3-ethynylanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=C(C=CC=4)C#C)N(C)C3=CC=2)=C1 SSCFJZWYAZORJU-UHFFFAOYSA-N 0.000 description 1
- DULLTCJMKLEKCC-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-(3-pyrrolidin-1-ylpropyl)pyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)NCCCN3CCCC3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 DULLTCJMKLEKCC-UHFFFAOYSA-N 0.000 description 1
- XLZSBGWFJTXBDS-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 XLZSBGWFJTXBDS-UHFFFAOYSA-N 0.000 description 1
- NOAPEINCMDCENK-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(N)=O)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 NOAPEINCMDCENK-UHFFFAOYSA-N 0.000 description 1
- GQMVTZBVAHIADQ-UHFFFAOYSA-N 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(O)=O)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 GQMVTZBVAHIADQ-UHFFFAOYSA-N 0.000 description 1
- GFFZFWAUXAFCSY-UHFFFAOYSA-N 4-[2-(4-nitrophenyl)ethyl]morpholine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCN1CCOCC1 GFFZFWAUXAFCSY-UHFFFAOYSA-N 0.000 description 1
- LGXPXEHAKCAUEV-UHFFFAOYSA-N 4-[2-[(4-bromophenyl)methyl]-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(CC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 LGXPXEHAKCAUEV-UHFFFAOYSA-N 0.000 description 1
- BOIUWJGRDPMYPW-UHFFFAOYSA-N 4-[2-[4-(dimethylamino)anilino]-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylic acid Chemical compound CN(C1=CC=C(C=C1)NC1=NC2=C(N1C)C=CC(=C2)OC1=CC(=NC=C1)C(=O)O)C BOIUWJGRDPMYPW-UHFFFAOYSA-N 0.000 description 1
- XLBXCORNNCOCMC-UHFFFAOYSA-N 4-[2-isothiocyanato-4-(trifluoromethyl)phenoxy]benzonitrile Chemical compound S=C=NC1=CC(C(F)(F)F)=CC=C1OC1=CC=C(C#N)C=C1 XLBXCORNNCOCMC-UHFFFAOYSA-N 0.000 description 1
- OHCCWFYFBLWJTD-UHFFFAOYSA-N 4-[3-amino-4-(methylamino)phenoxy]-n-(2-hydroxyethyl)pyridine-2-carboxamide Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCO)=C1 OHCCWFYFBLWJTD-UHFFFAOYSA-N 0.000 description 1
- WTWNAWPQCMHEGE-UHFFFAOYSA-N 4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carbaldehyde Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=O)=C1 WTWNAWPQCMHEGE-UHFFFAOYSA-N 0.000 description 1
- RHRHKLGNIJNJDW-UHFFFAOYSA-N 4-[[2-(4-bromoanilino)-1,3-benzothiazol-5-yl]oxy]pyridine-2-carboxamide Chemical compound C1=NC(C(=O)N)=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)SC3=CC=2)=C1 RHRHKLGNIJNJDW-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 1
- PTPTZLXZHPPVKG-UHFFFAOYSA-N 4-bromo-2-fluoropyridine Chemical compound FC1=CC(Br)=CC=N1 PTPTZLXZHPPVKG-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- DYEZRXLVZMZHQT-UHFFFAOYSA-N 4-chloropyridine-2-carbonitrile Chemical compound ClC1=CC=NC(C#N)=C1 DYEZRXLVZMZHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- XGYLIUFAVVEPJY-UHFFFAOYSA-N 4-isothiocyanato-3-(trifluoromethoxy)benzonitrile Chemical compound FC(F)(F)OC1=CC(C#N)=CC=C1N=C=S XGYLIUFAVVEPJY-UHFFFAOYSA-N 0.000 description 1
- RBEFRYQKJYMLCC-UHFFFAOYSA-N 4-isothiocyanatobenzoic acid Chemical compound OC(=O)C1=CC=C(N=C=S)C=C1 RBEFRYQKJYMLCC-UHFFFAOYSA-N 0.000 description 1
- YBUGOACXDPDUIR-UHFFFAOYSA-N 4-methoxy-2-nitrophenol Chemical compound COC1=CC=C(O)C([N+]([O-])=O)=C1 YBUGOACXDPDUIR-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- YQYGPGKTNQNXMH-UHFFFAOYSA-N 4-nitroacetophenone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C=C1 YQYGPGKTNQNXMH-UHFFFAOYSA-N 0.000 description 1
- AWPNFXRMNNPKDW-UHFFFAOYSA-N 4-phenylthiadiazole Chemical compound S1N=NC(C=2C=CC=CC=2)=C1 AWPNFXRMNNPKDW-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- YGRGPJVLDRHCIN-UHFFFAOYSA-N 5-(2-phenylethynyl)-1h-pyrimidine-2,4-dione Chemical compound O=C1NC(=O)NC=C1C#CC1=CC=CC=C1 YGRGPJVLDRHCIN-UHFFFAOYSA-N 0.000 description 1
- YOPXKEXWJYKOAZ-UHFFFAOYSA-N 5-(2-phenylethynyl)pyrimidin-2-amine Chemical group C1=NC(N)=NC=C1C#CC1=CC=CC=C1 YOPXKEXWJYKOAZ-UHFFFAOYSA-N 0.000 description 1
- XKTCKCXYGXXAHX-UHFFFAOYSA-N 5-[2-(1h-benzimidazol-2-yl)pyridin-4-yl]oxy-n-(4-fluorophenyl)-1-methylbenzimidazol-2-amine Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C=3NC4=CC=CC=C4N=3)=CC=C2N(C)C=1NC1=CC=C(F)C=C1 XKTCKCXYGXXAHX-UHFFFAOYSA-N 0.000 description 1
- NNZZKVDXEJZNDP-UHFFFAOYSA-N 5-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxy-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CN=CC(OC=2C=C3N=C(NC=4C=CC(Br)=CC=4)N(C)C3=CC=2)=C1 NNZZKVDXEJZNDP-UHFFFAOYSA-N 0.000 description 1
- HNTOKMBEXFFLBR-UHFFFAOYSA-N 5-[2-(methoxyiminomethyl)pyridin-4-yl]oxy-1-methyl-n-[4-(trifluoromethylsulfanyl)phenyl]benzimidazol-2-amine Chemical compound C1=NC(C=NOC)=CC(OC=2C=C3N=C(NC=4C=CC(SC(F)(F)F)=CC=4)N(C)C3=CC=2)=C1 HNTOKMBEXFFLBR-UHFFFAOYSA-N 0.000 description 1
- IHYBUYYBVCVGOS-UHFFFAOYSA-N 5-isothiocyanato-n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=C(N=C=S)C=N1 IHYBUYYBVCVGOS-UHFFFAOYSA-N 0.000 description 1
