DK259979A - Fremgangsmaade til fremstilling af terephthalsyre ud fra dimethylterephthalat som mellemprodukt - Google Patents
Fremgangsmaade til fremstilling af terephthalsyre ud fra dimethylterephthalat som mellemproduktInfo
- Publication number
- DK259979A DK259979A DK259979A DK259979A DK259979A DK 259979 A DK259979 A DK 259979A DK 259979 A DK259979 A DK 259979A DK 259979 A DK259979 A DK 259979A DK 259979 A DK259979 A DK 259979A
- Authority
- DK
- Denmark
- Prior art keywords
- dimethylthephthalate
- procedure
- terephthalic acid
- preparing terephthalic
- preparing
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2916197A DE2916197C2 (de) | 1979-04-21 | 1979-04-21 | Verfahren zur Herstellung von Terephthalsäure aus Dimethyltherephthalat als Zwischenprodukt |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK259979A true DK259979A (da) | 1980-10-22 |
Family
ID=6068923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK259979A DK259979A (da) | 1979-04-21 | 1979-06-21 | Fremgangsmaade til fremstilling af terephthalsyre ud fra dimethylterephthalat som mellemprodukt |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US4302595A (enExample) |
| JP (1) | JPS55141433A (enExample) |
| AR (1) | AR217177A1 (enExample) |
| BE (1) | BE878566A (enExample) |
| BG (1) | BG60054B2 (enExample) |
| BR (1) | BR7904770A (enExample) |
| CA (1) | CA1134857A (enExample) |
| CS (1) | CS216849B2 (enExample) |
| DD (1) | DD146822A5 (enExample) |
| DE (1) | DE2916197C2 (enExample) |
| DK (1) | DK259979A (enExample) |
| EG (1) | EG14817A (enExample) |
| ES (1) | ES482621A1 (enExample) |
| FR (1) | FR2454432B1 (enExample) |
| GB (1) | GB2047704B (enExample) |
| IN (1) | IN154606B (enExample) |
| IT (1) | IT1162607B (enExample) |
| MX (1) | MX153587A (enExample) |
| NL (1) | NL188036C (enExample) |
| PH (1) | PH22194A (enExample) |
| PL (1) | PL123543B1 (enExample) |
| PT (1) | PT70080A (enExample) |
| RO (1) | RO80178A (enExample) |
| SU (1) | SU1041029A3 (enExample) |
| TR (1) | TR21461A (enExample) |
| UA (1) | UA7015A1 (enExample) |
| YU (1) | YU42487B (enExample) |
| ZA (1) | ZA793646B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3011858C2 (de) * | 1979-04-21 | 1982-11-25 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephtalsäure aus Roh-Dimethylterephthalat durch kontinuierliche Hydrolyse mit Wasser |
| DE3041293A1 (de) * | 1979-04-21 | 1982-06-16 | Dynamit Nobel Ag, 5210 Troisdorf | Verbessertes verfahren zur herstellung von terephthalsaeure aus dimethylterephthalat als zwischenprodukt |
| DE2938163A1 (de) * | 1979-09-21 | 1981-04-09 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur herstellung von terephthalsaeure aus dimethylterephthalat als zwischenprodukt |
| DE3044617C2 (de) * | 1980-11-27 | 1985-09-26 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephthalsäure aus Dimethylterephthalat als Zwischenprodukt |
| JPS5983309A (ja) * | 1982-11-05 | 1984-05-14 | 三菱電機株式会社 | ガス遮断器 |
| DE3407912C1 (de) * | 1984-03-03 | 1985-05-09 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephthalsaeure ueber Terephthalsaeuredimethylester aus p-Xylol und Methanol |
| DE3904586A1 (de) * | 1989-02-16 | 1990-08-23 | Huels Chemische Werke Ag | Verfahren zur herstellung von dmt-zwischenprodukt bestimmter reinheit sowie dessen weiterverarbeitung zu reinst-dmt und/oder mittel- oder hochreiner terephthalsaeure |
| US5563294A (en) * | 1991-12-19 | 1996-10-08 | Amoco Corporation | Process for preparing purified 2,6-naphthalenedicarboxylic acid |
| DE69214937T3 (de) * | 1991-12-19 | 2002-07-18 | Bp Corp. North America Inc. (N.D.Ges.D. Staates Indiana), Chicago | Verfahren zur herstellung von gereinigten 2,6-naphthalindicarbonsäuren |
| ES2129645T3 (es) * | 1993-07-05 | 1999-06-16 | Du Pont | Produccion de acidos dicarboxilicos o esteres de los mismos. |
| EP0725054A1 (de) * | 1995-01-24 | 1996-08-07 | Hüls Aktiengesellschaft | Verfahren zur Herstellung von Terephthalsäure und ihrer Isomeren |
