DEP0009609MA - - Google Patents
Info
- Publication number
- DEP0009609MA DEP0009609MA DEP0009609MA DE P0009609M A DEP0009609M A DE P0009609MA DE P0009609M A DEP0009609M A DE P0009609MA
- Authority
- DE
- Germany
- Prior art keywords
- paper
- cellulose
- nitrogen dioxide
- oxidation
- paper rolls
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims description 11
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 11
- 238000007254 oxidation reaction Methods 0.000 claims description 10
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000001913 cellulose Substances 0.000 claims description 9
- 239000011261 inert gas Substances 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 5
- 230000001590 oxidative effect Effects 0.000 claims description 3
- -1 Oxy- Chemical class 0.000 claims 1
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 15
- 230000003647 oxidation Effects 0.000 description 9
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229910017604 nitric acid Inorganic materials 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 235000019504 cigarettes Nutrition 0.000 description 2
- WFPZPJSADLPSON-UHFFFAOYSA-N dinitrogen tetraoxide Chemical compound [O-][N+](=O)[N+]([O-])=O WFPZPJSADLPSON-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 229920002201 Oxidized cellulose Polymers 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006003 cornification Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229940107304 oxidized cellulose Drugs 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE843394C (de) | Verfahren zum Bleichen von organischen Stoffen | |
| DE2327407C3 (de) | Verfahren zur LJgninzerstörung oder zum Bleichen von chemisch aufbereitetem Stoff bzw. Zellstoff | |
| DE69913883T2 (de) | Verfahren und Anlage zur Herstellung einer wässerigen Wasserstoffperoxydlösung und wässerige Wasserstoffperoxydlösung | |
| DE2733956A1 (de) | Verfahren zum denitrieren von abgas | |
| DE967144C (de) | Verfahren zum Oxydieren von Cellulose durch Behandlung mit Stickstoffdioxyd | |
| DE2704075C3 (de) | Verfahren zur Entfernung von organischen Verunreinigungen aus Phosphorsäure | |
| DEP0009609MA (enExample) | ||
| DE3820089C2 (enExample) | ||
| EP0447673A1 (de) | Verfahren zum enzymatischen Bleichen von Zellstoffen | |
| DE69013447T2 (de) | Verfahren zum Säurebeizen von Metallgegenständen, die Titan oder ein chemisches Element der Titangruppe enthalten. | |
| DE2304269C3 (de) | Verfahren zum Stabilisieren eines aktivierten Eisen-Hydrierungskatalysators | |
| EP0783460B1 (de) | Verfahren zur aufarbeitung einer wässrigen prozessflüssigkeit des aminoxidverfahrens | |
| DE1467122A1 (de) | Verfahren und Herstellung von Wasserstoffsuperoxyd | |
| DE2526084C2 (de) | Verfahren zum Bleichen von Lignocellulosematerial | |
| AT404033B (de) | Verfahren zur herstellung einer wässrigen lösung von n-methylmorpholin-n-oxid | |
| DE1299286B (de) | Verfahren zur Verminderung der Luftentzuendlichkeit eines pyrophoren Katalysators | |
| DE941282C (de) | Verfahren und Vorrichtung zum Oxydieren von Cellulose oder cellulosehaltigen Stoffenmittels Stickstoffdioxyd | |
| DE872491C (de) | Verfahren zur Herstellung von Chlordioxyd | |
| DE2112997A1 (de) | Verfahren zum Neutralisieren von Papier | |
| DE1033173B (de) | Verfahren zum Entschlichten von Textilien aus Cellulose | |
| DE942506C (de) | Verfahren zur Verhuetung von Korrosionen | |
| DE4315951C2 (de) | Verfahren zum Bleichen von Nitratcellulose | |
| DE1225619B (de) | Verfahren zur Herstellung eines an Kaliummonopersulfat reichen Salzgemisches | |
| EP0647466A2 (de) | Cellulosische Membranen | |
| DE1261833B (de) | Verfahren zur Herstellung von Chlor und Alkalinitrat |