- JDPITNFDYXOKRM-UHFFFAOYSA-N 5-methoxy-3h-1,3-benzothiazole-2-thione Chemical compound COC1=CC=C2SC(=S)NC2=C1 JDPITNFDYXOKRM-UHFFFAOYSA-N 0.000 description 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical compound N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- PSWCIARYGITEOY-UHFFFAOYSA-N 6-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2C=CNC2=C1 PSWCIARYGITEOY-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 206010004950 Birth mark Diseases 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- WVWXZXYGNRBMJA-UHFFFAOYSA-N C1=C(N)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 WVWXZXYGNRBMJA-UHFFFAOYSA-N 0.000 description 1
- FEOLZZVRQKERDR-UHFFFAOYSA-N C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C=NO)=C1 FEOLZZVRQKERDR-UHFFFAOYSA-N 0.000 description 1
- CEZBXSWVAXOTAZ-UHFFFAOYSA-N CC(=O)Nc1ccc(cc1)C#CC#Cc1ccccc1 Chemical compound CC(=O)Nc1ccc(cc1)C#CC#Cc1ccccc1 CEZBXSWVAXOTAZ-UHFFFAOYSA-N 0.000 description 1
- XXLSVIPCYWBIJJ-UHFFFAOYSA-N CC(C(C(N)=O)=NC=C1)=C1OC(C=C1)=CC2=C1N=C(NC(C=C1)=C(C(F)(F)F)C=C1Br)N2 Chemical compound CC(C(C(N)=O)=NC=C1)=C1OC(C=C1)=CC2=C1N=C(NC(C=C1)=C(C(F)(F)F)C=C1Br)N2 XXLSVIPCYWBIJJ-UHFFFAOYSA-N 0.000 description 1
- RWKFBCZLWPTJAF-UHFFFAOYSA-N CC(C(C(N)=O)=NC=C1)=C1OC(C=C1)=CC2=C1NC(NC(C=C(C(OC)=C1)Cl)=C1OC)=N2 Chemical compound CC(C(C(N)=O)=NC=C1)=C1OC(C=C1)=CC2=C1NC(NC(C=C(C(OC)=C1)Cl)=C1OC)=N2 RWKFBCZLWPTJAF-UHFFFAOYSA-N 0.000 description 1
- MMGVNIGWXBJUOP-UHFFFAOYSA-N CC(C)C1=CC(=CC=C1)NC2=NC3=C(N2C)C=CC(=C3)OC4=CC(=NC=C4)C(=O)NCCN5CCCC5 Chemical compound CC(C)C1=CC(=CC=C1)NC2=NC3=C(N2C)C=CC(=C3)OC4=CC(=NC=C4)C(=O)NCCN5CCCC5 MMGVNIGWXBJUOP-UHFFFAOYSA-N 0.000 description 1
- IDENMDDRRIUJHI-UHFFFAOYSA-N CC1=C(C=CN=C1C(=O)N)OC2=CC3=C(C=C2)N=C(N3)NC4=CC(=C(C=C4)Cl)C(F)(F)F Chemical compound CC1=C(C=CN=C1C(=O)N)OC2=CC3=C(C=C2)N=C(N3)NC4=CC(=C(C=C4)Cl)C(F)(F)F IDENMDDRRIUJHI-UHFFFAOYSA-N 0.000 description 1
- PQOKVJUAWZHMRM-UHFFFAOYSA-N CC1=C(C=CN=C1C(=O)N)OC2=CC3=C(C=C2)N=C(N3)NC4=CC5=C(C=C4)OCO5 Chemical compound CC1=C(C=CN=C1C(=O)N)OC2=CC3=C(C=C2)N=C(N3)NC4=CC5=C(C=C4)OCO5 PQOKVJUAWZHMRM-UHFFFAOYSA-N 0.000 description 1
- KTYHDKLGFGIISC-UHFFFAOYSA-N CCN1CCN(C(C1)C)C2=CC=CC=C2[N+](=O)[O-] Chemical compound CCN1CCN(C(C1)C)C2=CC=CC=C2[N+](=O)[O-] KTYHDKLGFGIISC-UHFFFAOYSA-N 0.000 description 1
- 101100324465 Caenorhabditis elegans arr-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 102000053642 Catalytic RNA Human genes 0.000 description 1
- 108090000994 Catalytic RNA Proteins 0.000 description 1
- UWNXGZKSIKQKAH-UHFFFAOYSA-N Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 Chemical compound Cc1cc(CNC(CO)C(O)=O)c(OCc2cccc(c2)C#N)cc1OCc1cccc(c1C)-c1ccc2OCCOc2c1 UWNXGZKSIKQKAH-UHFFFAOYSA-N 0.000 description 1
- 229940123587 Cell cycle inhibitor Drugs 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 101100203200 Danio rerio shha gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 101100012466 Drosophila melanogaster Sras gene Proteins 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000014150 Interferons Human genes 0.000 description 1
- 108010050904 Interferons Proteins 0.000 description 1
- 102000015696 Interleukins Human genes 0.000 description 1
- 108010063738 Interleukins Proteins 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102100030817 Liver carboxylesterase 1 Human genes 0.000 description 1
- 101150040099 MAP2K2 gene Proteins 0.000 description 1
- 229940124647 MEK inhibitor Drugs 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZRVUJXDFFKFLMG-UHFFFAOYSA-N Meloxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=NC=C(C)S1 ZRVUJXDFFKFLMG-UHFFFAOYSA-N 0.000 description 1
- UUIQMZJEGPQKFD-UHFFFAOYSA-N Methyl butyrate Chemical compound CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 description 1
- 229910017976 MgO 4 Inorganic materials 0.000 description 1
- NFCGAPURPAJRHQ-UHFFFAOYSA-N N'-pyridin-4-ylacetohydrazide Chemical compound C(C)(=O)NNC1=CC=NC=C1 NFCGAPURPAJRHQ-UHFFFAOYSA-N 0.000 description 1
- CHGAEXPUMIOMEZ-UHFFFAOYSA-N N-[2-(2-oxoimidazolidin-1-yl)ethyl]pyridine-2-carboxamide Chemical compound N1=C(C=CC=C1)C(=O)NCCN1C(NCC1)=O CHGAEXPUMIOMEZ-UHFFFAOYSA-N 0.000 description 1
- BXLLLGWXSNSBJZ-UHFFFAOYSA-N N-[2-(benzylsulfonylamino)ethyl]pyridine-2-carboxamide Chemical compound N1=C(C=CC=C1)C(=O)NCCNS(=O)(=O)CC1=CC=CC=C1 BXLLLGWXSNSBJZ-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical compound ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 1
- NYHHYBRRMNYBIC-UHFFFAOYSA-N N=C=S.CC(C)(C)C1=CC=CC=C1 Chemical compound N=C=S.CC(C)(C)C1=CC=CC=C1 NYHHYBRRMNYBIC-UHFFFAOYSA-N 0.000 description 1
- VTMBYMKFSXCTRN-UHFFFAOYSA-N N=C=S.CC(C)C1=CC=CC=C1 Chemical compound N=C=S.CC(C)C1=CC=CC=C1 VTMBYMKFSXCTRN-UHFFFAOYSA-N 0.000 description 1
- CDKMTDNTFCFBJJ-UHFFFAOYSA-N N=C=S.CCC1=CC=CC=C1 Chemical compound N=C=S.CCC1=CC=CC=C1 CDKMTDNTFCFBJJ-UHFFFAOYSA-N 0.000 description 1
- HOWKHVFVHXZDBS-UHFFFAOYSA-N N=C=S.CN(C)C1=CC=CC=C1 Chemical compound N=C=S.CN(C)C1=CC=CC=C1 HOWKHVFVHXZDBS-UHFFFAOYSA-N 0.000 description 1
- KDXKGVZVDJVWLO-UHFFFAOYSA-N N=C=S.FC1=CC=C(C(F)(F)F)C=C1 Chemical compound N=C=S.FC1=CC=C(C(F)(F)F)C=C1 KDXKGVZVDJVWLO-UHFFFAOYSA-N 0.000 description 1
