DEU0001642MA - - Google Patents
Info
- Publication number
- DEU0001642MA DEU0001642MA DEU0001642MA DE U0001642M A DEU0001642M A DE U0001642MA DE U0001642M A DEU0001642M A DE U0001642MA
- Authority
- DE
- Germany
- Prior art keywords
- trione
- diol
- vol
- halogenation
- acetate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 230000026030 halogenation Effects 0.000 claims description 10
- 238000005658 halogenation reaction Methods 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- 230000002140 halogenating effect Effects 0.000 claims description 9
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 claims description 7
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000013078 crystal Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 150000003431 steroids Chemical class 0.000 description 5
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- -1 acetoxy, propionoxy, butanoyloxy, Isobutanoyloxy, valeroyloxy, isovaleroyloxy, hexanoyloxy, heptanoyloxy, octanoyloxy Chemical group 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 3
- LYXHPJRJBIANDD-UHFFFAOYSA-N 3-bromo-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)NC(=O)N(Br)C1=O LYXHPJRJBIANDD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2714680A1 (de) | Verfahren zur herstellung von 7-keto-delta hoch 5 -steroiden | |
| DE2301317C2 (de) | Alkylierte 3,20-Diketo-Δ↑4↑-steroide der Pregnanreihe und Verfahren zu deren Herstellung | |
| DE2916889C2 (de) | Verfahren und Zwischenprodukte zur Herstellung von 6α-Halogen-3-Keto-Δ↑1↑↑,↑↑4↑-pregnadienderivaten | |
| DE2913147C2 (enExample) | ||
| DE2236115A1 (de) | Verfahren zur herstellung von delta hoch 4.9(11).16 -3.20diketosteroiden | |
| CH493449A (de) | Verfahren zur Oxydation primärer und sekundärer Alkohole | |
| DE945507C (de) | Verfahren zur Herstellung von 4-Halogenpregnan-17ª‡, 21-diol-3, 11, 20-trion-21-acylatn | |
| DE2365102C2 (de) | Neue Pregnansäure-Derivate | |
| DE938729C (de) | Verfahren zur Herstellung von 4-Halogen-21-acyloxy-17-oxypregnan-3, 11, 20-trionen | |
| DE1593407C3 (de) | 17beta-Hydroxy-2-oxaöstra-4,9(10)dien-3-on sowie Verfahren zur Herstellung dieser Verbindung | |
| DE961534C (de) | Verfahren zur Herstellung von in 4-Stellung halogenierten 3-Ketosteroiden | |
| DE955949C (de) | Verfahren zur Herstellung von in ª‡-Stellung zur Ketogruppe chlorierten Ketosteroiden | |
| DE1002347C2 (de) | Verfahren zur Herstellung von in 4(5)-Stellung ungesaettigten 2-Jodsteroid-3-ketonen bzw. Steroid-3-ketonen | |
| DE2110140C3 (enExample) | ||
| DE957661C (de) | Verfahren zur Herstellung von 17-Oxy-20-keto-21acyl-oxypregnanen | |
| DE929190C (de) | Verfahren zur Herstellung von ª‡,ª‰-ungesaettigten Ketosteroiden | |
| AT234283B (de) | Verfahren zur Herstellung von 16-Alkylenolsteroiden oder den entsprechenden 16-Alkyl-20-ketosteroiden | |
| DE1793114C3 (de) | Verfahren zur Herstellung von 16 a-Alkyl-17alphachlor-20-ketosteroiden sowie 17 «Chlor-13 ß-acetoxy-16 a-methyl-5-pregnen- 20-on als Zwischenprodukt | |
| DE1418857C (de) | Verfahren zur Herstellung von 3beta-Hydroxy-(bzw.-Acyloxy)-9alpha, llbeta-dichlor-lobeta-methyl-Salphasteroiden der Pregnanreihe | |
| DE1668784C3 (de) | Verfahren zur Herstellung von Aldehyden oder Ketonen durch Oxidation primärer oder sekundärer Alkohole | |
| DE2164840A1 (de) | Verfahren zum Herstellen eines 6-Methylentetracyclins | |
| DEU0002279MA (enExample) | ||
| DEU0001787MA (enExample) | ||
| DE1593407B2 (de) | 17 beta-hydroxy-2-oxaoestra-4,9(10)- dien-3-on sowie verfahren zur herstellung dieser verbindung | |
| DE1418857B (de) | Verfahren zur Herstellung von 3beta-Hydroxy-(bzw.-Acyloxy)-9alpha, 11 beta-dichlor-16beta-methyl-5alphasteroiden der Pregnanreihe |