DER0011577MA - - Google Patents
Info
- Publication number
- DER0011577MA DER0011577MA DER0011577MA DE R0011577M A DER0011577M A DE R0011577MA DE R0011577M A DER0011577M A DE R0011577MA
- Authority
- DE
- Germany
- Prior art keywords
- cobalt
- cellulose
- pulp
- hours
- ppm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920002678 cellulose Polymers 0.000 claims description 35
- 239000001913 cellulose Substances 0.000 claims description 35
- 230000005070 ripening Effects 0.000 claims description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- 150000001868 cobalt Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000012991 xanthate Substances 0.000 claims description 5
- 230000001590 oxidative effect Effects 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- 239000010941 cobalt Substances 0.000 description 40
- 229910017052 cobalt Inorganic materials 0.000 description 40
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 40
- 229920000297 Rayon Polymers 0.000 description 22
- 235000011121 sodium hydroxide Nutrition 0.000 description 15
- 239000003513 alkali Substances 0.000 description 11
- 230000010198 maturation time Effects 0.000 description 8
- 238000001914 filtration Methods 0.000 description 7
- 229920002488 Hemicellulose Polymers 0.000 description 5
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 5
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 4
- 229910000335 cobalt(II) sulfate Inorganic materials 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 229920001131 Pulp (paper) Polymers 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt(II) nitrate Inorganic materials [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 230000035800 maturation Effects 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 238000004904 shortening Methods 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000005517 mercerization Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE860389C (de) | Verfahren zur Herstellung von Gebilden aus regenerierter Cellulose | |
| EP0178292B1 (de) | Verfahren zur Herstellung von Cellulosecarbamaten | |
| DE1108849B (de) | Verfahren zur Herstellung von Gebilden aus regenerierter Cellulose | |
| DE829649C (de) | Verfahren zur Herstellung von Gebilden aus regenerierter Cellulose | |
| DE971888C (de) | Verfahren zur Herstellung von kuenstlichen, einen hohen Polymerisationsgrad aufweisenden Faeden durch Verspinnen von hochviscoser Viscose mit niedrigem Alkaligehalt | |
| DE1924804A1 (de) | Verfahren zur Herstellung von Viskose | |
| DE69804481T2 (de) | Herstellung von viskose and daraus hergestellte gegenstände | |
| EP0812942A2 (de) | Schwammtuch und Verfahren zu dessen Herstellung | |
| EP0003135B1 (de) | Verfahren zur Verbesserung des Lösungszustandes von Viskosen | |
| DE971618C (de) | Verfahren zur Herstellung von Viscosekunstseidenfaeden | |
| DER0011577MA (enExample) | ||
| DE19707387C1 (de) | Verfahren zur Herstellung von Viskose | |
| EP0012928B1 (de) | Verfahren zur Herstellung von Viskose | |
| EP0812941A2 (de) | Schwamm und Verfahren zu dessen Herstellung | |
| DE610329C (de) | Verfahren zur Herstellung einer fuer die Weiterverarbeitung auf Faeden, Filme u. dgl. geeigneten Viscose | |
| DE858396C (de) | Verfahren zur Herstellung gut filtrierbarer Viskose aus Alkalicellulose | |
| DE740622C (de) | Verfahren zur Herstellung von Loesungen von Cellulose in Schwefelsaeure | |
| DE953341C (de) | Verfahren zur Herstellung einer fuer die Kunstfasererzeugung geeigneten Viskose | |
| AT367805B (de) | Verfahren zur herstellung von fasern aus regenerierter zellulose | |
| DE3213856C2 (de) | Verfahren zum Delignifizieren eines chemisch hergestellten Cellulosehalbstoffes | |
| DE585447C (de) | Verfahren zur Herstellung von Faeden, Fasern und Roehren aus waessrigen Kautschukdispersionen | |
| AT408986B (de) | Verfahren zur alkalisierung von zellstoff | |
| AT356140B (de) | Verfahren zur herstellung von viskose | |
| EP0074012A2 (de) | Verfahren zur Verbesserung der Viskosefiltration | |
| AT151642B (de) | Verfahren zur Herstellung von pigmentmattierter Kunstseide nach dem Viskoseverfahren. |