- YQDZSJWKIYZYIH-UHFFFAOYSA-N N=C=S.FC1=CC=CC=C1Br Chemical compound N=C=S.FC1=CC=CC=C1Br YQDZSJWKIYZYIH-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- JDDYCQICAHDSAP-UHFFFAOYSA-N OBO.FC1=CC=CC=N1 Chemical compound OBO.FC1=CC=CC=N1 JDDYCQICAHDSAP-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 108091005682 Receptor kinases Proteins 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- 101710169844 Sesquipedalian-1 Proteins 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- 241000120020 Tela Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- WQTNBJRMWYYGQB-UHFFFAOYSA-N [4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methanol Chemical compound N=1C2=CC(OC=3C=C(CO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 WQTNBJRMWYYGQB-UHFFFAOYSA-N 0.000 description 1
- AVOVJYSYRUEVIA-UHFFFAOYSA-N [4-[2-(4-chloroanilino)-1-methylbenzimidazol-5-yl]oxypyridin-2-yl]methanol Chemical compound N=1C2=CC(OC=3C=C(CO)N=CC=3)=CC=C2N(C)C=1NC1=CC=C(Cl)C=C1 AVOVJYSYRUEVIA-UHFFFAOYSA-N 0.000 description 1
- XQAZZUSVBUUVDS-UHFFFAOYSA-N [4-[3-amino-4-(methylamino)phenoxy]pyridin-2-yl]methanol Chemical compound C1=C(N)C(NC)=CC=C1OC1=CC=NC(CO)=C1 XQAZZUSVBUUVDS-UHFFFAOYSA-N 0.000 description 1
- FQRKHFUJNUYBPI-UHFFFAOYSA-N [4-[4-(methylamino)-3-nitrophenoxy]pyridin-2-yl]methanol Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(CO)=C1 FQRKHFUJNUYBPI-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004945 acylaminoalkyl group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000003044 adaptive effect Effects 0.000 description 1
- 108091005764 adaptor proteins Proteins 0.000 description 1
- 102000035181 adaptor proteins Human genes 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005277 alkyl imino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 229940121369 angiogenesis inhibitor Drugs 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000000051 antiandrogen Substances 0.000 description 1
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005125 aryl alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000005126 aryl alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 125000005100 aryl amino carbonyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 125000004567 azetidin-3-yl group Chemical group N1CC(C1)* 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 229960000997 bicalutamide Drugs 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- JRXXLCKWQFKACW-UHFFFAOYSA-N biphenylacetylene Chemical compound C1=CC=CC=C1C#CC1=CC=CC=C1 JRXXLCKWQFKACW-UHFFFAOYSA-N 0.000 description 1
- XGIUDIMNNMKGDE-UHFFFAOYSA-N bis(trimethylsilyl)azanide Chemical compound C[Si](C)(C)[N-][Si](C)(C)C XGIUDIMNNMKGDE-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 230000005907 cancer growth Effects 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 230000025084 cell cycle arrest Effects 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229940106189 ceramide Drugs 0.000 description 1
- 150000001783 ceramides Chemical class 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- DMBHXSBFGMSJOM-UHFFFAOYSA-N chlorobenzene;isothiocyanic acid Chemical compound N=C=S.ClC1=CC=CC=C1 DMBHXSBFGMSJOM-UHFFFAOYSA-N 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000011260 co-administration Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000000750 constant-initial-state spectroscopy Methods 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- BALGDZWGNCXXES-UHFFFAOYSA-N cyclopentane;propanoic acid Chemical compound CCC(O)=O.C1CCCC1 BALGDZWGNCXXES-UHFFFAOYSA-N 0.000 description 1
- 125000006312 cyclopentyl amino group Chemical group [H]N(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001086 cytosolic effect Effects 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 230000002074 deregulated effect Effects 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- WKSZAWDBMJQRKJ-UHFFFAOYSA-N di(piperazin-1-yl)methanone Chemical compound C1CNCCN1C(=O)N1CCNCC1 WKSZAWDBMJQRKJ-UHFFFAOYSA-N 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- GAFRWLVTHPVQGK-UHFFFAOYSA-N dipentyl sulfate Chemical class CCCCCOS(=O)(=O)OCCCCC GAFRWLVTHPVQGK-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- DLAHAXOYRFRPFQ-UHFFFAOYSA-N dodecyl benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC=CC=C1 DLAHAXOYRFRPFQ-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- UFNRBVBZNVLGRM-UHFFFAOYSA-N ethyl n-[1-methyl-5-[2-(methylcarbamoyl)pyridin-4-yl]oxybenzimidazol-2-yl]carbamate Chemical compound C=1C=C2N(C)C(NC(=O)OCC)=NC2=CC=1OC1=CC=NC(C(=O)NC)=C1 UFNRBVBZNVLGRM-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- DBEPLOCGEIEOCV-WSBQPABSSA-N finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 1
- 229960004039 finasteride Drugs 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 1
- 229960002074 flutamide Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000003394 haemopoietic effect Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004992 haloalkylamino group Chemical group 0.000 description 1
- 150000005748 halopyridines Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940022353 herceptin Drugs 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000018819 hormone-resistant breast carcinoma Diseases 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 239000000367 immunologic factor Substances 0.000 description 1
- 239000002955 immunomodulating agent Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229940047124 interferons Drugs 0.000 description 1
