DEW0009689MA - - Google Patents
Info
- Publication number
- DEW0009689MA DEW0009689MA DEW0009689MA DE W0009689M A DEW0009689M A DE W0009689MA DE W0009689M A DEW0009689M A DE W0009689MA
- Authority
- DE
- Germany
- Prior art keywords
- bis
- pentan
- dimethylaminophenyl
- cholinesterase
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000001875 compounds Chemical class 0.000 claims description 14
- 230000000694 effects Effects 0.000 claims description 8
- 150000001450 anions Chemical group 0.000 claims description 5
- 239000000544 cholinesterase inhibitor Substances 0.000 claims description 5
- QMUCAYSGOFKPAM-UHFFFAOYSA-N CN(C1=CC=C(C=C1)CCC(CC)=O)C Chemical compound CN(C1=CC=C(C=C1)CCC(CC)=O)C QMUCAYSGOFKPAM-UHFFFAOYSA-N 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 235000015250 liver sausages Nutrition 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000009835 boiling Methods 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 102000003914 Cholinesterases Human genes 0.000 description 3
- 108090000322 Cholinesterases Proteins 0.000 description 3
- 229940048961 cholinesterase Drugs 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- HFEHLDPGIKPNKL-UHFFFAOYSA-N allyl iodide Chemical compound ICC=C HFEHLDPGIKPNKL-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 108010053652 Butyrylcholinesterase Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100032404 Cholinesterase Human genes 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- SUDMKGNNRMLBMF-UHFFFAOYSA-N prop-2-enyl methanesulfonate Chemical compound CS(=O)(=O)OCC=C SUDMKGNNRMLBMF-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2065236C3 (de) | Phosphonsäuresalze, ihre Herstellung und Verwendung | |
| DE2166398C3 (de) | 43-Tetrazolo [1,5-a] chinoline und Verfahren zu ihrer Herstellung | |
| DE2739912A1 (de) | Uracilderivate und herstellungsverfahren | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| DE2253594A1 (de) | Verfahren zur trennung von tertiaeren polyalkylenpolyaminen | |
| DEW0009689MA (cs) | ||
| DE1274100B (de) | Verfahren zur Herstellung von 1, 6-Dibrom-1, 6-didesoxydulcit | |
| DE946544C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen mit Anti-Cholinesterase-Wirkung | |
| EP0003052B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-chlormethylimidazol | |
| CH622791A5 (cs) | ||
| DE2008578A1 (de) | Verfahren zur Herstellung von Nifcrosoharnstof1/erbindungen | |
| DE2458191C3 (de) | Verfahren zur Herstellung von s-Trialkoxybenzolen | |
| DE1292664B (de) | 1, 2, 3, 5, 6-Pentathiacycloheptan, Verfahren zu dessen Herstellung und Verwendung | |
| DE1545981B2 (de) | Verfahren zur Herstellung von Alkylen^'-bipyridyliumdichloriden | |
| CH637127A5 (de) | Verfahren zur herstellung von bis-2-furanidylaether und n (sup 1)-(2'-furanidyl)-5-fluor-uracil. | |
| DE1695789C3 (de) | Verfahren zur Herstellung von Benzodiazepinderivaten | |
| DE1643491C3 (de) | Macrocyclische Polyether und deren Verwendung als Kationenkomplexbildner | |
| DE2356999A1 (de) | 1,2-dihydroinden-2-spiro-2'-piperazinderivate und verfahren zu ihrer herstellung | |
| AT394720B (de) | Verfahren zur herstellung von 17,18hu8505101758/85 | |
| DE2800489A1 (de) | Ticrynafen der polymorphen modifikation b | |
| AT221871B (de) | Ungeziefervertilgungsmittel | |
| DE1568339A1 (de) | Verfahren zur Herstellung von cyclischen Thioaethern des Ferrocens | |
| DD154817A5 (de) | Verfahren zur darstellung der molekularen verbindung von beta-diaethylaminoaethylamid der p-chlorophenoxyessigsaeure mit 4-n-butyl-3,5-diketo-1,2-diphenylpyrazolidin | |
| AT210420B (de) | Verfahren zur Herstellung von neuen Azetidin-Derivaten | |
| DE1062244B (de) | Verfahren zur Herstellung von metall- oder metalloidorganischen Acetylenverbindungen |