DESC010242MA - - Google Patents
Info
- Publication number
- DESC010242MA DESC010242MA DESC010242MA DE SC010242M A DESC010242M A DE SC010242MA DE SC010242M A DESC010242M A DE SC010242MA
- Authority
- DE
- Germany
- Prior art keywords
- acid
- ecm
- carboxy
- solution
- triiodanilide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002872 contrast media Substances 0.000 claims description 12
- 229940039231 contrast media Drugs 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims description 2
- 229960004050 aminobenzoic acid Drugs 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 238000009606 cholecystography Methods 0.000 claims description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- FFINMCNLQNTKLU-UHFFFAOYSA-N adipiodone Chemical compound OC(=O)C1=C(I)C=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(O)=O)C(I)=CC=2I)I)=C1I FFINMCNLQNTKLU-UHFFFAOYSA-N 0.000 description 19
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 14
- 239000012153 distilled water Substances 0.000 description 13
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 9
- 230000007935 neutral effect Effects 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 5
- -1 fatty acid esters Chemical class 0.000 description 5
- 229910003002 lithium salt Inorganic materials 0.000 description 5
- 159000000002 lithium salts Chemical class 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 4
- 239000012154 double-distilled water Substances 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000000084 colloidal system Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 210000003734 kidney Anatomy 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- VWSLLSXLURJCDF-UHFFFAOYSA-N 2-methyl-4,5-dihydro-1h-imidazole Chemical compound CC1=NCCN1 VWSLLSXLURJCDF-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000002085 irritant Substances 0.000 description 2
- 231100000021 irritant Toxicity 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 231100000344 non-irritating Toxicity 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- CBOJBBMQJBVCMW-BTVCFUMJSA-N (2r,3r,4s,5r)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride Chemical compound Cl.O=C[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO CBOJBBMQJBVCMW-BTVCFUMJSA-N 0.000 description 1
- CKJGHPBOPQNPHM-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;sodium Chemical compound [Na].OCCN(CCO)CCO CKJGHPBOPQNPHM-UHFFFAOYSA-N 0.000 description 1
- QMQFFHSJUJDRPG-UHFFFAOYSA-N 3-amino-2,4,6-triiodobenzoic acid Chemical class NC1=C(I)C=C(I)C(C(O)=O)=C1I QMQFFHSJUJDRPG-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000001278 adipic acid derivatives Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- ZXVOCOLRQJZVBW-UHFFFAOYSA-N azane;ethanol Chemical compound N.CCO ZXVOCOLRQJZVBW-UHFFFAOYSA-N 0.000 description 1
- 238000013276 bronchoscopy Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical class O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 229960001911 glucosamine hydrochloride Drugs 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 231100000404 nontoxic agent Toxicity 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000005527 organic iodine compounds Chemical class 0.000 description 1
- 150000002912 oxalic acid derivatives Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical class OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0675941B1 (de) | Wässrige textilweichmacher-dispersionen | |
| DE2524059A1 (de) | Kontrastmittel fuer roentgenaufnahmen | |
| CH414063A (de) | Röntgenkontrastmittel | |
| DE2928417A1 (de) | Trijodierte basen | |
| DESC010242MA (enExample) | ||
| DE962545C (de) | Roentgenkontrastmittel | |
| DE4404990C1 (de) | Verfahren zur Herstellung eines sterilen Prednisolongels | |
| DE2515594B2 (de) | Verfahren zur Herstellung eines stabilen, topisch aktiven Geles | |
| DE1915687A1 (de) | Verfahren zur Herstellung von Polysacchariden mit Antitumorwirkung | |
| CH326004A (de) | Verfahren zur Herstellung von Röntgenphotogrammen | |
| DE1593222C3 (de) | Oberflächenaktive Verbindungen, Verfahren zu deren Herstellung sowie Haarpflegemittel, die diese Verbindungen enthalten | |
| CH616403A5 (en) | Process for the preparation of 2,4,6-triodoisophthalamides which are readily soluble in water. | |
| DE2124904C3 (de) | Hydroxy- und Alkoxyacetamido-trijodbenzoesäuren, deren Salze mit physiologisch verträglichen Basen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Röntgenkontrastmittel | |
| DE275932C (enExample) | ||
| AT381024B (de) | Verfahren zur herstellung eines pharmazeutischen mittels zur rekonstitution mit wasser | |
| DE704549C (de) | Verfahren zur Herstellung von Pplyjodoxyphenylphenylessigsaeuren | |
| DE955060C (de) | Verfahren zur Herstellung von Penicillinsalzen | |
| DE2547789C3 (de) | 5-Hydroxypropionylamino-2,4,6-trijodisophthalsäure-bis-(dihydroxypropylamide), Verfahren zu ihrer Herstellung und diese enthaltende Röntgenkontrastmittel | |
| DE1066707B (de) | Roentgenkontrastmittel | |
| DE1922578C3 (de) | 4,7,10-Trioxatrldecan-1,13-dioyibis-(3-carboxy-2,4,6-trijod-anilid) und dessen Salze, Verfahren zur Herstellung dieser Verbindungen sowie diese Verbindungen enthaltende Röntgenkontrastmittel | |
| DE464674C (de) | Verfahren zur Darstellung von in alkalischem Medium kolloidal loeslichen, Cholesterin enthaltenden Produkten | |
| DE1492067C3 (de) | Gemische von Asparaginderivaten, deren Herstellung und diese enthaltende kosmetische Mittel | |
| AT129598B (de) | Verfahren zur Herstellung therapeautisch verwertbarer Lösungen von basischem Chinin. | |
| DE1922606A1 (de) | Neue Roentgenkontrastmittel,deren Anwendung und Verfahren zu ihrer Herstellung | |
| EP0273218A1 (de) | Konservierte Haar- und Körperreinigungsmittel sowie Verwendung einer Konservierungsstoff-Kombination |