- 229940047122 interleukins Drugs 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000002555 ionophore Substances 0.000 description 1
- 230000000236 ionophoric effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- ZRBFSULGNPXCMK-UHFFFAOYSA-N isothiocyanic acid;toluene Chemical compound N=C=S.CC1=CC=CC=C1 ZRBFSULGNPXCMK-UHFFFAOYSA-N 0.000 description 1
- 238000003674 kinase activity assay Methods 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 229960001929 meloxicam Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000002829 mitogen activated protein kinase inhibitor Substances 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VBKFWWCJLMRGEK-UHFFFAOYSA-N n-(1,3-thiazol-2-yl)pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NC1=NC=CS1 VBKFWWCJLMRGEK-UHFFFAOYSA-N 0.000 description 1
- ZSMTUVRQQASGAC-UHFFFAOYSA-N n-(2,2,2-trifluoroethyl)pyridine-2-carboxamide Chemical compound FC(F)(F)CNC(=O)C1=CC=CC=N1 ZSMTUVRQQASGAC-UHFFFAOYSA-N 0.000 description 1
- HHXAUUFQZNWJDC-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=C([N+]([O-])=O)C(NC)=CC=C1OC1=CC=NC(C(=O)NCCO)=C1 HHXAUUFQZNWJDC-UHFFFAOYSA-N 0.000 description 1
- SIUMVFGIULAFNI-UHFFFAOYSA-N n-(2-hydroxyethyl)pyridine-2-carboxamide Chemical compound OCCNC(=O)C1=CC=CC=N1 SIUMVFGIULAFNI-UHFFFAOYSA-N 0.000 description 1
- ZBRUAABMEXHVHQ-UHFFFAOYSA-N n-(2-piperidin-2-ylethyl)formamide Chemical compound O=CNCCC1CCCCN1 ZBRUAABMEXHVHQ-UHFFFAOYSA-N 0.000 description 1
- GJWWYKMOBPPJHU-UHFFFAOYSA-N n-(3-methoxypropyl)pyridine-2-carboxamide Chemical compound COCCCNC(=O)C1=CC=CC=N1 GJWWYKMOBPPJHU-UHFFFAOYSA-N 0.000 description 1
- VNHLHHAXIJZPQO-UHFFFAOYSA-N n-(4-bromophenyl)-1,3-benzothiazol-2-amine Chemical compound C1=CC(Br)=CC=C1NC1=NC2=CC=CC=C2S1 VNHLHHAXIJZPQO-UHFFFAOYSA-N 0.000 description 1
- CFBLOAVHBSHFFU-UHFFFAOYSA-N n-(4-bromophenyl)-6-nitro-1h-benzimidazol-2-amine Chemical compound N1C2=CC([N+](=O)[O-])=CC=C2N=C1NC1=CC=C(Br)C=C1 CFBLOAVHBSHFFU-UHFFFAOYSA-N 0.000 description 1
- SNQJDSNBSOBUOP-UHFFFAOYSA-N n-(nitromethyl)aniline Chemical compound [O-][N+](=O)CNC1=CC=CC=C1 SNQJDSNBSOBUOP-UHFFFAOYSA-N 0.000 description 1
- SXSPPGZKJKBIAU-UHFFFAOYSA-N n-(oxolan-2-ylmethyl)pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NCC1CCCO1 SXSPPGZKJKBIAU-UHFFFAOYSA-N 0.000 description 1
- VHVJIHSPRWXJMP-UHFFFAOYSA-N n-(piperidin-4-ylmethyl)pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NCC1CCNCC1 VHVJIHSPRWXJMP-UHFFFAOYSA-N 0.000 description 1
- CBGUUUPBKCCPMD-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]pyridine-2-carboxamide Chemical compound CCN1CCCC1CNC(=O)C1=CC=CC=N1 CBGUUUPBKCCPMD-UHFFFAOYSA-N 0.000 description 1
- LKUFUQKKOINRJA-UHFFFAOYSA-N n-[(5-phenylthiophen-2-yl)methylidene]hydroxylamine Chemical compound S1C(C=NO)=CC=C1C1=CC=CC=C1 LKUFUQKKOINRJA-UHFFFAOYSA-N 0.000 description 1
- FWKGWDDKYHDXIA-UHFFFAOYSA-N n-[2-(benzylsulfonylamino)ethyl]-4-[1-methyl-2-(3-propan-2-ylanilino)benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound CC(C)C1=CC=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(=O)NCCNS(=O)(=O)CC=4C=CC=CC=4)C=C3N=2)C)=C1 FWKGWDDKYHDXIA-UHFFFAOYSA-N 0.000 description 1
- IKTMLCHVAZTPSB-UHFFFAOYSA-N n-[2-(dimethylamino)ethyl]pyridine-2-carboxamide Chemical compound CN(C)CCNC(=O)C1=CC=CC=N1 IKTMLCHVAZTPSB-UHFFFAOYSA-N 0.000 description 1
- TVVZTPAQEAIUFS-UHFFFAOYSA-N n-[3-(2-oxopyrrolidin-1-yl)propyl]pyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NCCCN1CCCC1=O TVVZTPAQEAIUFS-UHFFFAOYSA-N 0.000 description 1
- QANIAORLZJKBAP-UHFFFAOYSA-N n-[4-(2-phenylethynyl)phenyl]butanamide Chemical compound C1=CC(NC(=O)CCC)=CC=C1C#CC1=CC=CC=C1 QANIAORLZJKBAP-UHFFFAOYSA-N 0.000 description 1
- YHMVURFONZCBBL-UHFFFAOYSA-N n-[4-(2-phenylethynyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)CC)=CC=C1C#CC1=CC=CC=C1 YHMVURFONZCBBL-UHFFFAOYSA-N 0.000 description 1
- SVBRYJZTSPUETP-UHFFFAOYSA-N n-[4-fluoro-3-(trifluoromethyl)phenyl]-1h-benzimidazol-2-amine Chemical compound C1=C(C(F)(F)F)C(F)=CC=C1NC1=NC2=CC=CC=C2N1 SVBRYJZTSPUETP-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- AAAGSERQFUIAMB-UHFFFAOYSA-N n-hydroxy-2-(3-phenylphenoxy)acetamide Chemical compound ONC(=O)COC1=CC=CC(C=2C=CC=CC=2)=C1 AAAGSERQFUIAMB-UHFFFAOYSA-N 0.000 description 1
- RQADQLTVYXPJEE-UHFFFAOYSA-N n-methyl-4-[1-methyl-2-[(4-methylphenyl)methylamino]benzimidazol-5-yl]oxypyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C3N=C(NCC=4C=CC(C)=CC=4)N(C)C3=CC=2)=C1 RQADQLTVYXPJEE-UHFFFAOYSA-N 0.000 description 1
- NOEZAIFFTNSSLL-UHFFFAOYSA-N n-methyl-4-[4-(methylamino)-3-nitrophenoxy]pyridine-2-carboxamide Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=C(C(NC)=CC=2)[N+]([O-])=O)=C1 NOEZAIFFTNSSLL-UHFFFAOYSA-N 0.000 description 1