| US6472557B1 (en) | 1999-02-10 | 2002-10-29 | Eastman Chemical Company | Process for recycling polyesters |
| JP2006143612A (ja) * | 2004-11-17 | 2006-06-08 | Teijin Ltd | スラリーの送液方法 |
| JP5129753B2 (ja) * | 2006-11-07 | 2013-01-30 | 帝人株式会社 | テレフタル酸−アルキレングリコール混合物の製造方法 |
| US8426639B2 (en) | 2009-06-16 | 2013-04-23 | Amyris, Inc. | Preparation of trans, trans muconic acid and trans, trans muconates |
| MX2011014007A (es) | 2009-06-16 | 2012-06-01 | Amyris Inc | 1, 4-carboxilatos de ciclohexeno. |
| WO2010148063A2 (en) | 2009-06-16 | 2010-12-23 | Draths Corporation | Cyclohexene 1,4-carboxylates |
| US8415496B2 (en) | 2009-06-16 | 2013-04-09 | Amyris, Inc. | Biobased polyesters |
| US8367859B2 (en) | 2009-06-16 | 2013-02-05 | Amyris, Inc. | Cyclohexane 1,4 carboxylates |
| MY202430A (en) * | 2018-08-30 | 2024-04-29 | Nextchem Tech S P A | Method and apparatus to produce fatty acids from methyl esters throughout non-catalytic process |
| US10752776B2 (en) | 2018-09-19 | 2020-08-25 | International Business Machines Corporation | Cyclic bio-renewable flame retardants |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1112973B (de) * | 1954-09-08 | 1961-08-24 | Ici Ltd | Vorrichtung zur Reinigung von Terephthalsaeure |
| US2794832A (en) * | 1955-06-20 | 1957-06-04 | Shell Dev | Crystallization and separation of crystals |
| US2992168A (en) * | 1959-07-09 | 1961-07-11 | Eastman Kodak Co | Process of purifying dimethyl terephthalate and other compounds which sublime |
| US3108132A (en) * | 1962-01-16 | 1963-10-22 | Standard Oil Co | Purification of dmt by filtration |
| US3396087A (en) * | 1966-01-10 | 1968-08-06 | Exxon Research Engineering Co | Dimethylterephthalate recovery from paraxylene feed |
| GB1130695A (en) * | 1966-04-18 | 1968-10-16 | Hercules Inc | Production of terephthalic acid by hydrolysis of an alkyl terephthalate |
| DE1299627B (de) * | 1966-08-31 | 1969-07-24 | Dynamit Nobel Ag | Verfahren zur Herstellung von reinster Terepthalsaeure |
| DE2010137C3 (de) | 1970-03-04 | 1979-07-05 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Terephthalsauredimethylester |
| US4118313A (en) * | 1973-11-03 | 1978-10-03 | Dynamit Nobel Aktiengesellschaft | Process and apparatus for mass transfer between heterogeneous systems |
-
1979
- 1979-04-21 DE DE2916197A patent/DE2916197C2/de not_active Expired
- 1979-06-21 DK DK259979A patent/DK259979A/da unknown
- 1979-07-02 YU YU1596/79A patent/YU42487B/xx unknown
- 1979-07-05 IT IT49662/79A patent/IT1162607B/it active
- 1979-07-06 NL NLAANVRAGE7905318,A patent/NL188036C/xx not_active IP Right Cessation
- 1979-07-10 MX MX178417A patent/MX153587A/es unknown
- 1979-07-13 JP JP8832279A patent/JPS55141433A/ja active Granted
- 1979-07-16 CS CS794967A patent/CS216849B2/cs unknown
- 1979-07-18 ZA ZA00793646A patent/ZA793646B/xx unknown
- 1979-07-19 ES ES482621A patent/ES482621A1/es not_active Expired
- 1979-07-20 FR FR7918841A patent/FR2454432B1/fr not_active Expired
- 1979-07-25 BR BR7904770A patent/BR7904770A/pt not_active IP Right Cessation
- 1979-07-26 AR AR277475A patent/AR217177A1/es active
- 1979-08-13 PL PL1979217729A patent/PL123543B1/pl unknown
- 1979-08-17 PT PT70080A patent/PT70080A/pt unknown
- 1979-08-20 RO RO7998485A patent/RO80178A/ro unknown
- 1979-09-03 BE BE0/196991A patent/BE878566A/xx not_active IP Right Cessation
- 1979-09-27 US US06/079,253 patent/US4302595A/en not_active Expired - Lifetime
- 1979-11-20 DD DD79217017A patent/DD146822A5/de not_active IP Right Cessation
- 1979-11-26 PH PH23328A patent/PH22194A/en unknown
- 1979-12-19 CA CA000342255A patent/CA1134857A/en not_active Expired
-
1980
- 1980-01-12 EG EG22/80A patent/EG14817A/xx active
- 1980-04-02 IN IN382/CAL/80A patent/IN154606B/en unknown
- 1980-04-15 TR TR21461A patent/TR21461A/xx unknown
- 1980-04-18 BG BG047456A patent/BG60054B2/bg unknown
- 1980-04-18 UA UA2910350A patent/UA7015A1/uk unknown