- QROKOTBWFZITJZ-UHFFFAOYSA-N n-pyridin-2-ylacetamide Chemical compound CC(=O)NC1=CC=CC=N1 QROKOTBWFZITJZ-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 210000004940 nucleus Anatomy 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 230000006548 oncogenic transformation Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- KGCNHWXDPDPSBV-UHFFFAOYSA-N p-nitrobenzyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CCl)C=C1 KGCNHWXDPDPSBV-UHFFFAOYSA-N 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- BOTNYLSAWDQNEX-UHFFFAOYSA-N phenoxymethylbenzene Chemical compound C=1C=CC=CC=1COC1=CC=CC=C1 BOTNYLSAWDQNEX-UHFFFAOYSA-N 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 150000008105 phosphatidylcholines Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical compound NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- JSPCTNUQYWIIOT-UHFFFAOYSA-N piperidine-1-carboxamide Chemical compound NC(=O)N1CCCCC1 JSPCTNUQYWIIOT-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 150000003058 platinum compounds Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 108091033319 polynucleotide Proteins 0.000 description 1
- 102000040430 polynucleotide Human genes 0.000 description 1
- 239000002157 polynucleotide Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 1
- VLJNHYLEOZPXFW-UHFFFAOYSA-N pyrrolidine-2-carboxamide Chemical compound NC(=O)C1CCCN1 VLJNHYLEOZPXFW-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 1
- 229930185107 quinolinone Natural products 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000004508 retinoic acid derivatives Chemical class 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 108091092562 ribozyme Proteins 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003334 secondary amides Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000008054 signal transmission Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000004960 subcellular localization Effects 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- IAHFWCOBPZCAEA-UHFFFAOYSA-N succinonitrile Chemical compound N#CCCC#N IAHFWCOBPZCAEA-UHFFFAOYSA-N 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- 229940063683 taxotere Drugs 0.000 description 1
- XCGQPDYRHYBWKY-UHFFFAOYSA-N tert-butyl 4-(4-amino-3-nitrophenoxy)pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OC(C)(C)C)=CC(OC=2C=C(C(N)=CC=2)[N+]([O-])=O)=C1 XCGQPDYRHYBWKY-UHFFFAOYSA-N 0.000 description 1
- ZZMIVVQWYYWIHR-UHFFFAOYSA-N tert-butyl 4-[2-(4-bromo-3-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylate Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)OC(C)(C)C)=CC=C2N(C)C=1NC1=CC=C(Br)C(F)=C1 ZZMIVVQWYYWIHR-UHFFFAOYSA-N 0.000 description 1
- NPEVKZPKKKODTD-UHFFFAOYSA-N tert-butyl 4-[2-(4-bromo-3-methylanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylate Chemical compound C1=C(Br)C(C)=CC(NC=2N(C3=CC=C(OC=4C=C(N=CC=4)C(=O)OC(C)(C)C)C=C3N=2)C)=C1 NPEVKZPKKKODTD-UHFFFAOYSA-N 0.000 description 1
- POZVYDAENHPODX-UHFFFAOYSA-N tert-butyl 4-[2-(4-bromoanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylate Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)OC(C)(C)C)=CC=C2N(C)C=1NC1=CC=C(Br)C=C1 POZVYDAENHPODX-UHFFFAOYSA-N 0.000 description 1
- GJCNUENCUUPGOL-UHFFFAOYSA-N tert-butyl 4-[2-(4-fluoroanilino)-1-methylbenzimidazol-5-yl]oxypyridine-2-carboxylate Chemical compound N=1C2=CC(OC=3C=C(N=CC=3)C(=O)OC(C)(C)C)=CC=C2N(C)C=1NC1=CC=C(F)C=C1 GJCNUENCUUPGOL-UHFFFAOYSA-N 0.000 description 1
- KNLKRAUJQBLECR-UHFFFAOYSA-N tert-butyl pyridine-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1=CC=CC=N1 KNLKRAUJQBLECR-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- NONOKGVFTBWRLD-UHFFFAOYSA-N thioisocyanate group Chemical group S(N=C=O)N=C=O NONOKGVFTBWRLD-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-M thiophene-2-carboxylate Chemical compound [O-]C(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-M 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 238000010361 transduction Methods 0.000 description 1
- 230000026683 transduction Effects 0.000 description 1
- 230000005945 translocation Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- AVBGNFCMKJOFIN-UHFFFAOYSA-N triethylammonium acetate Chemical compound CC(O)=O.CCN(CC)CC AVBGNFCMKJOFIN-UHFFFAOYSA-N 0.000 description 1
- 125000004360 trifluorophenyl group Chemical group 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- 150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 230000006444 vascular growth Effects 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/622—Forming processes; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/626—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B
- C04B35/63—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B using additives specially adapted for forming the products, e.g.. binder binders
- C04B35/632—Organic additives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Health & Medical Sciences (AREA)
- Manufacturing & Machinery (AREA)
- Ceramic Engineering (AREA)
- Public Health (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Structural Engineering (AREA)
- Materials Engineering (AREA)
- Inorganic Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/675,927 US8299108B2 (en) | 2002-03-29 | 2003-09-29 | Substituted benzazoles and methods of their use as inhibitors of raf kinase |
| PCT/US2004/032161 WO2005032548A1 (en) | 2003-09-29 | 2004-09-29 | Substituted benzazoles and use thereof as inhibitors of raf kinase |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA200600689A1 EA200600689A1 (ru) | 2006-08-25 |
| EA011890B1 true EA011890B1 (ru) | 2009-06-30 |
Family
ID=34422104
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA200600689A EA011890B1 (ru) | 2003-09-29 | 2004-09-29 | Замещённые бензазолы и их применение в качестве ингибиторов raf-киназы |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US8299108B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1675584A1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP2007507428A (cg-RX-API-DMAC7.html) |
| KR (1) | KR20060089232A (cg-RX-API-DMAC7.html) |
| CN (1) | CN1913884A (cg-RX-API-DMAC7.html) |
| AU (1) | AU2004277405A1 (cg-RX-API-DMAC7.html) |
| BR (1) | BRPI0414908A (cg-RX-API-DMAC7.html) |
| CA (1) | CA2539748A1 (cg-RX-API-DMAC7.html) |
| EA (1) | EA011890B1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL174431A0 (cg-RX-API-DMAC7.html) |
| MX (1) | MXPA06003435A (cg-RX-API-DMAC7.html) |
| WO (1) | WO2005032548A1 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA200603418B (cg-RX-API-DMAC7.html) |
Families Citing this family (74)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| ME00275B (me) | 1999-01-13 | 2011-02-10 | Bayer Corp | ω-KARBOKSIARIL SUPSTITUISANI DIFENIL KARBAMIDI KAO INHIBITORI RAF KINAZE |
| JP2002534468A (ja) | 1999-01-13 | 2002-10-15 | バイエル コーポレイション | p38キナーゼ阻害剤としてのω−カルボキシアリール置換ジフェニル尿素 |
| US20030216396A1 (en) | 2002-02-11 | 2003-11-20 | Bayer Corporation | Pyridine, quinoline, and isoquinoline N-oxides as kinase inhibitors |
| PT1478358E (pt) | 2002-02-11 | 2013-09-11 | Bayer Healthcare Llc | Tosilato de sorafenib para o tratamento de doenças caracterizadas por angiogénese anormal |
| DK1499311T3 (da) * | 2002-03-29 | 2010-03-08 | Novartis Vaccines & Diagnostic | Substituerede benzaboler og anvendelse deraf som RAF-kinaseinhibitorer |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| WO2004110990A2 (en) | 2003-05-15 | 2004-12-23 | Arqule, Inc. | Imidazothiazoles and imidazoxazole derivatives as inhibitors of p38 |
| PL1626714T3 (pl) | 2003-05-20 | 2007-12-31 | Bayer Healthcare Llc | Diarylowe pochodne mocznika do schorzeń, w których pośredniczy PDGFR |
| CN102816113B (zh) | 2003-07-23 | 2015-05-13 | 拜耳医药保健有限责任公司 | 用于治疗和预防疾病和疾病症状的氟代ω-羧芳基二苯基脲 |
| US7423150B2 (en) * | 2003-10-16 | 2008-09-09 | Novartis Ag | Substituted benzazoles and methods of their use as inhibitors of Raf kinase |
| US7829560B2 (en) * | 2004-07-08 | 2010-11-09 | Arqule, Inc. | 1,4-disubstituted naphthalenes as inhibitors of P38 MAP kinase |
| WO2006044869A1 (en) * | 2004-10-19 | 2006-04-27 | Arqule, Inc. | Synthesis of imidazooxazole and imidazothiazole inhibitors of p38 map kinase |
| WO2006078907A1 (en) * | 2005-01-20 | 2006-07-27 | Amgen Inc. | 2-substituted benzimidazole derivatives as vanilloid receptor ligands and their use in treatments |
| TWI370820B (en) * | 2005-04-27 | 2012-08-21 | Takeda Pharmaceutical | Fused heterocyclic compounds |
| TW200804345A (en) * | 2005-08-30 | 2008-01-16 | Novartis Ag | Substituted benzimidazoles and methods of preparation |
| EP1943226A2 (en) * | 2005-10-13 | 2008-07-16 | Smithkline Beecham Corporation | Phenol ethers as modulators of the opioid receptors |
| EP1987028A2 (en) | 2006-02-10 | 2008-11-05 | Transtech Pharma, Inc. | Benzazole derivatives, compositions, and methods of use as aurora kinase inhibitors |
| ES2654847T3 (es) | 2006-04-19 | 2018-02-15 | Novartis Ag | Compuestos de benzoxazol y benzotiazol sustituidos en 6-O y métodos para inhibir la señalización CSF-1R |
| CN101516335B (zh) | 2006-07-21 | 2014-01-08 | 诺瓦提斯公司 | 苯并咪唑基吡啶基醚的制剂 |
| PE20130814A1 (es) * | 2006-08-30 | 2013-08-08 | Novartis Ag | Sales de benzimidazolil piridil eteres y formulaciones que las contienen |
| KR20090126286A (ko) * | 2007-04-05 | 2009-12-08 | 다이이찌 산쿄 가부시키가이샤 | 축합 2 고리형 헤테로아릴 유도체 |
| TW200904816A (en) | 2007-06-05 | 2009-02-01 | Takeda Pharmaceutical | Fused heterocycle derivatives and use thereof |
| EP2181987B9 (en) | 2007-08-23 | 2014-09-03 | Takeda Pharmaceutical Company Limited | 2-Carbonylaminobenzothiazoles and their use for the prophylaxis and treatment of cancer |
| EP2184285B1 (en) * | 2007-08-29 | 2015-11-04 | Takeda Pharmaceutical Company Limited | Heterocyclic compound and use thereof |
| UA101166C2 (ru) | 2007-09-21 | 2013-03-11 | Аррей Биофарма Инк. | Производные пиридин-2-иламино-1,2,4-тиадиазола как активаторы глюкокиназы для лечения сахарного диабета |
| US20100261679A1 (en) * | 2007-10-18 | 2010-10-14 | James Sutton | CSF-1R, Inhibitors, Compositions, and Methods of Use |
| US8697874B2 (en) * | 2008-12-01 | 2014-04-15 | Takeda Pharmaceutical Company Limited | Heterocyclic compound and use thereof |
| JO3101B1 (ar) | 2008-12-02 | 2017-09-20 | Takeda Pharmaceuticals Co | مشتقات بنزوثيازول كعوامل مضادة للسرطان |
| EP2361254A1 (en) * | 2008-12-05 | 2011-08-31 | ArQule, Inc. | Raf inhibitors and their uses |
| ES2617191T3 (es) | 2009-03-05 | 2017-06-15 | Daiichi Sankyo Company, Limited | Derivado de piridina como inhibidor de PPARY |
| AU2011265254B2 (en) | 2010-06-11 | 2016-05-19 | Smith & Nephew, Inc. | Patient-matched instruments |
| US9120752B2 (en) | 2010-07-16 | 2015-09-01 | Purdue Pharma, L.P. | Pyridine compounds as sodium channel blockers |