- 1980-04-18 SU SU802910350A patent/SU1041029A3/ru active
- 1980-04-18 GB GB8012888A patent/GB2047704B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EG14817A (en) | 1985-06-30 |
| GB2047704B (en) | 1983-07-20 |
| BR7904770A (pt) | 1980-12-02 |
| MX153587A (es) | 1986-12-01 |
| NL7905318A (nl) | 1980-10-23 |
| IT7949662A0 (it) | 1979-07-05 |
| AR217177A1 (es) | 1980-02-29 |
| UA7015A1 (uk) | 1995-03-31 |
| BG60054B2 (bg) | 1993-08-30 |
| PH22194A (en) | 1988-06-28 |
| PT70080A (de) | 1979-09-01 |
| TR21461A (tr) | 1984-06-19 |
| ZA793646B (en) | 1980-07-30 |
| PL217729A1 (enExample) | 1980-11-03 |
| FR2454432A1 (fr) | 1980-11-14 |
| IN154606B (enExample) | 1984-11-17 |
| BE878566A (fr) | 1979-12-31 |
| CA1134857A (en) | 1982-11-02 |
| PL123543B1 (en) | 1982-10-30 |
| YU42487B (en) | 1988-10-31 |
| DE2916197C2 (de) | 1982-01-28 |
| FR2454432B1 (fr) | 1985-10-25 |
| IT1162607B (it) | 1987-04-01 |
| YU159679A (en) | 1982-08-31 |
| NL188036C (nl) | 1992-03-16 |
| DD146822A5 (de) | 1981-03-04 |
| GB2047704A (en) | 1980-12-03 |
| JPS5753332B2 (enExample) | 1982-11-12 |
| DE2916197A1 (de) | 1980-10-23 |
| RO80178A (ro) | 1982-10-26 |
| ES482621A1 (es) | 1980-04-01 |
| US4302595A (en) | 1981-11-24 |
| SU1041029A3 (ru) | 1983-09-07 |
| JPS55141433A (en) | 1980-11-05 |
| CS216849B2 (en) | 1982-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK259979A (da) | Fremgangsmaade til fremstilling af terephthalsyre ud fra dimethylterephthalat som mellemprodukt | |
| DK43279A (da) | Fremgangsmaade til fremstilling af 2-penem-3-carboxylsyreforbindelser | |
| DK153943C (da) | Fremgangsmaade til fremstilling af 1-hydroxyvitamin-d-forbindelser ud fra 1-hydroxy-3,5-cyclovitamin-d-forbindelser | |
| DK294880A (da) | Fremgangsmaade til fremstilling af n-phosphonomethylglycin | |
| DK502078A (da) | Frefmgangsmaade til fremstilling af cephalosporansyrederivater | |
| DK323780A (da) | Fremgangsmaade til fremstilling af substituerede 3-amino-sydnonimider eller farmakologisk acceptable syreadditionssalte deraf | |
| DK416479A (da) | Fremgangsmaade til fremstilling af cyanoketoner afledt af glycyrrhetinsyre | |
| DK165778A (da) | Fremgangsmaade til fremstilling af analoge af ergotalkaloider | |
| DK396880A (da) | Fremgangsmaade til fremstilling af cyclohexancarboxylsyrederivater | |
| DK103683D0 (da) | Fremgangsmade til fremstilling af 2-keto-l-gulonsyre | |
| DK103583D0 (da) | Fremgangsmade til fremstilling af 2-keto-l-gulonsyre | |
| DK99980A (da) | Fremgangsmaade til fremstilling af mercaptoacyldihydropyrazolcarboxylsyrederivater | |
| NO801667L (no) | Fremgangsmaate til fremstilling av en alkoholoksyd fra mikroorganismer av pichia-typen | |
| DK365980A (da) | Fremgangsmaade til fremstilling af 7-betaaminothiadiazolylacetylamino-3-cephem-4-carboxylsyreforbindelser eller salte deraf | |
| DK146534C (da) | Fremgangsmaade til fremstilling af rene substituerede n-methyl-pyrazol-acetanilider | |
| DK157677C (da) | Fremgangsmaade til fremstilling af cyclopropancarboxylsyreesterderivater | |
| DK201878A (da) | Fremgangsmaade til fremstilling af 1-acylamino-2-hydroxy-3-phenylamino-propaner eller syreadditionsforbindelser deraf | |
| DK146622C (da) | Fremgangsmaade til fremstilling af aminosyrer ud fra de tilsvarende n-carbamylaminosyrer | |
| DK163667C (da) | Fremgangsmaade til fremstilling af 7-amino-3-chlor-3-cephem-4-carboxylsyreestere | |
| DK57381A (da) | Fremgansmaade til fremstilling af bifenyloxypropionsyrederivater | |
| DK285178A (da) | Fremgangsmaade til fremstilling af puridinkarboxylsyre-piperazider | |
| DK394978A (da) | Fremgangsmaade til fremstilling af bromerede cephalosporansyrederivater | |
| DK157613C (da) | Fremgangsmaade til fremstilling af cyclopropancarboxylsyreesterderivater | |
| DK125080A (da) | Fremgangsmaade til fremstilling af alkylesterphosphorsyredichlorider | |
| DK156300C (da) | Analogifremgangsmaade til fremstilling af substituerede pyrrolidinyl-benzoesyrederivater |