| BR112013006272A2 (pt) | 2010-09-17 | 2019-09-24 | Purdue Pharma Lp | compostos de piridina e seus usos |
| CN102276482A (zh) * | 2011-04-11 | 2011-12-14 | 常州大学 | 2-甲氧基-5-溴苯胺的制备方法 |
| US9408885B2 (en) | 2011-12-01 | 2016-08-09 | Vib Vzw | Combinations of therapeutic agents for treating melanoma |
| WO2013136170A1 (en) | 2012-03-16 | 2013-09-19 | Purdue Pharma L.P. | Substituted pyridines as sodium channel blockers |
| US9714252B2 (en) | 2012-12-20 | 2017-07-25 | Purdue Pharma L.P. | Cyclic sulfonamides as sodium channel blockers |
| US9242969B2 (en) | 2013-03-14 | 2016-01-26 | Novartis Ag | Biaryl amide compounds as kinase inhibitors |
| CN103435554A (zh) * | 2013-09-06 | 2013-12-11 | 中国药科大学 | 2-苯氨基苯并咪唑类化合物及其用途 |
| EP3046557A1 (en) | 2013-09-20 | 2016-07-27 | Stichting Het Nederlands Kanker Instituut | Rock in combination with mapk-pathway |
| WO2015041534A1 (en) | 2013-09-20 | 2015-03-26 | Stichting Het Nederlands Kanker Instituut | P90rsk in combination with raf/erk/mek |
| US10730866B2 (en) | 2014-04-07 | 2020-08-04 | Purdue Pharma L.P. | Indole derivatives and use thereof |
| US20170027940A1 (en) | 2014-04-10 | 2017-02-02 | Stichting Het Nederlands Kanker Instituut | Method for treating cancer |
| WO2015178770A1 (en) | 2014-05-19 | 2015-11-26 | Stichting Het Nederlands Kanker Instituut | Compositions for cancer treatment |
| UY36294A (es) | 2014-09-12 | 2016-04-29 | Novartis Ag | Compuestos y composiciones como inhibidores de quinasa |
| AU2015362790A1 (en) | 2014-12-16 | 2017-07-20 | Axovant Sciences Gmbh | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors |
| CN105949178B (zh) * | 2015-03-09 | 2020-05-26 | 西格莱(苏州)生物医药有限公司 | 一种苯并咪唑类化合物、其制备方法、中间体及应用 |
| MX2017016231A (es) | 2015-06-10 | 2018-11-29 | Axovant Sciences Gmbh | Compuestos de aminobencisoxazol como agonistas de receptores a7-nicotínicos de acetilcolina. |
| US10428062B2 (en) | 2015-08-12 | 2019-10-01 | Axovant Sciences Gmbh | Geminal substituted aminobenzisoxazole compounds as agonists of α7-nicotinic acetylcholine receptors |
| KR101770310B1 (ko) | 2015-08-24 | 2017-08-24 | 이화여자대학교 산학협력단 | 2-(페닐아미노)벤조[d]옥사졸-5-올 유도체, 이의 제조방법 및 이를 유효성분으로 함유하는 염증성 질환의 예방 또는 치료용 약학적 조성물 |
| WO2017095950A2 (en) * | 2015-11-30 | 2017-06-08 | Children's Medical Center Corporation | Compounds for treating proliferative diseases |
| EP3515446B1 (en) | 2016-09-19 | 2023-12-20 | Novartis AG | Therapeutic combinations comprising a raf inhibitor and a erk inhibitor |
| CN106674264A (zh) * | 2016-12-20 | 2017-05-17 | 苏州汉德创宏生化科技有限公司 | (2,2,2‑三氟乙氧基)苯硼酸类化合物的合成方法 |
| US11471538B2 (en) | 2017-02-10 | 2022-10-18 | INSERM (Institut National de la Santéet de la Recherche Medicale) | Methods and pharmaceutical compositions for the treatment of cancers associated with activation of the MAPK pathway |
| JP7094942B2 (ja) | 2017-03-15 | 2022-07-04 | 住友ファーマ株式会社 | ベンズイミダゾール誘導体の製造方法 |
| DK3618875T3 (da) | 2017-05-02 | 2023-07-10 | Novartis Ag | Kombinationsterapi omfattende en raf-inhibitor og trametinib |
| US11299488B2 (en) * | 2017-07-12 | 2022-04-12 | Bristol-Myers Squibb Company | Five membered-aminoheterocycle and 5,6-or 6,6-membered bicyclic aminoheterocyclic inhibitors of rock for the treatment of heart failure |
| EP3700904B1 (en) | 2017-10-24 | 2023-07-19 | Bayer AG | 4h-pyrrolo[3,2-c]pyridin-4-one derivatives |
| EP3732285A1 (en) | 2017-12-28 | 2020-11-04 | Tract Pharmaceuticals, Inc. | Stem cell culture systems for columnar epithelial stem cells, and uses related thereto |
| CN111788183B (zh) * | 2018-02-07 | 2024-02-23 | 韩国化学硏究院 | 用于抑制tnik的杂环融合苯基化合物及其医疗用途 |
| WO2020055760A1 (en) | 2018-09-10 | 2020-03-19 | Mirati Therapeutics, Inc. | Combination therapies |
| WO2020097398A1 (en) | 2018-11-07 | 2020-05-14 | Dana-Farber Cancer Institute, Inc. | Benzothiazole derivatives and 7-aza-benzothiazole derivatives as janus kinase 2 inhibitors and uses thereof |
| US12403135B2 (en) | 2019-04-24 | 2025-09-02 | Bayer Aktiengesellschaft | 4H-pyrrolo[3,2-c]pyridin-4-one derivatives |
| TWI849114B (zh) | 2019-04-24 | 2024-07-21 | 德商拜耳廠股份有限公司 | 4H-吡咯并[3,2-c]吡啶-4-酮化合物 |
| WO2020216773A1 (en) | 2019-04-24 | 2020-10-29 | Bayer Aktiengesellschaft | 4h-pyrrolo[3,2-c]pyridin-4-one compounds |
| KR102881316B1 (ko) | 2019-05-13 | 2025-11-05 | 노파르티스 아게 | 암 치료를 위한 raf 억제제로서의 n-(3-(2-(2-하이드록시에톡시)-6-모르폴리노피리딘-4-일)-4-메틸페닐)-2 (트리플루오로메틸)이소니코틴아미드의 새로운 결정질 형태 |
| WO2021198020A1 (en) | 2020-03-31 | 2021-10-07 | Bayer Aktiengesellschaft | 3-(anilino)-2-[3-(3-alkoxy-pyridin-4-yl]-1,5,6,7-tetrahydro-4h-pyrrolo[3,2-c]pyridin-4-one derivatives as egfr inhibitors for the treatment of cancer |
| WO2021226261A1 (en) * | 2020-05-06 | 2021-11-11 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
| EP4263531A2 (en) * | 2020-12-16 | 2023-10-25 | IFM Due, Inc. | Compounds and compositions for treating conditions associated with sting activity |
| EP4267574B1 (en) | 2020-12-23 | 2025-04-23 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
| WO2023009708A1 (en) * | 2021-07-29 | 2023-02-02 | Ajax Therapeutics, Inc. | Heteroaryloxy triazolo- and imidazo-azines as jak2 inhibitors |
| US12162881B2 (en) | 2021-11-09 | 2024-12-10 | Ajax Therapeutics, Inc. | Forms and compositions of inhibitors of JAK2 |
| CA3234638A1 (en) | 2021-11-09 | 2023-05-19 | Ajax Therapeutics, Inc. | 6-heteroaryloxy benzimidazoles and azabenzimidazoles as jak2 inhibitors |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002094808A1 (en) * | 2001-05-19 | 2002-11-28 | Smithkline Beecham P.L.C. | Imidazole-2-carboxamide derivatives as raf kinase inhibitors |
| WO2003082272A1 (en) * | 2002-03-29 | 2003-10-09 | Chiron Corporation | Substituted benzazoles and use thereof as raf kinase inhibitors |
| WO2004085425A1 (en) * | 2003-03-21 | 2004-10-07 | Amgen Inc | Fused azoles such as 2,5-disubstituted benzimidazoles, benzoxazoles and benzothiazoles as kinase inhibitors |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6248771B1 (en) * | 1997-03-05 | 2001-06-19 | Sugen, Inc. | Formulations for hydrophobic pharmaceutical agents |
| GB9711650D0 (en) * | 1997-06-05 | 1997-07-30 | Pfizer Ltd | Compounds useful in therapy |
| US6211177B1 (en) * | 1998-11-24 | 2001-04-03 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted 2-aryl-benzimidazole derivatives |
| EP1140840B1 (en) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| CA2366932C (en) | 1999-04-15 | 2009-08-25 | Bristol-Myers Squibb Company | Cyclic protein tyrosine kinase inhibitors |
| ATE339406T1 (de) * | 1999-09-23 | 2006-10-15 | Astrazeneca Ab | Chinazoline verbindungen als heilmittel |
| AU2001235838A1 (en) | 2000-03-06 | 2001-09-17 | Smithkline Beecham Plc | Imidazol derivatives as raf kinase inhibitors |
| HUP0400651A2 (hu) | 2000-11-07 | 2004-06-28 | Bristol-Myers Squibb Company | Szerin proteáz inhibitorokként alkalmazható savszármazékok és ezeket tartalmazó gyógyszerkészítmények |
| WO2002044156A2 (en) | 2000-11-29 | 2002-06-06 | Glaxo Group Limited | Benzimidazole derivatives useful as tie-2 and/or vegfr-2 inhibitors |
| US20030009034A1 (en) | 2001-03-22 | 2003-01-09 | Neil Wishart | Transition metal mediated process |
| WO2004087153A2 (en) * | 2003-03-28 | 2004-10-14 | Chiron Corporation | Use of organic compounds for immunopotentiation |
-
2003
- 2003-09-29 US US10/675,927 patent/US8299108B2/en not_active Expired - Fee Related
-
2004
- 2004-09-29 EA EA200600689A patent/EA011890B1/ru not_active IP Right Cessation
- 2004-09-29 EP EP04789345A patent/EP1675584A1/en not_active Withdrawn
- 2004-09-29 AU AU2004277405A patent/AU2004277405A1/en not_active Abandoned
- 2004-09-29 WO PCT/US2004/032161 patent/WO2005032548A1/en not_active Ceased
- 2004-09-29 MX MXPA06003435A patent/MXPA06003435A/es not_active Application Discontinuation
- 2004-09-29 CA CA002539748A patent/CA2539748A1/en not_active Abandoned
- 2004-09-29 CN CNA2004800326778A patent/CN1913884A/zh active Pending
- 2004-09-29 JP JP2006528331A patent/JP2007507428A/ja not_active Withdrawn
- 2004-09-29 KR KR1020067006470A patent/KR20060089232A/ko not_active Ceased
- 2004-09-29 BR BRPI0414908-4A patent/BRPI0414908A/pt not_active IP Right Cessation
-
2006
- 2006-03-21 IL IL174431A patent/IL174431A0/en unknown
- 2006-04-28 ZA ZA200603418A patent/ZA200603418B/en unknown
-
2012
- 2012-07-24 US US13/556,907 patent/US20120288501A1/en not_active Abandoned
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2002094808A1 (en) * | 2001-05-19 | 2002-11-28 | Smithkline Beecham P.L.C. | Imidazole-2-carboxamide derivatives as raf kinase inhibitors |
| WO2003082272A1 (en) * | 2002-03-29 | 2003-10-09 | Chiron Corporation | Substituted benzazoles and use thereof as raf kinase inhibitors |
| WO2004085425A1 (en) * | 2003-03-21 | 2004-10-07 | Amgen Inc | Fused azoles such as 2,5-disubstituted benzimidazoles, benzoxazoles and benzothiazoles as kinase inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| US20040122237A1 (en) | 2004-06-24 |
| WO2005032548A1 (en) | 2005-04-14 |
| EA200600689A1 (ru) | 2006-08-25 |
| MXPA06003435A (es) | 2006-06-20 |
| AU2004277405A1 (en) | 2005-04-14 |
| EP1675584A1 (en) | 2006-07-05 |
| CN1913884A (zh) | 2007-02-14 |
| CA2539748A1 (en) | 2005-04-14 |
| US8299108B2 (en) | 2012-10-30 |
| IL174431A0 (en) | 2006-08-01 |
| US20120288501A1 (en) | 2012-11-15 |
| JP2007507428A (ja) | 2007-03-29 |
| BRPI0414908A (pt) | 2006-11-07 |
| ZA200603418B (en) | 2007-07-25 |
| KR20060089232A (ko) | 2006-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA011890B1 (ru) | Замещённые бензазолы и их применение в качестве ингибиторов raf-киназы | |
| EA007987B1 (ru) | Замещённые бензазолы и их применение в качестве ингибиторов киназы raf | |
| RU2606497C2 (ru) | Тиазолилфенилбензолсульфонамидопроизводные в качестве ингибиторов киназ | |
| US8415382B2 (en) | Substituted benzazoles and methods of their use as inhibitors of RAF Kinase | |
| KR20150013548A (ko) | 키나제 억제제로서의 신규 고리-치환된 n-피리디닐 아미드 | |
| RU2741000C2 (ru) | Производное 1,4-дизамещенного имидазола | |
| KR20100047901A (ko) | 암 및 건선 치료에 유용한 복소환 아미드 | |
| KR20170029495A (ko) | 테트라하이드로피라닐메틸기를 갖는 피리돈 유도체 | |
| KR20140025326A (ko) | 신규 인돌, 인다졸 유도체 또는 그 염 | |
| EP3885348B1 (en) | Novel tricyclic compound as irak4 inhibitor | |
| CN121240860A (zh) | 用于抑制yap/taz-tead的苯并咪唑及相关类似物 | |
| HK1067945B (en) | Substituted benzazoles and use thereof as raf kinase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG MD TJ TM RU |